This commit fixes structural payload issues preventing XHTTP from functioning correctly and eliminates WebSocket log spam.

- **[Fix X-Padding UI]** Added missing `cookie` and `query` options to X-Padding Placement. Fixes the issue where using Cookie fallback triggers whole HTTP Cookie header interception and silent drop in Xray-core. (Resolves [#3992](https://github.com/MHSanaei/3x-ui/issues/3992))
- **[Fix Uplink Data Options]** Replaced the invalid `query` option with `cookie` in Uplink Data Placement dropdown to prevent Xray-core backend panic `unsupported uplink data placement: query`.
- **[Fix WebSockets Spam]** Boosted `maxMessageSize` boundary to 100MB and gracefully handled fallback fetch signals via `broadcastInvalidate` to avoid buffer dropping spam. (Resolves [#3984](https://github.com/MHSanaei/3x-ui/issues/3984))
This commit is contained in:
test999 2026-04-06 15:04:35 +03:00
parent 367152556a
commit 64f790932a
892 changed files with 2 additions and 132018 deletions

View file

@ -12,9 +12,5 @@ services:
XRAY_VMESS_AEAD_FORCED: "false"
XUI_ENABLE_FAIL2BAN: "true"
tty: true
# network_mode: host # Отключено, так как на Windows 11/WSL эта опция не пробрасывает порты на localhost
ports:
- "2053:2053" # Веб-панель
- "2054:2054" # Доп. порт панели/API
- "2096:2096" # Порт подписки (Subscription port)
network_mode: host
restart: unless-stopped

View file

@ -1,78 +0,0 @@
name: Bug report
description: "Submit Xray-core bug"
body:
- type: checkboxes
attributes:
label: Integrity requirements
description: |-
Please check all of the following options to prove that you have read and understood the requirements, otherwise this issue will be closed.
options:
- label: I have read all the comments in the issue template and ensured that this issue meet the requirements.
required: true
- label: I confirm that I have read the documentation, understand the meaning of all the configuration items I wrote, and did not pile up seemingly useful options or default values.
required: true
- label: I provided the complete config and logs, rather than just providing the truncated parts based on my own judgment.
required: true
- label: I searched issues and did not find any similar issues.
required: true
- label: The problem can be successfully reproduced in the latest Release
required: true
- type: textarea
attributes:
label: Description
description: |-
Please provide a detailed description of the error. And the information you think valuable.
If the problem occurs after the update, please provide the **specific** version
validations:
required: true
- type: textarea
attributes:
label: Reproduction Method
description: |-
Based on the configuration you provided below, provide the method to reproduce the bug.
validations:
required: true
- type: markdown
attributes:
value: |-
## Configuration and Log Section
### For config
Please provide the configuration files that can reproduce the problem, including the server and client.
Don't just paste a big exported config file here. Eliminate useless inbound/outbound, rules, options, this can help determine the problem, if you really want to get help.
After removing parts that do not affect reproduction, provide the actual running **complete** file.
meaning of complete: This config can be directly used to start the core, **not a truncated part of the config**. For fields like keys, use newly generated valid parameters that have not been actually used to fill in.
### For logs
Please set the log level to debug and dnsLog to true first.
Restart Xray-core, then operate according to the reproduction method, try to reduce the irrelevant part in the log.
Remember to delete parts with personal information (such as UUID and IP).
Provide the log of Xray-core, not the log output by the panel or other things.
### Finally
The specific content to be filled in each of the following text boxes needs to be placed between ```<details><pre><code>``` and ```</code></pre></details>```, like this
```
<details><pre><code>
(config)
</code></pre></details>
```
- type: textarea
attributes:
label: Client config
validations:
required: true
- type: textarea
attributes:
label: Server config
validations:
required: true
- type: textarea
attributes:
label: Client log
validations:
required: true
- type: textarea
attributes:
label: Server log
validations:
required: true

View file

@ -1,78 +0,0 @@
name: bug反馈
description: "提交 Xray-core bug"
body:
- type: checkboxes
attributes:
label: 完整性要求
description: |-
请勾选以下所有选项以证明您已经阅读并理解了以下要求,否则该 issue 将被关闭。
options:
- label: 我读完了 issue 模板中的所有注释,确保填写符合要求。
required: true
- label: 我保证阅读了文档,了解所有我编写的配置文件项的含义,而不是大量堆砌看似有用的选项或默认值。
required: true
- label: 我提供了完整的配置文件和日志,而不是出于自己的判断只给出截取的部分。
required: true
- label: 我搜索了 issues, 没有发现已提出的类似问题。
required: true
- label: 问题在 Release 最新的版本上可以成功复现
required: true
- type: textarea
attributes:
label: 描述
description: |-
请提供错误的详细描述。以及你认为有价值的信息。
如果问题在更新后出现,请提供**具体**出现问题的版本号。
validations:
required: true
- type: textarea
attributes:
label: 重现方式
description: |-
基于你下面提供的配置提供重现BUG方法。
validations:
required: true
- type: markdown
attributes:
value: |-
## 配置与日志部分
### 对于配置文件
请提供可以重现问题的配置文件,包括服务端和客户端。
不要直接在这里黏贴一大段导出的 config 文件。去掉无用的出入站、规则、选项,这可以帮助确定问题,如果你真的想得到帮助。
在去掉不影响复现的部分后,提供实际运行的**完整**文件。
完整的含义:可以直接使用这个配置启动核心,**不是截取的部分配置**。对于密钥等参数使用重新生成未实际使用的有效参数填充。
### 对于日志
请先将日志等级设置为 debug, dnsLog 设置为true.
重启 Xray-core ,再按复现方式操作,尽量减少日志中的无关部分。
记得删除有关个人信息如UUID与IP的部分。
提供 Xray-core 的日志,而不是面板或者别的东西输出的日志。
### 最后
把下面的每格具体内容需要放在 ```<details><pre><code>``` 和 ```</code></pre></details>``` 中间,如
```
<details><pre><code>
(config)
</code></pre></details>
```
- type: textarea
attributes:
label: 客户端配置
validations:
required: true
- type: textarea
attributes:
label: 服务端配置
validations:
required: true
- type: textarea
attributes:
label: 客户端日志
validations:
required: true
- type: textarea
attributes:
label: 服务端日志
validations:
required: true

View file

@ -1,4 +0,0 @@
contact_links:
- name: Community Support and Questions
url: https://github.com/XTLS/Xray-core/discussions
about: Please ask and answer questions there. The issue tracker is for issues with core.

View file

@ -1,33 +0,0 @@
{
"android-arm64": { "friendlyName": "android-arm64-v8a" },
"darwin-amd64": { "friendlyName": "macos-64" },
"darwin-arm64": { "friendlyName": "macos-arm64-v8a" },
"freebsd-386": { "friendlyName": "freebsd-32" },
"freebsd-amd64": { "friendlyName": "freebsd-64" },
"freebsd-arm64": { "friendlyName": "freebsd-arm64-v8a" },
"freebsd-arm7": { "friendlyName": "freebsd-arm32-v7a" },
"linux-386": { "friendlyName": "linux-32" },
"linux-amd64": { "friendlyName": "linux-64" },
"linux-arm5": { "friendlyName": "linux-arm32-v5" },
"linux-arm64": { "friendlyName": "linux-arm64-v8a" },
"linux-arm6": { "friendlyName": "linux-arm32-v6" },
"linux-arm7": { "friendlyName": "linux-arm32-v7a" },
"linux-mips64le": { "friendlyName": "linux-mips64le" },
"linux-mips64": { "friendlyName": "linux-mips64" },
"linux-mipslesoftfloat": { "friendlyName": "linux-mips32le-softfloat" },
"linux-mipsle": { "friendlyName": "linux-mips32le" },
"linux-mipssoftfloat": { "friendlyName": "linux-mips32-softfloat" },
"linux-mips": { "friendlyName": "linux-mips32" },
"linux-ppc64le": { "friendlyName": "linux-ppc64le" },
"linux-ppc64": { "friendlyName": "linux-ppc64" },
"linux-riscv64": { "friendlyName": "linux-riscv64" },
"linux-loong64": { "friendlyName": "linux-loong64" },
"linux-s390x": { "friendlyName": "linux-s390x" },
"openbsd-386": { "friendlyName": "openbsd-32" },
"openbsd-amd64": { "friendlyName": "openbsd-64" },
"openbsd-arm64": { "friendlyName": "openbsd-arm64-v8a" },
"openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
"windows-386": { "friendlyName": "windows-32" },
"windows-amd64": { "friendlyName": "windows-64" },
"windows-arm64": { "friendlyName": "windows-arm64-v8a" }
}

View file

@ -1,15 +0,0 @@
# To get started with Dependabot version updates, you'll need to specify which
# package ecosystems to update and where the package manifests are located.
# Please see the documentation for all configuration options:
# https://help.github.com/github/administering-a-repository/configuration-options-for-dependency-updates
version: 2
updates:
- package-ecosystem: "gomod"
directory: "/" # Location of package manifests
schedule:
interval: "daily"
- package-ecosystem: "github-actions"
directory: "/"
schedule:
interval: "daily"

View file

@ -1,62 +0,0 @@
# syntax=docker/dockerfile:latest
FROM --platform=$BUILDPLATFORM golang:latest AS build
# Build xray-core
WORKDIR /src
COPY . .
ARG TARGETOS
ARG TARGETARCH
RUN GOOS=$TARGETOS GOARCH=$TARGETARCH CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags "-s -w -buildid=" ./main
# Download geodat into a staging directory
ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geoip.dat /tmp/geodat/geoip.dat
ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geosite.dat /tmp/geodat/geosite.dat
RUN mkdir -p /tmp/empty
# Create config files with empty JSON content
RUN mkdir -p /tmp/usr/local/etc/xray
RUN cat <<EOF >/tmp/usr/local/etc/xray/00_log.json
{
"log": {
"error": "/var/log/xray/error.log",
"loglevel": "warning",
"access": "none",
"dnsLog": false
}
}
EOF
RUN echo '{}' >/tmp/usr/local/etc/xray/01_api.json
RUN echo '{}' >/tmp/usr/local/etc/xray/02_dns.json
RUN echo '{}' >/tmp/usr/local/etc/xray/03_routing.json
RUN echo '{}' >/tmp/usr/local/etc/xray/04_policy.json
RUN echo '{}' >/tmp/usr/local/etc/xray/05_inbounds.json
RUN echo '{}' >/tmp/usr/local/etc/xray/06_outbounds.json
RUN echo '{}' >/tmp/usr/local/etc/xray/07_transport.json
RUN echo '{}' >/tmp/usr/local/etc/xray/08_stats.json
RUN echo '{}' >/tmp/usr/local/etc/xray/09_reverse.json
# Create log files
RUN mkdir -p /tmp/var/log/xray && touch \
/tmp/var/log/xray/access.log \
/tmp/var/log/xray/error.log
# Build finally image
FROM gcr.io/distroless/static:nonroot
COPY --from=build --chown=0:0 --chmod=755 /src/xray /usr/local/bin/xray
COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/share/xray
COPY --from=build --chown=0:0 --chmod=644 /tmp/geodat/*.dat /usr/local/share/xray/
COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/etc/xray
COPY --from=build --chown=0:0 --chmod=644 /tmp/usr/local/etc/xray/*.json /usr/local/etc/xray/
COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /var/log/xray
COPY --from=build --chown=65532:65532 --chmod=600 /tmp/var/log/xray/*.log /var/log/xray/
VOLUME /usr/local/etc/xray
VOLUME /var/log/xray
ARG TZ=Etc/UTC
ENV TZ=$TZ
ENTRYPOINT [ "/usr/local/bin/xray" ]
CMD [ "-confdir", "/usr/local/etc/xray/" ]

View file

@ -1,71 +0,0 @@
# syntax=docker/dockerfile:latest
FROM --platform=$BUILDPLATFORM golang:latest AS build
# Build xray-core
WORKDIR /src
COPY . .
ARG TARGETOS
ARG TARGETARCH
RUN GOOS=$TARGETOS GOARCH=$TARGETARCH CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags "-s -w -buildid=" ./main
# Download geodat into a staging directory
ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geoip.dat /tmp/geodat/geoip.dat
ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geosite.dat /tmp/geodat/geosite.dat
RUN mkdir -p /tmp/empty
# Create config files with empty JSON content
RUN mkdir -p /tmp/usr/local/etc/xray
RUN cat <<EOF >/tmp/usr/local/etc/xray/00_log.json
{
"log": {
"error": "/var/log/xray/error.log",
"loglevel": "warning",
"access": "none",
"dnsLog": false
}
}
EOF
RUN echo '{}' >/tmp/usr/local/etc/xray/01_api.json
RUN echo '{}' >/tmp/usr/local/etc/xray/02_dns.json
RUN echo '{}' >/tmp/usr/local/etc/xray/03_routing.json
RUN echo '{}' >/tmp/usr/local/etc/xray/04_policy.json
RUN echo '{}' >/tmp/usr/local/etc/xray/05_inbounds.json
RUN echo '{}' >/tmp/usr/local/etc/xray/06_outbounds.json
RUN echo '{}' >/tmp/usr/local/etc/xray/07_transport.json
RUN echo '{}' >/tmp/usr/local/etc/xray/08_stats.json
RUN echo '{}' >/tmp/usr/local/etc/xray/09_reverse.json
# Create log files
RUN mkdir -p /tmp/var/log/xray && touch \
/tmp/var/log/xray/access.log \
/tmp/var/log/xray/error.log
# Build finally image
# Note on Distroless Base Image and Architecture Support:
# - The official 'gcr.io/distroless/static' image provided by Google only supports a limited set of architectures for Linux:
# - linux/amd64
# - linux/arm/v7
# - linux/arm64/v8
# - linux/ppc64le
# - linux/s390x
# - Upon inspection, the blob contents of the Distroless images across these architectures are nearly identical, with only minor differences in metadata (e.g., 'Architecture' field in the manifest).
# - Due to this similarity in content, it is feasible to forcibly specify a single platform (e.g., '--platform=linux/amd64') for unsupported architectures, as the core image content remains compatible with statically compiled binaries like Go applications.
FROM --platform=linux/amd64 gcr.io/distroless/static:nonroot
COPY --from=build --chown=0:0 --chmod=755 /src/xray /usr/local/bin/xray
COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/share/xray
COPY --from=build --chown=0:0 --chmod=644 /tmp/geodat/*.dat /usr/local/share/xray/
COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/etc/xray
COPY --from=build --chown=0:0 --chmod=644 /tmp/usr/local/etc/xray/*.json /usr/local/etc/xray/
COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /var/log/xray
COPY --from=build --chown=65532:65532 --chmod=600 /tmp/var/log/xray/*.log /var/log/xray/
VOLUME /usr/local/etc/xray
VOLUME /var/log/xray
ARG TZ=Etc/UTC
ENV TZ=$TZ
ENTRYPOINT [ "/usr/local/bin/xray" ]
CMD [ "-confdir", "/usr/local/etc/xray/" ]

View file

@ -1,133 +0,0 @@
name: Build and Push Docker Image
on:
release:
types:
- published
- released
workflow_dispatch:
inputs:
tag:
description: "Docker image tag:"
required: true
latest:
description: "Set to latest"
type: boolean
default: false
jobs:
build-and-push:
if: (github.event.action != 'published') || (github.event.action == 'published' && github.event.release.prerelease == true)
runs-on: ubuntu-latest
permissions:
contents: read
packages: write
steps:
- name: Set repository and image name to lowercase
env:
IMAGE_NAME: "${{ github.repository }}"
run: |
echo "IMAGE_NAME=${IMAGE_NAME,,}" >>${GITHUB_ENV}
echo "FULL_IMAGE_NAME=ghcr.io/${IMAGE_NAME,,}" >>${GITHUB_ENV}
- name: Validate and extract tag
run: |
SOURCE_TAG="${{ github.event.inputs.tag }}"
if [[ -z "$SOURCE_TAG" ]]; then
SOURCE_TAG="${{ github.ref_name }}"
fi
if [[ -z "$SOURCE_TAG" ]]; then
SOURCE_TAG="${{ github.event.release.tag_name }}"
fi
if [[ -z "$SOURCE_TAG" ]]; then
echo "Error: Could not determine a valid tag source. Input tag and context tag (github.ref_name) are both empty."
exit 1
fi
if [[ "$SOURCE_TAG" =~ ^v[0-9]+\.[0-9] ]]; then
IMAGE_TAG="${SOURCE_TAG#v}"
else
IMAGE_TAG="$SOURCE_TAG"
fi
echo "Docker image tag: '$IMAGE_TAG'."
echo "IMAGE_TAG=$IMAGE_TAG" >>${GITHUB_ENV}
LATEST=false
if [[ "${{ github.event_name }}" == "release" && "${{ github.event.release.prerelease }}" == "false" ]] || [[ "${{ github.event_name }}" == "workflow_dispatch" && "${{ github.event.inputs.latest }}" == "true" ]]; then
LATEST=true
fi
echo "Latest: '$LATEST'."
echo "LATEST=$LATEST" >>${GITHUB_ENV}
- name: Checkout code
uses: actions/checkout@v6
- name: Set up QEMU
uses: docker/setup-qemu-action@v4
- name: Set up Docker Buildx
uses: docker/setup-buildx-action@v4
- name: Login to GitHub Container Registry
uses: docker/login-action@v4
with:
registry: ghcr.io
username: ${{ github.repository_owner }}
password: ${{ secrets.GITHUB_TOKEN }}
- name: Build Docker image (main architectures)
id: build_main_arches
uses: docker/build-push-action@v7
with:
context: .
file: .github/docker/Dockerfile
platforms: |
linux/amd64
linux/arm/v7
linux/arm64/v8
linux/ppc64le
linux/s390x
provenance: false
outputs: type=image,name=${{ env.FULL_IMAGE_NAME }},push-by-digest=true,name-canonical=true,push=true
- name: Build Docker image (additional architectures)
id: build_additional_arches
uses: docker/build-push-action@v7
with:
context: .
file: .github/docker/Dockerfile.usa
platforms: |
linux/386
linux/arm/v6
linux/riscv64
linux/loong64
provenance: false
outputs: type=image,name=${{ env.FULL_IMAGE_NAME }},push-by-digest=true,name-canonical=true,push=true
- name: Create manifest list and push
run: |
echo "Creating multi-arch manifest with tag: '${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }}'."
docker buildx imagetools create \
--tag ${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }} \
${{ env.FULL_IMAGE_NAME }}@${{ steps.build_main_arches.outputs.digest }} \
${{ env.FULL_IMAGE_NAME }}@${{ steps.build_additional_arches.outputs.digest }}
if [[ "${{ env.LATEST }}" == "true" ]]; then
echo "Adding 'latest' tag to manifest: '${{ env.FULL_IMAGE_NAME }}:latest'."
docker buildx imagetools create \
--tag ${{ env.FULL_IMAGE_NAME }}:latest \
${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }}
fi
- name: Inspect image
run: |
docker buildx imagetools inspect ${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }}
if [[ "${{ env.LATEST }}" == "true" ]]; then
docker buildx imagetools inspect ${{ env.FULL_IMAGE_NAME }}:latest
fi

View file

@ -1,180 +0,0 @@
name: Build and Release for Windows 7
on:
workflow_dispatch:
release:
types: [published]
push:
pull_request:
types: [opened, synchronize, reopened]
jobs:
check-assets:
runs-on: ubuntu-latest
steps:
- name: Restore Geodat Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-geodat-
- name: Restore Wintun Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-wintun-
- name: Check Assets Existence
id: check-assets
run: |
[ -d 'resources' ] || mkdir resources
LIST=('geoip.dat' 'geosite.dat')
for FILE_NAME in "${LIST[@]}"
do
echo -e "Checking ${FILE_NAME}..."
if [ -s "./resources/${FILE_NAME}" ]; then
echo -e "${FILE_NAME} exists."
else
echo -e "${FILE_NAME} does not exist."
echo "missing=true" >> $GITHUB_OUTPUT
break
fi
done
LIST=('amd64' 'x86')
for ARCHITECTURE in "${LIST[@]}"
do
echo -e "Checking wintun.dll for ${ARCHITECTURE}..."
if [ -s "./resources/wintun/bin/${ARCHITECTURE}/wintun.dll" ]; then
echo -e "wintun.dll for ${ARCHITECTURE} exists."
else
echo -e "wintun.dll for ${ARCHITECTURE} is missing."
echo "missing=true" >> $GITHUB_OUTPUT
break
fi
done
- name: Sleep for 90 seconds if Assets Missing
if: steps.check-assets.outputs.missing == 'true'
run: sleep 90
build:
needs: check-assets
permissions:
contents: write
strategy:
matrix:
include:
# BEGIN Windows 7
- goos: windows
goarch: amd64
assetname: win7-64
- goos: windows
goarch: 386
assetname: win7-32
# END Windows 7
fail-fast: false
runs-on: ubuntu-latest
env:
GOOS: ${{ matrix.goos}}
GOARCH: ${{ matrix.goarch }}
CGO_ENABLED: 0
steps:
- name: Checkout codebase
uses: actions/checkout@v6
- name: Show workflow information
run: |
_NAME=${{ matrix.assetname }}
echo "GOOS: ${{ matrix.goos }}, GOARCH: ${{ matrix.goarch }}, RELEASE_NAME: $_NAME"
echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
- name: Set up Go
uses: actions/setup-go@v6
with:
go-version-file: go.mod
check-latest: true
- name: Setup patched builder
run: |
GOSDK=$(go env GOROOT)
rm -r $GOSDK/*
cd $GOSDK
curl -O -L -H "Authorization: Bearer ${{ secrets.GITHUB_TOKEN }}" https://github.com/XTLS/go-win7/releases/latest/download/go-for-win7-linux-amd64.zip
unzip ./go-for-win7-linux-amd64.zip -d $GOSDK
rm ./go-for-win7-linux-amd64.zip
- name: Get project dependencies
run: go mod download
- name: Build Xray
run: |
mkdir -p build_assets
COMMID=$(git describe --always --dirty)
echo 'Building Xray for Windows 7...'
go build -o build_assets/xray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
# The line below is for without running conhost.exe version. Commented for not being used. Provided for reference.
# go build -o build_assets/wxray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-H windowsgui -X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
- name: Restore Geodat Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-geodat-
- name: Restore Wintun Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-wintun-
- name: Add additional assets into package
run: |
mv -f resources/geo* build_assets/
if [[ ${GOOS} == 'windows' ]]; then
echo 'CreateObject("Wscript.Shell").Run "xray.exe -config config.json",0' > build_assets/xray_no_window.vbs
echo 'Start-Process -FilePath ".\xray.exe" -ArgumentList "-config .\config.json" -WindowStyle Hidden' > build_assets/xray_no_window.ps1
if [[ ${GOARCH} == 'amd64' ]]; then
mv resources/wintun/bin/amd64/wintun.dll build_assets/
fi
if [[ ${GOARCH} == '386' ]]; then
mv resources/wintun/bin/x86/wintun.dll build_assets/
fi
mv resources/wintun/LICENSE.txt build_assets/LICENSE-wintun.txt
fi
- name: Copy README.md & LICENSE
run: |
cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
- name: Create ZIP archive
if: github.event_name == 'release'
shell: bash
run: |
pushd build_assets || exit 1
touch -mt $(date +%Y01010000) *
zip -9vr ../Xray-${{ env.ASSET_NAME }}.zip .
popd || exit 1
FILE=./Xray-${{ env.ASSET_NAME }}.zip
DGST=$FILE.dgst
for METHOD in {"md5","sha1","sha256","sha512"}
do
openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
done
- name: Upload binaries to release
uses: svenstaro/upload-release-action@v2
if: github.event_name == 'release'
with:
repo_token: ${{ secrets.GITHUB_TOKEN }}
file: ./Xray-${{ env.ASSET_NAME }}.zip*
tag: ${{ github.ref }}
file_glob: true
- name: Upload files to Artifacts
uses: actions/upload-artifact@v7
with:
name: Xray-${{ env.ASSET_NAME }}
path: |
./build_assets/*

View file

@ -1,287 +0,0 @@
name: Build and Release
on:
workflow_dispatch:
release:
types: [published]
push:
pull_request:
types: [opened, synchronize, reopened]
jobs:
check-assets:
runs-on: ubuntu-latest
steps:
- name: Restore Geodat Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-geodat-
- name: Restore Wintun Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-wintun-
- name: Check Assets Existence
id: check-assets
run: |
[ -d 'resources' ] || mkdir resources
LIST=('geoip.dat' 'geosite.dat')
for FILE_NAME in "${LIST[@]}"
do
echo -e "Checking ${FILE_NAME}..."
if [ -s "./resources/${FILE_NAME}" ]; then
echo -e "${FILE_NAME} exists."
else
echo -e "${FILE_NAME} does not exist."
echo "missing=true" >> $GITHUB_OUTPUT
break
fi
done
LIST=('amd64' 'x86' 'arm64')
for ARCHITECTURE in "${LIST[@]}"
do
echo -e "Checking wintun.dll for ${ARCHITECTURE}..."
if [ -s "./resources/wintun/bin/${ARCHITECTURE}/wintun.dll" ]; then
echo -e "wintun.dll for ${ARCHITECTURE} exists."
else
echo -e "wintun.dll for ${ARCHITECTURE} is missing."
echo "missing=true" >> $GITHUB_OUTPUT
break
fi
done
- name: Trigger Asset Update Workflow if Assets Missing
if: steps.check-assets.outputs.missing == 'true'
uses: actions/github-script@v8
with:
github-token: ${{ secrets.GITHUB_TOKEN }}
script: |
const { owner, repo } = context.repo;
await github.rest.actions.createWorkflowDispatch({
owner,
repo,
workflow_id: 'scheduled-assets-update.yml',
ref: context.ref
});
console.log('Triggered scheduled-assets-update.yml due to missing assets on branch:', context.ref);
- name: Sleep for 90 seconds if Assets Missing
if: steps.check-assets.outputs.missing == 'true'
run: sleep 90
build:
needs: check-assets
permissions:
contents: write
strategy:
matrix:
# Include amd64 on all platforms.
goos: [windows, freebsd, openbsd, linux, darwin]
goarch: [amd64, 386]
patch-assetname: [""]
exclude:
# Exclude i386 on darwin
- goarch: 386
goos: darwin
include:
# BEGIN MacOS ARM64
- goos: darwin
goarch: arm64
# END MacOS ARM64
# BEGIN Linux ARM 5 6 7
- goos: linux
goarch: arm
goarm: 7
- goos: linux
goarch: arm
goarm: 6
- goos: linux
goarch: arm
goarm: 5
# END Linux ARM 5 6 7
# BEGIN Android ARM 8
- goos: android
goarch: arm64
# END Android ARM 8
# BEGIN Android AMD64
- goos: android
goarch: amd64
patch-assetname: android-amd64
# END Android AMD64
# Windows ARM
- goos: windows
goarch: arm64
# BEGIN Other architectures
# BEGIN riscv64 & ARM64 & LOONG64
- goos: linux
goarch: arm64
- goos: linux
goarch: riscv64
- goos: linux
goarch: loong64
# END riscv64 & ARM64 & LOONG64
# BEGIN MIPS
- goos: linux
goarch: mips64
- goos: linux
goarch: mips64le
- goos: linux
goarch: mipsle
- goos: linux
goarch: mips
# END MIPS
# BEGIN PPC
- goos: linux
goarch: ppc64
- goos: linux
goarch: ppc64le
# END PPC
# BEGIN FreeBSD ARM
- goos: freebsd
goarch: arm64
- goos: freebsd
goarch: arm
goarm: 7
# END FreeBSD ARM
# BEGIN S390X
- goos: linux
goarch: s390x
# END S390X
# END Other architectures
# BEGIN OPENBSD ARM
- goos: openbsd
goarch: arm64
- goos: openbsd
goarch: arm
goarm: 7
# END OPENBSD ARM
fail-fast: false
runs-on: ubuntu-latest
env:
GOOS: ${{ matrix.goos }}
GOARCH: ${{ matrix.goarch }}
GOARM: ${{ matrix.goarm }}
CGO_ENABLED: 0
steps:
- name: Checkout codebase
uses: actions/checkout@v6
- name: Set up NDK
if: matrix.goos == 'android'
run: |
wget -qO android-ndk.zip https://dl.google.com/android/repository/android-ndk-r28b-linux.zip
unzip android-ndk.zip
rm android-ndk.zip
declare -A arches=(
["amd64"]="x86_64-linux-android24-clang"
["arm64"]="aarch64-linux-android24-clang"
)
echo CC="$(realpath android-ndk-*/toolchains/llvm/prebuilt/linux-x86_64/bin)/${arches[${{ matrix.goarch }}]}" >> $GITHUB_ENV
echo CGO_ENABLED=1 >> $GITHUB_ENV
- name: Show workflow information
run: |
_NAME=${{ matrix.patch-assetname }}
[ -n "$_NAME" ] || _NAME=$(jq ".[\"$GOOS-$GOARCH$GOARM$GOMIPS\"].friendlyName" -r < .github/build/friendly-filenames.json)
echo "GOOS: $GOOS, GOARCH: $GOARCH, GOARM: $GOARM, GOMIPS: $GOMIPS, RELEASE_NAME: $_NAME"
echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
- name: Set up Go
uses: actions/setup-go@v6
with:
go-version-file: go.mod
check-latest: true
- name: Get project dependencies
run: go mod download
- name: Build Xray
run: |
mkdir -p build_assets
COMMID=$(git describe --always --dirty)
if [[ ${GOOS} == 'windows' ]]; then
echo 'Building Xray for Windows...'
go build -o build_assets/xray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
# The line below is for without running conhost.exe version. Commented for not being used. Provided for reference.
# go build -o build_assets/wxray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-H windowsgui -X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
else
echo 'Building Xray...'
if [[ ${GOARCH} == 'mips' || ${GOARCH} == 'mipsle' ]]; then
go build -o build_assets/xray -trimpath -buildvcs=false -gcflags="-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
echo 'Building soft-float Xray for MIPS/MIPSLE 32-bit...'
GOMIPS=softfloat go build -o build_assets/xray_softfloat -trimpath -buildvcs=false -gcflags="-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
else
go build -o build_assets/xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
fi
fi
- name: Restore Geodat Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-geodat-
- name: Restore Wintun Cache
if: matrix.goos == 'windows'
uses: actions/cache/restore@v5
with:
path: resources
key: xray-wintun-
- name: Add additional assets into package
run: |
mv -f resources/geo* build_assets/
if [[ ${GOOS} == 'windows' ]]; then
echo 'CreateObject("Wscript.Shell").Run "xray.exe -config config.json",0' > build_assets/xray_no_window.vbs
echo 'Start-Process -FilePath ".\xray.exe" -ArgumentList "-config .\config.json" -WindowStyle Hidden' > build_assets/xray_no_window.ps1
if [[ ${GOARCH} == 'amd64' ]]; then
mv resources/wintun/bin/amd64/wintun.dll build_assets/
fi
if [[ ${GOARCH} == '386' ]]; then
mv resources/wintun/bin/x86/wintun.dll build_assets/
fi
if [[ ${GOARCH} == 'arm64' ]]; then
mv resources/wintun/bin/arm64/wintun.dll build_assets/
fi
mv resources/wintun/LICENSE.txt build_assets/LICENSE-wintun.txt
fi
- name: Copy README.md & LICENSE
run: |
cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
- name: Create ZIP archive
if: github.event_name == 'release'
shell: bash
run: |
pushd build_assets || exit 1
touch -mt $(date +%Y01010000) *
zip -9vr ../Xray-${{ env.ASSET_NAME }}.zip .
popd || exit 1
FILE=./Xray-${{ env.ASSET_NAME }}.zip
DGST=$FILE.dgst
for METHOD in {"md5","sha1","sha256","sha512"}
do
openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
done
- name: Upload binaries to release
uses: svenstaro/upload-release-action@v2
if: github.event_name == 'release'
with:
repo_token: ${{ secrets.GITHUB_TOKEN }}
file: ./Xray-${{ env.ASSET_NAME }}.zip*
tag: ${{ github.ref }}
file_glob: true
- name: Upload files to Artifacts
uses: actions/upload-artifact@v7
with:
name: Xray-${{ env.ASSET_NAME }}
path: |
./build_assets/*

View file

@ -1,129 +0,0 @@
name: Scheduled assets update
# NOTE: This Github Actions is required by other actions, for preparing other packaging assets in a
# routine manner, for example: GeoIP/GeoSite.
# Currently updating:
# - Geodat (GeoIP/Geosite)
# - Wintun (wintun.dll)
on:
workflow_dispatch:
schedule:
# Update GeoData on every day (22:30 UTC)
- cron: "30 22 * * *"
push:
# Prevent triggering update request storm
paths:
- ".github/workflows/scheduled-assets-update.yml"
pull_request:
# Prevent triggering update request storm
paths:
- ".github/workflows/scheduled-assets-update.yml"
jobs:
geodat:
if: github.event.schedule == '30 22 * * *' || github.event_name == 'push' || github.event_name == 'pull_request' || github.event_name == 'workflow_dispatch'
runs-on: ubuntu-latest
steps:
- name: Restore Geodat Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-geodat-
- name: Update Geodat
id: update
uses: nick-fields/retry@v4
with:
timeout_minutes: 60
retry_wait_seconds: 60
max_attempts: 60
command: |
[ -d 'resources' ] || mkdir resources
LIST=('Loyalsoldier v2ray-rules-dat geoip geoip' 'Loyalsoldier v2ray-rules-dat geosite geosite')
for i in "${LIST[@]}"
do
INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3,$4}'))
FILE_NAME="${INFO[3]}.dat"
echo -e "Verifying HASH key..."
HASH="$(curl -sL -H "Authorization: Bearer ${{ secrets.GITHUB_TOKEN }}" "https://raw.githubusercontent.com/${INFO[0]}/${INFO[1]}/release/${INFO[2]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
if [ -s "./resources/${FILE_NAME}" ] && [ "$(sha256sum "./resources/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ]; then
continue
else
echo -e "Downloading https://raw.githubusercontent.com/${INFO[0]}/${INFO[1]}/release/${INFO[2]}.dat..."
curl -L -H "Authorization: Bearer ${{ secrets.GITHUB_TOKEN }}" "https://raw.githubusercontent.com/${INFO[0]}/${INFO[1]}/release/${INFO[2]}.dat" -o ./resources/${FILE_NAME}
echo -e "Verifying HASH key..."
[ "$(sha256sum "./resources/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
echo "unhit=true" >> $GITHUB_OUTPUT
fi
done
- name: Save Geodat Cache
uses: actions/cache/save@v5
if: ${{ steps.update.outputs.unhit }}
with:
path: resources
key: xray-geodat-${{ github.sha }}-${{ github.run_number }}
wintun:
if: github.event.schedule == '30 22 * * *' || github.event_name == 'push' || github.event_name == 'pull_request' || github.event_name == 'workflow_dispatch'
runs-on: ubuntu-latest
steps:
- name: Restore Wintun Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-wintun-
- name: Force downloading if run manually or on file update
if: github.event_name == 'workflow_dispatch' || github.event_name == 'push'
run: |
echo "FORCE_UPDATE=true" >> $GITHUB_ENV
- name: Update Wintun
id: update
uses: nick-fields/retry@v4
with:
timeout_minutes: 60
retry_wait_seconds: 60
max_attempts: 60
command: |
[ -d 'resources' ] || mkdir resources
LIST=('amd64' 'x86' 'arm64')
for ARCHITECTURE in "${LIST[@]}"
do
FILE_PATH="resources/wintun/bin/${ARCHITECTURE}/wintun.dll"
echo -e "Checking if wintun.dll for ${ARCHITECTURE} exists..."
if [ -s "./resources/wintun/bin/${ARCHITECTURE}/wintun.dll" ]; then
echo -e "wintun.dll for ${ARCHITECTURE} exists"
continue
else
echo -e "wintun.dll for ${ARCHITECTURE} is missing"
missing=true
fi
done
if [ -s "./resources/wintun/LICENSE.txt" ]; then
echo -e "LICENSE for Wintun exists"
else
echo -e "LICENSE for Wintun is missing"
missing=true
fi
if [[ -v FORCE_UPDATE ]]; then
missing=true
fi
if [[ "$missing" == true ]]; then
FILENAME=wintun.zip
DOWNLOAD_FILE=wintun-0.14.1.zip
echo -e "Downloading https://www.wintun.net/builds/${DOWNLOAD_FILE}..."
curl -L "https://www.wintun.net/builds/${DOWNLOAD_FILE}" -o "${FILENAME}"
echo -e "Unpacking wintun..."
unzip -u ${FILENAME} -d resources/
echo "unhit=true" >> $GITHUB_OUTPUT
fi
- name: Save Wintun Cache
uses: actions/cache/save@v5
if: ${{ steps.update.outputs.unhit }}
with:
path: resources
key: xray-wintun-${{ github.sha }}-${{ github.run_number }}

View file

@ -1,77 +0,0 @@
name: Test
on:
push:
pull_request:
types: [opened, synchronize, reopened]
jobs:
check-assets:
runs-on: ubuntu-latest
steps:
- name: Restore Geodat Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-geodat-
- name: Check Assets Existence
id: check-assets
run: |
[ -d 'resources' ] || mkdir resources
LIST=('geoip.dat' 'geosite.dat')
for FILE_NAME in "${LIST[@]}"
do
echo -e "Checking ${FILE_NAME}..."
if [ -s "./resources/${FILE_NAME}" ]; then
echo -e "${FILE_NAME} exists."
else
echo -e "${FILE_NAME} does not exist."
echo "missing=true" >> $GITHUB_OUTPUT
break
fi
done
- name: Sleep for 90 seconds if Assets Missing
if: steps.check-assets.outputs.missing == 'true'
run: sleep 90
check-proto:
runs-on: ubuntu-latest
steps:
- name: Checkout codebase
uses: actions/checkout@v6
- name: Check Proto Version Header
run: |
head -n 4 core/config.pb.go > ref.txt
find . -name "*.pb.go" ! -name "*_grpc.pb.go" -print0 | while IFS= read -r -d '' file; do
if ! cmp -s ref.txt <(head -n 4 "$file"); then
echo "Error: Header mismatch in $file"
head -n 4 "$file"
exit 1
fi
done
test:
needs: check-assets
permissions:
contents: read
runs-on: ${{ matrix.os }}
strategy:
fail-fast: false
matrix:
os: [windows-latest, ubuntu-latest, macos-latest]
steps:
- name: Checkout codebase
uses: actions/checkout@v6
- name: Set up Go
uses: actions/setup-go@v6
with:
go-version-file: go.mod
check-latest: true
- name: Restore Geodat Cache
uses: actions/cache/restore@v5
with:
path: resources
key: xray-geodat-
enableCrossOsArchive: true
- name: Test
run: go test -timeout 1h -v ./...

View file

@ -1,68 +0,0 @@
# Binaries for programs and plugins
*.exe
*.exe~
*.dll
*.so
*.dylib
# Test binary, built with `go test -c`
*.test
# Output of the go coverage tool, specifically when used with LiteIDE
*.out
# macOS specific files
.DS_Store
# IDE/editor specific files
.idea/
.vscode/
*.swp
*.swo
# Archives and compressed files
*.zip
*.tar.gz
*.tar
*.gz
*.bz2
# Go build binaries
xray
xray_softfloat
mockgen
vprotogen
!infra/vprotogen/
errorgen
!common/errors/errorgen/
*.dat
# Build assets
/build_assets/
# Output from dlv test
**/debug.*
# Certificates and keys
*.crt
*.key
# Dependency directories (uncomment if needed)
# vendor/
# Logs
*.log
# Coverage reports
coverage.*
# Node modules (in case of frontend assets)
node_modules/
# System files
Thumbs.db
ehthumbs.db
# Other common ignores
*.bak
*.tmp

View file

@ -1,128 +0,0 @@
# Contributor Covenant Code of Conduct
## Our Pledge
We as members, contributors, and leaders pledge to make participation in our
community a harassment-free experience for everyone, regardless of age, body
size, visible or invisible disability, ethnicity, sex characteristics, gender
identity and expression, level of experience, education, socio-economic status,
nationality, personal appearance, race, religion, or sexual identity
and orientation.
We pledge to act and interact in ways that contribute to an open, welcoming,
diverse, inclusive, and healthy community.
## Our Standards
Examples of behavior that contributes to a positive environment for our
community include:
* Demonstrating empathy and kindness toward other people
* Being respectful of differing opinions, viewpoints, and experiences
* Giving and gracefully accepting constructive feedback
* Accepting responsibility and apologizing to those affected by our mistakes,
and learning from the experience
* Focusing on what is best not just for us as individuals, but for the
overall community
Examples of unacceptable behavior include:
* The use of sexualized language or imagery, and sexual attention or
advances of any kind
* Trolling, insulting or derogatory comments, and personal or political attacks
* Public or private harassment
* Publishing others' private information, such as a physical or email
address, without their explicit permission
* Other conduct which could reasonably be considered inappropriate in a
professional setting
## Enforcement Responsibilities
Community leaders are responsible for clarifying and enforcing our standards of
acceptable behavior and will take appropriate and fair corrective action in
response to any behavior that they deem inappropriate, threatening, offensive,
or harmful.
Community leaders have the right and responsibility to remove, edit, or reject
comments, commits, code, wiki edits, issues, and other contributions that are
not aligned to this Code of Conduct, and will communicate reasons for moderation
decisions when appropriate.
## Scope
This Code of Conduct applies within all community spaces, and also applies when
an individual is officially representing the community in public spaces.
Examples of representing our community include using an official e-mail address,
posting via an official social media account, or acting as an appointed
representative at an online or offline event.
## Enforcement
Instances of abusive, harassing, or otherwise unacceptable behavior may be
reported to the community leaders responsible for enforcement at
https://t.me/projectXtls.
All complaints will be reviewed and investigated promptly and fairly.
All community leaders are obligated to respect the privacy and security of the
reporter of any incident.
## Enforcement Guidelines
Community leaders will follow these Community Impact Guidelines in determining
the consequences for any action they deem in violation of this Code of Conduct:
### 1. Correction
**Community Impact**: Use of inappropriate language or other behavior deemed
unprofessional or unwelcome in the community.
**Consequence**: A private, written warning from community leaders, providing
clarity around the nature of the violation and an explanation of why the
behavior was inappropriate. A public apology may be requested.
### 2. Warning
**Community Impact**: A violation through a single incident or series
of actions.
**Consequence**: A warning with consequences for continued behavior. No
interaction with the people involved, including unsolicited interaction with
those enforcing the Code of Conduct, for a specified period of time. This
includes avoiding interactions in community spaces as well as external channels
like social media. Violating these terms may lead to a temporary or
permanent ban.
### 3. Temporary Ban
**Community Impact**: A serious violation of community standards, including
sustained inappropriate behavior.
**Consequence**: A temporary ban from any sort of interaction or public
communication with the community for a specified period of time. No public or
private interaction with the people involved, including unsolicited interaction
with those enforcing the Code of Conduct, is allowed during this period.
Violating these terms may lead to a permanent ban.
### 4. Permanent Ban
**Community Impact**: Demonstrating a pattern of violation of community
standards, including sustained inappropriate behavior, harassment of an
individual, or aggression toward or disparagement of classes of individuals.
**Consequence**: A permanent ban from any sort of public interaction within
the community.
## Attribution
This Code of Conduct is adapted from the [Contributor Covenant][homepage],
version 2.0, available at
https://www.contributor-covenant.org/version/2/0/code_of_conduct.html.
Community Impact Guidelines were inspired by [Mozilla's code of conduct
enforcement ladder](https://github.com/mozilla/diversity).
[homepage]: https://www.contributor-covenant.org
For answers to common questions about this code of conduct, see the FAQ at
https://www.contributor-covenant.org/faq. Translations are available at
https://www.contributor-covenant.org/translations.

View file

@ -1,373 +0,0 @@
Mozilla Public License Version 2.0
==================================
1. Definitions
--------------
1.1. "Contributor"
means each individual or legal entity that creates, contributes to
the creation of, or owns Covered Software.
1.2. "Contributor Version"
means the combination of the Contributions of others (if any) used
by a Contributor and that particular Contributor's Contribution.
1.3. "Contribution"
means Covered Software of a particular Contributor.
1.4. "Covered Software"
means Source Code Form to which the initial Contributor has attached
the notice in Exhibit A, the Executable Form of such Source Code
Form, and Modifications of such Source Code Form, in each case
including portions thereof.
1.5. "Incompatible With Secondary Licenses"
means
(a) that the initial Contributor has attached the notice described
in Exhibit B to the Covered Software; or
(b) that the Covered Software was made available under the terms of
version 1.1 or earlier of the License, but not also under the
terms of a Secondary License.
1.6. "Executable Form"
means any form of the work other than Source Code Form.
1.7. "Larger Work"
means a work that combines Covered Software with other material, in
a separate file or files, that is not Covered Software.
1.8. "License"
means this document.
1.9. "Licensable"
means having the right to grant, to the maximum extent possible,
whether at the time of the initial grant or subsequently, any and
all of the rights conveyed by this License.
1.10. "Modifications"
means any of the following:
(a) any file in Source Code Form that results from an addition to,
deletion from, or modification of the contents of Covered
Software; or
(b) any new file in Source Code Form that contains any Covered
Software.
1.11. "Patent Claims" of a Contributor
means any patent claim(s), including without limitation, method,
process, and apparatus claims, in any patent Licensable by such
Contributor that would be infringed, but for the grant of the
License, by the making, using, selling, offering for sale, having
made, import, or transfer of either its Contributions or its
Contributor Version.
1.12. "Secondary License"
means either the GNU General Public License, Version 2.0, the GNU
Lesser General Public License, Version 2.1, the GNU Affero General
Public License, Version 3.0, or any later versions of those
licenses.
1.13. "Source Code Form"
means the form of the work preferred for making modifications.
1.14. "You" (or "Your")
means an individual or a legal entity exercising rights under this
License. For legal entities, "You" includes any entity that
controls, is controlled by, or is under common control with You. For
purposes of this definition, "control" means (a) the power, direct
or indirect, to cause the direction or management of such entity,
whether by contract or otherwise, or (b) ownership of more than
fifty percent (50%) of the outstanding shares or beneficial
ownership of such entity.
2. License Grants and Conditions
--------------------------------
2.1. Grants
Each Contributor hereby grants You a world-wide, royalty-free,
non-exclusive license:
(a) under intellectual property rights (other than patent or trademark)
Licensable by such Contributor to use, reproduce, make available,
modify, display, perform, distribute, and otherwise exploit its
Contributions, either on an unmodified basis, with Modifications, or
as part of a Larger Work; and
(b) under Patent Claims of such Contributor to make, use, sell, offer
for sale, have made, import, and otherwise transfer either its
Contributions or its Contributor Version.
2.2. Effective Date
The licenses granted in Section 2.1 with respect to any Contribution
become effective for each Contribution on the date the Contributor first
distributes such Contribution.
2.3. Limitations on Grant Scope
The licenses granted in this Section 2 are the only rights granted under
this License. No additional rights or licenses will be implied from the
distribution or licensing of Covered Software under this License.
Notwithstanding Section 2.1(b) above, no patent license is granted by a
Contributor:
(a) for any code that a Contributor has removed from Covered Software;
or
(b) for infringements caused by: (i) Your and any other third party's
modifications of Covered Software, or (ii) the combination of its
Contributions with other software (except as part of its Contributor
Version); or
(c) under Patent Claims infringed by Covered Software in the absence of
its Contributions.
This License does not grant any rights in the trademarks, service marks,
or logos of any Contributor (except as may be necessary to comply with
the notice requirements in Section 3.4).
2.4. Subsequent Licenses
No Contributor makes additional grants as a result of Your choice to
distribute the Covered Software under a subsequent version of this
License (see Section 10.2) or under the terms of a Secondary License (if
permitted under the terms of Section 3.3).
2.5. Representation
Each Contributor represents that the Contributor believes its
Contributions are its original creation(s) or it has sufficient rights
to grant the rights to its Contributions conveyed by this License.
2.6. Fair Use
This License is not intended to limit any rights You have under
applicable copyright doctrines of fair use, fair dealing, or other
equivalents.
2.7. Conditions
Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted
in Section 2.1.
3. Responsibilities
-------------------
3.1. Distribution of Source Form
All distribution of Covered Software in Source Code Form, including any
Modifications that You create or to which You contribute, must be under
the terms of this License. You must inform recipients that the Source
Code Form of the Covered Software is governed by the terms of this
License, and how they can obtain a copy of this License. You may not
attempt to alter or restrict the recipients' rights in the Source Code
Form.
3.2. Distribution of Executable Form
If You distribute Covered Software in Executable Form then:
(a) such Covered Software must also be made available in Source Code
Form, as described in Section 3.1, and You must inform recipients of
the Executable Form how they can obtain a copy of such Source Code
Form by reasonable means in a timely manner, at a charge no more
than the cost of distribution to the recipient; and
(b) You may distribute such Executable Form under the terms of this
License, or sublicense it under different terms, provided that the
license for the Executable Form does not attempt to limit or alter
the recipients' rights in the Source Code Form under this License.
3.3. Distribution of a Larger Work
You may create and distribute a Larger Work under terms of Your choice,
provided that You also comply with the requirements of this License for
the Covered Software. If the Larger Work is a combination of Covered
Software with a work governed by one or more Secondary Licenses, and the
Covered Software is not Incompatible With Secondary Licenses, this
License permits You to additionally distribute such Covered Software
under the terms of such Secondary License(s), so that the recipient of
the Larger Work may, at their option, further distribute the Covered
Software under the terms of either this License or such Secondary
License(s).
3.4. Notices
You may not remove or alter the substance of any license notices
(including copyright notices, patent notices, disclaimers of warranty,
or limitations of liability) contained within the Source Code Form of
the Covered Software, except that You may alter any license notices to
the extent required to remedy known factual inaccuracies.
3.5. Application of Additional Terms
You may choose to offer, and to charge a fee for, warranty, support,
indemnity or liability obligations to one or more recipients of Covered
Software. However, You may do so only on Your own behalf, and not on
behalf of any Contributor. You must make it absolutely clear that any
such warranty, support, indemnity, or liability obligation is offered by
You alone, and You hereby agree to indemnify every Contributor for any
liability incurred by such Contributor as a result of warranty, support,
indemnity or liability terms You offer. You may include additional
disclaimers of warranty and limitations of liability specific to any
jurisdiction.
4. Inability to Comply Due to Statute or Regulation
---------------------------------------------------
If it is impossible for You to comply with any of the terms of this
License with respect to some or all of the Covered Software due to
statute, judicial order, or regulation then You must: (a) comply with
the terms of this License to the maximum extent possible; and (b)
describe the limitations and the code they affect. Such description must
be placed in a text file included with all distributions of the Covered
Software under this License. Except to the extent prohibited by statute
or regulation, such description must be sufficiently detailed for a
recipient of ordinary skill to be able to understand it.
5. Termination
--------------
5.1. The rights granted under this License will terminate automatically
if You fail to comply with any of its terms. However, if You become
compliant, then the rights granted under this License from a particular
Contributor are reinstated (a) provisionally, unless and until such
Contributor explicitly and finally terminates Your grants, and (b) on an
ongoing basis, if such Contributor fails to notify You of the
non-compliance by some reasonable means prior to 60 days after You have
come back into compliance. Moreover, Your grants from a particular
Contributor are reinstated on an ongoing basis if such Contributor
notifies You of the non-compliance by some reasonable means, this is the
first time You have received notice of non-compliance with this License
from such Contributor, and You become compliant prior to 30 days after
Your receipt of the notice.
5.2. If You initiate litigation against any entity by asserting a patent
infringement claim (excluding declaratory judgment actions,
counter-claims, and cross-claims) alleging that a Contributor Version
directly or indirectly infringes any patent, then the rights granted to
You by any and all Contributors for the Covered Software under Section
2.1 of this License shall terminate.
5.3. In the event of termination under Sections 5.1 or 5.2 above, all
end user license agreements (excluding distributors and resellers) which
have been validly granted by You or Your distributors under this License
prior to termination shall survive termination.
************************************************************************
* *
* 6. Disclaimer of Warranty *
* ------------------------- *
* *
* Covered Software is provided under this License on an "as is" *
* basis, without warranty of any kind, either expressed, implied, or *
* statutory, including, without limitation, warranties that the *
* Covered Software is free of defects, merchantable, fit for a *
* particular purpose or non-infringing. The entire risk as to the *
* quality and performance of the Covered Software is with You. *
* Should any Covered Software prove defective in any respect, You *
* (not any Contributor) assume the cost of any necessary servicing, *
* repair, or correction. This disclaimer of warranty constitutes an *
* essential part of this License. No use of any Covered Software is *
* authorized under this License except under this disclaimer. *
* *
************************************************************************
************************************************************************
* *
* 7. Limitation of Liability *
* -------------------------- *
* *
* Under no circumstances and under no legal theory, whether tort *
* (including negligence), contract, or otherwise, shall any *
* Contributor, or anyone who distributes Covered Software as *
* permitted above, be liable to You for any direct, indirect, *
* special, incidental, or consequential damages of any character *
* including, without limitation, damages for lost profits, loss of *
* goodwill, work stoppage, computer failure or malfunction, or any *
* and all other commercial damages or losses, even if such party *
* shall have been informed of the possibility of such damages. This *
* limitation of liability shall not apply to liability for death or *
* personal injury resulting from such party's negligence to the *
* extent applicable law prohibits such limitation. Some *
* jurisdictions do not allow the exclusion or limitation of *
* incidental or consequential damages, so this exclusion and *
* limitation may not apply to You. *
* *
************************************************************************
8. Litigation
-------------
Any litigation relating to this License may be brought only in the
courts of a jurisdiction where the defendant maintains its principal
place of business and such litigation shall be governed by laws of that
jurisdiction, without reference to its conflict-of-law provisions.
Nothing in this Section shall prevent a party's ability to bring
cross-claims or counter-claims.
9. Miscellaneous
----------------
This License represents the complete agreement concerning the subject
matter hereof. If any provision of this License is held to be
unenforceable, such provision shall be reformed only to the extent
necessary to make it enforceable. Any law or regulation which provides
that the language of a contract shall be construed against the drafter
shall not be used to construe this License against a Contributor.
10. Versions of the License
---------------------------
10.1. New Versions
Mozilla Foundation is the license steward. Except as provided in Section
10.3, no one other than the license steward has the right to modify or
publish new versions of this License. Each version will be given a
distinguishing version number.
10.2. Effect of New Versions
You may distribute the Covered Software under the terms of the version
of the License under which You originally received the Covered Software,
or under the terms of any subsequent version published by the license
steward.
10.3. Modified Versions
If you create software not governed by this License, and you want to
create a new license for such software, you may create and use a
modified version of this License if you rename the license and remove
any references to the name of the license steward (except to note that
such modified license differs from this License).
10.4. Distributing Source Code Form that is Incompatible With Secondary
Licenses
If You choose to distribute Source Code Form that is Incompatible With
Secondary Licenses under the terms of this version of the License, the
notice described in Exhibit B of this License must be attached.
Exhibit A - Source Code Form License Notice
-------------------------------------------
This Source Code Form is subject to the terms of the Mozilla Public
License, v. 2.0. If a copy of the MPL was not distributed with this
file, You can obtain one at http://mozilla.org/MPL/2.0/.
If it is not possible or desirable to put the notice in a particular
file, then You may include the notice in a location (such as a LICENSE
file in a relevant directory) where a recipient would be likely to look
for such a notice.
You may add additional accurate notices of copyright ownership.
Exhibit B - "Incompatible With Secondary Licenses" Notice
---------------------------------------------------------
This Source Code Form is "Incompatible With Secondary Licenses", as
defined by the Mozilla Public License, v. 2.0.

View file

@ -1,214 +0,0 @@
# Project X
[Project X](https://github.com/XTLS) originates from XTLS protocol, providing a set of network tools such as [Xray-core](https://github.com/XTLS/Xray-core) and [REALITY](https://github.com/XTLS/REALITY).
[README](https://github.com/XTLS/Xray-core#readme) is open, so feel free to submit your project [here](https://github.com/XTLS/Xray-core/pulls).
## Sponsors
[![Remnawave](https://github.com/user-attachments/assets/a22d34ae-01ee-441c-843a-85356748ed1e)](https://docs.rw)
[![Happ](https://github.com/user-attachments/assets/14055dab-e8bb-48bd-89e8-962709e4098e)](https://happ.su)
[![BlancVPN](https://github.com/user-attachments/assets/9145ea7d-5da3-446e-8143-710dba4292c3)](https://blanc.link/VMTSDqW)
[**Sponsor Xray-core**](https://github.com/XTLS/Xray-core/issues/3668)
## Donation & NFTs
### [Collect a Project X NFT to support the development of Project X!](https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/1)
[<img alt="Project X NFT" width="150px" src="https://raw2.seadn.io/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/7fa9ce900fb39b44226348db330e32/8b7fa9ce900fb39b44226348db330e32.svg" />](https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/1)
- **TRX(Tron)/USDT/USDC: `TNrDh5VSfwd4RPrwsohr6poyNTfFefNYan`**
- **TON: `UQApeV-u2gm43aC1uP76xAC1m6vCylstaN1gpfBmre_5IyTH`**
- **BTC: `1JpqcziZZuqv3QQJhZGNGBVdCBrGgkL6cT`**
- **XMR: `4ABHQZ3yJZkBnLoqiKvb3f8eqUnX4iMPb6wdant5ZLGQELctcerceSGEfJnoCk6nnyRZm73wrwSgvZ2WmjYLng6R7sR67nq`**
- **SOL/USDT/USDC: `3x5NuXHzB5APG6vRinPZcsUv5ukWUY1tBGRSJiEJWtZa`**
- **ETH/USDT/USDC: `0xDc3Fe44F0f25D13CACb1C4896CD0D321df3146Ee`**
- **Project X NFT: https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/1**
- **VLESS NFT: https://opensea.io/collection/vless**
- **REALITY NFT: https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/2**
- **Related links: [VLESS Post-Quantum Encryption](https://github.com/XTLS/Xray-core/pull/5067), [XHTTP: Beyond REALITY](https://github.com/XTLS/Xray-core/discussions/4113), [Announcement of NFTs by Project X](https://github.com/XTLS/Xray-core/discussions/3633)**
## License
[Mozilla Public License Version 2.0](https://github.com/XTLS/Xray-core/blob/main/LICENSE)
## Documentation
[Project X Official Website](https://xtls.github.io)
## Telegram
[Project X](https://t.me/projectXray)
[Project X Channel](https://t.me/projectXtls)
[Project VLESS](https://t.me/projectVless) (Русский)
[Project XHTTP](https://t.me/projectXhttp) (Persian)
## Installation
- Linux Script
- [XTLS/Xray-install](https://github.com/XTLS/Xray-install) (**Official**)
- [tempest](https://github.com/team-cloudchaser/tempest) (supports [`systemd`](https://systemd.io) and [OpenRC](https://github.com/OpenRC/openrc); Linux-only)
- Docker
- [ghcr.io/xtls/xray-core](https://ghcr.io/xtls/xray-core) (**Official**)
- [teddysun/xray](https://hub.docker.com/r/teddysun/xray)
- [wulabing/xray_docker](https://github.com/wulabing/xray_docker)
- Web Panel
- [Remnawave](https://github.com/remnawave/panel)
- [3X-UI](https://github.com/MHSanaei/3x-ui)
- [PasarGuard](https://github.com/PasarGuard/panel)
- [Xray-UI](https://github.com/qist/xray-ui)
- [X-Panel](https://github.com/xeefei/X-Panel)
- [Marzban](https://github.com/Gozargah/Marzban)
- [Hiddify](https://github.com/hiddify/Hiddify-Manager)
- [TX-UI](https://github.com/AghayeCoder/tx-ui)
- [CELERITY](https://github.com/ClickDevTech/CELERITY-panel)
- One Click
- [Xray-REALITY](https://github.com/zxcvos/Xray-script), [xray-reality](https://github.com/sajjaddg/xray-reality), [reality-ezpz](https://github.com/aleskxyz/reality-ezpz)
- [Xray_bash_onekey](https://github.com/hello-yunshu/Xray_bash_onekey), [XTool](https://github.com/LordPenguin666/XTool), [VPainLess](https://github.com/vpainless/vpainless)
- [v2ray-agent](https://github.com/mack-a/v2ray-agent), [Xray_onekey](https://github.com/wulabing/Xray_onekey), [ProxySU](https://github.com/proxysu/ProxySU)
- Magisk
- [NetProxy-Magisk](https://github.com/Fanju6/NetProxy-Magisk)
- [Xray4Magisk](https://github.com/Asterisk4Magisk/Xray4Magisk)
- [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
- Homebrew
- `brew install xray`
## Usage
- Example
- [VLESS-XTLS-uTLS-REALITY](https://github.com/XTLS/REALITY#readme)
- [VLESS-TCP-XTLS-Vision](https://github.com/XTLS/Xray-examples/tree/main/VLESS-TCP-XTLS-Vision)
- [All-in-One-fallbacks-Nginx](https://github.com/XTLS/Xray-examples/tree/main/All-in-One-fallbacks-Nginx)
- Xray-examples
- [XTLS/Xray-examples](https://github.com/XTLS/Xray-examples)
- [chika0801/Xray-examples](https://github.com/chika0801/Xray-examples)
- [lxhao61/integrated-examples](https://github.com/lxhao61/integrated-examples)
- Tutorial
- [XTLS Vision](https://github.com/chika0801/Xray-install)
- [REALITY (English)](https://cscot.pages.dev/2023/03/02/Xray-REALITY-tutorial/)
- [XTLS-Iran-Reality (English)](https://github.com/SasukeFreestyle/XTLS-Iran-Reality)
- [Xray REALITY with 'steal oneself' (English)](https://computerscot.github.io/vless-xtls-utls-reality-steal-oneself.html)
- [Xray with WireGuard inbound (English)](https://g800.pages.dev/wireguard)
## GUI Clients
- OpenWrt
- [PassWall](https://github.com/Openwrt-Passwall/openwrt-passwall), [PassWall 2](https://github.com/Openwrt-Passwall/openwrt-passwall2)
- [ShadowSocksR Plus+](https://github.com/fw876/helloworld)
- [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
- Asuswrt-Merlin
- [XRAYUI](https://github.com/DanielLavrushin/asuswrt-merlin-xrayui)
- [fancyss](https://github.com/hq450/fancyss)
- Windows
- [v2rayN](https://github.com/2dust/v2rayN)
- [Furious](https://github.com/LorenEteval/Furious)
- [Invisible Man - Xray](https://github.com/InvisibleManVPN/InvisibleMan-XRayClient)
- [AnyPortal](https://github.com/AnyPortal/AnyPortal)
- [GenyConnect](https://github.com/genyleap/GenyConnect)
- Android
- [v2rayNG](https://github.com/2dust/v2rayNG)
- [X-flutter](https://github.com/XTLS/X-flutter)
- [SaeedDev94/Xray](https://github.com/SaeedDev94/Xray)
- [SimpleXray](https://github.com/lhear/SimpleXray)
- [XrayFA](https://github.com/Q7DF1/XrayFA)
- [AnyPortal](https://github.com/AnyPortal/AnyPortal)
- [NetProxy-Magisk](https://github.com/Fanju6/NetProxy-Magisk)
- iOS & macOS arm64 & tvOS
- [Happ](https://apps.apple.com/app/happ-proxy-utility/id6504287215) | [Happ RU](https://apps.apple.com/ru/app/happ-proxy-utility-plus/id6746188973) | [Happ tvOS](https://apps.apple.com/us/app/happ-proxy-utility-for-tv/id6748297274)
- [Streisand](https://apps.apple.com/app/streisand/id6450534064)
- [OneXray](https://github.com/OneXray/OneXray)
- [INCY](https://apps.apple.com/en/app/incy/id6756943388)
- macOS arm64 & x64
- [Happ](https://apps.apple.com/app/happ-proxy-utility/id6504287215) | [Happ RU](https://apps.apple.com/ru/app/happ-proxy-utility-plus/id6746188973)
- [V2rayU](https://github.com/yanue/V2rayU)
- [V2RayXS](https://github.com/tzmax/V2RayXS)
- [Furious](https://github.com/LorenEteval/Furious)
- [OneXray](https://github.com/OneXray/OneXray)
- [GoXRay](https://github.com/goxray/desktop)
- [AnyPortal](https://github.com/AnyPortal/AnyPortal)
- [v2rayN](https://github.com/2dust/v2rayN)
- [GenyConnect](https://github.com/genyleap/GenyConnect)
- [INCY](https://apps.apple.com/en/app/incy/id6756943388)
- Linux
- [v2rayA](https://github.com/v2rayA/v2rayA)
- [Furious](https://github.com/LorenEteval/Furious)
- [GorzRay](https://github.com/ketetefid/GorzRay)
- [GoXRay](https://github.com/goxray/desktop)
- [AnyPortal](https://github.com/AnyPortal/AnyPortal)
- [v2rayN](https://github.com/2dust/v2rayN)
- [GenyConnect](https://github.com/genyleap/GenyConnect)
## Others that support VLESS, XTLS, REALITY, XUDP, PLUX...
- iOS & macOS arm64 & tvOS
- [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
- [Loon](https://apps.apple.com/us/app/loon/id1373567447)
- [Egern](https://apps.apple.com/us/app/egern/id1616105820)
- [Quantumult X](https://apps.apple.com/us/app/quantumult-x/id1443988620)
- Xray Tools
- [xray-knife](https://github.com/lilendian0x00/xray-knife)
- [xray-checker](https://github.com/kutovoys/xray-checker)
- Xray Wrapper
- [XTLS/libXray](https://github.com/XTLS/libXray)
- [xtls-sdk](https://github.com/remnawave/xtls-sdk)
- [xtlsapi](https://github.com/hiddify/xtlsapi)
- [AndroidLibXrayLite](https://github.com/2dust/AndroidLibXrayLite)
- [Xray-core-python](https://github.com/LorenEteval/Xray-core-python)
- [xray-api](https://github.com/XVGuardian/xray-api)
- [XrayR](https://github.com/XrayR-project/XrayR)
- [XrayR-release](https://github.com/XrayR-project/XrayR-release)
- [XrayR-V2Board](https://github.com/missuo/XrayR-V2Board)
- Cores
- [Amnezia VPN](https://github.com/amnezia-vpn)
- [mihomo](https://github.com/MetaCubeX/mihomo)
- [sing-box](https://github.com/SagerNet/sing-box)
## Contributing
[Code of Conduct](https://github.com/XTLS/Xray-core/blob/main/CODE_OF_CONDUCT.md)
[![Ask DeepWiki](https://deepwiki.com/badge.svg)](https://deepwiki.com/XTLS/Xray-core)
## Credits
- [Xray-core v1.0.0](https://github.com/XTLS/Xray-core/releases/tag/v1.0.0) was forked from [v2fly-core 9a03cc5](https://github.com/v2fly/v2ray-core/commit/9a03cc5c98d04cc28320fcee26dbc236b3291256), and we have made & accumulated a huge number of enhancements over time, check [the release notes for each version](https://github.com/XTLS/Xray-core/releases).
- For third-party projects used in [Xray-core](https://github.com/XTLS/Xray-core), check your local or [the latest go.mod](https://github.com/XTLS/Xray-core/blob/main/go.mod).
## One-line Compilation
### Windows (PowerShell)
```powershell
$env:CGO_ENABLED=0
go build -o xray.exe -trimpath -buildvcs=false -ldflags="-s -w -buildid=" -v ./main
```
### Linux / macOS
```bash
CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -ldflags="-s -w -buildid=" -v ./main
```
### Reproducible Releases
Make sure that you are using the same Go version, and remember to set the git commit id (7 bytes):
```bash
CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=REPLACE -s -w -buildid=" -v ./main
```
If you are compiling a 32-bit MIPS/MIPSLE target, use this command instead:
```bash
CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=REPLACE -s -w -buildid=" -v ./main
```
## Stargazers over time
[![Stargazers over time](https://starchart.cc/XTLS/Xray-core.svg)](https://starchart.cc/XTLS/Xray-core)

View file

@ -1,5 +0,0 @@
# Security Policy
If you found an issue related to security vulnerability or protocol-identification problem, please report it to us via "[Report a vulnerability](https://github.com/XTLS/Xray-core/security/advisories/new)" privately, instead of publish it publicly before we release the fixed version.
Thanks for your contribution to the FREE Internet!

View file

@ -1,2 +0,0 @@
// Package app contains feature implementations of Xray. The features may be enabled during runtime.
package app

View file

@ -1,121 +0,0 @@
package commander
import (
"context"
"net"
"sync"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/signal/done"
core "github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/outbound"
"google.golang.org/grpc"
)
// Commander is a Xray feature that provides gRPC methods to external clients.
type Commander struct {
sync.Mutex
server *grpc.Server
services []Service
ohm outbound.Manager
tag string
listen string
}
// NewCommander creates a new Commander based on the given config.
func NewCommander(ctx context.Context, config *Config) (*Commander, error) {
c := &Commander{
tag: config.Tag,
listen: config.Listen,
}
common.Must(core.RequireFeatures(ctx, func(om outbound.Manager) {
c.ohm = om
}))
for _, rawConfig := range config.Service {
config, err := rawConfig.GetInstance()
if err != nil {
return nil, err
}
rawService, err := common.CreateObject(ctx, config)
if err != nil {
return nil, err
}
service, ok := rawService.(Service)
if !ok {
return nil, errors.New("not a Service.")
}
c.services = append(c.services, service)
}
return c, nil
}
// Type implements common.HasType.
func (c *Commander) Type() interface{} {
return (*Commander)(nil)
}
// Start implements common.Runnable.
func (c *Commander) Start() error {
c.Lock()
c.server = grpc.NewServer()
for _, service := range c.services {
service.Register(c.server)
}
c.Unlock()
var listen = func(listener net.Listener) {
if err := c.server.Serve(listener); err != nil {
errors.LogErrorInner(context.Background(), err, "failed to start grpc server")
}
}
if len(c.listen) > 0 {
if l, err := net.Listen("tcp", c.listen); err != nil {
errors.LogErrorInner(context.Background(), err, "API server failed to listen on ", c.listen)
return err
} else {
errors.LogInfo(context.Background(), "API server listening on ", l.Addr())
go listen(l)
}
return nil
}
listener := &OutboundListener{
buffer: make(chan net.Conn, 4),
done: done.New(),
}
go listen(listener)
if err := c.ohm.RemoveHandler(context.Background(), c.tag); err != nil {
errors.LogInfoInner(context.Background(), err, "failed to remove existing handler")
}
return c.ohm.AddHandler(context.Background(), &Outbound{
tag: c.tag,
listener: listener,
})
}
// Close implements common.Closable.
func (c *Commander) Close() error {
c.Lock()
defer c.Unlock()
if c.server != nil {
c.server.Stop()
c.server = nil
}
return nil
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
return NewCommander(ctx, cfg.(*Config))
}))
}

View file

@ -1,188 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/commander/config.proto
package commander
import (
serial "github.com/xtls/xray-core/common/serial"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// Config is the settings for Commander.
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
// Tag of the outbound handler that handles grpc connections.
Tag string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
// Network address of commander grpc service.
Listen string `protobuf:"bytes,3,opt,name=listen,proto3" json:"listen,omitempty"`
// Services that supported by this server. All services must implement Service
// interface.
Service []*serial.TypedMessage `protobuf:"bytes,2,rep,name=service,proto3" json:"service,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_commander_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_commander_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_commander_config_proto_rawDescGZIP(), []int{0}
}
func (x *Config) GetTag() string {
if x != nil {
return x.Tag
}
return ""
}
func (x *Config) GetListen() string {
if x != nil {
return x.Listen
}
return ""
}
func (x *Config) GetService() []*serial.TypedMessage {
if x != nil {
return x.Service
}
return nil
}
// ReflectionConfig is the placeholder config for ReflectionService.
type ReflectionConfig struct {
state protoimpl.MessageState `protogen:"open.v1"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *ReflectionConfig) Reset() {
*x = ReflectionConfig{}
mi := &file_app_commander_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *ReflectionConfig) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*ReflectionConfig) ProtoMessage() {}
func (x *ReflectionConfig) ProtoReflect() protoreflect.Message {
mi := &file_app_commander_config_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use ReflectionConfig.ProtoReflect.Descriptor instead.
func (*ReflectionConfig) Descriptor() ([]byte, []int) {
return file_app_commander_config_proto_rawDescGZIP(), []int{1}
}
var File_app_commander_config_proto protoreflect.FileDescriptor
const file_app_commander_config_proto_rawDesc = "" +
"\n" +
"\x1aapp/commander/config.proto\x12\x12xray.app.commander\x1a!common/serial/typed_message.proto\"n\n" +
"\x06Config\x12\x10\n" +
"\x03tag\x18\x01 \x01(\tR\x03tag\x12\x16\n" +
"\x06listen\x18\x03 \x01(\tR\x06listen\x12:\n" +
"\aservice\x18\x02 \x03(\v2 .xray.common.serial.TypedMessageR\aservice\"\x12\n" +
"\x10ReflectionConfigBX\n" +
"\x16com.xray.app.commanderP\x01Z'github.com/xtls/xray-core/app/commander\xaa\x02\x12Xray.App.Commanderb\x06proto3"
var (
file_app_commander_config_proto_rawDescOnce sync.Once
file_app_commander_config_proto_rawDescData []byte
)
func file_app_commander_config_proto_rawDescGZIP() []byte {
file_app_commander_config_proto_rawDescOnce.Do(func() {
file_app_commander_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_commander_config_proto_rawDesc), len(file_app_commander_config_proto_rawDesc)))
})
return file_app_commander_config_proto_rawDescData
}
var file_app_commander_config_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
var file_app_commander_config_proto_goTypes = []any{
(*Config)(nil), // 0: xray.app.commander.Config
(*ReflectionConfig)(nil), // 1: xray.app.commander.ReflectionConfig
(*serial.TypedMessage)(nil), // 2: xray.common.serial.TypedMessage
}
var file_app_commander_config_proto_depIdxs = []int32{
2, // 0: xray.app.commander.Config.service:type_name -> xray.common.serial.TypedMessage
1, // [1:1] is the sub-list for method output_type
1, // [1:1] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_commander_config_proto_init() }
func file_app_commander_config_proto_init() {
if File_app_commander_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_commander_config_proto_rawDesc), len(file_app_commander_config_proto_rawDesc)),
NumEnums: 0,
NumMessages: 2,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_commander_config_proto_goTypes,
DependencyIndexes: file_app_commander_config_proto_depIdxs,
MessageInfos: file_app_commander_config_proto_msgTypes,
}.Build()
File_app_commander_config_proto = out.File
file_app_commander_config_proto_goTypes = nil
file_app_commander_config_proto_depIdxs = nil
}

View file

@ -1,25 +0,0 @@
syntax = "proto3";
package xray.app.commander;
option csharp_namespace = "Xray.App.Commander";
option go_package = "github.com/xtls/xray-core/app/commander";
option java_package = "com.xray.app.commander";
option java_multiple_files = true;
import "common/serial/typed_message.proto";
// Config is the settings for Commander.
message Config {
// Tag of the outbound handler that handles grpc connections.
string tag = 1;
// Network address of commander grpc service.
string listen = 3;
// Services that supported by this server. All services must implement Service
// interface.
repeated xray.common.serial.TypedMessage service = 2;
}
// ReflectionConfig is the placeholder config for ReflectionService.
message ReflectionConfig {}

View file

@ -1,121 +0,0 @@
package commander
import (
"context"
"sync"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
"github.com/xtls/xray-core/common/serial"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/transport"
)
// OutboundListener is a net.Listener for listening gRPC connections.
type OutboundListener struct {
buffer chan net.Conn
done *done.Instance
}
func (l *OutboundListener) add(conn net.Conn) {
select {
case l.buffer <- conn:
case <-l.done.Wait():
conn.Close()
default:
conn.Close()
}
}
// Accept implements net.Listener.
func (l *OutboundListener) Accept() (net.Conn, error) {
select {
case <-l.done.Wait():
return nil, errors.New("listen closed")
case c := <-l.buffer:
return c, nil
}
}
// Close implements net.Listener.
func (l *OutboundListener) Close() error {
common.Must(l.done.Close())
L:
for {
select {
case c := <-l.buffer:
c.Close()
default:
break L
}
}
return nil
}
// Addr implements net.Listener.
func (l *OutboundListener) Addr() net.Addr {
return &net.TCPAddr{
IP: net.IP{0, 0, 0, 0},
Port: 0,
}
}
// Outbound is a outbound.Handler that handles gRPC connections.
type Outbound struct {
tag string
listener *OutboundListener
access sync.RWMutex
closed bool
}
// Dispatch implements outbound.Handler.
func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
co.access.RLock()
if co.closed {
common.Interrupt(link.Reader)
common.Interrupt(link.Writer)
co.access.RUnlock()
return
}
closeSignal := done.New()
c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
co.listener.add(c)
co.access.RUnlock()
<-closeSignal.Wait()
}
// Tag implements outbound.Handler.
func (co *Outbound) Tag() string {
return co.tag
}
// Start implements common.Runnable.
func (co *Outbound) Start() error {
co.access.Lock()
co.closed = false
co.access.Unlock()
return nil
}
// Close implements common.Closable.
func (co *Outbound) Close() error {
co.access.Lock()
defer co.access.Unlock()
co.closed = true
return co.listener.Close()
}
// SenderSettings implements outbound.Handler.
func (co *Outbound) SenderSettings() *serial.TypedMessage {
return nil
}
// ProxySettings implements outbound.Handler.
func (co *Outbound) ProxySettings() *serial.TypedMessage {
return nil
}

View file

@ -1,27 +0,0 @@
package commander
import (
"context"
"github.com/xtls/xray-core/common"
"google.golang.org/grpc"
"google.golang.org/grpc/reflection"
)
// Service is a Commander service.
type Service interface {
// Register registers the service itself to a gRPC server.
Register(*grpc.Server)
}
type reflectionService struct{}
func (r reflectionService) Register(s *grpc.Server) {
reflection.Register(s)
}
func init() {
common.Must(common.RegisterConfig((*ReflectionConfig)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
return reflectionService{}, nil
}))
}

View file

@ -1,162 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/dispatcher/config.proto
package dispatcher
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type SessionConfig struct {
state protoimpl.MessageState `protogen:"open.v1"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *SessionConfig) Reset() {
*x = SessionConfig{}
mi := &file_app_dispatcher_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *SessionConfig) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*SessionConfig) ProtoMessage() {}
func (x *SessionConfig) ProtoReflect() protoreflect.Message {
mi := &file_app_dispatcher_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use SessionConfig.ProtoReflect.Descriptor instead.
func (*SessionConfig) Descriptor() ([]byte, []int) {
return file_app_dispatcher_config_proto_rawDescGZIP(), []int{0}
}
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
Settings *SessionConfig `protobuf:"bytes,1,opt,name=settings,proto3" json:"settings,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_dispatcher_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_dispatcher_config_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_dispatcher_config_proto_rawDescGZIP(), []int{1}
}
func (x *Config) GetSettings() *SessionConfig {
if x != nil {
return x.Settings
}
return nil
}
var File_app_dispatcher_config_proto protoreflect.FileDescriptor
const file_app_dispatcher_config_proto_rawDesc = "" +
"\n" +
"\x1bapp/dispatcher/config.proto\x12\x13xray.app.dispatcher\"\x15\n" +
"\rSessionConfigJ\x04\b\x01\x10\x02\"H\n" +
"\x06Config\x12>\n" +
"\bsettings\x18\x01 \x01(\v2\".xray.app.dispatcher.SessionConfigR\bsettingsB[\n" +
"\x17com.xray.app.dispatcherP\x01Z(github.com/xtls/xray-core/app/dispatcher\xaa\x02\x13Xray.App.Dispatcherb\x06proto3"
var (
file_app_dispatcher_config_proto_rawDescOnce sync.Once
file_app_dispatcher_config_proto_rawDescData []byte
)
func file_app_dispatcher_config_proto_rawDescGZIP() []byte {
file_app_dispatcher_config_proto_rawDescOnce.Do(func() {
file_app_dispatcher_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_dispatcher_config_proto_rawDesc), len(file_app_dispatcher_config_proto_rawDesc)))
})
return file_app_dispatcher_config_proto_rawDescData
}
var file_app_dispatcher_config_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
var file_app_dispatcher_config_proto_goTypes = []any{
(*SessionConfig)(nil), // 0: xray.app.dispatcher.SessionConfig
(*Config)(nil), // 1: xray.app.dispatcher.Config
}
var file_app_dispatcher_config_proto_depIdxs = []int32{
0, // 0: xray.app.dispatcher.Config.settings:type_name -> xray.app.dispatcher.SessionConfig
1, // [1:1] is the sub-list for method output_type
1, // [1:1] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_dispatcher_config_proto_init() }
func file_app_dispatcher_config_proto_init() {
if File_app_dispatcher_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_dispatcher_config_proto_rawDesc), len(file_app_dispatcher_config_proto_rawDesc)),
NumEnums: 0,
NumMessages: 2,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_dispatcher_config_proto_goTypes,
DependencyIndexes: file_app_dispatcher_config_proto_depIdxs,
MessageInfos: file_app_dispatcher_config_proto_msgTypes,
}.Build()
File_app_dispatcher_config_proto = out.File
file_app_dispatcher_config_proto_goTypes = nil
file_app_dispatcher_config_proto_depIdxs = nil
}

View file

@ -1,15 +0,0 @@
syntax = "proto3";
package xray.app.dispatcher;
option csharp_namespace = "Xray.App.Dispatcher";
option go_package = "github.com/xtls/xray-core/app/dispatcher";
option java_package = "com.xray.app.dispatcher";
option java_multiple_files = true;
message SessionConfig {
reserved 1;
}
message Config {
SessionConfig settings = 1;
}

View file

@ -1,519 +0,0 @@
package dispatcher
import (
"context"
"regexp"
"strings"
"sync"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/protocol"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/features/policy"
"github.com/xtls/xray-core/features/routing"
routing_session "github.com/xtls/xray-core/features/routing/session"
"github.com/xtls/xray-core/features/stats"
"github.com/xtls/xray-core/transport"
"github.com/xtls/xray-core/transport/pipe"
)
var errSniffingTimeout = errors.New("timeout on sniffing")
type cachedReader struct {
sync.Mutex
reader buf.TimeoutReader // *pipe.Reader or *buf.TimeoutWrapperReader
cache buf.MultiBuffer
}
func (r *cachedReader) Cache(b *buf.Buffer, deadline time.Duration) error {
mb, err := r.reader.ReadMultiBufferTimeout(deadline)
if err != nil {
return err
}
r.Lock()
if !mb.IsEmpty() {
r.cache, _ = buf.MergeMulti(r.cache, mb)
}
b.Clear()
rawBytes := b.Extend(min(r.cache.Len(), b.Cap()))
n := r.cache.Copy(rawBytes)
b.Resize(0, int32(n))
r.Unlock()
return nil
}
func (r *cachedReader) readInternal() buf.MultiBuffer {
r.Lock()
defer r.Unlock()
if r.cache != nil && !r.cache.IsEmpty() {
mb := r.cache
r.cache = nil
return mb
}
return nil
}
func (r *cachedReader) ReadMultiBuffer() (buf.MultiBuffer, error) {
mb := r.readInternal()
if mb != nil {
return mb, nil
}
return r.reader.ReadMultiBuffer()
}
func (r *cachedReader) ReadMultiBufferTimeout(timeout time.Duration) (buf.MultiBuffer, error) {
mb := r.readInternal()
if mb != nil {
return mb, nil
}
return r.reader.ReadMultiBufferTimeout(timeout)
}
func (r *cachedReader) Interrupt() {
r.Lock()
if r.cache != nil {
r.cache = buf.ReleaseMulti(r.cache)
}
r.Unlock()
if p, ok := r.reader.(*pipe.Reader); ok {
p.Interrupt()
}
}
// DefaultDispatcher is a default implementation of Dispatcher.
type DefaultDispatcher struct {
ohm outbound.Manager
router routing.Router
policy policy.Manager
stats stats.Manager
fdns dns.FakeDNSEngine
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
d := new(DefaultDispatcher)
if err := core.RequireFeatures(ctx, func(om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager, dc dns.Client) error {
core.OptionalFeatures(ctx, func(fdns dns.FakeDNSEngine) {
d.fdns = fdns
})
return d.Init(config.(*Config), om, router, pm, sm)
}); err != nil {
return nil, err
}
return d, nil
}))
}
// Init initializes DefaultDispatcher.
func (d *DefaultDispatcher) Init(config *Config, om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager) error {
d.ohm = om
d.router = router
d.policy = pm
d.stats = sm
return nil
}
// Type implements common.HasType.
func (*DefaultDispatcher) Type() interface{} {
return routing.DispatcherType()
}
// Start implements common.Runnable.
func (*DefaultDispatcher) Start() error {
return nil
}
// Close implements common.Closable.
func (*DefaultDispatcher) Close() error { return nil }
func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *transport.Link) {
opt := pipe.OptionsFromContext(ctx)
uplinkReader, uplinkWriter := pipe.New(opt...)
downlinkReader, downlinkWriter := pipe.New(opt...)
inboundLink := &transport.Link{
Reader: downlinkReader,
Writer: uplinkWriter,
}
outboundLink := &transport.Link{
Reader: uplinkReader,
Writer: downlinkWriter,
}
sessionInbound := session.InboundFromContext(ctx)
var user *protocol.MemoryUser
if sessionInbound != nil {
user = sessionInbound.User
}
if user != nil && len(user.Email) > 0 {
p := d.policy.ForLevel(user.Level)
if p.Stats.UserUplink {
name := "user>>>" + user.Email + ">>>traffic>>>uplink"
if c, _ := stats.GetOrRegisterCounter(d.stats, name); c != nil {
inboundLink.Writer = &SizeStatWriter{
Counter: c,
Writer: inboundLink.Writer,
}
}
}
if p.Stats.UserDownlink {
name := "user>>>" + user.Email + ">>>traffic>>>downlink"
if c, _ := stats.GetOrRegisterCounter(d.stats, name); c != nil {
outboundLink.Writer = &SizeStatWriter{
Counter: c,
Writer: outboundLink.Writer,
}
}
}
if p.Stats.UserOnline {
name := "user>>>" + user.Email + ">>>online"
if om, _ := stats.GetOrRegisterOnlineMap(d.stats, name); om != nil {
userIP := sessionInbound.Source.Address.String()
om.AddIP(userIP)
context.AfterFunc(ctx, func() { om.RemoveIP(userIP) })
}
}
}
return inboundLink, outboundLink
}
func WrapLink(ctx context.Context, policyManager policy.Manager, statsManager stats.Manager, link *transport.Link) *transport.Link {
sessionInbound := session.InboundFromContext(ctx)
var user *protocol.MemoryUser
if sessionInbound != nil {
user = sessionInbound.User
}
link.Reader = &buf.TimeoutWrapperReader{Reader: link.Reader}
if user != nil && len(user.Email) > 0 {
p := policyManager.ForLevel(user.Level)
if p.Stats.UserUplink {
name := "user>>>" + user.Email + ">>>traffic>>>uplink"
if c, _ := stats.GetOrRegisterCounter(statsManager, name); c != nil {
link.Reader.(*buf.TimeoutWrapperReader).Counter = c
}
}
if p.Stats.UserDownlink {
name := "user>>>" + user.Email + ">>>traffic>>>downlink"
if c, _ := stats.GetOrRegisterCounter(statsManager, name); c != nil {
link.Writer = &SizeStatWriter{
Counter: c,
Writer: link.Writer,
}
}
}
if p.Stats.UserOnline {
name := "user>>>" + user.Email + ">>>online"
if om, _ := stats.GetOrRegisterOnlineMap(statsManager, name); om != nil {
userIP := sessionInbound.Source.Address.String()
om.AddIP(userIP)
context.AfterFunc(ctx, func() { om.RemoveIP(userIP) })
}
}
}
return link
}
func (d *DefaultDispatcher) shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
domain := result.Domain()
if domain == "" {
return false
}
for _, d := range request.ExcludeForDomain {
if strings.HasPrefix(d, "regexp:") {
pattern := d[7:]
re, err := regexp.Compile(pattern)
if err != nil {
errors.LogInfo(ctx, "Unable to compile regex")
continue
}
if re.MatchString(domain) {
return false
}
} else {
if strings.ToLower(domain) == d {
return false
}
}
}
protocolString := result.Protocol()
if resComp, ok := result.(SnifferResultComposite); ok {
protocolString = resComp.ProtocolForDomainResult()
}
for _, p := range request.OverrideDestinationForProtocol {
if strings.HasPrefix(protocolString, p) || strings.HasPrefix(p, protocolString) {
return true
}
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && protocolString != "bittorrent" && p == "fakedns" &&
fkr0.IsIPInIPPool(destination.Address) {
errors.LogInfo(ctx, "Using sniffer ", protocolString, " since the fake DNS missed")
return true
}
if resultSubset, ok := result.(SnifferIsProtoSubsetOf); ok {
if resultSubset.IsProtoSubsetOf(p) {
return true
}
}
}
return false
}
// Dispatch implements routing.Dispatcher.
func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destination) (*transport.Link, error) {
if !destination.IsValid() {
panic("Dispatcher: Invalid destination.")
}
outbounds := session.OutboundsFromContext(ctx)
if len(outbounds) == 0 {
outbounds = []*session.Outbound{{}}
ctx = session.ContextWithOutbounds(ctx, outbounds)
}
ob := outbounds[len(outbounds)-1]
ob.OriginalTarget = destination
ob.Target = destination
content := session.ContentFromContext(ctx)
if content == nil {
content = new(session.Content)
ctx = session.ContextWithContent(ctx, content)
}
sniffingRequest := content.SniffingRequest
inbound, outbound := d.getLink(ctx)
if !sniffingRequest.Enabled {
go d.routedDispatch(ctx, outbound, destination)
} else {
go func() {
cReader := &cachedReader{
reader: outbound.Reader.(*pipe.Reader),
}
outbound.Reader = cReader
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
if err == nil {
content.Protocol = result.Protocol()
}
if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
domain := result.Domain()
errors.LogInfo(ctx, "sniffed domain: ", domain)
destination.Address = net.ParseAddress(domain)
protocol := result.Protocol()
if resComp, ok := result.(SnifferResultComposite); ok {
protocol = resComp.ProtocolForDomainResult()
}
isFakeIP := false
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && fkr0.IsIPInIPPool(ob.Target.Address) {
isFakeIP = true
}
if sniffingRequest.RouteOnly && protocol != "fakedns" && protocol != "fakedns+others" && !isFakeIP {
ob.RouteTarget = destination
} else {
ob.Target = destination
}
}
d.routedDispatch(ctx, outbound, destination)
}()
}
return inbound, nil
}
// DispatchLink implements routing.Dispatcher.
func (d *DefaultDispatcher) DispatchLink(ctx context.Context, destination net.Destination, outbound *transport.Link) error {
if !destination.IsValid() {
return errors.New("Dispatcher: Invalid destination.")
}
outbounds := session.OutboundsFromContext(ctx)
if len(outbounds) == 0 {
outbounds = []*session.Outbound{{}}
ctx = session.ContextWithOutbounds(ctx, outbounds)
}
ob := outbounds[len(outbounds)-1]
ob.OriginalTarget = destination
ob.Target = destination
content := session.ContentFromContext(ctx)
if content == nil {
content = new(session.Content)
ctx = session.ContextWithContent(ctx, content)
}
outbound = WrapLink(ctx, d.policy, d.stats, outbound)
sniffingRequest := content.SniffingRequest
if !sniffingRequest.Enabled {
d.routedDispatch(ctx, outbound, destination)
} else {
cReader := &cachedReader{
reader: outbound.Reader.(buf.TimeoutReader),
}
outbound.Reader = cReader
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
if err == nil {
content.Protocol = result.Protocol()
}
if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
domain := result.Domain()
errors.LogInfo(ctx, "sniffed domain: ", domain)
destination.Address = net.ParseAddress(domain)
protocol := result.Protocol()
if resComp, ok := result.(SnifferResultComposite); ok {
protocol = resComp.ProtocolForDomainResult()
}
isFakeIP := false
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && fkr0.IsIPInIPPool(ob.Target.Address) {
isFakeIP = true
}
if sniffingRequest.RouteOnly && protocol != "fakedns" && protocol != "fakedns+others" && !isFakeIP {
ob.RouteTarget = destination
} else {
ob.Target = destination
}
}
d.routedDispatch(ctx, outbound, destination)
}
return nil
}
func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool, network net.Network) (SniffResult, error) {
payload := buf.NewWithSize(32767)
defer payload.Release()
sniffer := NewSniffer(ctx)
metaresult, metadataErr := sniffer.SniffMetadata(ctx)
if metadataOnly {
return metaresult, metadataErr
}
contentResult, contentErr := func() (SniffResult, error) {
cacheDeadline := 200 * time.Millisecond
totalAttempt := 0
for {
select {
case <-ctx.Done():
return nil, ctx.Err()
default:
cachingStartingTimeStamp := time.Now()
err := cReader.Cache(payload, cacheDeadline)
if err != nil {
return nil, err
}
cachingTimeElapsed := time.Since(cachingStartingTimeStamp)
cacheDeadline -= cachingTimeElapsed
if !payload.IsEmpty() {
result, err := sniffer.Sniff(ctx, payload.Bytes(), network)
switch err {
case common.ErrNoClue: // No Clue: protocol not matches, and sniffer cannot determine whether there will be a match or not
totalAttempt++
case protocol.ErrProtoNeedMoreData: // Protocol Need More Data: protocol matches, but need more data to complete sniffing
// in this case, do not add totalAttempt(allow to read until timeout)
default:
return result, err
}
} else {
totalAttempt++
}
if totalAttempt >= 2 || cacheDeadline <= 0 {
return nil, errSniffingTimeout
}
}
}
}()
if contentErr != nil && metadataErr == nil {
return metaresult, nil
}
if contentErr == nil && metadataErr == nil {
return CompositeResult(metaresult, contentResult), nil
}
return contentResult, contentErr
}
func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
outbounds := session.OutboundsFromContext(ctx)
ob := outbounds[len(outbounds)-1]
var handler outbound.Handler
routingLink := routing_session.AsRoutingContext(ctx)
inTag := routingLink.GetInboundTag()
isPickRoute := 0
if forcedOutboundTag := session.GetForcedOutboundTagFromContext(ctx); forcedOutboundTag != "" {
ctx = session.SetForcedOutboundTagToContext(ctx, "")
if h := d.ohm.GetHandler(forcedOutboundTag); h != nil {
isPickRoute = 1
errors.LogInfo(ctx, "taking platform initialized detour [", forcedOutboundTag, "] for [", destination, "]")
handler = h
} else {
errors.LogError(ctx, "non existing tag for platform initialized detour: ", forcedOutboundTag)
common.Close(link.Writer)
common.Interrupt(link.Reader)
return
}
} else if d.router != nil {
if route, err := d.router.PickRoute(routingLink); err == nil {
outTag := route.GetOutboundTag()
if h := d.ohm.GetHandler(outTag); h != nil {
isPickRoute = 2
if route.GetRuleTag() == "" {
errors.LogInfo(ctx, "taking detour [", outTag, "] for [", destination, "]")
} else {
errors.LogInfo(ctx, "Hit route rule: [", route.GetRuleTag(), "] so taking detour [", outTag, "] for [", destination, "]")
}
handler = h
} else {
errors.LogWarning(ctx, "non existing outTag: ", outTag)
common.Close(link.Writer)
common.Interrupt(link.Reader)
return // DO NOT CHANGE: the traffic shouldn't be processed by default outbound if the specified outbound tag doesn't exist (yet), e.g., VLESS Reverse Proxy
}
} else {
errors.LogInfo(ctx, "default route for ", destination)
}
}
if handler == nil {
handler = d.ohm.GetDefaultHandler()
}
if handler == nil {
errors.LogInfo(ctx, "default outbound handler not exist")
common.Close(link.Writer)
common.Interrupt(link.Reader)
return
}
ob.Tag = handler.Tag()
if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
if tag := handler.Tag(); tag != "" {
if inTag == "" {
accessMessage.Detour = tag
} else if isPickRoute == 1 {
accessMessage.Detour = inTag + " ==> " + tag
} else if isPickRoute == 2 {
accessMessage.Detour = inTag + " -> " + tag
} else {
accessMessage.Detour = inTag + " >> " + tag
}
}
log.Record(accessMessage)
}
handler.Dispatch(ctx, link)
}

View file

@ -1 +0,0 @@
package dispatcher

View file

@ -1,121 +0,0 @@
package dispatcher
import (
"context"
"strings"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/dns"
)
// newFakeDNSSniffer Creates a Fake DNS metadata sniffer
func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
var fakeDNSEngine dns.FakeDNSEngine
{
fakeDNSEngineFeat := core.MustFromContext(ctx).GetFeature((*dns.FakeDNSEngine)(nil))
if fakeDNSEngineFeat != nil {
fakeDNSEngine = fakeDNSEngineFeat.(dns.FakeDNSEngine)
}
}
if fakeDNSEngine == nil {
errNotInit := errors.New("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
return protocolSnifferWithMetadata{}, errNotInit
}
return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
outbounds := session.OutboundsFromContext(ctx)
ob := outbounds[len(outbounds)-1]
if ob.Target.Network == net.Network_TCP || ob.Target.Network == net.Network_UDP {
domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(ob.Target.Address)
if domainFromFakeDNS != "" {
errors.LogInfo(ctx, "fake dns got domain: ", domainFromFakeDNS, " for ip: ", ob.Target.Address.String())
return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
}
}
if ipAddressInRangeValueI := ctx.Value(ipAddressInRange); ipAddressInRangeValueI != nil {
ipAddressInRangeValue := ipAddressInRangeValueI.(*ipAddressInRangeOpt)
if fkr0, ok := fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
inPool := fkr0.IsIPInIPPool(ob.Target.Address)
ipAddressInRangeValue.addressInRange = &inPool
}
}
return nil, common.ErrNoClue
}, metadataSniffer: true}, nil
}
type fakeDNSSniffResult struct {
domainName string
}
func (fakeDNSSniffResult) Protocol() string {
return "fakedns"
}
func (f fakeDNSSniffResult) Domain() string {
return f.domainName
}
type fakeDNSExtraOpts int
const ipAddressInRange fakeDNSExtraOpts = 1
type ipAddressInRangeOpt struct {
addressInRange *bool
}
type DNSThenOthersSniffResult struct {
domainName string
protocolOriginalName string
}
func (f DNSThenOthersSniffResult) IsProtoSubsetOf(protocolName string) bool {
return strings.HasPrefix(protocolName, f.protocolOriginalName)
}
func (DNSThenOthersSniffResult) Protocol() string {
return "fakedns+others"
}
func (f DNSThenOthersSniffResult) Domain() string {
return f.domainName
}
func newFakeDNSThenOthers(ctx context.Context, fakeDNSSniffer protocolSnifferWithMetadata, others []protocolSnifferWithMetadata) (
protocolSnifferWithMetadata, error,
) { // nolint: unparam
// ctx may be used in the future
_ = ctx
return protocolSnifferWithMetadata{
protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
ipAddressInRangeValue := &ipAddressInRangeOpt{}
ctx = context.WithValue(ctx, ipAddressInRange, ipAddressInRangeValue)
result, err := fakeDNSSniffer.protocolSniffer(ctx, bytes)
if err == nil {
return result, nil
}
if ipAddressInRangeValue.addressInRange != nil {
if *ipAddressInRangeValue.addressInRange {
for _, v := range others {
if v.metadataSniffer || bytes != nil {
if result, err := v.protocolSniffer(ctx, bytes); err == nil {
return DNSThenOthersSniffResult{domainName: result.Domain(), protocolOriginalName: result.Protocol()}, nil
}
}
}
return nil, common.ErrNoClue
}
errors.LogDebug(ctx, "ip address not in fake dns range, return as is")
return nil, common.ErrNoClue
}
errors.LogWarning(ctx, "fake dns sniffer did not set address in range option, assume false.")
return nil, common.ErrNoClue
},
metadataSniffer: false,
}, nil
}

View file

@ -1,142 +0,0 @@
package dispatcher
import (
"context"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/protocol"
"github.com/xtls/xray-core/common/protocol/bittorrent"
"github.com/xtls/xray-core/common/protocol/http"
"github.com/xtls/xray-core/common/protocol/quic"
"github.com/xtls/xray-core/common/protocol/tls"
)
type SniffResult interface {
Protocol() string
Domain() string
}
type protocolSniffer func(context.Context, []byte) (SniffResult, error)
type protocolSnifferWithMetadata struct {
protocolSniffer protocolSniffer
// A Metadata sniffer will be invoked on connection establishment only, with nil body,
// for both TCP and UDP connections
// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
metadataSniffer bool
network net.Network
}
type Sniffer struct {
sniffer []protocolSnifferWithMetadata
}
func NewSniffer(ctx context.Context) *Sniffer {
ret := &Sniffer{
sniffer: []protocolSnifferWithMetadata{
{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b, c) }, false, net.Network_TCP},
{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false, net.Network_TCP},
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false, net.Network_TCP},
{func(c context.Context, b []byte) (SniffResult, error) { return quic.SniffQUIC(b) }, false, net.Network_UDP},
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffUTP(b) }, false, net.Network_UDP},
},
}
if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
others := ret.sniffer
ret.sniffer = append(ret.sniffer, sniffer)
fakeDNSThenOthers, err := newFakeDNSThenOthers(ctx, sniffer, others)
if err == nil {
ret.sniffer = append([]protocolSnifferWithMetadata{fakeDNSThenOthers}, ret.sniffer...)
}
}
return ret
}
var errUnknownContent = errors.New("unknown content")
func (s *Sniffer) Sniff(c context.Context, payload []byte, network net.Network) (SniffResult, error) {
var pendingSniffer []protocolSnifferWithMetadata
for _, si := range s.sniffer {
protocolSniffer := si.protocolSniffer
if si.metadataSniffer || si.network != network {
continue
}
result, err := protocolSniffer(c, payload)
if err == common.ErrNoClue {
pendingSniffer = append(pendingSniffer, si)
continue
} else if err == protocol.ErrProtoNeedMoreData { // Sniffer protocol matched, but need more data to complete sniffing
s.sniffer = []protocolSnifferWithMetadata{si}
return nil, err
}
if err == nil && result != nil {
return result, nil
}
}
if len(pendingSniffer) > 0 {
s.sniffer = pendingSniffer
return nil, common.ErrNoClue
}
return nil, errUnknownContent
}
func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
var pendingSniffer []protocolSnifferWithMetadata
for _, si := range s.sniffer {
s := si.protocolSniffer
if !si.metadataSniffer {
pendingSniffer = append(pendingSniffer, si)
continue
}
result, err := s(c, nil)
if err == common.ErrNoClue {
pendingSniffer = append(pendingSniffer, si)
continue
}
if err == nil && result != nil {
return result, nil
}
}
if len(pendingSniffer) > 0 {
s.sniffer = pendingSniffer
return nil, common.ErrNoClue
}
return nil, errUnknownContent
}
func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
}
type compositeResult struct {
domainResult SniffResult
protocolResult SniffResult
}
func (c compositeResult) Protocol() string {
return c.protocolResult.Protocol()
}
func (c compositeResult) Domain() string {
return c.domainResult.Domain()
}
func (c compositeResult) ProtocolForDomainResult() string {
return c.domainResult.Protocol()
}
type SnifferResultComposite interface {
ProtocolForDomainResult() string
}
type SnifferIsProtoSubsetOf interface {
IsProtoSubsetOf(protocolName string) bool
}

View file

@ -1,25 +0,0 @@
package dispatcher
import (
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/features/stats"
)
type SizeStatWriter struct {
Counter stats.Counter
Writer buf.Writer
}
func (w *SizeStatWriter) WriteMultiBuffer(mb buf.MultiBuffer) error {
w.Counter.Add(int64(mb.Len()))
return w.Writer.WriteMultiBuffer(mb)
}
func (w *SizeStatWriter) Close() error {
return common.Close(w.Writer)
}
func (w *SizeStatWriter) Interrupt() {
common.Interrupt(w.Writer)
}

View file

@ -1,44 +0,0 @@
package dispatcher_test
import (
"testing"
. "github.com/xtls/xray-core/app/dispatcher"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/buf"
)
type TestCounter int64
func (c *TestCounter) Value() int64 {
return int64(*c)
}
func (c *TestCounter) Add(v int64) int64 {
x := int64(*c) + v
*c = TestCounter(x)
return x
}
func (c *TestCounter) Set(v int64) int64 {
*c = TestCounter(v)
return v
}
func TestStatsWriter(t *testing.T) {
var c TestCounter
writer := &SizeStatWriter{
Counter: &c,
Writer: buf.Discard,
}
mb := buf.MergeBytes(nil, []byte("abcd"))
common.Must(writer.WriteMultiBuffer(mb))
mb = buf.MergeBytes(nil, []byte("efg"))
common.Must(writer.WriteMultiBuffer(mb))
if c.Value() != 7 {
t.Fatal("unexpected counter value. want 7, but got ", c.Value())
}
}

View file

@ -1,339 +0,0 @@
package dns
import (
"context"
go_errors "errors"
"runtime"
"sync"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/signal/pubsub"
"github.com/xtls/xray-core/common/task"
dns_feature "github.com/xtls/xray-core/features/dns"
"golang.org/x/net/dns/dnsmessage"
"golang.org/x/sync/singleflight"
)
const (
minSizeForEmptyRebuild = 512
shrinkAbsoluteThreshold = 10240
shrinkRatioThreshold = 0.65
migrationBatchSize = 4096
)
type CacheController struct {
name string
disableCache bool
serveStale bool
serveExpiredTTL int32
ips map[string]*record
dirtyips map[string]*record
sync.RWMutex
pub *pubsub.Service
cacheCleanup *task.Periodic
highWatermark int
requestGroup singleflight.Group
}
func NewCacheController(name string, disableCache bool, serveStale bool, serveExpiredTTL uint32) *CacheController {
c := &CacheController{
name: name,
disableCache: disableCache,
serveStale: serveStale,
serveExpiredTTL: -int32(serveExpiredTTL),
ips: make(map[string]*record),
pub: pubsub.NewService(),
}
c.cacheCleanup = &task.Periodic{
Interval: 300 * time.Second,
Execute: c.CacheCleanup,
}
return c
}
// CacheCleanup clears expired items from cache
func (c *CacheController) CacheCleanup() error {
expiredKeys, err := c.collectExpiredKeys()
if err != nil {
return err
}
if len(expiredKeys) == 0 {
return nil
}
c.writeAndShrink(expiredKeys)
return nil
}
func (c *CacheController) collectExpiredKeys() ([]string, error) {
c.RLock()
defer c.RUnlock()
if len(c.ips) == 0 {
return nil, errors.New("nothing to do. stopping...")
}
// skip collection if a migration is in progress
if c.dirtyips != nil {
return nil, nil
}
now := time.Now()
if c.serveStale && c.serveExpiredTTL != 0 {
now = now.Add(time.Duration(c.serveExpiredTTL) * time.Second)
}
expiredKeys := make([]string, 0, len(c.ips)/4) // pre-allocate
for domain, rec := range c.ips {
if (rec.A != nil && rec.A.Expire.Before(now)) ||
(rec.AAAA != nil && rec.AAAA.Expire.Before(now)) {
expiredKeys = append(expiredKeys, domain)
}
}
return expiredKeys, nil
}
func (c *CacheController) writeAndShrink(expiredKeys []string) {
c.Lock()
defer c.Unlock()
// double check to prevent upper call multiple cleanup tasks
if c.dirtyips != nil {
return
}
lenBefore := len(c.ips)
if lenBefore > c.highWatermark {
c.highWatermark = lenBefore
}
now := time.Now()
if c.serveStale && c.serveExpiredTTL != 0 {
now = now.Add(time.Duration(c.serveExpiredTTL) * time.Second)
}
for _, domain := range expiredKeys {
rec := c.ips[domain]
if rec == nil {
continue
}
if rec.A != nil && rec.A.Expire.Before(now) {
rec.A = nil
}
if rec.AAAA != nil && rec.AAAA.Expire.Before(now) {
rec.AAAA = nil
}
if rec.A == nil && rec.AAAA == nil {
delete(c.ips, domain)
}
}
lenAfter := len(c.ips)
if lenAfter == 0 {
if c.highWatermark >= minSizeForEmptyRebuild {
errors.LogDebug(context.Background(), c.name,
" rebuilding empty cache map to reclaim memory.",
" size_before_cleanup=", lenBefore,
" peak_size_before_rebuild=", c.highWatermark,
)
c.ips = make(map[string]*record)
c.highWatermark = 0
}
return
}
if reductionFromPeak := c.highWatermark - lenAfter; reductionFromPeak > shrinkAbsoluteThreshold &&
float64(reductionFromPeak) > float64(c.highWatermark)*shrinkRatioThreshold {
errors.LogDebug(context.Background(), c.name,
" shrinking cache map to reclaim memory.",
" new_size=", lenAfter,
" peak_size_before_shrink=", c.highWatermark,
" reduction_since_peak=", reductionFromPeak,
)
c.dirtyips = c.ips
c.ips = make(map[string]*record, int(float64(lenAfter)*1.1))
c.highWatermark = lenAfter
go c.migrate()
}
}
type migrationEntry struct {
key string
value *record
}
func (c *CacheController) migrate() {
defer func() {
if r := recover(); r != nil {
errors.LogError(context.Background(), c.name, " panic during cache migration: ", r)
c.Lock()
c.dirtyips = nil
// c.ips = make(map[string]*record)
// c.highWatermark = 0
c.Unlock()
}
}()
c.RLock()
dirtyips := c.dirtyips
c.RUnlock()
// double check to prevent upper call multiple cleanup tasks
if dirtyips == nil {
return
}
errors.LogDebug(context.Background(), c.name, " starting background cache migration for ", len(dirtyips), " items")
batch := make([]migrationEntry, 0, migrationBatchSize)
for domain, recD := range dirtyips {
batch = append(batch, migrationEntry{domain, recD})
if len(batch) >= migrationBatchSize {
c.flush(batch)
batch = batch[:0]
runtime.Gosched()
}
}
if len(batch) > 0 {
c.flush(batch)
}
c.Lock()
c.dirtyips = nil
c.Unlock()
errors.LogDebug(context.Background(), c.name, " cache migration completed")
}
func (c *CacheController) flush(batch []migrationEntry) {
c.Lock()
defer c.Unlock()
for _, dirty := range batch {
if cur := c.ips[dirty.key]; cur != nil {
merge := &record{}
if cur.A == nil {
merge.A = dirty.value.A
} else {
merge.A = cur.A
}
if cur.AAAA == nil {
merge.AAAA = dirty.value.AAAA
} else {
merge.AAAA = cur.AAAA
}
c.ips[dirty.key] = merge
} else {
c.ips[dirty.key] = dirty.value
}
}
}
func (c *CacheController) updateRecord(req *dnsRequest, rep *IPRecord) {
rtt := time.Since(req.start)
switch req.reqType {
case dnsmessage.TypeA:
c.pub.Publish(req.domain+"4", rep)
case dnsmessage.TypeAAAA:
c.pub.Publish(req.domain+"6", rep)
}
if c.disableCache {
errors.LogInfo(context.Background(), c.name, " got answer: ", req.domain, " ", req.reqType, " -> ", rep.IP, ", rtt: ", rtt)
return
}
c.Lock()
lockWait := time.Since(req.start) - rtt
newRec := &record{}
oldRec := c.ips[req.domain]
var dirtyRec *record
if c.dirtyips != nil {
dirtyRec = c.dirtyips[req.domain]
}
var pubRecord *IPRecord
var pubSuffix string
switch req.reqType {
case dnsmessage.TypeA:
newRec.A = rep
if oldRec != nil && oldRec.AAAA != nil {
newRec.AAAA = oldRec.AAAA
pubRecord = oldRec.AAAA
} else if dirtyRec != nil && dirtyRec.AAAA != nil {
pubRecord = dirtyRec.AAAA
}
pubSuffix = "6"
case dnsmessage.TypeAAAA:
newRec.AAAA = rep
if oldRec != nil && oldRec.A != nil {
newRec.A = oldRec.A
pubRecord = oldRec.A
} else if dirtyRec != nil && dirtyRec.A != nil {
pubRecord = dirtyRec.A
}
pubSuffix = "4"
}
c.ips[req.domain] = newRec
c.Unlock()
if pubRecord != nil {
_, ttl, err := pubRecord.getIPs()
if ttl > 0 && !go_errors.Is(err, errRecordNotFound) {
c.pub.Publish(req.domain+pubSuffix, pubRecord)
}
}
errors.LogInfo(context.Background(), c.name, " got answer: ", req.domain, " ", req.reqType, " -> ", rep.IP, ", rtt: ", rtt, ", lock: ", lockWait)
if !c.serveStale || c.serveExpiredTTL != 0 {
common.Must(c.cacheCleanup.Start())
}
}
func (c *CacheController) findRecords(domain string) *record {
c.RLock()
defer c.RUnlock()
rec := c.ips[domain]
if rec == nil && c.dirtyips != nil {
rec = c.dirtyips[domain]
}
return rec
}
func (c *CacheController) registerSubscribers(domain string, option dns_feature.IPOption) (sub4 *pubsub.Subscriber, sub6 *pubsub.Subscriber) {
// ipv4 and ipv6 belong to different subscription groups
if option.IPv4Enable {
sub4 = c.pub.Subscribe(domain + "4")
}
if option.IPv6Enable {
sub6 = c.pub.Subscribe(domain + "6")
}
return
}
func closeSubscribers(sub4 *pubsub.Subscriber, sub6 *pubsub.Subscriber) {
if sub4 != nil {
sub4.Close()
}
if sub6 != nil {
sub6.Close()
}
}

View file

@ -1,64 +0,0 @@
package dns
import (
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/common/uuid"
)
var typeMap = map[DomainMatchingType]strmatcher.Type{
DomainMatchingType_Full: strmatcher.Full,
DomainMatchingType_Subdomain: strmatcher.Domain,
DomainMatchingType_Keyword: strmatcher.Substr,
DomainMatchingType_Regex: strmatcher.Regex,
}
// References:
// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
var localTLDsAndDotlessDomains = []*NameServer_PriorityDomain{
{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
{Type: DomainMatchingType_Subdomain, Domain: "local"},
{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
{Type: DomainMatchingType_Subdomain, Domain: "lan"},
{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
{Type: DomainMatchingType_Subdomain, Domain: "example"},
{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
{Type: DomainMatchingType_Subdomain, Domain: "test"},
}
var localTLDsAndDotlessDomainsRule = &NameServer_OriginalRule{
Rule: "geosite:private",
Size: uint32(len(localTLDsAndDotlessDomains)),
}
func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
strMType, f := typeMap[t]
if !f {
return nil, errors.New("unknown mapping type", t).AtWarning()
}
matcher, err := strMType.New(domain)
if err != nil {
return nil, errors.New("failed to create str matcher").Base(err)
}
return matcher, nil
}
func toNetIP(addrs []net.Address) ([]net.IP, error) {
ips := make([]net.IP, 0, len(addrs))
for _, addr := range addrs {
if addr.Family().IsIP() {
ips = append(ips, addr.IP())
} else {
return nil, errors.New("Failed to convert address", addr, "to Net IP.").AtWarning()
}
}
return ips, nil
}
func generateRandomTag() string {
id := uuid.New()
return "xray.system." + id.String()
}

View file

@ -1,748 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/dns/config.proto
package dns
import (
router "github.com/xtls/xray-core/app/router"
net "github.com/xtls/xray-core/common/net"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type DomainMatchingType int32
const (
DomainMatchingType_Full DomainMatchingType = 0
DomainMatchingType_Subdomain DomainMatchingType = 1
DomainMatchingType_Keyword DomainMatchingType = 2
DomainMatchingType_Regex DomainMatchingType = 3
)
// Enum value maps for DomainMatchingType.
var (
DomainMatchingType_name = map[int32]string{
0: "Full",
1: "Subdomain",
2: "Keyword",
3: "Regex",
}
DomainMatchingType_value = map[string]int32{
"Full": 0,
"Subdomain": 1,
"Keyword": 2,
"Regex": 3,
}
)
func (x DomainMatchingType) Enum() *DomainMatchingType {
p := new(DomainMatchingType)
*p = x
return p
}
func (x DomainMatchingType) String() string {
return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
}
func (DomainMatchingType) Descriptor() protoreflect.EnumDescriptor {
return file_app_dns_config_proto_enumTypes[0].Descriptor()
}
func (DomainMatchingType) Type() protoreflect.EnumType {
return &file_app_dns_config_proto_enumTypes[0]
}
func (x DomainMatchingType) Number() protoreflect.EnumNumber {
return protoreflect.EnumNumber(x)
}
// Deprecated: Use DomainMatchingType.Descriptor instead.
func (DomainMatchingType) EnumDescriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{0}
}
type QueryStrategy int32
const (
QueryStrategy_USE_IP QueryStrategy = 0
QueryStrategy_USE_IP4 QueryStrategy = 1
QueryStrategy_USE_IP6 QueryStrategy = 2
QueryStrategy_USE_SYS QueryStrategy = 3
)
// Enum value maps for QueryStrategy.
var (
QueryStrategy_name = map[int32]string{
0: "USE_IP",
1: "USE_IP4",
2: "USE_IP6",
3: "USE_SYS",
}
QueryStrategy_value = map[string]int32{
"USE_IP": 0,
"USE_IP4": 1,
"USE_IP6": 2,
"USE_SYS": 3,
}
)
func (x QueryStrategy) Enum() *QueryStrategy {
p := new(QueryStrategy)
*p = x
return p
}
func (x QueryStrategy) String() string {
return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
}
func (QueryStrategy) Descriptor() protoreflect.EnumDescriptor {
return file_app_dns_config_proto_enumTypes[1].Descriptor()
}
func (QueryStrategy) Type() protoreflect.EnumType {
return &file_app_dns_config_proto_enumTypes[1]
}
func (x QueryStrategy) Number() protoreflect.EnumNumber {
return protoreflect.EnumNumber(x)
}
// Deprecated: Use QueryStrategy.Descriptor instead.
func (QueryStrategy) EnumDescriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{1}
}
type NameServer struct {
state protoimpl.MessageState `protogen:"open.v1"`
Address *net.Endpoint `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"`
ClientIp []byte `protobuf:"bytes,5,opt,name=client_ip,json=clientIp,proto3" json:"client_ip,omitempty"`
SkipFallback bool `protobuf:"varint,6,opt,name=skipFallback,proto3" json:"skipFallback,omitempty"`
PrioritizedDomain []*NameServer_PriorityDomain `protobuf:"bytes,2,rep,name=prioritized_domain,json=prioritizedDomain,proto3" json:"prioritized_domain,omitempty"`
ExpectedGeoip []*router.GeoIP `protobuf:"bytes,3,rep,name=expected_geoip,json=expectedGeoip,proto3" json:"expected_geoip,omitempty"`
OriginalRules []*NameServer_OriginalRule `protobuf:"bytes,4,rep,name=original_rules,json=originalRules,proto3" json:"original_rules,omitempty"`
QueryStrategy QueryStrategy `protobuf:"varint,7,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
ActPrior bool `protobuf:"varint,8,opt,name=actPrior,proto3" json:"actPrior,omitempty"`
Tag string `protobuf:"bytes,9,opt,name=tag,proto3" json:"tag,omitempty"`
TimeoutMs uint64 `protobuf:"varint,10,opt,name=timeoutMs,proto3" json:"timeoutMs,omitempty"`
DisableCache *bool `protobuf:"varint,11,opt,name=disableCache,proto3,oneof" json:"disableCache,omitempty"`
ServeStale *bool `protobuf:"varint,15,opt,name=serveStale,proto3,oneof" json:"serveStale,omitempty"`
ServeExpiredTTL *uint32 `protobuf:"varint,16,opt,name=serveExpiredTTL,proto3,oneof" json:"serveExpiredTTL,omitempty"`
FinalQuery bool `protobuf:"varint,12,opt,name=finalQuery,proto3" json:"finalQuery,omitempty"`
UnexpectedGeoip []*router.GeoIP `protobuf:"bytes,13,rep,name=unexpected_geoip,json=unexpectedGeoip,proto3" json:"unexpected_geoip,omitempty"`
ActUnprior bool `protobuf:"varint,14,opt,name=actUnprior,proto3" json:"actUnprior,omitempty"`
PolicyID uint32 `protobuf:"varint,17,opt,name=policyID,proto3" json:"policyID,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *NameServer) Reset() {
*x = NameServer{}
mi := &file_app_dns_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *NameServer) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*NameServer) ProtoMessage() {}
func (x *NameServer) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use NameServer.ProtoReflect.Descriptor instead.
func (*NameServer) Descriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{0}
}
func (x *NameServer) GetAddress() *net.Endpoint {
if x != nil {
return x.Address
}
return nil
}
func (x *NameServer) GetClientIp() []byte {
if x != nil {
return x.ClientIp
}
return nil
}
func (x *NameServer) GetSkipFallback() bool {
if x != nil {
return x.SkipFallback
}
return false
}
func (x *NameServer) GetPrioritizedDomain() []*NameServer_PriorityDomain {
if x != nil {
return x.PrioritizedDomain
}
return nil
}
func (x *NameServer) GetExpectedGeoip() []*router.GeoIP {
if x != nil {
return x.ExpectedGeoip
}
return nil
}
func (x *NameServer) GetOriginalRules() []*NameServer_OriginalRule {
if x != nil {
return x.OriginalRules
}
return nil
}
func (x *NameServer) GetQueryStrategy() QueryStrategy {
if x != nil {
return x.QueryStrategy
}
return QueryStrategy_USE_IP
}
func (x *NameServer) GetActPrior() bool {
if x != nil {
return x.ActPrior
}
return false
}
func (x *NameServer) GetTag() string {
if x != nil {
return x.Tag
}
return ""
}
func (x *NameServer) GetTimeoutMs() uint64 {
if x != nil {
return x.TimeoutMs
}
return 0
}
func (x *NameServer) GetDisableCache() bool {
if x != nil && x.DisableCache != nil {
return *x.DisableCache
}
return false
}
func (x *NameServer) GetServeStale() bool {
if x != nil && x.ServeStale != nil {
return *x.ServeStale
}
return false
}
func (x *NameServer) GetServeExpiredTTL() uint32 {
if x != nil && x.ServeExpiredTTL != nil {
return *x.ServeExpiredTTL
}
return 0
}
func (x *NameServer) GetFinalQuery() bool {
if x != nil {
return x.FinalQuery
}
return false
}
func (x *NameServer) GetUnexpectedGeoip() []*router.GeoIP {
if x != nil {
return x.UnexpectedGeoip
}
return nil
}
func (x *NameServer) GetActUnprior() bool {
if x != nil {
return x.ActUnprior
}
return false
}
func (x *NameServer) GetPolicyID() uint32 {
if x != nil {
return x.PolicyID
}
return 0
}
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
// NameServer list used by this DNS client.
// A special value 'localhost' as a domain address can be set to use DNS on local system.
NameServer []*NameServer `protobuf:"bytes,5,rep,name=name_server,json=nameServer,proto3" json:"name_server,omitempty"`
// Client IP for EDNS client subnet. Must be 4 bytes (IPv4) or 16 bytes
// (IPv6).
ClientIp []byte `protobuf:"bytes,3,opt,name=client_ip,json=clientIp,proto3" json:"client_ip,omitempty"`
StaticHosts []*Config_HostMapping `protobuf:"bytes,4,rep,name=static_hosts,json=staticHosts,proto3" json:"static_hosts,omitempty"`
// Tag is the inbound tag of DNS client.
Tag string `protobuf:"bytes,6,opt,name=tag,proto3" json:"tag,omitempty"`
// DisableCache disables DNS cache
DisableCache bool `protobuf:"varint,8,opt,name=disableCache,proto3" json:"disableCache,omitempty"`
ServeStale bool `protobuf:"varint,12,opt,name=serveStale,proto3" json:"serveStale,omitempty"`
ServeExpiredTTL uint32 `protobuf:"varint,13,opt,name=serveExpiredTTL,proto3" json:"serveExpiredTTL,omitempty"`
QueryStrategy QueryStrategy `protobuf:"varint,9,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
DisableFallback bool `protobuf:"varint,10,opt,name=disableFallback,proto3" json:"disableFallback,omitempty"`
DisableFallbackIfMatch bool `protobuf:"varint,11,opt,name=disableFallbackIfMatch,proto3" json:"disableFallbackIfMatch,omitempty"`
EnableParallelQuery bool `protobuf:"varint,14,opt,name=enableParallelQuery,proto3" json:"enableParallelQuery,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_dns_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_config_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{1}
}
func (x *Config) GetNameServer() []*NameServer {
if x != nil {
return x.NameServer
}
return nil
}
func (x *Config) GetClientIp() []byte {
if x != nil {
return x.ClientIp
}
return nil
}
func (x *Config) GetStaticHosts() []*Config_HostMapping {
if x != nil {
return x.StaticHosts
}
return nil
}
func (x *Config) GetTag() string {
if x != nil {
return x.Tag
}
return ""
}
func (x *Config) GetDisableCache() bool {
if x != nil {
return x.DisableCache
}
return false
}
func (x *Config) GetServeStale() bool {
if x != nil {
return x.ServeStale
}
return false
}
func (x *Config) GetServeExpiredTTL() uint32 {
if x != nil {
return x.ServeExpiredTTL
}
return 0
}
func (x *Config) GetQueryStrategy() QueryStrategy {
if x != nil {
return x.QueryStrategy
}
return QueryStrategy_USE_IP
}
func (x *Config) GetDisableFallback() bool {
if x != nil {
return x.DisableFallback
}
return false
}
func (x *Config) GetDisableFallbackIfMatch() bool {
if x != nil {
return x.DisableFallbackIfMatch
}
return false
}
func (x *Config) GetEnableParallelQuery() bool {
if x != nil {
return x.EnableParallelQuery
}
return false
}
type NameServer_PriorityDomain struct {
state protoimpl.MessageState `protogen:"open.v1"`
Type DomainMatchingType `protobuf:"varint,1,opt,name=type,proto3,enum=xray.app.dns.DomainMatchingType" json:"type,omitempty"`
Domain string `protobuf:"bytes,2,opt,name=domain,proto3" json:"domain,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *NameServer_PriorityDomain) Reset() {
*x = NameServer_PriorityDomain{}
mi := &file_app_dns_config_proto_msgTypes[2]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *NameServer_PriorityDomain) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*NameServer_PriorityDomain) ProtoMessage() {}
func (x *NameServer_PriorityDomain) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_config_proto_msgTypes[2]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use NameServer_PriorityDomain.ProtoReflect.Descriptor instead.
func (*NameServer_PriorityDomain) Descriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{0, 0}
}
func (x *NameServer_PriorityDomain) GetType() DomainMatchingType {
if x != nil {
return x.Type
}
return DomainMatchingType_Full
}
func (x *NameServer_PriorityDomain) GetDomain() string {
if x != nil {
return x.Domain
}
return ""
}
type NameServer_OriginalRule struct {
state protoimpl.MessageState `protogen:"open.v1"`
Rule string `protobuf:"bytes,1,opt,name=rule,proto3" json:"rule,omitempty"`
Size uint32 `protobuf:"varint,2,opt,name=size,proto3" json:"size,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *NameServer_OriginalRule) Reset() {
*x = NameServer_OriginalRule{}
mi := &file_app_dns_config_proto_msgTypes[3]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *NameServer_OriginalRule) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*NameServer_OriginalRule) ProtoMessage() {}
func (x *NameServer_OriginalRule) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_config_proto_msgTypes[3]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use NameServer_OriginalRule.ProtoReflect.Descriptor instead.
func (*NameServer_OriginalRule) Descriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{0, 1}
}
func (x *NameServer_OriginalRule) GetRule() string {
if x != nil {
return x.Rule
}
return ""
}
func (x *NameServer_OriginalRule) GetSize() uint32 {
if x != nil {
return x.Size
}
return 0
}
type Config_HostMapping struct {
state protoimpl.MessageState `protogen:"open.v1"`
Type DomainMatchingType `protobuf:"varint,1,opt,name=type,proto3,enum=xray.app.dns.DomainMatchingType" json:"type,omitempty"`
Domain string `protobuf:"bytes,2,opt,name=domain,proto3" json:"domain,omitempty"`
Ip [][]byte `protobuf:"bytes,3,rep,name=ip,proto3" json:"ip,omitempty"`
// ProxiedDomain indicates the mapped domain has the same IP address on this
// domain. Xray will use this domain for IP queries.
ProxiedDomain string `protobuf:"bytes,4,opt,name=proxied_domain,json=proxiedDomain,proto3" json:"proxied_domain,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config_HostMapping) Reset() {
*x = Config_HostMapping{}
mi := &file_app_dns_config_proto_msgTypes[4]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config_HostMapping) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config_HostMapping) ProtoMessage() {}
func (x *Config_HostMapping) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_config_proto_msgTypes[4]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config_HostMapping.ProtoReflect.Descriptor instead.
func (*Config_HostMapping) Descriptor() ([]byte, []int) {
return file_app_dns_config_proto_rawDescGZIP(), []int{1, 0}
}
func (x *Config_HostMapping) GetType() DomainMatchingType {
if x != nil {
return x.Type
}
return DomainMatchingType_Full
}
func (x *Config_HostMapping) GetDomain() string {
if x != nil {
return x.Domain
}
return ""
}
func (x *Config_HostMapping) GetIp() [][]byte {
if x != nil {
return x.Ip
}
return nil
}
func (x *Config_HostMapping) GetProxiedDomain() string {
if x != nil {
return x.ProxiedDomain
}
return ""
}
var File_app_dns_config_proto protoreflect.FileDescriptor
const file_app_dns_config_proto_rawDesc = "" +
"\n" +
"\x14app/dns/config.proto\x12\fxray.app.dns\x1a\x1ccommon/net/destination.proto\x1a\x17app/router/config.proto\"\xdf\a\n" +
"\n" +
"NameServer\x123\n" +
"\aaddress\x18\x01 \x01(\v2\x19.xray.common.net.EndpointR\aaddress\x12\x1b\n" +
"\tclient_ip\x18\x05 \x01(\fR\bclientIp\x12\"\n" +
"\fskipFallback\x18\x06 \x01(\bR\fskipFallback\x12V\n" +
"\x12prioritized_domain\x18\x02 \x03(\v2'.xray.app.dns.NameServer.PriorityDomainR\x11prioritizedDomain\x12=\n" +
"\x0eexpected_geoip\x18\x03 \x03(\v2\x16.xray.app.router.GeoIPR\rexpectedGeoip\x12L\n" +
"\x0eoriginal_rules\x18\x04 \x03(\v2%.xray.app.dns.NameServer.OriginalRuleR\roriginalRules\x12B\n" +
"\x0equery_strategy\x18\a \x01(\x0e2\x1b.xray.app.dns.QueryStrategyR\rqueryStrategy\x12\x1a\n" +
"\bactPrior\x18\b \x01(\bR\bactPrior\x12\x10\n" +
"\x03tag\x18\t \x01(\tR\x03tag\x12\x1c\n" +
"\ttimeoutMs\x18\n" +
" \x01(\x04R\ttimeoutMs\x12'\n" +
"\fdisableCache\x18\v \x01(\bH\x00R\fdisableCache\x88\x01\x01\x12#\n" +
"\n" +
"serveStale\x18\x0f \x01(\bH\x01R\n" +
"serveStale\x88\x01\x01\x12-\n" +
"\x0fserveExpiredTTL\x18\x10 \x01(\rH\x02R\x0fserveExpiredTTL\x88\x01\x01\x12\x1e\n" +
"\n" +
"finalQuery\x18\f \x01(\bR\n" +
"finalQuery\x12A\n" +
"\x10unexpected_geoip\x18\r \x03(\v2\x16.xray.app.router.GeoIPR\x0funexpectedGeoip\x12\x1e\n" +
"\n" +
"actUnprior\x18\x0e \x01(\bR\n" +
"actUnprior\x12\x1a\n" +
"\bpolicyID\x18\x11 \x01(\rR\bpolicyID\x1a^\n" +
"\x0ePriorityDomain\x124\n" +
"\x04type\x18\x01 \x01(\x0e2 .xray.app.dns.DomainMatchingTypeR\x04type\x12\x16\n" +
"\x06domain\x18\x02 \x01(\tR\x06domain\x1a6\n" +
"\fOriginalRule\x12\x12\n" +
"\x04rule\x18\x01 \x01(\tR\x04rule\x12\x12\n" +
"\x04size\x18\x02 \x01(\rR\x04sizeB\x0f\n" +
"\r_disableCacheB\r\n" +
"\v_serveStaleB\x12\n" +
"\x10_serveExpiredTTL\"\x98\x05\n" +
"\x06Config\x129\n" +
"\vname_server\x18\x05 \x03(\v2\x18.xray.app.dns.NameServerR\n" +
"nameServer\x12\x1b\n" +
"\tclient_ip\x18\x03 \x01(\fR\bclientIp\x12C\n" +
"\fstatic_hosts\x18\x04 \x03(\v2 .xray.app.dns.Config.HostMappingR\vstaticHosts\x12\x10\n" +
"\x03tag\x18\x06 \x01(\tR\x03tag\x12\"\n" +
"\fdisableCache\x18\b \x01(\bR\fdisableCache\x12\x1e\n" +
"\n" +
"serveStale\x18\f \x01(\bR\n" +
"serveStale\x12(\n" +
"\x0fserveExpiredTTL\x18\r \x01(\rR\x0fserveExpiredTTL\x12B\n" +
"\x0equery_strategy\x18\t \x01(\x0e2\x1b.xray.app.dns.QueryStrategyR\rqueryStrategy\x12(\n" +
"\x0fdisableFallback\x18\n" +
" \x01(\bR\x0fdisableFallback\x126\n" +
"\x16disableFallbackIfMatch\x18\v \x01(\bR\x16disableFallbackIfMatch\x120\n" +
"\x13enableParallelQuery\x18\x0e \x01(\bR\x13enableParallelQuery\x1a\x92\x01\n" +
"\vHostMapping\x124\n" +
"\x04type\x18\x01 \x01(\x0e2 .xray.app.dns.DomainMatchingTypeR\x04type\x12\x16\n" +
"\x06domain\x18\x02 \x01(\tR\x06domain\x12\x0e\n" +
"\x02ip\x18\x03 \x03(\fR\x02ip\x12%\n" +
"\x0eproxied_domain\x18\x04 \x01(\tR\rproxiedDomainJ\x04\b\a\x10\b*E\n" +
"\x12DomainMatchingType\x12\b\n" +
"\x04Full\x10\x00\x12\r\n" +
"\tSubdomain\x10\x01\x12\v\n" +
"\aKeyword\x10\x02\x12\t\n" +
"\x05Regex\x10\x03*B\n" +
"\rQueryStrategy\x12\n" +
"\n" +
"\x06USE_IP\x10\x00\x12\v\n" +
"\aUSE_IP4\x10\x01\x12\v\n" +
"\aUSE_IP6\x10\x02\x12\v\n" +
"\aUSE_SYS\x10\x03BF\n" +
"\x10com.xray.app.dnsP\x01Z!github.com/xtls/xray-core/app/dns\xaa\x02\fXray.App.Dnsb\x06proto3"
var (
file_app_dns_config_proto_rawDescOnce sync.Once
file_app_dns_config_proto_rawDescData []byte
)
func file_app_dns_config_proto_rawDescGZIP() []byte {
file_app_dns_config_proto_rawDescOnce.Do(func() {
file_app_dns_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_dns_config_proto_rawDesc), len(file_app_dns_config_proto_rawDesc)))
})
return file_app_dns_config_proto_rawDescData
}
var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 2)
var file_app_dns_config_proto_msgTypes = make([]protoimpl.MessageInfo, 5)
var file_app_dns_config_proto_goTypes = []any{
(DomainMatchingType)(0), // 0: xray.app.dns.DomainMatchingType
(QueryStrategy)(0), // 1: xray.app.dns.QueryStrategy
(*NameServer)(nil), // 2: xray.app.dns.NameServer
(*Config)(nil), // 3: xray.app.dns.Config
(*NameServer_PriorityDomain)(nil), // 4: xray.app.dns.NameServer.PriorityDomain
(*NameServer_OriginalRule)(nil), // 5: xray.app.dns.NameServer.OriginalRule
(*Config_HostMapping)(nil), // 6: xray.app.dns.Config.HostMapping
(*net.Endpoint)(nil), // 7: xray.common.net.Endpoint
(*router.GeoIP)(nil), // 8: xray.app.router.GeoIP
}
var file_app_dns_config_proto_depIdxs = []int32{
7, // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
4, // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
8, // 2: xray.app.dns.NameServer.expected_geoip:type_name -> xray.app.router.GeoIP
5, // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
1, // 4: xray.app.dns.NameServer.query_strategy:type_name -> xray.app.dns.QueryStrategy
8, // 5: xray.app.dns.NameServer.unexpected_geoip:type_name -> xray.app.router.GeoIP
2, // 6: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
6, // 7: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
1, // 8: xray.app.dns.Config.query_strategy:type_name -> xray.app.dns.QueryStrategy
0, // 9: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
0, // 10: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
11, // [11:11] is the sub-list for method output_type
11, // [11:11] is the sub-list for method input_type
11, // [11:11] is the sub-list for extension type_name
11, // [11:11] is the sub-list for extension extendee
0, // [0:11] is the sub-list for field type_name
}
func init() { file_app_dns_config_proto_init() }
func file_app_dns_config_proto_init() {
if File_app_dns_config_proto != nil {
return
}
file_app_dns_config_proto_msgTypes[0].OneofWrappers = []any{}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_dns_config_proto_rawDesc), len(file_app_dns_config_proto_rawDesc)),
NumEnums: 2,
NumMessages: 5,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_dns_config_proto_goTypes,
DependencyIndexes: file_app_dns_config_proto_depIdxs,
EnumInfos: file_app_dns_config_proto_enumTypes,
MessageInfos: file_app_dns_config_proto_msgTypes,
}.Build()
File_app_dns_config_proto = out.File
file_app_dns_config_proto_goTypes = nil
file_app_dns_config_proto_depIdxs = nil
}

View file

@ -1,95 +0,0 @@
syntax = "proto3";
package xray.app.dns;
option csharp_namespace = "Xray.App.Dns";
option go_package = "github.com/xtls/xray-core/app/dns";
option java_package = "com.xray.app.dns";
option java_multiple_files = true;
import "common/net/destination.proto";
import "app/router/config.proto";
message NameServer {
xray.common.net.Endpoint address = 1;
bytes client_ip = 5;
bool skipFallback = 6;
message PriorityDomain {
DomainMatchingType type = 1;
string domain = 2;
}
message OriginalRule {
string rule = 1;
uint32 size = 2;
}
repeated PriorityDomain prioritized_domain = 2;
repeated xray.app.router.GeoIP expected_geoip = 3;
repeated OriginalRule original_rules = 4;
QueryStrategy query_strategy = 7;
bool actPrior = 8;
string tag = 9;
uint64 timeoutMs = 10;
optional bool disableCache = 11;
optional bool serveStale = 15;
optional uint32 serveExpiredTTL = 16;
bool finalQuery = 12;
repeated xray.app.router.GeoIP unexpected_geoip = 13;
bool actUnprior = 14;
uint32 policyID = 17;
}
enum DomainMatchingType {
Full = 0;
Subdomain = 1;
Keyword = 2;
Regex = 3;
}
enum QueryStrategy {
USE_IP = 0;
USE_IP4 = 1;
USE_IP6 = 2;
USE_SYS = 3;
}
message Config {
// NameServer list used by this DNS client.
// A special value 'localhost' as a domain address can be set to use DNS on local system.
repeated NameServer name_server = 5;
// Client IP for EDNS client subnet. Must be 4 bytes (IPv4) or 16 bytes
// (IPv6).
bytes client_ip = 3;
message HostMapping {
DomainMatchingType type = 1;
string domain = 2;
repeated bytes ip = 3;
// ProxiedDomain indicates the mapped domain has the same IP address on this
// domain. Xray will use this domain for IP queries.
string proxied_domain = 4;
}
repeated HostMapping static_hosts = 4;
// Tag is the inbound tag of DNS client.
string tag = 6;
reserved 7;
// DisableCache disables DNS cache
bool disableCache = 8;
bool serveStale = 12;
uint32 serveExpiredTTL = 13;
QueryStrategy query_strategy = 9;
bool disableFallback = 10;
bool disableFallbackIfMatch = 11;
bool enableParallelQuery = 14;
}

View file

@ -1,606 +0,0 @@
// Package dns is an implementation of core.DNS feature.
package dns
import (
"context"
go_errors "errors"
"fmt"
"os"
"runtime"
"sort"
"strings"
"sync"
"time"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/platform"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/features/dns"
)
// DNS is a DNS rely server.
type DNS struct {
sync.Mutex
disableFallback bool
disableFallbackIfMatch bool
enableParallelQuery bool
ipOption *dns.IPOption
hosts *StaticHosts
clients []*Client
ctx context.Context
domainMatcher strmatcher.IndexMatcher
matcherInfos []*DomainMatcherInfo
checkSystem bool
}
// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
type DomainMatcherInfo struct {
clientIdx uint16
domainRuleIdx uint16
}
// New creates a new DNS server with given configuration.
func New(ctx context.Context, config *Config) (*DNS, error) {
var clientIP net.IP
switch len(config.ClientIp) {
case 0, net.IPv4len, net.IPv6len:
clientIP = net.IP(config.ClientIp)
default:
return nil, errors.New("unexpected client IP length ", len(config.ClientIp))
}
var ipOption dns.IPOption
checkSystem := false
switch config.QueryStrategy {
case QueryStrategy_USE_IP:
ipOption = dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
}
case QueryStrategy_USE_SYS:
ipOption = dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
}
checkSystem = true
case QueryStrategy_USE_IP4:
ipOption = dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
FakeEnable: false,
}
case QueryStrategy_USE_IP6:
ipOption = dns.IPOption{
IPv4Enable: false,
IPv6Enable: true,
FakeEnable: false,
}
default:
return nil, errors.New("unexpected query strategy ", config.QueryStrategy)
}
var hosts *StaticHosts
mphLoaded := false
domainMatcherPath := platform.NewEnvFlag(platform.MphCachePath).GetValue(func() string { return "" })
if domainMatcherPath != "" {
if f, err := os.Open(domainMatcherPath); err == nil {
defer f.Close()
if m, err := router.LoadGeoSiteMatcher(f, "HOSTS"); err == nil {
f.Seek(0, 0)
if hostIPs, err := router.LoadGeoSiteHosts(f); err == nil {
if sh, err := NewStaticHostsFromCache(m, hostIPs); err == nil {
hosts = sh
mphLoaded = true
errors.LogDebug(ctx, "MphDomainMatcher loaded from cache for DNS hosts, size: ", sh.matchers.Size())
}
}
}
}
}
if !mphLoaded {
sh, err := NewStaticHosts(config.StaticHosts)
if err != nil {
return nil, errors.New("failed to create hosts").Base(err)
}
hosts = sh
}
var clients []*Client
domainRuleCount := 0
var defaultTag = config.Tag
if len(config.Tag) == 0 {
defaultTag = generateRandomTag()
}
for _, ns := range config.NameServer {
domainRuleCount += len(ns.PrioritizedDomain)
}
// MatcherInfos is ensured to cover the maximum index domainMatcher could return, where matcher's index starts from 1
matcherInfos := make([]*DomainMatcherInfo, domainRuleCount+1)
domainMatcher := &strmatcher.MatcherGroup{}
for _, ns := range config.NameServer {
clientIdx := len(clients)
updateDomain := func(domainRule strmatcher.Matcher, originalRuleIdx int, matcherInfos []*DomainMatcherInfo) {
midx := domainMatcher.Add(domainRule)
matcherInfos[midx] = &DomainMatcherInfo{
clientIdx: uint16(clientIdx),
domainRuleIdx: uint16(originalRuleIdx),
}
}
myClientIP := clientIP
switch len(ns.ClientIp) {
case net.IPv4len, net.IPv6len:
myClientIP = net.IP(ns.ClientIp)
}
disableCache := config.DisableCache
if ns.DisableCache != nil {
disableCache = *ns.DisableCache
}
serveStale := config.ServeStale
if ns.ServeStale != nil {
serveStale = *ns.ServeStale
}
serveExpiredTTL := config.ServeExpiredTTL
if ns.ServeExpiredTTL != nil {
serveExpiredTTL = *ns.ServeExpiredTTL
}
var tag = defaultTag
if len(ns.Tag) > 0 {
tag = ns.Tag
}
clientIPOption := ResolveIpOptionOverride(ns.QueryStrategy, ipOption)
if !clientIPOption.IPv4Enable && !clientIPOption.IPv6Enable {
return nil, errors.New("no QueryStrategy available for ", ns.Address)
}
client, err := NewClient(ctx, ns, myClientIP, disableCache, serveStale, serveExpiredTTL, tag, clientIPOption, &matcherInfos, updateDomain)
if err != nil {
return nil, errors.New("failed to create client").Base(err)
}
clients = append(clients, client)
}
// If there is no DNS client in config, add a `localhost` DNS client
if len(clients) == 0 {
clients = append(clients, NewLocalDNSClient(ipOption))
}
return &DNS{
hosts: hosts,
ipOption: &ipOption,
clients: clients,
ctx: ctx,
domainMatcher: domainMatcher,
matcherInfos: matcherInfos,
disableFallback: config.DisableFallback,
disableFallbackIfMatch: config.DisableFallbackIfMatch,
enableParallelQuery: config.EnableParallelQuery,
checkSystem: checkSystem,
}, nil
}
// Type implements common.HasType.
func (*DNS) Type() interface{} {
return dns.ClientType()
}
// Start implements common.Runnable.
func (s *DNS) Start() error {
return nil
}
// Close implements common.Closable.
func (s *DNS) Close() error {
return nil
}
// IsOwnLink implements proxy.dns.ownLinkVerifier
func (s *DNS) IsOwnLink(ctx context.Context) bool {
inbound := session.InboundFromContext(ctx)
if inbound == nil {
return false
}
for _, client := range s.clients {
if client.tag == inbound.Tag {
return true
}
}
return false
}
// LookupIP implements dns.Client.
func (s *DNS) LookupIP(domain string, option dns.IPOption) ([]net.IP, uint32, error) {
// Normalize the FQDN form query
domain = strings.TrimSuffix(domain, ".")
if domain == "" {
return nil, 0, errors.New("empty domain name")
}
if s.checkSystem {
supportIPv4, supportIPv6 := checkRoutes()
option.IPv4Enable = option.IPv4Enable && supportIPv4
option.IPv6Enable = option.IPv6Enable && supportIPv6
} else {
option.IPv4Enable = option.IPv4Enable && s.ipOption.IPv4Enable
option.IPv6Enable = option.IPv6Enable && s.ipOption.IPv6Enable
}
if !option.IPv4Enable && !option.IPv6Enable {
return nil, 0, dns.ErrEmptyResponse
}
// Static host lookup
switch addrs, err := s.hosts.Lookup(domain, option); {
case err != nil:
if go_errors.Is(err, dns.ErrEmptyResponse) {
return nil, 0, dns.ErrEmptyResponse
}
return nil, 0, errors.New("returning nil for domain ", domain).Base(err)
case addrs == nil: // Domain not recorded in static host
break
case len(addrs) == 0: // Domain recorded, but no valid IP returned (e.g. IPv4 address with only IPv6 enabled)
return nil, 0, dns.ErrEmptyResponse
case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Domain replacement
errors.LogInfo(s.ctx, "domain replaced: ", domain, " -> ", addrs[0].Domain())
domain = addrs[0].Domain()
default: // Successfully found ip records in static host
errors.LogInfo(s.ctx, "returning ", len(addrs), " IP(s) for domain ", domain, " -> ", addrs)
ips, err := toNetIP(addrs)
if err != nil {
return nil, 0, err
}
return ips, 10, nil // Hosts ttl is 10
}
// Name servers lookup
if s.enableParallelQuery {
return s.parallelQuery(domain, option)
} else {
return s.serialQuery(domain, option)
}
}
func (s *DNS) sortClients(domain string) []*Client {
clients := make([]*Client, 0, len(s.clients))
clientUsed := make([]bool, len(s.clients))
clientNames := make([]string, 0, len(s.clients))
domainRules := []string{}
// Priority domain matching
hasMatch := false
MatchSlice := s.domainMatcher.Match(domain)
sort.Slice(MatchSlice, func(i, j int) bool {
return MatchSlice[i] < MatchSlice[j]
})
for _, match := range MatchSlice {
info := s.matcherInfos[match]
client := s.clients[info.clientIdx]
domainRule := client.domains[info.domainRuleIdx]
domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", domainRule, info.clientIdx))
if clientUsed[info.clientIdx] {
continue
}
clientUsed[info.clientIdx] = true
clients = append(clients, client)
clientNames = append(clientNames, client.Name())
hasMatch = true
if client.finalQuery {
return clients
}
}
if !(s.disableFallback || s.disableFallbackIfMatch && hasMatch) {
// Default round-robin query
for idx, client := range s.clients {
if clientUsed[idx] || client.skipFallback {
continue
}
clientUsed[idx] = true
clients = append(clients, client)
clientNames = append(clientNames, client.Name())
if client.finalQuery {
return clients
}
}
}
if len(domainRules) > 0 {
errors.LogDebug(s.ctx, "domain ", domain, " matches following rules: ", domainRules)
}
if len(clientNames) > 0 {
errors.LogDebug(s.ctx, "domain ", domain, " will use DNS in order: ", clientNames)
}
if len(clients) == 0 {
if len(s.clients) > 0 {
clients = append(clients, s.clients[0])
clientNames = append(clientNames, s.clients[0].Name())
errors.LogWarning(s.ctx, "domain ", domain, " will use the first DNS: ", clientNames)
} else {
errors.LogError(s.ctx, "no DNS clients available for domain ", domain, " and no default clients configured")
}
}
return clients
}
func mergeQueryErrors(domain string, errs []error) error {
if len(errs) == 0 {
return dns.ErrEmptyResponse
}
var noRNF error
for _, err := range errs {
if go_errors.Is(err, errRecordNotFound) {
continue // server no response, ignore
} else if noRNF == nil {
noRNF = err
} else if !go_errors.Is(err, noRNF) {
return errors.New("returning nil for domain ", domain).Base(errors.Combine(errs...))
}
}
if go_errors.Is(noRNF, dns.ErrEmptyResponse) {
return dns.ErrEmptyResponse
}
if noRNF == nil {
noRNF = errRecordNotFound
}
return errors.New("returning nil for domain ", domain).Base(noRNF)
}
func (s *DNS) serialQuery(domain string, option dns.IPOption) ([]net.IP, uint32, error) {
var errs []error
for _, client := range s.sortClients(domain) {
if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
errors.LogDebug(s.ctx, "skip DNS resolution for domain ", domain, " at server ", client.Name())
continue
}
ips, ttl, err := client.QueryIP(s.ctx, domain, option)
if len(ips) > 0 {
return ips, ttl, nil
}
errors.LogInfoInner(s.ctx, err, "failed to lookup ip for domain ", domain, " at server ", client.Name(), " in serial query mode")
if err == nil {
err = dns.ErrEmptyResponse
}
errs = append(errs, err)
}
return nil, 0, mergeQueryErrors(domain, errs)
}
func (s *DNS) parallelQuery(domain string, option dns.IPOption) ([]net.IP, uint32, error) {
var errs []error
clients := s.sortClients(domain)
resultsChan := asyncQueryAll(domain, option, clients, s.ctx)
groups, groupOf := makeGroups( /*s.ctx,*/ clients)
results := make([]*queryResult, len(clients))
pending := make([]int, len(groups))
for gi, g := range groups {
pending[gi] = g.end - g.start + 1
}
nextGroup := 0
for range clients {
result := <-resultsChan
results[result.index] = &result
gi := groupOf[result.index]
pending[gi]--
for nextGroup < len(groups) {
g := groups[nextGroup]
// group race, minimum rtt -> return
for j := g.start; j <= g.end; j++ {
r := results[j]
if r != nil && r.err == nil && len(r.ips) > 0 {
return r.ips, r.ttl, nil
}
}
// current group is incomplete and no one success -> continue pending
if pending[nextGroup] > 0 {
break
}
// all failed -> log and continue next group
for j := g.start; j <= g.end; j++ {
r := results[j]
e := r.err
if e == nil {
e = dns.ErrEmptyResponse
}
errors.LogInfoInner(s.ctx, e, "failed to lookup ip for domain ", domain, " at server ", clients[j].Name(), " in parallel query mode")
errs = append(errs, e)
}
nextGroup++
}
}
return nil, 0, mergeQueryErrors(domain, errs)
}
type queryResult struct {
ips []net.IP
ttl uint32
err error
index int
}
func asyncQueryAll(domain string, option dns.IPOption, clients []*Client, ctx context.Context) chan queryResult {
if len(clients) == 0 {
ch := make(chan queryResult)
close(ch)
return ch
}
ch := make(chan queryResult, len(clients))
for i, client := range clients {
if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
errors.LogDebug(ctx, "skip DNS resolution for domain ", domain, " at server ", client.Name())
ch <- queryResult{err: dns.ErrEmptyResponse, index: i}
continue
}
go func(i int, c *Client) {
qctx := ctx
if !c.server.IsDisableCache() {
nctx, cancel := context.WithTimeout(context.WithoutCancel(ctx), c.timeoutMs*2)
qctx = nctx
defer cancel()
}
ips, ttl, err := c.QueryIP(qctx, domain, option)
ch <- queryResult{ips: ips, ttl: ttl, err: err, index: i}
}(i, client)
}
return ch
}
type group struct{ start, end int }
// merge only adjacent and rule-equivalent Client into a single group
func makeGroups( /*ctx context.Context,*/ clients []*Client) ([]group, []int) {
n := len(clients)
if n == 0 {
return nil, nil
}
groups := make([]group, 0, n)
groupOf := make([]int, n)
s, e := 0, 0
for i := 1; i < n; i++ {
if clients[i-1].policyID == clients[i].policyID {
e = i
} else {
for k := s; k <= e; k++ {
groupOf[k] = len(groups)
}
groups = append(groups, group{start: s, end: e})
s, e = i, i
}
}
for k := s; k <= e; k++ {
groupOf[k] = len(groups)
}
groups = append(groups, group{start: s, end: e})
// var b strings.Builder
// b.WriteString("dns grouping: total clients=")
// b.WriteString(strconv.Itoa(n))
// b.WriteString(", groups=")
// b.WriteString(strconv.Itoa(len(groups)))
// for gi, g := range groups {
// b.WriteString("\n [")
// b.WriteString(strconv.Itoa(g.start))
// b.WriteString("..")
// b.WriteString(strconv.Itoa(g.end))
// b.WriteString("] gid=")
// b.WriteString(strconv.Itoa(gi))
// b.WriteString(" pid=")
// b.WriteString(strconv.FormatUint(uint64(clients[g.start].policyID), 10))
// b.WriteString(" members: ")
// for i := g.start; i <= g.end; i++ {
// if i > g.start {
// b.WriteString(", ")
// }
// b.WriteString(strconv.Itoa(i))
// b.WriteByte(':')
// b.WriteString(clients[i].Name())
// }
// }
// errors.LogDebug(ctx, b.String())
return groups, groupOf
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}
func probeRoutes() (ipv4 bool, ipv6 bool) {
if conn, err := net.Dial("udp4", "192.33.4.12:53"); err == nil {
ipv4 = true
conn.Close()
}
if conn, err := net.Dial("udp6", "[2001:500:2::c]:53"); err == nil {
ipv6 = true
conn.Close()
}
return
}
var routeCache struct {
sync.Once
sync.RWMutex
expire time.Time
ipv4, ipv6 bool
}
func checkRoutes() (bool, bool) {
if !isGUIPlatform {
routeCache.Once.Do(func() {
routeCache.ipv4, routeCache.ipv6 = probeRoutes()
})
return routeCache.ipv4, routeCache.ipv6
}
routeCache.RWMutex.RLock()
now := time.Now()
if routeCache.expire.After(now) {
routeCache.RWMutex.RUnlock()
return routeCache.ipv4, routeCache.ipv6
}
routeCache.RWMutex.RUnlock()
routeCache.RWMutex.Lock()
defer routeCache.RWMutex.Unlock()
now = time.Now()
if routeCache.expire.After(now) { // double-check
return routeCache.ipv4, routeCache.ipv6
}
routeCache.ipv4, routeCache.ipv6 = probeRoutes() // ~2ms
routeCache.expire = now.Add(100 * time.Millisecond) // ttl
return routeCache.ipv4, routeCache.ipv6
}
var isGUIPlatform = detectGUIPlatform()
func detectGUIPlatform() bool {
switch runtime.GOOS {
case "android", "ios", "windows", "darwin":
return true
case "linux", "freebsd", "openbsd":
if t := os.Getenv("XDG_SESSION_TYPE"); t == "wayland" || t == "x11" {
return true
}
if os.Getenv("DISPLAY") != "" || os.Getenv("WAYLAND_DISPLAY") != "" {
return true
}
}
return false
}

File diff suppressed because it is too large Load diff

View file

@ -1,263 +0,0 @@
package dns
import (
"context"
"encoding/binary"
"math"
"strings"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/core"
dns_feature "github.com/xtls/xray-core/features/dns"
"golang.org/x/net/dns/dnsmessage"
)
// Fqdn normalizes domain make sure it ends with '.'
// case-sensitive
func Fqdn(domain string) string {
if len(domain) > 0 && strings.HasSuffix(domain, ".") {
return domain
}
return domain + "."
}
type record struct {
A *IPRecord
AAAA *IPRecord
}
// IPRecord is a cacheable item for a resolved domain
type IPRecord struct {
ReqID uint16
IP []net.IP
Expire time.Time
RCode dnsmessage.RCode
RawHeader *dnsmessage.Header
}
func (r *IPRecord) getIPs() ([]net.IP, int32, error) {
if r == nil {
return nil, 0, errRecordNotFound
}
untilExpire := time.Until(r.Expire).Seconds()
ttl := int32(math.Ceil(untilExpire))
if r.RCode != dnsmessage.RCodeSuccess {
return nil, ttl, dns_feature.RCodeError(r.RCode)
}
if len(r.IP) == 0 {
return nil, ttl, dns_feature.ErrEmptyResponse
}
return r.IP, ttl, nil
}
var errRecordNotFound = errors.New("record not found")
type dnsRequest struct {
reqType dnsmessage.Type
domain string
start time.Time
expire time.Time
msg *dnsmessage.Message
}
func genEDNS0Options(clientIP net.IP, padding int) *dnsmessage.Resource {
if len(clientIP) == 0 && padding == 0 {
return nil
}
const EDNS0SUBNET = 0x8
const EDNS0PADDING = 0xc
opt := new(dnsmessage.Resource)
common.Must(opt.Header.SetEDNS0(1350, 0xfe00, true))
body := dnsmessage.OPTResource{}
opt.Body = &body
if len(clientIP) != 0 {
var netmask int
var family uint16
if len(clientIP) == 4 {
family = 1
netmask = 24 // 24 for IPV4, 96 for IPv6
} else {
family = 2
netmask = 96
}
b := make([]byte, 4)
binary.BigEndian.PutUint16(b[0:], family)
b[2] = byte(netmask)
b[3] = 0
switch family {
case 1:
ip := clientIP.To4().Mask(net.CIDRMask(netmask, net.IPv4len*8))
needLength := (netmask + 8 - 1) / 8 // division rounding up
b = append(b, ip[:needLength]...)
case 2:
ip := clientIP.Mask(net.CIDRMask(netmask, net.IPv6len*8))
needLength := (netmask + 8 - 1) / 8 // division rounding up
b = append(b, ip[:needLength]...)
}
body.Options = append(body.Options,
dnsmessage.Option{
Code: EDNS0SUBNET,
Data: b,
})
}
if padding != 0 {
body.Options = append(body.Options,
dnsmessage.Option{
Code: EDNS0PADDING,
Data: make([]byte, padding),
})
}
return opt
}
func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
qA := dnsmessage.Question{
Name: dnsmessage.MustNewName(domain),
Type: dnsmessage.TypeA,
Class: dnsmessage.ClassINET,
}
qAAAA := dnsmessage.Question{
Name: dnsmessage.MustNewName(domain),
Type: dnsmessage.TypeAAAA,
Class: dnsmessage.ClassINET,
}
var reqs []*dnsRequest
now := time.Now()
if option.IPv4Enable {
msg := new(dnsmessage.Message)
msg.Header.ID = reqIDGen()
msg.Header.RecursionDesired = true
msg.Questions = []dnsmessage.Question{qA}
if reqOpts != nil {
msg.Additionals = append(msg.Additionals, *reqOpts)
}
reqs = append(reqs, &dnsRequest{
reqType: dnsmessage.TypeA,
domain: domain,
start: now,
msg: msg,
})
}
if option.IPv6Enable {
msg := new(dnsmessage.Message)
msg.Header.ID = reqIDGen()
msg.Header.RecursionDesired = true
msg.Questions = []dnsmessage.Question{qAAAA}
if reqOpts != nil {
msg.Additionals = append(msg.Additionals, *reqOpts)
}
reqs = append(reqs, &dnsRequest{
reqType: dnsmessage.TypeAAAA,
domain: domain,
start: now,
msg: msg,
})
}
return reqs
}
// parseResponse parses DNS answers from the returned payload
func parseResponse(payload []byte) (*IPRecord, error) {
var parser dnsmessage.Parser
h, err := parser.Start(payload)
if err != nil {
return nil, errors.New("failed to parse DNS response").Base(err).AtWarning()
}
if err := parser.SkipAllQuestions(); err != nil {
return nil, errors.New("failed to skip questions in DNS response").Base(err).AtWarning()
}
now := time.Now()
ipRecord := &IPRecord{
ReqID: h.ID,
RCode: h.RCode,
Expire: now.Add(time.Second * dns_feature.DefaultTTL),
RawHeader: &h,
}
L:
for {
ah, err := parser.AnswerHeader()
if err != nil {
if err != dnsmessage.ErrSectionDone {
errors.LogInfoInner(context.Background(), err, "failed to parse answer section for domain: ", ah.Name.String())
}
break
}
ttl := ah.TTL
if ttl == 0 {
ttl = 1
}
expire := now.Add(time.Duration(ttl) * time.Second)
if ipRecord.Expire.After(expire) {
ipRecord.Expire = expire
}
switch ah.Type {
case dnsmessage.TypeA:
ans, err := parser.AResource()
if err != nil {
errors.LogInfoInner(context.Background(), err, "failed to parse A record for domain: ", ah.Name)
break L
}
ipRecord.IP = append(ipRecord.IP, net.IPAddress(ans.A[:]).IP())
case dnsmessage.TypeAAAA:
ans, err := parser.AAAAResource()
if err != nil {
errors.LogInfoInner(context.Background(), err, "failed to parse AAAA record for domain: ", ah.Name)
break L
}
newIP := net.IPAddress(ans.AAAA[:]).IP()
if len(newIP) == net.IPv6len {
ipRecord.IP = append(ipRecord.IP, newIP)
}
default:
if err := parser.SkipAnswer(); err != nil {
errors.LogInfoInner(context.Background(), err, "failed to skip answer")
break L
}
continue
}
}
return ipRecord, nil
}
// toDnsContext create a new background context with parent inbound, session and dns log
func toDnsContext(ctx context.Context, addr string) context.Context {
dnsCtx := core.ToBackgroundDetachedContext(ctx)
if inbound := session.InboundFromContext(ctx); inbound != nil {
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
}
dnsCtx = session.ContextWithContent(dnsCtx, session.ContentFromContext(ctx))
dnsCtx = log.ContextWithAccessMessage(dnsCtx, &log.AccessMessage{
From: "DNS",
To: addr,
Status: log.AccessAccepted,
Reason: "",
})
return dnsCtx
}

View file

@ -1,185 +0,0 @@
package dns
import (
"math/rand"
"testing"
"time"
"github.com/google/go-cmp/cmp"
"github.com/miekg/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
dns_feature "github.com/xtls/xray-core/features/dns"
"golang.org/x/net/dns/dnsmessage"
)
func Test_parseResponse(t *testing.T) {
var p [][]byte
ans := new(dns.Msg)
ans.Id = 0
p = append(p, common.Must2(ans.Pack()))
p = append(p, []byte{})
ans = new(dns.Msg)
ans.Id = 1
ans.Answer = append(ans.Answer,
common.Must2(dns.NewRR("google.com. IN CNAME m.test.google.com")),
common.Must2(dns.NewRR("google.com. IN CNAME fake.google.com")),
common.Must2(dns.NewRR("google.com. IN A 8.8.8.8")),
common.Must2(dns.NewRR("google.com. IN A 8.8.4.4")),
)
p = append(p, common.Must2(ans.Pack()))
ans = new(dns.Msg)
ans.Id = 2
ans.Answer = append(ans.Answer,
common.Must2(dns.NewRR("google.com. IN CNAME m.test.google.com")),
common.Must2(dns.NewRR("google.com. IN CNAME fake.google.com")),
common.Must2(dns.NewRR("google.com. IN CNAME m.test.google.com")),
common.Must2(dns.NewRR("google.com. IN CNAME test.google.com")),
common.Must2(dns.NewRR("google.com. IN AAAA 2001:4860:4860::8888")),
common.Must2(dns.NewRR("google.com. IN AAAA 2001:4860:4860::8844")),
)
p = append(p, common.Must2(ans.Pack()))
tests := []struct {
name string
want *IPRecord
wantErr bool
}{
{
"empty",
&IPRecord{0, []net.IP(nil), time.Time{}, dnsmessage.RCodeSuccess, nil},
false,
},
{
"error",
nil,
true,
},
{
"a record",
&IPRecord{
1,
[]net.IP{net.ParseIP("8.8.8.8"), net.ParseIP("8.8.4.4")},
time.Time{},
dnsmessage.RCodeSuccess,
nil,
},
false,
},
{
"aaaa record",
&IPRecord{2, []net.IP{net.ParseIP("2001:4860:4860::8888"), net.ParseIP("2001:4860:4860::8844")}, time.Time{}, dnsmessage.RCodeSuccess, nil},
false,
},
}
for i, tt := range tests {
t.Run(tt.name, func(t *testing.T) {
got, err := parseResponse(p[i])
if (err != nil) != tt.wantErr {
t.Errorf("handleResponse() error = %v, wantErr %v", err, tt.wantErr)
return
}
if got != nil {
// reset the time and RawHeader
got.Expire = time.Time{}
got.RawHeader = nil
}
if cmp.Diff(got, tt.want) != "" {
t.Error(cmp.Diff(got, tt.want))
// t.Errorf("handleResponse() = %#v, want %#v", got, tt.want)
}
})
}
}
func Test_buildReqMsgs(t *testing.T) {
stubID := func() uint16 {
return uint16(rand.Uint32())
}
type args struct {
domain string
option dns_feature.IPOption
reqOpts *dnsmessage.Resource
}
tests := []struct {
name string
args args
want int
}{
{"dual stack", args{"test.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
}, nil}, 2},
{"ipv4 only", args{"test.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: false,
FakeEnable: false,
}, nil}, 1},
{"ipv6 only", args{"test.com", dns_feature.IPOption{
IPv4Enable: false,
IPv6Enable: true,
FakeEnable: false,
}, nil}, 1},
{"none/error", args{"test.com", dns_feature.IPOption{
IPv4Enable: false,
IPv6Enable: false,
FakeEnable: false,
}, nil}, 0},
}
for _, tt := range tests {
t.Run(tt.name, func(t *testing.T) {
if got := buildReqMsgs(tt.args.domain, tt.args.option, stubID, tt.args.reqOpts); !(len(got) == tt.want) {
t.Errorf("buildReqMsgs() = %v, want %v", got, tt.want)
}
})
}
}
func Test_genEDNS0Options(t *testing.T) {
type args struct {
clientIP net.IP
}
tests := []struct {
name string
args args
want *dnsmessage.Resource
}{
// TODO: Add test cases.
{"ipv4", args{net.ParseIP("4.3.2.1")}, nil},
{"ipv6", args{net.ParseIP("2001::4321")}, nil},
}
for _, tt := range tests {
t.Run(tt.name, func(t *testing.T) {
if got := genEDNS0Options(tt.args.clientIP, 0); got == nil {
t.Errorf("genEDNS0Options() = %v, want %v", got, tt.want)
}
})
}
}
func TestFqdn(t *testing.T) {
type args struct {
domain string
}
tests := []struct {
name string
args args
want string
}{
{"with fqdn", args{"www.example.com."}, "www.example.com."},
{"without fqdn", args{"www.example.com"}, "www.example.com."},
}
for _, tt := range tests {
t.Run(tt.name, func(t *testing.T) {
if got := Fqdn(tt.args.domain); got != tt.want {
t.Errorf("Fqdn() = %v, want %v", got, tt.want)
}
})
}
}

View file

@ -1,250 +0,0 @@
package fakedns
import (
"context"
"math"
"math/big"
"sync"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/cache"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
type Holder struct {
domainToIP cache.Lru
ipRange *net.IPNet
mu *sync.Mutex
config *FakeDnsPool
}
func (fkdns *Holder) IsIPInIPPool(ip net.Address) bool {
if ip.Family().IsDomain() {
return false
}
return fkdns.ipRange.Contains(ip.IP())
}
func (fkdns *Holder) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
isIPv6 := fkdns.ipRange.IP.To4() == nil
if (isIPv6 && ipv6) || (!isIPv6 && ipv4) {
return fkdns.GetFakeIPForDomain(domain)
}
return []net.Address{}
}
func (*Holder) Type() interface{} {
return (*dns.FakeDNSEngine)(nil)
}
func (fkdns *Holder) Start() error {
if fkdns.config != nil && fkdns.config.IpPool != "" && fkdns.config.LruSize != 0 {
return fkdns.initializeFromConfig()
}
return errors.New("invalid fakeDNS setting")
}
func (fkdns *Holder) Close() error {
fkdns.domainToIP = nil
fkdns.ipRange = nil
fkdns.mu = nil
return nil
}
func NewFakeDNSHolder() (*Holder, error) {
var fkdns *Holder
var err error
if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
return nil, errors.New("Unable to create Fake Dns Engine").Base(err).AtError()
}
err = fkdns.initialize(dns.FakeIPv4Pool, 65535)
if err != nil {
return nil, err
}
return fkdns, nil
}
func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
return &Holder{nil, nil, nil, conf}, nil
}
func (fkdns *Holder) initializeFromConfig() error {
return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
}
func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
var ipRange *net.IPNet
var err error
if _, ipRange, err = net.ParseCIDR(ipPoolCidr); err != nil {
return errors.New("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
}
ones, bits := ipRange.Mask.Size()
rooms := bits - ones
if math.Log2(float64(lruSize)) >= float64(rooms) {
return errors.New("LRU size is bigger than subnet size").AtError()
}
fkdns.domainToIP = cache.NewLru(lruSize)
fkdns.ipRange = ipRange
fkdns.mu = new(sync.Mutex)
return nil
}
// GetFakeIPForDomain checks and generates a fake IP for a domain name
func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
fkdns.mu.Lock()
defer fkdns.mu.Unlock()
if v, ok := fkdns.domainToIP.Get(domain); ok {
return []net.Address{v.(net.Address)}
}
currentTimeMillis := uint64(time.Now().UnixNano() / 1e6)
ones, bits := fkdns.ipRange.Mask.Size()
rooms := bits - ones
if rooms < 64 {
currentTimeMillis %= (uint64(1) << rooms)
}
bigIntIP := big.NewInt(0).SetBytes(fkdns.ipRange.IP)
bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
var ip net.Address
for {
ip = net.IPAddress(bigIntIP.Bytes())
// if we run for a long time, we may go back to beginning and start seeing the IP in use
if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
break
}
bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
}
}
fkdns.domainToIP.Put(domain, ip)
return []net.Address{ip}
}
// GetDomainFromFakeDNS checks if an IP is a fake IP and have corresponding domain name
func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
return ""
}
if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
return k.(string)
}
errors.LogInfo(context.Background(), "A fake ip request to ", ip, ", however there is no matching domain name in fake DNS")
return ""
}
type HolderMulti struct {
holders []*Holder
config *FakeDnsPoolMulti
}
func (h *HolderMulti) IsIPInIPPool(ip net.Address) bool {
if ip.Family().IsDomain() {
return false
}
for _, v := range h.holders {
if v.IsIPInIPPool(ip) {
return true
}
}
return false
}
func (h *HolderMulti) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
var ret []net.Address
for _, v := range h.holders {
ret = append(ret, v.GetFakeIPForDomain3(domain, ipv4, ipv6)...)
}
return ret
}
func (h *HolderMulti) GetFakeIPForDomain(domain string) []net.Address {
var ret []net.Address
for _, v := range h.holders {
ret = append(ret, v.GetFakeIPForDomain(domain)...)
}
return ret
}
func (h *HolderMulti) GetDomainFromFakeDNS(ip net.Address) string {
for _, v := range h.holders {
if domain := v.GetDomainFromFakeDNS(ip); domain != "" {
return domain
}
}
return ""
}
func (h *HolderMulti) Type() interface{} {
return (*dns.FakeDNSEngine)(nil)
}
func (h *HolderMulti) Start() error {
for _, v := range h.holders {
if v.config != nil && v.config.IpPool != "" && v.config.LruSize != 0 {
if err := v.Start(); err != nil {
return errors.New("Cannot start all fake dns pools").Base(err)
}
} else {
return errors.New("invalid fakeDNS setting")
}
}
return nil
}
func (h *HolderMulti) Close() error {
for _, v := range h.holders {
if err := v.Close(); err != nil {
return errors.New("Cannot close all fake dns pools").Base(err)
}
}
return nil
}
func (h *HolderMulti) createHolderGroups() error {
for _, v := range h.config.Pools {
holder, err := NewFakeDNSHolderConfigOnly(v)
if err != nil {
return err
}
h.holders = append(h.holders, holder)
}
return nil
}
func NewFakeDNSHolderMulti(conf *FakeDnsPoolMulti) (*HolderMulti, error) {
holderMulti := &HolderMulti{nil, conf}
if err := holderMulti.createHolderGroups(); err != nil {
return nil, err
}
return holderMulti, nil
}
func init() {
common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
var f *Holder
var err error
if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
return nil, err
}
return f, nil
}))
common.Must(common.RegisterConfig((*FakeDnsPoolMulti)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
var f *HolderMulti
var err error
if f, err = NewFakeDNSHolderMulti(config.(*FakeDnsPoolMulti)); err != nil {
return nil, err
}
return f, nil
}))
}

View file

@ -1 +0,0 @@
package fakedns

View file

@ -1,180 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/dns/fakedns/fakedns.proto
package fakedns
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type FakeDnsPool struct {
state protoimpl.MessageState `protogen:"open.v1"`
IpPool string `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
LruSize int64 `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"` //Size of Pool for remembering relationship between domain name and IP address
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *FakeDnsPool) Reset() {
*x = FakeDnsPool{}
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *FakeDnsPool) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*FakeDnsPool) ProtoMessage() {}
func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
func (*FakeDnsPool) Descriptor() ([]byte, []int) {
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
}
func (x *FakeDnsPool) GetIpPool() string {
if x != nil {
return x.IpPool
}
return ""
}
func (x *FakeDnsPool) GetLruSize() int64 {
if x != nil {
return x.LruSize
}
return 0
}
type FakeDnsPoolMulti struct {
state protoimpl.MessageState `protogen:"open.v1"`
Pools []*FakeDnsPool `protobuf:"bytes,1,rep,name=pools,proto3" json:"pools,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *FakeDnsPoolMulti) Reset() {
*x = FakeDnsPoolMulti{}
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *FakeDnsPoolMulti) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*FakeDnsPoolMulti) ProtoMessage() {}
func (x *FakeDnsPoolMulti) ProtoReflect() protoreflect.Message {
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use FakeDnsPoolMulti.ProtoReflect.Descriptor instead.
func (*FakeDnsPoolMulti) Descriptor() ([]byte, []int) {
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{1}
}
func (x *FakeDnsPoolMulti) GetPools() []*FakeDnsPool {
if x != nil {
return x.Pools
}
return nil
}
var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
const file_app_dns_fakedns_fakedns_proto_rawDesc = "" +
"\n" +
"\x1dapp/dns/fakedns/fakedns.proto\x12\x14xray.app.dns.fakedns\"@\n" +
"\vFakeDnsPool\x12\x17\n" +
"\aip_pool\x18\x01 \x01(\tR\x06ipPool\x12\x18\n" +
"\alruSize\x18\x02 \x01(\x03R\alruSize\"K\n" +
"\x10FakeDnsPoolMulti\x127\n" +
"\x05pools\x18\x01 \x03(\v2!.xray.app.dns.fakedns.FakeDnsPoolR\x05poolsB^\n" +
"\x18com.xray.app.dns.fakednsP\x01Z)github.com/xtls/xray-core/app/dns/fakedns\xaa\x02\x14Xray.App.Dns.Fakednsb\x06proto3"
var (
file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
file_app_dns_fakedns_fakedns_proto_rawDescData []byte
)
func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_dns_fakedns_fakedns_proto_rawDesc), len(file_app_dns_fakedns_fakedns_proto_rawDesc)))
})
return file_app_dns_fakedns_fakedns_proto_rawDescData
}
var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
var file_app_dns_fakedns_fakedns_proto_goTypes = []any{
(*FakeDnsPool)(nil), // 0: xray.app.dns.fakedns.FakeDnsPool
(*FakeDnsPoolMulti)(nil), // 1: xray.app.dns.fakedns.FakeDnsPoolMulti
}
var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
0, // 0: xray.app.dns.fakedns.FakeDnsPoolMulti.pools:type_name -> xray.app.dns.fakedns.FakeDnsPool
1, // [1:1] is the sub-list for method output_type
1, // [1:1] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_dns_fakedns_fakedns_proto_init() }
func file_app_dns_fakedns_fakedns_proto_init() {
if File_app_dns_fakedns_fakedns_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_dns_fakedns_fakedns_proto_rawDesc), len(file_app_dns_fakedns_fakedns_proto_rawDesc)),
NumEnums: 0,
NumMessages: 2,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_dns_fakedns_fakedns_proto_goTypes,
DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
MessageInfos: file_app_dns_fakedns_fakedns_proto_msgTypes,
}.Build()
File_app_dns_fakedns_fakedns_proto = out.File
file_app_dns_fakedns_fakedns_proto_goTypes = nil
file_app_dns_fakedns_fakedns_proto_depIdxs = nil
}

View file

@ -1,16 +0,0 @@
syntax = "proto3";
package xray.app.dns.fakedns;
option csharp_namespace = "Xray.App.Dns.Fakedns";
option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
option java_package = "com.xray.app.dns.fakedns";
option java_multiple_files = true;
message FakeDnsPool{
string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
int64 lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
}
message FakeDnsPoolMulti{
repeated FakeDnsPool pools = 1;
}

View file

@ -1,205 +0,0 @@
package fakedns
import (
"strconv"
"testing"
"github.com/stretchr/testify/assert"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/uuid"
"github.com/xtls/xray-core/features/dns"
"golang.org/x/sync/errgroup"
)
var ipPrefix = "198.1"
func TestNewFakeDnsHolder(_ *testing.T) {
_, err := NewFakeDNSHolder()
common.Must(err)
}
func TestFakeDnsHolderCreateMapping(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
}
func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
}
func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
{
result := fkdns.GetDomainFromFakeDNS(addr[0])
assert.Equal(t, "fakednstest.example.com", result)
}
{
result := fkdns.GetDomainFromFakeDNS(addr2[0])
assert.Equal(t, "fakednstest2.example.com", result)
}
}
func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
}
func TestGetFakeIPForDomainConcurrently(t *testing.T) {
fkdns, err := NewFakeDNSHolder()
common.Must(err)
total := 200
addr := make([][]net.Address, total)
var errg errgroup.Group
for i := 0; i < total; i++ {
errg.Go(testGetFakeIP(i, addr, fkdns))
}
errg.Wait()
for i := 0; i < total; i++ {
for j := i + 1; j < total; j++ {
assert.NotEqual(t, addr[i][0].IP().String(), addr[j][0].IP().String())
}
}
}
func testGetFakeIP(index int, addr [][]net.Address, fkdns *Holder) func() error {
return func() error {
addr[index] = fkdns.GetFakeIPForDomain("fakednstest" + strconv.Itoa(index) + ".example.com")
return nil
}
}
func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
IpPool: dns.FakeIPv4Pool,
LruSize: 256,
})
common.Must(err)
err = fkdns.Start()
common.Must(err)
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
for i := 0; i <= 8192; i++ {
{
result := fkdns.GetDomainFromFakeDNS(addr[0])
assert.Equal(t, "fakednstest.example.com", result)
}
{
result := fkdns.GetDomainFromFakeDNS(addr2[0])
assert.Equal(t, "fakednstest2.example.com", result)
}
{
uuid := uuid.New()
domain := uuid.String() + ".fakednstest.example.com"
tempAddr := fkdns.GetFakeIPForDomain(domain)
rsaddr := tempAddr[0].IP().String()
result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
assert.Equal(t, domain, result)
}
}
}
func TestFakeDNSMulti(t *testing.T) {
fakeMulti, err := NewFakeDNSHolderMulti(&FakeDnsPoolMulti{
Pools: []*FakeDnsPool{{
IpPool: "240.0.0.0/12",
LruSize: 256,
}, {
IpPool: "fddd:c5b4:ff5f:f4f0::/64",
LruSize: 256,
}},
},
)
common.Must(err)
err = fakeMulti.Start()
common.Must(err)
assert.Nil(t, err, "Should not throw error")
_ = fakeMulti
t.Run("checkInRange", func(t *testing.T) {
t.Run("ipv4", func(t *testing.T) {
inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{240, 0, 0, 5}))
assert.True(t, inPool)
})
t.Run("ipv6", func(t *testing.T) {
ip, err := net.ResolveIPAddr("ip", "fddd:c5b4:ff5f:f4f0::5")
assert.Nil(t, err)
inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
assert.True(t, inPool)
})
t.Run("ipv4_inverse", func(t *testing.T) {
inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{241, 0, 0, 5}))
assert.False(t, inPool)
})
t.Run("ipv6_inverse", func(t *testing.T) {
ip, err := net.ResolveIPAddr("ip", "fcdd:c5b4:ff5f:f4f0::5")
assert.Nil(t, err)
inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
assert.False(t, inPool)
})
})
t.Run("allocateTwoAddressForTwoPool", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain("fakednstest.example.com")
assert.Len(t, address, 2, "should be 2 address one for each pool")
t.Run("eachOfThemShouldResolve:0", func(t *testing.T) {
domain := fakeMulti.GetDomainFromFakeDNS(address[0])
assert.Equal(t, "fakednstest.example.com", domain)
})
t.Run("eachOfThemShouldResolve:1", func(t *testing.T) {
domain := fakeMulti.GetDomainFromFakeDNS(address[1])
assert.Equal(t, "fakednstest.example.com", domain)
})
})
t.Run("understandIPTypeSelector", func(t *testing.T) {
t.Run("ipv4", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv4.example.com", true, false)
assert.Len(t, address, 1, "should be 1 address")
assert.True(t, address[0].Family().IsIPv4())
})
t.Run("ipv6", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv6.example.com", false, true)
assert.Len(t, address, 1, "should be 1 address")
assert.True(t, address[0].Family().IsIPv6())
})
t.Run("ipv46", func(t *testing.T) {
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv46.example.com", true, true)
assert.Len(t, address, 2, "should be 2 address")
assert.True(t, address[0].Family().IsIPv4())
assert.True(t, address[1].Family().IsIPv6())
})
})
}

View file

@ -1,173 +0,0 @@
package dns
import (
"context"
"runtime"
"strconv"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/features/dns"
)
// StaticHosts represents static domain-ip mapping in DNS server.
type StaticHosts struct {
ips [][]net.Address
matchers strmatcher.IndexMatcher
}
// NewStaticHosts creates a new StaticHosts instance.
func NewStaticHosts(hosts []*Config_HostMapping) (*StaticHosts, error) {
g := new(strmatcher.MatcherGroup)
sh := &StaticHosts{
ips: make([][]net.Address, len(hosts)+16),
matchers: g,
}
defer runtime.GC()
for i, mapping := range hosts {
hosts[i] = nil
matcher, err := toStrMatcher(mapping.Type, mapping.Domain)
if err != nil {
errors.LogErrorInner(context.Background(), err, "failed to create domain matcher, ignore domain rule [type: ", mapping.Type, ", domain: ", mapping.Domain, "]")
continue
}
id := g.Add(matcher)
ips := make([]net.Address, 0, len(mapping.Ip)+1)
switch {
case len(mapping.ProxiedDomain) > 0:
if mapping.ProxiedDomain[0] == '#' {
rcode, err := strconv.Atoi(mapping.ProxiedDomain[1:])
if err != nil {
return nil, err
}
ips = append(ips, dns.RCodeError(rcode))
} else {
ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
}
case len(mapping.Ip) > 0:
for _, ip := range mapping.Ip {
addr := net.IPAddress(ip)
if addr == nil {
errors.LogError(context.Background(), "invalid IP address in static hosts: ", ip, ", ignore this ip for rule [type: ", mapping.Type, ", domain: ", mapping.Domain, "]")
continue
}
ips = append(ips, addr)
}
if len(ips) == 0 {
continue
}
}
sh.ips[id] = ips
}
return sh, nil
}
func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
filtered := make([]net.Address, 0, len(ips))
for _, ip := range ips {
if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
filtered = append(filtered, ip)
}
}
return filtered
}
func (h *StaticHosts) lookupInternal(domain string) ([]net.Address, error) {
ips := make([]net.Address, 0)
found := false
for _, id := range h.matchers.Match(domain) {
for _, v := range h.ips[id] {
if err, ok := v.(dns.RCodeError); ok {
if uint16(err) == 0 {
return nil, dns.ErrEmptyResponse
}
return nil, err
}
}
ips = append(ips, h.ips[id]...)
found = true
}
if !found {
return nil, nil
}
return ips, nil
}
func (h *StaticHosts) lookup(domain string, option dns.IPOption, maxDepth int) ([]net.Address, error) {
switch addrs, err := h.lookupInternal(domain); {
case err != nil:
return nil, err
case len(addrs) == 0: // Not recorded in static hosts, return nil
return addrs, nil
case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Try to unwrap domain
errors.LogDebug(context.Background(), "found replaced domain: ", domain, " -> ", addrs[0].Domain(), ". Try to unwrap it")
if maxDepth > 0 {
unwrapped, err := h.lookup(addrs[0].Domain(), option, maxDepth-1)
if err != nil {
return nil, err
}
if unwrapped != nil {
return unwrapped, nil
}
}
return addrs, nil
default: // IP record found, return a non-nil IP array
return filterIP(addrs, option), nil
}
}
// Lookup returns IP addresses or proxied domain for the given domain, if exists in this StaticHosts.
func (h *StaticHosts) Lookup(domain string, option dns.IPOption) ([]net.Address, error) {
return h.lookup(domain, option, 5)
}
func NewStaticHostsFromCache(matcher strmatcher.IndexMatcher, hostIPs map[string][]string) (*StaticHosts, error) {
sh := &StaticHosts{
ips: make([][]net.Address, matcher.Size()+1),
matchers: matcher,
}
order := hostIPs["_ORDER"]
var offset uint32
img, ok := matcher.(*strmatcher.IndexMatcherGroup)
if !ok {
// Single matcher (e.g. only manual or only one geosite)
if len(order) > 0 {
pattern := order[0]
ips := parseIPs(hostIPs[pattern])
for i := uint32(1); i <= matcher.Size(); i++ {
sh.ips[i] = ips
}
}
return sh, nil
}
for i, m := range img.Matchers {
if i < len(order) {
pattern := order[i]
ips := parseIPs(hostIPs[pattern])
for j := uint32(1); j <= m.Size(); j++ {
sh.ips[offset+j] = ips
}
offset += m.Size()
}
}
return sh, nil
}
func parseIPs(raw []string) []net.Address {
addrs := make([]net.Address, 0, len(raw))
for _, s := range raw {
if len(s) > 1 && s[0] == '#' {
rcode, _ := strconv.Atoi(s[1:])
addrs = append(addrs, dns.RCodeError(rcode))
} else {
addrs = append(addrs, net.ParseAddress(s))
}
}
return addrs
}

View file

@ -1,188 +0,0 @@
package dns_test
import (
"bytes"
"testing"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
func TestStaticHosts(t *testing.T) {
pb := []*Config_HostMapping{
{
Type: DomainMatchingType_Subdomain,
Domain: "lan",
ProxiedDomain: "#3",
},
{
Type: DomainMatchingType_Full,
Domain: "example.com",
Ip: [][]byte{
{1, 1, 1, 1},
},
},
{
Type: DomainMatchingType_Full,
Domain: "proxy.xray.com",
Ip: [][]byte{
{1, 2, 3, 4},
{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
},
ProxiedDomain: "another-proxy.xray.com",
},
{
Type: DomainMatchingType_Full,
Domain: "proxy2.xray.com",
ProxiedDomain: "proxy.xray.com",
},
{
Type: DomainMatchingType_Subdomain,
Domain: "example.cn",
Ip: [][]byte{
{2, 2, 2, 2},
},
},
{
Type: DomainMatchingType_Subdomain,
Domain: "baidu.com",
Ip: [][]byte{
{127, 0, 0, 1},
{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
},
},
}
hosts, err := NewStaticHosts(pb)
common.Must(err)
{
_, err := hosts.Lookup("example.com.lan", dns.IPOption{})
if dns.RCodeFromError(err) != 3 {
t.Error(err)
}
}
{
ips, _ := hosts.Lookup("example.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
if len(ips) != 1 {
t.Error("expect 1 IP, but got ", len(ips))
}
if diff := cmp.Diff([]byte(ips[0].IP()), []byte{1, 1, 1, 1}); diff != "" {
t.Error(diff)
}
}
{
domain, _ := hosts.Lookup("proxy.xray.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
if len(domain) != 1 {
t.Error("expect 1 domain, but got ", len(domain))
}
if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
t.Error(diff)
}
}
{
domain, _ := hosts.Lookup("proxy2.xray.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
if len(domain) != 1 {
t.Error("expect 1 domain, but got ", len(domain))
}
if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
t.Error(diff)
}
}
{
ips, _ := hosts.Lookup("www.example.cn", dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
if len(ips) != 1 {
t.Error("expect 1 IP, but got ", len(ips))
}
if diff := cmp.Diff([]byte(ips[0].IP()), []byte{2, 2, 2, 2}); diff != "" {
t.Error(diff)
}
}
{
ips, _ := hosts.Lookup("baidu.com", dns.IPOption{
IPv4Enable: false,
IPv6Enable: true,
})
if len(ips) != 1 {
t.Error("expect 1 IP, but got ", len(ips))
}
if diff := cmp.Diff([]byte(ips[0].IP()), []byte(net.LocalHostIPv6.IP())); diff != "" {
t.Error(diff)
}
}
}
func TestStaticHostsFromCache(t *testing.T) {
sites := []*router.GeoSite{
{
CountryCode: "cloudflare-dns.com",
Domain: []*router.Domain{
{Type: router.Domain_Full, Value: "example.com"},
},
},
{
CountryCode: "geosite:cn",
Domain: []*router.Domain{
{Type: router.Domain_Domain, Value: "baidu.cn"},
},
},
}
deps := map[string][]string{
"HOSTS": {"cloudflare-dns.com", "geosite:cn"},
}
hostIPs := map[string][]string{
"cloudflare-dns.com": {"1.1.1.1"},
"geosite:cn": {"2.2.2.2"},
"_ORDER": {"cloudflare-dns.com", "geosite:cn"},
}
var buf bytes.Buffer
err := router.SerializeGeoSiteList(sites, deps, hostIPs, &buf)
common.Must(err)
// Load matcher
m, err := router.LoadGeoSiteMatcher(bytes.NewReader(buf.Bytes()), "HOSTS")
common.Must(err)
// Load hostIPs
f := bytes.NewReader(buf.Bytes())
hips, err := router.LoadGeoSiteHosts(f)
common.Must(err)
hosts, err := NewStaticHostsFromCache(m, hips)
common.Must(err)
{
ips, _ := hosts.Lookup("example.com", dns.IPOption{IPv4Enable: true})
if len(ips) != 1 || ips[0].String() != "1.1.1.1" {
t.Error("failed to lookup example.com from cache")
}
}
{
ips, _ := hosts.Lookup("baidu.cn", dns.IPOption{IPv4Enable: true})
if len(ips) != 1 || ips[0].String() != "2.2.2.2" {
t.Error("failed to lookup baidu.cn from cache deps")
}
}
}

View file

@ -1,342 +0,0 @@
package dns
import (
"context"
"net/url"
"runtime"
"strings"
"time"
"github.com/xtls/xray-core/app/router"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/platform"
"github.com/xtls/xray-core/common/platform/filesystem"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/strmatcher"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/routing"
)
type mphMatcherWrapper struct {
m strmatcher.IndexMatcher
}
func (w *mphMatcherWrapper) Match(s string) bool {
return w.m.Match(s) != nil
}
func (w *mphMatcherWrapper) String() string {
return "mph-matcher"
}
// Server is the interface for Name Server.
type Server interface {
// Name of the Client.
Name() string
IsDisableCache() bool
// QueryIP sends IP queries to its configured server.
QueryIP(ctx context.Context, domain string, option dns.IPOption) ([]net.IP, uint32, error)
}
// Client is the interface for DNS client.
type Client struct {
server Server
skipFallback bool
domains []string
expectedIPs router.GeoIPMatcher
unexpectedIPs router.GeoIPMatcher
actPrior bool
actUnprior bool
tag string
timeoutMs time.Duration
finalQuery bool
ipOption *dns.IPOption
checkSystem bool
policyID uint32
}
// NewServer creates a name server object according to the network destination url.
func NewServer(ctx context.Context, dest net.Destination, dispatcher routing.Dispatcher, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (Server, error) {
if address := dest.Address; address.Family().IsDomain() {
u, err := url.Parse(address.Domain())
if err != nil {
return nil, err
}
switch {
case strings.EqualFold(u.String(), "localhost"):
return NewLocalNameServer(), nil
case strings.EqualFold(u.Scheme, "https"): // DNS-over-HTTPS Remote mode
return NewDoHNameServer(u, dispatcher, false, disableCache, serveStale, serveExpiredTTL, clientIP), nil
case strings.EqualFold(u.Scheme, "h2c"): // DNS-over-HTTPS h2c Remote mode
return NewDoHNameServer(u, dispatcher, true, disableCache, serveStale, serveExpiredTTL, clientIP), nil
case strings.EqualFold(u.Scheme, "https+local"): // DNS-over-HTTPS Local mode
return NewDoHNameServer(u, nil, false, disableCache, serveStale, serveExpiredTTL, clientIP), nil
case strings.EqualFold(u.Scheme, "h2c+local"): // DNS-over-HTTPS h2c Local mode
return NewDoHNameServer(u, nil, true, disableCache, serveStale, serveExpiredTTL, clientIP), nil
case strings.EqualFold(u.Scheme, "quic+local"): // DNS-over-QUIC Local mode
return NewQUICNameServer(u, disableCache, serveStale, serveExpiredTTL, clientIP)
case strings.EqualFold(u.Scheme, "tcp"): // DNS-over-TCP Remote mode
return NewTCPNameServer(u, dispatcher, disableCache, serveStale, serveExpiredTTL, clientIP)
case strings.EqualFold(u.Scheme, "tcp+local"): // DNS-over-TCP Local mode
return NewTCPLocalNameServer(u, disableCache, serveStale, serveExpiredTTL, clientIP)
case strings.EqualFold(u.String(), "fakedns"):
var fd dns.FakeDNSEngine
err = core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
fd = fdns
})
if err != nil {
return nil, err
}
return NewFakeDNSServer(fd), nil
}
}
if dest.Network == net.Network_Unknown {
dest.Network = net.Network_UDP
}
if dest.Network == net.Network_UDP { // UDP classic DNS mode
return NewClassicNameServer(dest, dispatcher, disableCache, serveStale, serveExpiredTTL, clientIP), nil
}
return nil, errors.New("No available name server could be created from ", dest).AtWarning()
}
// NewClient creates a DNS client managing a name server with client IP, domain rules and expected IPs.
func NewClient(
ctx context.Context,
ns *NameServer,
clientIP net.IP,
disableCache bool, serveStale bool, serveExpiredTTL uint32,
tag string,
ipOption dns.IPOption,
matcherInfos *[]*DomainMatcherInfo,
updateDomainRule func(strmatcher.Matcher, int, []*DomainMatcherInfo),
) (*Client, error) {
client := &Client{}
err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
// Create a new server for each client for now
server, err := NewServer(ctx, ns.Address.AsDestination(), dispatcher, disableCache, serveStale, serveExpiredTTL, clientIP)
if err != nil {
return errors.New("failed to create nameserver").Base(err).AtWarning()
}
// Prioritize local domains with specific TLDs or those without any dot for the local DNS
if _, isLocalDNS := server.(*LocalNameServer); isLocalDNS {
ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
ns.OriginalRules = append(ns.OriginalRules, localTLDsAndDotlessDomainsRule)
// The following lines is a solution to avoid core panicsrule index out of range when setting `localhost` DNS client in config.
// Because the `localhost` DNS client will append len(localTLDsAndDotlessDomains) rules into matcherInfos to match `geosite:private` default rule.
// But `matcherInfos` has no enough length to add rules, which leads to core panics (rule index out of range).
// To avoid this, the length of `matcherInfos` must be equal to the expected, so manually append it with Golang default zero value first for later modification.
// Related issues:
// https://github.com/v2fly/v2ray-core/issues/529
// https://github.com/v2fly/v2ray-core/issues/719
for i := 0; i < len(localTLDsAndDotlessDomains); i++ {
*matcherInfos = append(*matcherInfos, &DomainMatcherInfo{
clientIdx: uint16(0),
domainRuleIdx: uint16(0),
})
}
}
// Establish domain rules
var rules []string
ruleCurr := 0
ruleIter := 0
// Check if domain matcher cache is provided via environment
domainMatcherPath := platform.NewEnvFlag(platform.MphCachePath).GetValue(func() string { return "" })
var mphLoaded bool
if domainMatcherPath != "" && ns.Tag != "" {
f, err := filesystem.NewFileReader(domainMatcherPath)
if err == nil {
defer f.Close()
g, err := router.LoadGeoSiteMatcher(f, ns.Tag)
if err == nil {
errors.LogDebug(ctx, "MphDomainMatcher loaded from cache for ", ns.Tag, " dns tag)")
updateDomainRule(&mphMatcherWrapper{m: g}, 0, *matcherInfos)
rules = append(rules, "[MPH Cache]")
mphLoaded = true
}
}
}
if !mphLoaded {
for i, domain := range ns.PrioritizedDomain {
ns.PrioritizedDomain[i] = nil
domainRule, err := toStrMatcher(domain.Type, domain.Domain)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to create domain matcher, ignore domain rule [type: ", domain.Type, ", domain: ", domain.Domain, "]")
domainRule, _ = toStrMatcher(DomainMatchingType_Full, "hack.fix.index.for.illegal.domain.rule")
}
originalRuleIdx := ruleCurr
if ruleCurr < len(ns.OriginalRules) {
rule := ns.OriginalRules[ruleCurr]
if ruleCurr >= len(rules) {
rules = append(rules, rule.Rule)
}
ruleIter++
if ruleIter >= int(rule.Size) {
ruleIter = 0
ruleCurr++
}
} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
rules = append(rules, domainRule.String())
ruleCurr++
}
updateDomainRule(domainRule, originalRuleIdx, *matcherInfos)
}
}
ns.PrioritizedDomain = nil
runtime.GC()
// Establish expected IPs
var expectedMatcher router.GeoIPMatcher
if len(ns.ExpectedGeoip) > 0 {
expectedMatcher, err = router.BuildOptimizedGeoIPMatcher(ns.ExpectedGeoip...)
if err != nil {
return errors.New("failed to create expected ip matcher").Base(err).AtWarning()
}
ns.ExpectedGeoip = nil
runtime.GC()
}
// Establish unexpected IPs
var unexpectedMatcher router.GeoIPMatcher
if len(ns.UnexpectedGeoip) > 0 {
unexpectedMatcher, err = router.BuildOptimizedGeoIPMatcher(ns.UnexpectedGeoip...)
if err != nil {
return errors.New("failed to create unexpected ip matcher").Base(err).AtWarning()
}
ns.UnexpectedGeoip = nil
runtime.GC()
}
if len(clientIP) > 0 {
switch ns.Address.Address.GetAddress().(type) {
case *net.IPOrDomain_Domain:
errors.LogInfo(ctx, "DNS: client ", ns.Address.Address.GetDomain(), " uses clientIP ", clientIP.String())
case *net.IPOrDomain_Ip:
errors.LogInfo(ctx, "DNS: client ", net.IP(ns.Address.Address.GetIp()), " uses clientIP ", clientIP.String())
}
}
var timeoutMs = 4000 * time.Millisecond
if ns.TimeoutMs > 0 {
timeoutMs = time.Duration(ns.TimeoutMs) * time.Millisecond
}
checkSystem := ns.QueryStrategy == QueryStrategy_USE_SYS
client.server = server
client.skipFallback = ns.SkipFallback
client.domains = rules
client.expectedIPs = expectedMatcher
client.unexpectedIPs = unexpectedMatcher
client.actPrior = ns.ActPrior
client.actUnprior = ns.ActUnprior
client.tag = tag
client.timeoutMs = timeoutMs
client.finalQuery = ns.FinalQuery
client.ipOption = &ipOption
client.checkSystem = checkSystem
client.policyID = ns.PolicyID
return nil
})
return client, err
}
// Name returns the server name the client manages.
func (c *Client) Name() string {
return c.server.Name()
}
// QueryIP sends DNS query to the name server with the client's IP.
func (c *Client) QueryIP(ctx context.Context, domain string, option dns.IPOption) ([]net.IP, uint32, error) {
if c.checkSystem {
supportIPv4, supportIPv6 := checkRoutes()
option.IPv4Enable = option.IPv4Enable && supportIPv4
option.IPv6Enable = option.IPv6Enable && supportIPv6
} else {
option.IPv4Enable = option.IPv4Enable && c.ipOption.IPv4Enable
option.IPv6Enable = option.IPv6Enable && c.ipOption.IPv6Enable
}
if !option.IPv4Enable && !option.IPv6Enable {
return nil, 0, dns.ErrEmptyResponse
}
ctx, cancel := context.WithTimeout(ctx, c.timeoutMs)
ctx = session.ContextWithInbound(ctx, &session.Inbound{Tag: c.tag})
ips, ttl, err := c.server.QueryIP(ctx, domain, option)
cancel()
if err != nil {
return nil, 0, err
}
if len(ips) == 0 {
return nil, 0, dns.ErrEmptyResponse
}
if c.expectedIPs != nil && !c.actPrior {
ips, _ = c.expectedIPs.FilterIPs(ips)
errors.LogDebug(context.Background(), "domain ", domain, " expectedIPs ", ips, " matched at server ", c.Name())
if len(ips) == 0 {
return nil, 0, dns.ErrEmptyResponse
}
}
if c.unexpectedIPs != nil && !c.actUnprior {
_, ips = c.unexpectedIPs.FilterIPs(ips)
errors.LogDebug(context.Background(), "domain ", domain, " unexpectedIPs ", ips, " matched at server ", c.Name())
if len(ips) == 0 {
return nil, 0, dns.ErrEmptyResponse
}
}
if c.expectedIPs != nil && c.actPrior {
ipsNew, _ := c.expectedIPs.FilterIPs(ips)
if len(ipsNew) > 0 {
ips = ipsNew
errors.LogDebug(context.Background(), "domain ", domain, " priorIPs ", ips, " matched at server ", c.Name())
}
}
if c.unexpectedIPs != nil && c.actUnprior {
_, ipsNew := c.unexpectedIPs.FilterIPs(ips)
if len(ipsNew) > 0 {
ips = ipsNew
errors.LogDebug(context.Background(), "domain ", domain, " unpriorIPs ", ips, " matched at server ", c.Name())
}
}
return ips, ttl, nil
}
func ResolveIpOptionOverride(queryStrategy QueryStrategy, ipOption dns.IPOption) dns.IPOption {
switch queryStrategy {
case QueryStrategy_USE_IP:
return ipOption
case QueryStrategy_USE_SYS:
return ipOption
case QueryStrategy_USE_IP4:
return dns.IPOption{
IPv4Enable: ipOption.IPv4Enable,
IPv6Enable: false,
FakeEnable: false,
}
case QueryStrategy_USE_IP6:
return dns.IPOption{
IPv4Enable: false,
IPv6Enable: ipOption.IPv6Enable,
FakeEnable: false,
}
default:
return ipOption
}
}

View file

@ -1,173 +0,0 @@
package dns
import (
"context"
go_errors "errors"
"time"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/signal/pubsub"
"github.com/xtls/xray-core/features/dns"
)
type CachedNameserver interface {
getCacheController() *CacheController
sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns.IPOption)
}
// queryIP is called from dns.Server->queryIPTimeout
func queryIP(ctx context.Context, s CachedNameserver, domain string, option dns.IPOption) ([]net.IP, uint32, error) {
fqdn := Fqdn(domain)
cache := s.getCacheController()
if !cache.disableCache {
if rec := cache.findRecords(fqdn); rec != nil {
ips, ttl, err := merge(option, rec.A, rec.AAAA)
if !go_errors.Is(err, errRecordNotFound) {
if ttl > 0 {
errors.LogDebugInner(ctx, err, cache.name, " cache HIT ", fqdn, " -> ", ips)
log.Record(&log.DNSLog{Server: cache.name, Domain: fqdn, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
return ips, uint32(ttl), err
}
if cache.serveStale && (cache.serveExpiredTTL == 0 || cache.serveExpiredTTL < ttl) {
errors.LogDebugInner(ctx, err, cache.name, " cache OPTIMISTE ", fqdn, " -> ", ips)
log.Record(&log.DNSLog{Server: cache.name, Domain: fqdn, Result: ips, Status: log.DNSCacheOptimiste, Elapsed: 0, Error: err})
go pull(ctx, s, fqdn, option)
return ips, 1, err
}
}
}
} else {
errors.LogDebug(ctx, "DNS cache is disabled. Querying IP for ", fqdn, " at ", cache.name)
}
return fetch(ctx, s, fqdn, option)
}
func pull(ctx context.Context, s CachedNameserver, fqdn string, option dns.IPOption) {
nctx, cancel := context.WithTimeout(context.WithoutCancel(ctx), 8*time.Second)
defer cancel()
fetch(nctx, s, fqdn, option)
}
func fetch(ctx context.Context, s CachedNameserver, fqdn string, option dns.IPOption) ([]net.IP, uint32, error) {
key := fqdn
switch {
case option.IPv4Enable && option.IPv6Enable:
key = key + "46"
case option.IPv4Enable:
key = key + "4"
case option.IPv6Enable:
key = key + "6"
}
v, _, _ := s.getCacheController().requestGroup.Do(key, func() (any, error) {
return doFetch(ctx, s, fqdn, option), nil
})
ret := v.(result)
return ret.ips, ret.ttl, ret.error
}
type result struct {
ips []net.IP
ttl uint32
error
}
func doFetch(ctx context.Context, s CachedNameserver, fqdn string, option dns.IPOption) result {
sub4, sub6 := s.getCacheController().registerSubscribers(fqdn, option)
defer closeSubscribers(sub4, sub6)
noResponseErrCh := make(chan error, 2)
onEvent := func(sub *pubsub.Subscriber) (*IPRecord, error) {
if sub == nil {
return nil, nil
}
select {
case <-ctx.Done():
return nil, ctx.Err()
case err := <-noResponseErrCh:
return nil, err
case msg := <-sub.Wait():
sub.Close()
return msg.(*IPRecord), nil // should panic
}
}
start := time.Now()
s.sendQuery(ctx, noResponseErrCh, fqdn, option)
rec4, err4 := onEvent(sub4)
rec6, err6 := onEvent(sub6)
var errs []error
if err4 != nil {
errs = append(errs, err4)
}
if err6 != nil {
errs = append(errs, err6)
}
ips, ttl, err := merge(option, rec4, rec6, errs...)
var rTTL uint32
if ttl > 0 {
rTTL = uint32(ttl)
} else if ttl == 0 && go_errors.Is(err, errRecordNotFound) {
rTTL = 0
} else { // edge case: where a fast rep's ttl expires during the rtt of a slower, parallel query
rTTL = 1
}
log.Record(&log.DNSLog{Server: s.getCacheController().name, Domain: fqdn, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
return result{ips, rTTL, err}
}
func merge(option dns.IPOption, rec4 *IPRecord, rec6 *IPRecord, errs ...error) ([]net.IP, int32, error) {
var allIPs []net.IP
var rTTL int32 = dns.DefaultTTL
mergeReq := option.IPv4Enable && option.IPv6Enable
if option.IPv4Enable {
ips, ttl, err := rec4.getIPs() // it's safe
if !mergeReq || go_errors.Is(err, errRecordNotFound) {
return ips, ttl, err
}
if ttl < rTTL {
rTTL = ttl
}
if len(ips) > 0 {
allIPs = append(allIPs, ips...)
} else {
errs = append(errs, err)
}
}
if option.IPv6Enable {
ips, ttl, err := rec6.getIPs() // it's safe
if !mergeReq || go_errors.Is(err, errRecordNotFound) {
return ips, ttl, err
}
if ttl < rTTL {
rTTL = ttl
}
if len(ips) > 0 {
allIPs = append(allIPs, ips...)
} else {
errs = append(errs, err)
}
}
if len(allIPs) > 0 {
return allIPs, rTTL, nil
}
if len(errs) == 2 && go_errors.Is(errs[0], errs[1]) {
return nil, rTTL, errs[0]
}
return nil, rTTL, errors.Combine(errs...)
}

View file

@ -1,239 +0,0 @@
package dns
import (
"bytes"
"context"
"crypto/tls"
"fmt"
"io"
"net/http"
"net/url"
"time"
utls "github.com/refraction-networking/utls"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/crypto"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
"github.com/xtls/xray-core/common/protocol/dns"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/utils"
dns_feature "github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/transport/internet"
"golang.org/x/net/http2"
)
// DoHNameServer implemented DNS over HTTPS (RFC8484) Wire Format,
// which is compatible with traditional dns over udp(RFC1035),
// thus most of the DOH implementation is copied from udpns.go
type DoHNameServer struct {
cacheController *CacheController
httpClient *http.Client
dohURL string
clientIP net.IP
}
// NewDoHNameServer creates DOH/DOHL client object for remote/local resolving.
func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, h2c bool, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) *DoHNameServer {
url.Scheme = "https"
mode := "DOH"
if dispatcher == nil {
mode = "DOHL"
}
errors.LogInfo(context.Background(), "DNS: created ", mode, " client for ", url.String(), ", with h2c ", h2c)
s := &DoHNameServer{
cacheController: NewCacheController(mode+"//"+url.Host, disableCache, serveStale, serveExpiredTTL),
dohURL: url.String(),
clientIP: clientIP,
}
s.httpClient = &http.Client{
Transport: &http2.Transport{
IdleConnTimeout: net.ConnIdleTimeout,
ReadIdleTimeout: net.ChromeH2KeepAlivePeriod,
DialTLSContext: func(ctx context.Context, network, addr string, cfg *tls.Config) (net.Conn, error) {
dest, err := net.ParseDestination(network + ":" + addr)
if err != nil {
return nil, err
}
var conn net.Conn
if dispatcher != nil {
dnsCtx := toDnsContext(ctx, s.dohURL)
if h2c {
dnsCtx = session.ContextWithMitmAlpn11(dnsCtx, false) // for insurance
dnsCtx = session.ContextWithMitmServerName(dnsCtx, url.Hostname())
}
link, err := dispatcher.Dispatch(dnsCtx, dest)
select {
case <-ctx.Done():
return nil, ctx.Err()
default:
}
if err != nil {
return nil, err
}
cc := common.ChainedClosable{}
if cw, ok := link.Writer.(common.Closable); ok {
cc = append(cc, cw)
}
if cr, ok := link.Reader.(common.Closable); ok {
cc = append(cc, cr)
}
conn = cnc.NewConnection(
cnc.ConnectionInputMulti(link.Writer),
cnc.ConnectionOutputMulti(link.Reader),
cnc.ConnectionOnClose(cc),
)
} else {
log.Record(&log.AccessMessage{
From: "DNS",
To: s.dohURL,
Status: log.AccessAccepted,
Detour: "local",
})
conn, err = internet.DialSystem(ctx, dest, nil)
if err != nil {
return nil, err
}
}
if !h2c {
conn = utls.UClient(conn, &utls.Config{ServerName: url.Hostname()}, utls.HelloChrome_Auto)
if err := conn.(*utls.UConn).HandshakeContext(ctx); err != nil {
return nil, err
}
}
return conn, nil
},
},
}
return s
}
// Name implements Server.
func (s *DoHNameServer) Name() string {
return s.cacheController.name
}
// IsDisableCache implements Server.
func (s *DoHNameServer) IsDisableCache() bool {
return s.cacheController.disableCache
}
func (s *DoHNameServer) newReqID() uint16 {
return 0
}
// getCacheController implements CachedNameserver.
func (s *DoHNameServer) getCacheController() *CacheController {
return s.cacheController
}
// sendQuery implements CachedNameserver.
func (s *DoHNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
errors.LogInfo(ctx, s.Name(), " querying: ", fqdn)
if s.Name()+"." == "DOH//"+fqdn {
errors.LogError(ctx, s.Name(), " tries to resolve itself! Use IP or set \"hosts\" instead")
if noResponseErrCh != nil {
noResponseErrCh <- errors.New("tries to resolve itself!", s.Name())
}
return
}
// As we don't want our traffic pattern looks like DoH, we use Random-Length Padding instead of Block-Length Padding recommended in RFC 8467
// Although DoH server like 1.1.1.1 will pad the response to Block-Length 468, at least it is better than no padding for response at all
reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, int(crypto.RandBetween(100, 300))))
var deadline time.Time
if d, ok := ctx.Deadline(); ok {
deadline = d
} else {
deadline = time.Now().Add(time.Second * 5)
}
for _, req := range reqs {
go func(r *dnsRequest) {
// generate new context for each req, using same context
// may cause reqs all aborted if any one encounter an error
dnsCtx := ctx
// reserve internal dns server requested Inbound
if inbound := session.InboundFromContext(ctx); inbound != nil {
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
}
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
Protocol: "https",
SkipDNSResolve: true,
})
// forced to use mux for DOH
// dnsCtx = session.ContextWithMuxPreferred(dnsCtx, true)
var cancel context.CancelFunc
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
defer cancel()
b, err := dns.PackMessage(r.msg)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to pack dns query for ", fqdn)
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
resp, err := s.dohHTTPSContext(dnsCtx, b.Bytes())
if err != nil {
errors.LogErrorInner(ctx, err, "failed to retrieve response for ", fqdn)
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
rec, err := parseResponse(resp)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to handle DOH response for ", fqdn)
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
s.cacheController.updateRecord(r, rec)
}(req)
}
}
func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte, error) {
body := bytes.NewBuffer(b)
req, err := http.NewRequest("POST", s.dohURL, body)
if err != nil {
return nil, err
}
req.Header.Add("Accept", "application/dns-message")
req.Header.Add("Content-Type", "application/dns-message")
utils.TryDefaultHeadersWith(req.Header, "fetch")
req.Header.Set("X-Padding", utils.H2Base62Pad(crypto.RandBetween(100, 1000)))
hc := s.httpClient
resp, err := hc.Do(req.WithContext(ctx))
if err != nil {
return nil, err
}
defer resp.Body.Close()
if resp.StatusCode != http.StatusOK {
io.Copy(io.Discard, resp.Body) // flush resp.Body so that the conn is reusable
return nil, fmt.Errorf("DOH server returned code %d", resp.StatusCode)
}
return io.ReadAll(resp.Body)
}
// QueryIP implements Server.
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
return queryIP(ctx, s, domain, option)
}

View file

@ -1,105 +0,0 @@
package dns_test
import (
"context"
"net/url"
"testing"
"time"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
dns_feature "github.com/xtls/xray-core/features/dns"
)
func TestDOHNameServer(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
}
func TestDOHNameServerWithCache(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips2, _, err := s.QueryIP(ctx2, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if r := cmp.Diff(ips2, ips); r != "" {
t.Fatal(r)
}
}
func TestDOHNameServerWithIPv4Override(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv4len {
t.Error("expect only IPv4 response from DNS query")
}
}
}
func TestDOHNameServerWithIPv6Override(t *testing.T) {
url, err := url.Parse("https+local://1.1.1.1/dns-query")
common.Must(err)
s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: false,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv6len {
t.Error("expect only IPv6 response from DNS query")
}
}
}

View file

@ -1,51 +0,0 @@
package dns
import (
"context"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
type FakeDNSServer struct {
fakeDNSEngine dns.FakeDNSEngine
}
func NewFakeDNSServer(fd dns.FakeDNSEngine) *FakeDNSServer {
return &FakeDNSServer{fakeDNSEngine: fd}
}
func (FakeDNSServer) Name() string {
return "FakeDNS"
}
// IsDisableCache implements Server.
func (s *FakeDNSServer) IsDisableCache() bool {
return true
}
func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, opt dns.IPOption) ([]net.IP, uint32, error) {
if f.fakeDNSEngine == nil {
return nil, 0, errors.New("Unable to locate a fake DNS Engine").AtError()
}
var ips []net.Address
if fkr0, ok := f.fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
ips = fkr0.GetFakeIPForDomain3(domain, opt.IPv4Enable, opt.IPv6Enable)
} else {
ips = f.fakeDNSEngine.GetFakeIPForDomain(domain)
}
netIP, err := toNetIP(ips)
if err != nil {
return nil, 0, errors.New("Unable to convert IP to net ip").Base(err).AtError()
}
errors.LogInfo(ctx, f.Name(), " got answer: ", domain, " -> ", ips)
if len(netIP) > 0 {
return netIP, 1, nil // fakeIP ttl is 1
}
return nil, 0, dns.ErrEmptyResponse
}

View file

@ -1,54 +0,0 @@
package dns
import (
"context"
"time"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/dns/localdns"
)
// LocalNameServer is an wrapper over local DNS feature.
type LocalNameServer struct {
client *localdns.Client
}
// QueryIP implements Server.
func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option dns.IPOption) (ips []net.IP, ttl uint32, err error) {
start := time.Now()
ips, ttl, err = s.client.LookupIP(domain, option)
if len(ips) > 0 {
errors.LogInfo(ctx, "Localhost got answer: ", domain, " -> ", ips)
log.Record(&log.DNSLog{Server: s.Name(), Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
}
return
}
// Name implements Server.
func (s *LocalNameServer) Name() string {
return "localhost"
}
// IsDisableCache implements Server.
func (s *LocalNameServer) IsDisableCache() bool {
return true
}
// NewLocalNameServer creates localdns server object for directly lookup in system DNS.
func NewLocalNameServer() *LocalNameServer {
errors.LogInfo(context.Background(), "DNS: created localhost client")
return &LocalNameServer{
client: localdns.New(),
}
}
// NewLocalDNSClient creates localdns client object for directly lookup in system DNS.
func NewLocalDNSClient(ipOption dns.IPOption) *Client {
return &Client{server: NewLocalNameServer(), ipOption: &ipOption}
}

View file

@ -1,26 +0,0 @@
package dns_test
import (
"context"
"testing"
"time"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/features/dns"
)
func TestLocalNameServer(t *testing.T) {
s := NewLocalNameServer()
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
FakeEnable: false,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
}

View file

@ -1,276 +0,0 @@
package dns
import (
"bytes"
"context"
"encoding/binary"
"net/url"
"sync"
"time"
"github.com/apernet/quic-go"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/protocol/dns"
"github.com/xtls/xray-core/common/session"
dns_feature "github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/transport/internet/tls"
"golang.org/x/net/http2"
)
// NextProtoDQ - During connection establishment, DNS/QUIC support is indicated
// by selecting the ALPN token "dq" in the crypto handshake.
const NextProtoDQ = "doq"
const handshakeTimeout = time.Second * 8
// QUICNameServer implemented DNS over QUIC
type QUICNameServer struct {
sync.RWMutex
cacheController *CacheController
destination *net.Destination
connection *quic.Conn
clientIP net.IP
}
// NewQUICNameServer creates DNS-over-QUIC client object for local resolving
func NewQUICNameServer(url *url.URL, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (*QUICNameServer, error) {
var err error
port := net.Port(853)
if url.Port() != "" {
port, err = net.PortFromString(url.Port())
if err != nil {
return nil, err
}
}
dest := net.UDPDestination(net.ParseAddress(url.Hostname()), port)
s := &QUICNameServer{
cacheController: NewCacheController(url.String(), disableCache, serveStale, serveExpiredTTL),
destination: &dest,
clientIP: clientIP,
}
errors.LogInfo(context.Background(), "DNS: created Local DNS-over-QUIC client for ", url.String())
return s, nil
}
// Name implements Server.
func (s *QUICNameServer) Name() string {
return s.cacheController.name
}
// IsDisableCache implements Server.
func (s *QUICNameServer) IsDisableCache() bool {
return s.cacheController.disableCache
}
func (s *QUICNameServer) newReqID() uint16 {
return 0
}
// getCacheController implements CachedNameServer.
func (s *QUICNameServer) getCacheController() *CacheController { return s.cacheController }
// sendQuery implements CachedNameServer.
func (s *QUICNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
errors.LogInfo(ctx, s.Name(), " querying: ", fqdn)
reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, 0))
var deadline time.Time
if d, ok := ctx.Deadline(); ok {
deadline = d
} else {
deadline = time.Now().Add(time.Second * 5)
}
for _, req := range reqs {
go func(r *dnsRequest) {
// generate new context for each req, using same context
// may cause reqs all aborted if any one encounter an error
dnsCtx := ctx
// reserve internal dns server requested Inbound
if inbound := session.InboundFromContext(ctx); inbound != nil {
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
}
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
Protocol: "quic",
SkipDNSResolve: true,
})
var cancel context.CancelFunc
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
defer cancel()
b, err := dns.PackMessage(r.msg)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to pack dns query")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
dnsReqBuf := buf.New()
err = binary.Write(dnsReqBuf, binary.BigEndian, uint16(b.Len()))
if err != nil {
errors.LogErrorInner(ctx, err, "binary write failed")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
_, err = dnsReqBuf.Write(b.Bytes())
if err != nil {
errors.LogErrorInner(ctx, err, "buffer write failed")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
b.Release()
conn, err := s.openStream(dnsCtx)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to open quic connection")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
_, err = conn.Write(dnsReqBuf.Bytes())
if err != nil {
errors.LogErrorInner(ctx, err, "failed to send query")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
_ = conn.Close()
respBuf := buf.New()
defer respBuf.Release()
n, err := respBuf.ReadFullFrom(conn, 2)
if err != nil && n == 0 {
errors.LogErrorInner(ctx, err, "failed to read response length")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
var length uint16
err = binary.Read(bytes.NewReader(respBuf.Bytes()), binary.BigEndian, &length)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to parse response length")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
respBuf.Clear()
n, err = respBuf.ReadFullFrom(conn, int32(length))
if err != nil && n == 0 {
errors.LogErrorInner(ctx, err, "failed to read response length")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
rec, err := parseResponse(respBuf.Bytes())
if err != nil {
errors.LogErrorInner(ctx, err, "failed to handle response")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
s.cacheController.updateRecord(r, rec)
}(req)
}
}
// QueryIP implements Server.
func (s *QUICNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
return queryIP(ctx, s, domain, option)
}
func isActive(s *quic.Conn) bool {
select {
case <-s.Context().Done():
return false
default:
return true
}
}
func (s *QUICNameServer) getConnection() (*quic.Conn, error) {
var conn *quic.Conn
s.RLock()
conn = s.connection
if conn != nil && isActive(conn) {
s.RUnlock()
return conn, nil
}
if conn != nil {
// we're recreating the connection, let's create a new one
_ = conn.CloseWithError(0, "")
}
s.RUnlock()
s.Lock()
defer s.Unlock()
var err error
conn, err = s.openConnection()
if err != nil {
// This does not look too nice, but QUIC (or maybe quic-go)
// doesn't seem stable enough.
// Maybe retransmissions aren't fully implemented in quic-go?
// Anyways, the simple solution is to make a second try when
// it fails to open the QUIC connection.
conn, err = s.openConnection()
if err != nil {
return nil, err
}
}
s.connection = conn
return conn, nil
}
func (s *QUICNameServer) openConnection() (*quic.Conn, error) {
tlsConfig := tls.Config{}
quicConfig := &quic.Config{
HandshakeIdleTimeout: handshakeTimeout,
}
tlsConfig.ServerName = s.destination.Address.String()
conn, err := quic.DialAddr(context.Background(), s.destination.NetAddr(), tlsConfig.GetTLSConfig(tls.WithNextProto("http/1.1", http2.NextProtoTLS, NextProtoDQ)), quicConfig)
log.Record(&log.AccessMessage{
From: "DNS",
To: s.destination,
Status: log.AccessAccepted,
Detour: "local",
})
if err != nil {
return nil, err
}
return conn, nil
}
func (s *QUICNameServer) openStream(ctx context.Context) (*quic.Stream, error) {
conn, err := s.getConnection()
if err != nil {
return nil, err
}
// open a new stream
return conn.OpenStreamSync(ctx)
}

View file

@ -1,87 +0,0 @@
package dns_test
import (
"context"
"net/url"
"testing"
"time"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/features/dns"
)
func TestQUICNameServer(t *testing.T) {
url, err := url.Parse("quic://dns.adguard-dns.com")
common.Must(err)
s, err := NewQUICNameServer(url, false, false, 0, net.IP(nil))
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips2, _, err := s.QueryIP(ctx2, "google.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if r := cmp.Diff(ips2, ips); r != "" {
t.Fatal(r)
}
}
func TestQUICNameServerWithIPv4Override(t *testing.T) {
url, err := url.Parse("quic://dns.adguard-dns.com")
common.Must(err)
s, err := NewQUICNameServer(url, false, false, 0, net.IP(nil))
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv4len {
t.Error("expect only IPv4 response from DNS query")
}
}
}
func TestQUICNameServerWithIPv6Override(t *testing.T) {
url, err := url.Parse("quic://dns.adguard-dns.com")
common.Must(err)
s, err := NewQUICNameServer(url, false, false, 0, net.IP(nil))
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
IPv4Enable: false,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv6len {
t.Error("expect only IPv6 response from DNS query")
}
}
}

View file

@ -1,235 +0,0 @@
package dns
import (
"bytes"
"context"
"encoding/binary"
"net/url"
"sync/atomic"
"time"
"github.com/xtls/xray-core/common/buf"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
"github.com/xtls/xray-core/common/protocol/dns"
"github.com/xtls/xray-core/common/session"
dns_feature "github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/transport/internet"
)
// TCPNameServer implemented DNS over TCP (RFC7766).
type TCPNameServer struct {
cacheController *CacheController
destination *net.Destination
reqID uint32
dial func(context.Context) (net.Conn, error)
clientIP net.IP
}
// NewTCPNameServer creates DNS over TCP server object for remote resolving.
func NewTCPNameServer(
url *url.URL,
dispatcher routing.Dispatcher,
disableCache bool, serveStale bool, serveExpiredTTL uint32,
clientIP net.IP,
) (*TCPNameServer, error) {
s, err := baseTCPNameServer(url, "TCP", disableCache, serveStale, serveExpiredTTL, clientIP)
if err != nil {
return nil, err
}
s.dial = func(ctx context.Context) (net.Conn, error) {
link, err := dispatcher.Dispatch(toDnsContext(ctx, s.destination.String()), *s.destination)
if err != nil {
return nil, err
}
return cnc.NewConnection(
cnc.ConnectionInputMulti(link.Writer),
cnc.ConnectionOutputMulti(link.Reader),
), nil
}
errors.LogInfo(context.Background(), "DNS: created TCP client initialized for ", url.String())
return s, nil
}
// NewTCPLocalNameServer creates DNS over TCP client object for local resolving
func NewTCPLocalNameServer(url *url.URL, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (*TCPNameServer, error) {
s, err := baseTCPNameServer(url, "TCPL", disableCache, serveStale, serveExpiredTTL, clientIP)
if err != nil {
return nil, err
}
s.dial = func(ctx context.Context) (net.Conn, error) {
return internet.DialSystem(ctx, *s.destination, nil)
}
errors.LogInfo(context.Background(), "DNS: created Local TCP client initialized for ", url.String())
return s, nil
}
func baseTCPNameServer(url *url.URL, prefix string, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (*TCPNameServer, error) {
port := net.Port(53)
if url.Port() != "" {
var err error
if port, err = net.PortFromString(url.Port()); err != nil {
return nil, err
}
}
dest := net.TCPDestination(net.ParseAddress(url.Hostname()), port)
s := &TCPNameServer{
cacheController: NewCacheController(prefix+"//"+dest.NetAddr(), disableCache, serveStale, serveExpiredTTL),
destination: &dest,
clientIP: clientIP,
}
return s, nil
}
// Name implements Server.
func (s *TCPNameServer) Name() string {
return s.cacheController.name
}
// IsDisableCache implements Server.
func (s *TCPNameServer) IsDisableCache() bool {
return s.cacheController.disableCache
}
func (s *TCPNameServer) newReqID() uint16 {
return uint16(atomic.AddUint32(&s.reqID, 1))
}
// getCacheController implements CachedNameserver.
func (s *TCPNameServer) getCacheController() *CacheController {
return s.cacheController
}
// sendQuery implements CachedNameserver.
func (s *TCPNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
errors.LogInfo(ctx, s.Name(), " querying DNS for: ", fqdn)
reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, 0))
var deadline time.Time
if d, ok := ctx.Deadline(); ok {
deadline = d
} else {
deadline = time.Now().Add(time.Second * 5)
}
for _, req := range reqs {
go func(r *dnsRequest) {
dnsCtx := ctx
if inbound := session.InboundFromContext(ctx); inbound != nil {
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
}
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
Protocol: "dns",
SkipDNSResolve: true,
})
var cancel context.CancelFunc
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
defer cancel()
b, err := dns.PackMessage(r.msg)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to pack dns query")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
conn, err := s.dial(dnsCtx)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to dial namesever")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
defer conn.Close()
dnsReqBuf := buf.New()
err = binary.Write(dnsReqBuf, binary.BigEndian, uint16(b.Len()))
if err != nil {
errors.LogErrorInner(ctx, err, "binary write failed")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
_, err = dnsReqBuf.Write(b.Bytes())
if err != nil {
errors.LogErrorInner(ctx, err, "buffer write failed")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
b.Release()
_, err = conn.Write(dnsReqBuf.Bytes())
if err != nil {
errors.LogErrorInner(ctx, err, "failed to send query")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
dnsReqBuf.Release()
respBuf := buf.New()
defer respBuf.Release()
n, err := respBuf.ReadFullFrom(conn, 2)
if err != nil && n == 0 {
errors.LogErrorInner(ctx, err, "failed to read response length")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
var length uint16
err = binary.Read(bytes.NewReader(respBuf.Bytes()), binary.BigEndian, &length)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to parse response length")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
respBuf.Clear()
n, err = respBuf.ReadFullFrom(conn, int32(length))
if err != nil && n == 0 {
errors.LogErrorInner(ctx, err, "failed to read response length")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
rec, err := parseResponse(respBuf.Bytes())
if err != nil {
errors.LogErrorInner(ctx, err, "failed to parse DNS over TCP response")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
s.cacheController.updateRecord(r, rec)
}(req)
}
}
// QueryIP implements Server.
func (s *TCPNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
return queryIP(ctx, s, domain, option)
}

View file

@ -1,107 +0,0 @@
package dns_test
import (
"context"
"net/url"
"testing"
"time"
"github.com/google/go-cmp/cmp"
. "github.com/xtls/xray-core/app/dns"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/net"
dns_feature "github.com/xtls/xray-core/features/dns"
)
func TestTCPLocalNameServer(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
}
func TestTCPLocalNameServerWithCache(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips2, _, err := s.QueryIP(ctx2, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: true,
})
cancel()
common.Must(err)
if r := cmp.Diff(ips2, ips); r != "" {
t.Fatal(r)
}
}
func TestTCPLocalNameServerWithIPv4Override(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: true,
IPv6Enable: false,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv4len {
t.Error("expect only IPv4 response from DNS query")
}
}
}
func TestTCPLocalNameServerWithIPv6Override(t *testing.T) {
url, err := url.Parse("tcp+local://8.8.8.8")
common.Must(err)
s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
common.Must(err)
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
IPv4Enable: false,
IPv6Enable: true,
})
cancel()
common.Must(err)
if len(ips) == 0 {
t.Error("expect some ips, but got 0")
}
for _, ip := range ips {
if len(ip) != net.IPv6len {
t.Error("expect only IPv6 response from DNS query")
}
}
}

View file

@ -1,191 +0,0 @@
package dns
import (
"context"
"strings"
"sync"
"sync/atomic"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/protocol/dns"
udp_proto "github.com/xtls/xray-core/common/protocol/udp"
"github.com/xtls/xray-core/common/task"
dns_feature "github.com/xtls/xray-core/features/dns"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/transport/internet/udp"
"golang.org/x/net/dns/dnsmessage"
)
// ClassicNameServer implemented traditional UDP DNS.
type ClassicNameServer struct {
sync.RWMutex
cacheController *CacheController
address *net.Destination
requests map[uint16]*udpDnsRequest
udpServer *udp.Dispatcher
requestsCleanup *task.Periodic
reqID uint32
clientIP net.IP
}
type udpDnsRequest struct {
dnsRequest
ctx context.Context
}
// NewClassicNameServer creates udp server object for remote resolving.
func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) *ClassicNameServer {
// default to 53 if unspecific
if address.Port == 0 {
address.Port = net.Port(53)
}
s := &ClassicNameServer{
cacheController: NewCacheController(strings.ToUpper(address.String()), disableCache, serveStale, serveExpiredTTL),
address: &address,
requests: make(map[uint16]*udpDnsRequest),
clientIP: clientIP,
}
s.requestsCleanup = &task.Periodic{
Interval: time.Minute,
Execute: s.RequestsCleanup,
}
s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
errors.LogInfo(context.Background(), "DNS: created UDP client initialized for ", address.NetAddr())
return s
}
// Name implements Server.
func (s *ClassicNameServer) Name() string {
return s.cacheController.name
}
// IsDisableCache implements Server.
func (s *ClassicNameServer) IsDisableCache() bool {
return s.cacheController.disableCache
}
// RequestsCleanup clears expired items from cache
func (s *ClassicNameServer) RequestsCleanup() error {
now := time.Now()
s.Lock()
defer s.Unlock()
if len(s.requests) == 0 {
return errors.New(s.Name(), " nothing to do. stopping...")
}
for id, req := range s.requests {
if req.expire.Before(now) {
delete(s.requests, id)
}
}
if len(s.requests) == 0 {
s.requests = make(map[uint16]*udpDnsRequest)
}
return nil
}
// HandleResponse handles udp response packet from remote DNS server.
func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_proto.Packet) {
payload := packet.Payload
ipRec, err := parseResponse(payload.Bytes())
payload.Release()
if err != nil {
errors.LogErrorInner(ctx, err, s.Name(), " fail to parse responded DNS udp")
return
}
s.Lock()
id := ipRec.ReqID
req, ok := s.requests[id]
if ok {
// remove the pending request
delete(s.requests, id)
}
s.Unlock()
if !ok {
errors.LogErrorInner(ctx, err, s.Name(), " cannot find the pending request")
return
}
// if truncated, retry with EDNS0 option(udp payload size: 1350)
if ipRec.RawHeader.Truncated {
// if already has EDNS0 option, no need to retry
if len(req.msg.Additionals) == 0 {
// copy necessary meta data from original request
// and add EDNS0 option
opt := new(dnsmessage.Resource)
common.Must(opt.Header.SetEDNS0(1350, 0xfe00, true))
opt.Body = &dnsmessage.OPTResource{}
newMsg := *req.msg
newReq := *req
newMsg.Additionals = append(newMsg.Additionals, *opt)
newMsg.ID = s.newReqID()
newReq.msg = &newMsg
s.addPendingRequest(&newReq)
b, _ := dns.PackMessage(newReq.msg)
copyDest := net.UDPDestination(s.address.Address, s.address.Port)
b.UDP = &copyDest
s.udpServer.Dispatch(toDnsContext(newReq.ctx, s.address.String()), *s.address, b)
return
}
}
s.cacheController.updateRecord(&req.dnsRequest, ipRec)
}
func (s *ClassicNameServer) newReqID() uint16 {
return uint16(atomic.AddUint32(&s.reqID, 1))
}
func (s *ClassicNameServer) addPendingRequest(req *udpDnsRequest) {
s.Lock()
id := req.msg.ID
req.expire = time.Now().Add(time.Second * 8)
s.requests[id] = req
s.Unlock()
common.Must(s.requestsCleanup.Start())
}
// getCacheController implements CachedNameserver.
func (s *ClassicNameServer) getCacheController() *CacheController {
return s.cacheController
}
// sendQuery implements CachedNameserver.
func (s *ClassicNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
errors.LogInfo(ctx, s.Name(), " querying DNS for: ", fqdn)
reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, 0))
for _, req := range reqs {
udpReq := &udpDnsRequest{
dnsRequest: *req,
ctx: ctx,
}
s.addPendingRequest(udpReq)
b, err := dns.PackMessage(req.msg)
if err != nil {
errors.LogErrorInner(ctx, err, "failed to pack dns query")
if noResponseErrCh != nil {
noResponseErrCh <- err
}
return
}
copyDest := net.UDPDestination(s.address.Address, s.address.Port)
b.UDP = &copyDest
s.udpServer.Dispatch(toDnsContext(ctx, s.address.String()), *s.address, b)
}
}
// QueryIP implements Server.
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
return queryIP(ctx, s, domain, option)
}

View file

@ -1,55 +0,0 @@
package command
import (
"context"
"github.com/xtls/xray-core/app/log"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/core"
grpc "google.golang.org/grpc"
)
type LoggerServer struct {
V *core.Instance
}
// RestartLogger implements LoggerService.
func (s *LoggerServer) RestartLogger(ctx context.Context, request *RestartLoggerRequest) (*RestartLoggerResponse, error) {
logger := s.V.GetFeature((*log.Instance)(nil))
if logger == nil {
return nil, errors.New("unable to get logger instance")
}
if err := logger.Close(); err != nil {
return nil, errors.New("failed to close logger").Base(err)
}
if err := logger.Start(); err != nil {
return nil, errors.New("failed to start logger").Base(err)
}
return &RestartLoggerResponse{}, nil
}
func (s *LoggerServer) mustEmbedUnimplementedLoggerServiceServer() {}
type service struct {
v *core.Instance
}
func (s *service) Register(server *grpc.Server) {
ls := &LoggerServer{
V: s.v,
}
RegisterLoggerServiceServer(server, ls)
// For compatibility purposes
vCoreDesc := LoggerService_ServiceDesc
vCoreDesc.ServiceName = "v2ray.core.app.log.command.LoggerService"
server.RegisterService(&vCoreDesc, ls)
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
s := core.MustFromContext(ctx)
return &service{v: s}, nil
}))
}

View file

@ -1,34 +0,0 @@
package command_test
import (
"context"
"testing"
"github.com/xtls/xray-core/app/dispatcher"
"github.com/xtls/xray-core/app/log"
. "github.com/xtls/xray-core/app/log/command"
"github.com/xtls/xray-core/app/proxyman"
_ "github.com/xtls/xray-core/app/proxyman/inbound"
_ "github.com/xtls/xray-core/app/proxyman/outbound"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/serial"
"github.com/xtls/xray-core/core"
)
func TestLoggerRestart(t *testing.T) {
v, err := core.New(&core.Config{
App: []*serial.TypedMessage{
serial.ToTypedMessage(&log.Config{}),
serial.ToTypedMessage(&dispatcher.Config{}),
serial.ToTypedMessage(&proxyman.InboundConfig{}),
serial.ToTypedMessage(&proxyman.OutboundConfig{}),
},
})
common.Must(err)
common.Must(v.Start())
server := &LoggerServer{
V: v,
}
common.Must2(server.RestartLogger(context.Background(), &RestartLoggerRequest{}))
}

View file

@ -1,194 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/log/command/config.proto
package command
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_log_command_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_log_command_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_log_command_config_proto_rawDescGZIP(), []int{0}
}
type RestartLoggerRequest struct {
state protoimpl.MessageState `protogen:"open.v1"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *RestartLoggerRequest) Reset() {
*x = RestartLoggerRequest{}
mi := &file_app_log_command_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *RestartLoggerRequest) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*RestartLoggerRequest) ProtoMessage() {}
func (x *RestartLoggerRequest) ProtoReflect() protoreflect.Message {
mi := &file_app_log_command_config_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use RestartLoggerRequest.ProtoReflect.Descriptor instead.
func (*RestartLoggerRequest) Descriptor() ([]byte, []int) {
return file_app_log_command_config_proto_rawDescGZIP(), []int{1}
}
type RestartLoggerResponse struct {
state protoimpl.MessageState `protogen:"open.v1"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *RestartLoggerResponse) Reset() {
*x = RestartLoggerResponse{}
mi := &file_app_log_command_config_proto_msgTypes[2]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *RestartLoggerResponse) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*RestartLoggerResponse) ProtoMessage() {}
func (x *RestartLoggerResponse) ProtoReflect() protoreflect.Message {
mi := &file_app_log_command_config_proto_msgTypes[2]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use RestartLoggerResponse.ProtoReflect.Descriptor instead.
func (*RestartLoggerResponse) Descriptor() ([]byte, []int) {
return file_app_log_command_config_proto_rawDescGZIP(), []int{2}
}
var File_app_log_command_config_proto protoreflect.FileDescriptor
const file_app_log_command_config_proto_rawDesc = "" +
"\n" +
"\x1capp/log/command/config.proto\x12\x14xray.app.log.command\"\b\n" +
"\x06Config\"\x16\n" +
"\x14RestartLoggerRequest\"\x17\n" +
"\x15RestartLoggerResponse2{\n" +
"\rLoggerService\x12j\n" +
"\rRestartLogger\x12*.xray.app.log.command.RestartLoggerRequest\x1a+.xray.app.log.command.RestartLoggerResponse\"\x00B^\n" +
"\x18com.xray.app.log.commandP\x01Z)github.com/xtls/xray-core/app/log/command\xaa\x02\x14Xray.App.Log.Commandb\x06proto3"
var (
file_app_log_command_config_proto_rawDescOnce sync.Once
file_app_log_command_config_proto_rawDescData []byte
)
func file_app_log_command_config_proto_rawDescGZIP() []byte {
file_app_log_command_config_proto_rawDescOnce.Do(func() {
file_app_log_command_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_log_command_config_proto_rawDesc), len(file_app_log_command_config_proto_rawDesc)))
})
return file_app_log_command_config_proto_rawDescData
}
var file_app_log_command_config_proto_msgTypes = make([]protoimpl.MessageInfo, 3)
var file_app_log_command_config_proto_goTypes = []any{
(*Config)(nil), // 0: xray.app.log.command.Config
(*RestartLoggerRequest)(nil), // 1: xray.app.log.command.RestartLoggerRequest
(*RestartLoggerResponse)(nil), // 2: xray.app.log.command.RestartLoggerResponse
}
var file_app_log_command_config_proto_depIdxs = []int32{
1, // 0: xray.app.log.command.LoggerService.RestartLogger:input_type -> xray.app.log.command.RestartLoggerRequest
2, // 1: xray.app.log.command.LoggerService.RestartLogger:output_type -> xray.app.log.command.RestartLoggerResponse
1, // [1:2] is the sub-list for method output_type
0, // [0:1] is the sub-list for method input_type
0, // [0:0] is the sub-list for extension type_name
0, // [0:0] is the sub-list for extension extendee
0, // [0:0] is the sub-list for field type_name
}
func init() { file_app_log_command_config_proto_init() }
func file_app_log_command_config_proto_init() {
if File_app_log_command_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_log_command_config_proto_rawDesc), len(file_app_log_command_config_proto_rawDesc)),
NumEnums: 0,
NumMessages: 3,
NumExtensions: 0,
NumServices: 1,
},
GoTypes: file_app_log_command_config_proto_goTypes,
DependencyIndexes: file_app_log_command_config_proto_depIdxs,
MessageInfos: file_app_log_command_config_proto_msgTypes,
}.Build()
File_app_log_command_config_proto = out.File
file_app_log_command_config_proto_goTypes = nil
file_app_log_command_config_proto_depIdxs = nil
}

View file

@ -1,17 +0,0 @@
syntax = "proto3";
package xray.app.log.command;
option csharp_namespace = "Xray.App.Log.Command";
option go_package = "github.com/xtls/xray-core/app/log/command";
option java_package = "com.xray.app.log.command";
option java_multiple_files = true;
message Config {}
message RestartLoggerRequest {}
message RestartLoggerResponse {}
service LoggerService {
rpc RestartLogger(RestartLoggerRequest) returns (RestartLoggerResponse) {}
}

View file

@ -1,121 +0,0 @@
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
// versions:
// - protoc-gen-go-grpc v1.6.0
// - protoc v6.33.5
// source: app/log/command/config.proto
package command
import (
context "context"
grpc "google.golang.org/grpc"
codes "google.golang.org/grpc/codes"
status "google.golang.org/grpc/status"
)
// This is a compile-time assertion to ensure that this generated file
// is compatible with the grpc package it is being compiled against.
// Requires gRPC-Go v1.64.0 or later.
const _ = grpc.SupportPackageIsVersion9
const (
LoggerService_RestartLogger_FullMethodName = "/xray.app.log.command.LoggerService/RestartLogger"
)
// LoggerServiceClient is the client API for LoggerService service.
//
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
type LoggerServiceClient interface {
RestartLogger(ctx context.Context, in *RestartLoggerRequest, opts ...grpc.CallOption) (*RestartLoggerResponse, error)
}
type loggerServiceClient struct {
cc grpc.ClientConnInterface
}
func NewLoggerServiceClient(cc grpc.ClientConnInterface) LoggerServiceClient {
return &loggerServiceClient{cc}
}
func (c *loggerServiceClient) RestartLogger(ctx context.Context, in *RestartLoggerRequest, opts ...grpc.CallOption) (*RestartLoggerResponse, error) {
cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...)
out := new(RestartLoggerResponse)
err := c.cc.Invoke(ctx, LoggerService_RestartLogger_FullMethodName, in, out, cOpts...)
if err != nil {
return nil, err
}
return out, nil
}
// LoggerServiceServer is the server API for LoggerService service.
// All implementations must embed UnimplementedLoggerServiceServer
// for forward compatibility.
type LoggerServiceServer interface {
RestartLogger(context.Context, *RestartLoggerRequest) (*RestartLoggerResponse, error)
mustEmbedUnimplementedLoggerServiceServer()
}
// UnimplementedLoggerServiceServer must be embedded to have
// forward compatible implementations.
//
// NOTE: this should be embedded by value instead of pointer to avoid a nil
// pointer dereference when methods are called.
type UnimplementedLoggerServiceServer struct{}
func (UnimplementedLoggerServiceServer) RestartLogger(context.Context, *RestartLoggerRequest) (*RestartLoggerResponse, error) {
return nil, status.Error(codes.Unimplemented, "method RestartLogger not implemented")
}
func (UnimplementedLoggerServiceServer) mustEmbedUnimplementedLoggerServiceServer() {}
func (UnimplementedLoggerServiceServer) testEmbeddedByValue() {}
// UnsafeLoggerServiceServer may be embedded to opt out of forward compatibility for this service.
// Use of this interface is not recommended, as added methods to LoggerServiceServer will
// result in compilation errors.
type UnsafeLoggerServiceServer interface {
mustEmbedUnimplementedLoggerServiceServer()
}
func RegisterLoggerServiceServer(s grpc.ServiceRegistrar, srv LoggerServiceServer) {
// If the following call panics, it indicates UnimplementedLoggerServiceServer was
// embedded by pointer and is nil. This will cause panics if an
// unimplemented method is ever invoked, so we test this at initialization
// time to prevent it from happening at runtime later due to I/O.
if t, ok := srv.(interface{ testEmbeddedByValue() }); ok {
t.testEmbeddedByValue()
}
s.RegisterService(&LoggerService_ServiceDesc, srv)
}
func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(RestartLoggerRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(LoggerServiceServer).RestartLogger(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: LoggerService_RestartLogger_FullMethodName,
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(LoggerServiceServer).RestartLogger(ctx, req.(*RestartLoggerRequest))
}
return interceptor(ctx, in, info, handler)
}
// LoggerService_ServiceDesc is the grpc.ServiceDesc for LoggerService service.
// It's only intended for direct use with grpc.RegisterService,
// and not to be introspected or modified (even as a copy)
var LoggerService_ServiceDesc = grpc.ServiceDesc{
ServiceName: "xray.app.log.command.LoggerService",
HandlerType: (*LoggerServiceServer)(nil),
Methods: []grpc.MethodDesc{
{
MethodName: "RestartLogger",
Handler: _LoggerService_RestartLogger_Handler,
},
},
Streams: []grpc.StreamDesc{},
Metadata: "app/log/command/config.proto",
}

View file

@ -1,242 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/log/config.proto
package log
import (
log "github.com/xtls/xray-core/common/log"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type LogType int32
const (
LogType_None LogType = 0
LogType_Console LogType = 1
LogType_File LogType = 2
LogType_Event LogType = 3
)
// Enum value maps for LogType.
var (
LogType_name = map[int32]string{
0: "None",
1: "Console",
2: "File",
3: "Event",
}
LogType_value = map[string]int32{
"None": 0,
"Console": 1,
"File": 2,
"Event": 3,
}
)
func (x LogType) Enum() *LogType {
p := new(LogType)
*p = x
return p
}
func (x LogType) String() string {
return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
}
func (LogType) Descriptor() protoreflect.EnumDescriptor {
return file_app_log_config_proto_enumTypes[0].Descriptor()
}
func (LogType) Type() protoreflect.EnumType {
return &file_app_log_config_proto_enumTypes[0]
}
func (x LogType) Number() protoreflect.EnumNumber {
return protoreflect.EnumNumber(x)
}
// Deprecated: Use LogType.Descriptor instead.
func (LogType) EnumDescriptor() ([]byte, []int) {
return file_app_log_config_proto_rawDescGZIP(), []int{0}
}
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
ErrorLogType LogType `protobuf:"varint,1,opt,name=error_log_type,json=errorLogType,proto3,enum=xray.app.log.LogType" json:"error_log_type,omitempty"`
ErrorLogLevel log.Severity `protobuf:"varint,2,opt,name=error_log_level,json=errorLogLevel,proto3,enum=xray.common.log.Severity" json:"error_log_level,omitempty"`
ErrorLogPath string `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
AccessLogType LogType `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
AccessLogPath string `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
EnableDnsLog bool `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
MaskAddress string `protobuf:"bytes,7,opt,name=mask_address,json=maskAddress,proto3" json:"mask_address,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_log_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_log_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_log_config_proto_rawDescGZIP(), []int{0}
}
func (x *Config) GetErrorLogType() LogType {
if x != nil {
return x.ErrorLogType
}
return LogType_None
}
func (x *Config) GetErrorLogLevel() log.Severity {
if x != nil {
return x.ErrorLogLevel
}
return log.Severity(0)
}
func (x *Config) GetErrorLogPath() string {
if x != nil {
return x.ErrorLogPath
}
return ""
}
func (x *Config) GetAccessLogType() LogType {
if x != nil {
return x.AccessLogType
}
return LogType_None
}
func (x *Config) GetAccessLogPath() string {
if x != nil {
return x.AccessLogPath
}
return ""
}
func (x *Config) GetEnableDnsLog() bool {
if x != nil {
return x.EnableDnsLog
}
return false
}
func (x *Config) GetMaskAddress() string {
if x != nil {
return x.MaskAddress
}
return ""
}
var File_app_log_config_proto protoreflect.FileDescriptor
const file_app_log_config_proto_rawDesc = "" +
"\n" +
"\x14app/log/config.proto\x12\fxray.app.log\x1a\x14common/log/log.proto\"\xde\x02\n" +
"\x06Config\x12;\n" +
"\x0eerror_log_type\x18\x01 \x01(\x0e2\x15.xray.app.log.LogTypeR\ferrorLogType\x12A\n" +
"\x0ferror_log_level\x18\x02 \x01(\x0e2\x19.xray.common.log.SeverityR\rerrorLogLevel\x12$\n" +
"\x0eerror_log_path\x18\x03 \x01(\tR\ferrorLogPath\x12=\n" +
"\x0faccess_log_type\x18\x04 \x01(\x0e2\x15.xray.app.log.LogTypeR\raccessLogType\x12&\n" +
"\x0faccess_log_path\x18\x05 \x01(\tR\raccessLogPath\x12$\n" +
"\x0eenable_dns_log\x18\x06 \x01(\bR\fenableDnsLog\x12!\n" +
"\fmask_address\x18\a \x01(\tR\vmaskAddress*5\n" +
"\aLogType\x12\b\n" +
"\x04None\x10\x00\x12\v\n" +
"\aConsole\x10\x01\x12\b\n" +
"\x04File\x10\x02\x12\t\n" +
"\x05Event\x10\x03BF\n" +
"\x10com.xray.app.logP\x01Z!github.com/xtls/xray-core/app/log\xaa\x02\fXray.App.Logb\x06proto3"
var (
file_app_log_config_proto_rawDescOnce sync.Once
file_app_log_config_proto_rawDescData []byte
)
func file_app_log_config_proto_rawDescGZIP() []byte {
file_app_log_config_proto_rawDescOnce.Do(func() {
file_app_log_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_log_config_proto_rawDesc), len(file_app_log_config_proto_rawDesc)))
})
return file_app_log_config_proto_rawDescData
}
var file_app_log_config_proto_enumTypes = make([]protoimpl.EnumInfo, 1)
var file_app_log_config_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
var file_app_log_config_proto_goTypes = []any{
(LogType)(0), // 0: xray.app.log.LogType
(*Config)(nil), // 1: xray.app.log.Config
(log.Severity)(0), // 2: xray.common.log.Severity
}
var file_app_log_config_proto_depIdxs = []int32{
0, // 0: xray.app.log.Config.error_log_type:type_name -> xray.app.log.LogType
2, // 1: xray.app.log.Config.error_log_level:type_name -> xray.common.log.Severity
0, // 2: xray.app.log.Config.access_log_type:type_name -> xray.app.log.LogType
3, // [3:3] is the sub-list for method output_type
3, // [3:3] is the sub-list for method input_type
3, // [3:3] is the sub-list for extension type_name
3, // [3:3] is the sub-list for extension extendee
0, // [0:3] is the sub-list for field type_name
}
func init() { file_app_log_config_proto_init() }
func file_app_log_config_proto_init() {
if File_app_log_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_log_config_proto_rawDesc), len(file_app_log_config_proto_rawDesc)),
NumEnums: 1,
NumMessages: 1,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_log_config_proto_goTypes,
DependencyIndexes: file_app_log_config_proto_depIdxs,
EnumInfos: file_app_log_config_proto_enumTypes,
MessageInfos: file_app_log_config_proto_msgTypes,
}.Build()
File_app_log_config_proto = out.File
file_app_log_config_proto_goTypes = nil
file_app_log_config_proto_depIdxs = nil
}

View file

@ -1,27 +0,0 @@
syntax = "proto3";
package xray.app.log;
option csharp_namespace = "Xray.App.Log";
option go_package = "github.com/xtls/xray-core/app/log";
option java_package = "com.xray.app.log";
option java_multiple_files = true;
import "common/log/log.proto";
enum LogType {
None = 0;
Console = 1;
File = 2;
Event = 3;
}
message Config {
LogType error_log_type = 1;
xray.common.log.Severity error_log_level = 2;
string error_log_path = 3;
LogType access_log_type = 4;
string access_log_path = 5;
bool enable_dns_log = 6;
string mask_address= 7;
}

View file

@ -1,256 +0,0 @@
package log
import (
"context"
"net"
"regexp"
"strconv"
"strings"
"sync"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
)
// Instance is a log.Handler that handles logs.
type Instance struct {
sync.RWMutex
config *Config
accessLogger log.Handler
errorLogger log.Handler
active bool
dns bool
mask4 int
mask6 int
}
// New creates a new log.Instance based on the given config.
func New(ctx context.Context, config *Config) (*Instance, error) {
m4, m6, err := ParseMaskAddress(config.MaskAddress)
if err != nil {
return nil, err
}
g := &Instance{
config: config,
active: false,
dns: config.EnableDnsLog,
mask4: m4,
mask6: m6,
}
log.RegisterHandler(g)
// start logger now,
// then other modules will be able to log during initialization
if err := g.startInternal(); err != nil {
return nil, err
}
errors.LogDebug(ctx, "Logger started")
return g, nil
}
func (g *Instance) initAccessLogger() error {
handler, err := createHandler(g.config.AccessLogType, HandlerCreatorOptions{
Path: g.config.AccessLogPath,
})
if err != nil {
return err
}
g.accessLogger = handler
return nil
}
func (g *Instance) initErrorLogger() error {
handler, err := createHandler(g.config.ErrorLogType, HandlerCreatorOptions{
Path: g.config.ErrorLogPath,
})
if err != nil {
return err
}
g.errorLogger = handler
return nil
}
// Type implements common.HasType.
func (*Instance) Type() interface{} {
return (*Instance)(nil)
}
func (g *Instance) startInternal() error {
g.Lock()
defer g.Unlock()
if g.active {
return nil
}
g.active = true
if err := g.initAccessLogger(); err != nil {
return errors.New("failed to initialize access logger").Base(err).AtWarning()
}
if err := g.initErrorLogger(); err != nil {
return errors.New("failed to initialize error logger").Base(err).AtWarning()
}
return nil
}
// Start implements common.Runnable.Start().
func (g *Instance) Start() error {
return g.startInternal()
}
// Handle implements log.Handler.
func (g *Instance) Handle(msg log.Message) {
g.RLock()
defer g.RUnlock()
if !g.active {
return
}
var Msg log.Message
if g.config.MaskAddress != "" {
Msg = &MaskedMsgWrapper{
Message: msg,
Mask4: g.mask4,
Mask6: g.mask6,
}
} else {
Msg = msg
}
switch msg := msg.(type) {
case *log.AccessMessage:
if g.accessLogger != nil {
g.accessLogger.Handle(Msg)
}
case *log.DNSLog:
if g.dns && g.accessLogger != nil {
g.accessLogger.Handle(Msg)
}
case *log.GeneralMessage:
if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
g.errorLogger.Handle(Msg)
}
default:
// Swallow
}
}
// Close implements common.Closable.Close().
func (g *Instance) Close() error {
errors.LogDebug(context.Background(), "Logger closing")
g.Lock()
defer g.Unlock()
if !g.active {
return nil
}
g.active = false
common.Close(g.accessLogger)
g.accessLogger = nil
common.Close(g.errorLogger)
g.errorLogger = nil
return nil
}
func ParseMaskAddress(c string) (int, int, error) {
var m4, m6 int
switch c {
case "half":
m4, m6 = 16, 32
case "quarter":
m4, m6 = 8, 16
case "full":
m4, m6 = 0, 0
case "":
// do nothing
default:
if parts := strings.Split(c, "+"); len(parts) > 0 {
if len(parts) >= 1 && parts[0] != "" {
i, err := strconv.Atoi(strings.TrimPrefix(parts[0], "/"))
if err != nil {
return 32, 128, err
}
m4 = i
}
if len(parts) >= 2 && parts[1] != "" {
i, err := strconv.Atoi(strings.TrimPrefix(parts[1], "/"))
if err != nil {
return 32, 128, err
}
m6 = i
}
}
}
if m4%8 != 0 || m4 > 32 || m4 < 0 {
return 32, 128, errors.New("Log Mask: ipv4 mask must be divisible by 8 and between 0-32")
}
return m4, m6, nil
}
// MaskedMsgWrapper is to wrap the string() method to mask IP addresses in the log.
type MaskedMsgWrapper struct {
log.Message
Mask4 int
Mask6 int
}
var (
ipv4Regex = regexp.MustCompile(`(\d{1,3}\.){3}\d{1,3}`)
ipv6Regex = regexp.MustCompile(`(?:[\da-fA-F]{0,4}:[\da-fA-F]{0,4}){2,7}`)
)
func (m *MaskedMsgWrapper) String() string {
str := m.Message.String()
// Process ipv4
maskedMsg := ipv4Regex.ReplaceAllStringFunc(str, func(s string) string {
if m.Mask4 == 32 {
return s
}
if m.Mask4 == 0 {
return "[Masked IPv4]"
}
parts := strings.Split(s, ".")
for i := m.Mask4 / 8; i < 4; i++ {
parts[i] = "*"
}
return strings.Join(parts, ".")
})
// process ipv6
maskedMsg = ipv6Regex.ReplaceAllStringFunc(maskedMsg, func(s string) string {
if m.Mask6 == 128 {
return s
}
if m.Mask6 == 0 {
return "Masked IPv6"
}
ip := net.ParseIP(s)
if ip == nil {
return s
}
return ip.Mask(net.CIDRMask(m.Mask6, 128)).String() + "/" + strconv.Itoa(m.Mask6)
})
return maskedMsg
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}

View file

@ -1,60 +0,0 @@
package log
import (
"sync"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/log"
)
type HandlerCreatorOptions struct {
Path string
}
type HandlerCreator func(LogType, HandlerCreatorOptions) (log.Handler, error)
var handlerCreatorMap = make(map[LogType]HandlerCreator)
var handlerCreatorMapLock = &sync.RWMutex{}
func RegisterHandlerCreator(logType LogType, f HandlerCreator) error {
if f == nil {
return errors.New("nil HandlerCreator")
}
handlerCreatorMapLock.Lock()
defer handlerCreatorMapLock.Unlock()
handlerCreatorMap[logType] = f
return nil
}
func createHandler(logType LogType, options HandlerCreatorOptions) (log.Handler, error) {
handlerCreatorMapLock.RLock()
defer handlerCreatorMapLock.RUnlock()
creator, found := handlerCreatorMap[logType]
if !found {
return nil, errors.New("unable to create log handler for ", logType)
}
return creator(logType, options)
}
func init() {
common.Must(RegisterHandlerCreator(LogType_Console, func(lt LogType, options HandlerCreatorOptions) (log.Handler, error) {
return log.NewLogger(log.CreateStdoutLogWriter()), nil
}))
common.Must(RegisterHandlerCreator(LogType_File, func(lt LogType, options HandlerCreatorOptions) (log.Handler, error) {
creator, err := log.CreateFileLogWriter(options.Path)
if err != nil {
return nil, err
}
return log.NewLogger(creator), nil
}))
common.Must(RegisterHandlerCreator(LogType_None, func(lt LogType, options HandlerCreatorOptions) (log.Handler, error) {
return nil, nil
}))
}

View file

@ -1,89 +0,0 @@
package log_test
import (
"context"
"net"
"testing"
"github.com/golang/mock/gomock"
"github.com/xtls/xray-core/app/log"
"github.com/xtls/xray-core/common"
clog "github.com/xtls/xray-core/common/log"
"github.com/xtls/xray-core/testing/mocks"
)
func TestCustomLogHandler(t *testing.T) {
mockCtl := gomock.NewController(t)
defer mockCtl.Finish()
var loggedValue []string
mockHandler := mocks.NewLogHandler(mockCtl)
mockHandler.EXPECT().Handle(gomock.Any()).AnyTimes().DoAndReturn(func(msg clog.Message) {
loggedValue = append(loggedValue, msg.String())
})
log.RegisterHandlerCreator(log.LogType_Console, func(lt log.LogType, options log.HandlerCreatorOptions) (clog.Handler, error) {
return mockHandler, nil
})
logger, err := log.New(context.Background(), &log.Config{
ErrorLogLevel: clog.Severity_Debug,
ErrorLogType: log.LogType_Console,
AccessLogType: log.LogType_None,
})
common.Must(err)
common.Must(logger.Start())
clog.Record(&clog.GeneralMessage{
Severity: clog.Severity_Debug,
Content: "test",
})
if len(loggedValue) < 2 {
t.Fatal("expected 2 log messages, but actually ", loggedValue)
}
if loggedValue[1] != "[Debug] test" {
t.Fatal("expected '[Debug] test', but actually ", loggedValue[1])
}
common.Must(logger.Close())
}
func TestMaskAddress(t *testing.T) {
m4, m6, err := log.ParseMaskAddress("half")
if err != nil {
t.Fatal(err)
}
maskedAddr := log.MaskedMsgWrapper{
Mask4: m4,
Mask6: m6,
}
maskedAddr.Message = net.ParseIP("11.45.1.4")
if maskedAddr.String() != "11.45.*.*" {
t.Fatal("expected '11.45.*.*', but actually ", maskedAddr.String())
}
maskedAddr.Message = net.ParseIP("11:45:14:19:19:81:0::")
if maskedAddr.String() != "11:45::/32" {
t.Fatal("expected '11:45::/32', but actually", maskedAddr.String())
}
m4, m6, err = log.ParseMaskAddress("/16+/64")
if err != nil {
t.Fatal(err)
}
maskedAddr = log.MaskedMsgWrapper{
Mask4: m4,
Mask6: m6,
}
maskedAddr.Message = net.ParseIP("11.45.1.4")
if maskedAddr.String() != "11.45.*.*" {
t.Fatal("expected '11.45.*.*', but actually ", maskedAddr.String())
}
maskedAddr.Message = net.ParseIP("11:45:14:19:19:81:0::")
if maskedAddr.String() != "11:45:14:19::/64" {
t.Fatal("expected '11:45:14:19::/64', but actually", maskedAddr.String())
}
}

View file

@ -1,134 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/metrics/config.proto
package metrics
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
// Config is the settings for metrics.
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
// Tag of the outbound handler that handles metrics http connections.
Tag string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
Listen string `protobuf:"bytes,2,opt,name=listen,proto3" json:"listen,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_metrics_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_metrics_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_metrics_config_proto_rawDescGZIP(), []int{0}
}
func (x *Config) GetTag() string {
if x != nil {
return x.Tag
}
return ""
}
func (x *Config) GetListen() string {
if x != nil {
return x.Listen
}
return ""
}
var File_app_metrics_config_proto protoreflect.FileDescriptor
const file_app_metrics_config_proto_rawDesc = "" +
"\n" +
"\x18app/metrics/config.proto\x12\x10xray.app.metrics\"2\n" +
"\x06Config\x12\x10\n" +
"\x03tag\x18\x01 \x01(\tR\x03tag\x12\x16\n" +
"\x06listen\x18\x02 \x01(\tR\x06listenBR\n" +
"\x14com.xray.app.metricsP\x01Z%github.com/xtls/xray-core/app/metrics\xaa\x02\x10Xray.App.Metricsb\x06proto3"
var (
file_app_metrics_config_proto_rawDescOnce sync.Once
file_app_metrics_config_proto_rawDescData []byte
)
func file_app_metrics_config_proto_rawDescGZIP() []byte {
file_app_metrics_config_proto_rawDescOnce.Do(func() {
file_app_metrics_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_metrics_config_proto_rawDesc), len(file_app_metrics_config_proto_rawDesc)))
})
return file_app_metrics_config_proto_rawDescData
}
var file_app_metrics_config_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
var file_app_metrics_config_proto_goTypes = []any{
(*Config)(nil), // 0: xray.app.metrics.Config
}
var file_app_metrics_config_proto_depIdxs = []int32{
0, // [0:0] is the sub-list for method output_type
0, // [0:0] is the sub-list for method input_type
0, // [0:0] is the sub-list for extension type_name
0, // [0:0] is the sub-list for extension extendee
0, // [0:0] is the sub-list for field type_name
}
func init() { file_app_metrics_config_proto_init() }
func file_app_metrics_config_proto_init() {
if File_app_metrics_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_metrics_config_proto_rawDesc), len(file_app_metrics_config_proto_rawDesc)),
NumEnums: 0,
NumMessages: 1,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_metrics_config_proto_goTypes,
DependencyIndexes: file_app_metrics_config_proto_depIdxs,
MessageInfos: file_app_metrics_config_proto_msgTypes,
}.Build()
File_app_metrics_config_proto = out.File
file_app_metrics_config_proto_goTypes = nil
file_app_metrics_config_proto_depIdxs = nil
}

View file

@ -1,14 +0,0 @@
syntax = "proto3";
package xray.app.metrics;
option csharp_namespace = "Xray.App.Metrics";
option go_package = "github.com/xtls/xray-core/app/metrics";
option java_package = "com.xray.app.metrics";
option java_multiple_files = true;
// Config is the settings for metrics.
message Config {
// Tag of the outbound handler that handles metrics http connections.
string tag = 1;
string listen = 2;
}

View file

@ -1,139 +0,0 @@
package metrics
import (
"context"
"expvar"
"net/http"
_ "net/http/pprof"
"strings"
"github.com/xtls/xray-core/app/observatory"
"github.com/xtls/xray-core/app/stats"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/extension"
"github.com/xtls/xray-core/features/outbound"
feature_stats "github.com/xtls/xray-core/features/stats"
)
type MetricsHandler struct {
ohm outbound.Manager
statsManager feature_stats.Manager
observatory extension.Observatory
tag string
listen string
tcpListener net.Listener
}
// NewMetricsHandler creates a new MetricsHandler based on the given config.
func NewMetricsHandler(ctx context.Context, config *Config) (*MetricsHandler, error) {
c := &MetricsHandler{
tag: config.Tag,
listen: config.Listen,
}
common.Must(core.RequireFeatures(ctx, func(om outbound.Manager, sm feature_stats.Manager) {
c.statsManager = sm
c.ohm = om
}))
expvar.Publish("stats", expvar.Func(func() interface{} {
manager, ok := c.statsManager.(*stats.Manager)
if !ok {
return nil
}
resp := map[string]map[string]map[string]int64{
"inbound": {},
"outbound": {},
"user": {},
}
manager.VisitCounters(func(name string, counter feature_stats.Counter) bool {
nameSplit := strings.Split(name, ">>>")
typeName, tagOrUser, direction := nameSplit[0], nameSplit[1], nameSplit[3]
if item, found := resp[typeName][tagOrUser]; found {
item[direction] = counter.Value()
} else {
resp[typeName][tagOrUser] = map[string]int64{
direction: counter.Value(),
}
}
return true
})
return resp
}))
expvar.Publish("observatory", expvar.Func(func() interface{} {
if c.observatory == nil {
common.Must(core.RequireFeatures(ctx, func(observatory extension.Observatory) error {
c.observatory = observatory
return nil
}))
if c.observatory == nil {
return nil
}
}
resp := map[string]*observatory.OutboundStatus{}
if o, err := c.observatory.GetObservation(context.Background()); err != nil {
return err
} else {
for _, x := range o.(*observatory.ObservationResult).GetStatus() {
resp[x.OutboundTag] = x
}
}
return resp
}))
return c, nil
}
func (p *MetricsHandler) Type() interface{} {
return (*MetricsHandler)(nil)
}
func (p *MetricsHandler) Start() error {
// direct listen a port if listen is set
if p.listen != "" {
TCPlistener, err := net.Listen("tcp", p.listen)
if err != nil {
return err
}
p.tcpListener = TCPlistener
errors.LogInfo(context.Background(), "Metrics server listening on ", p.listen)
go func() {
if err := http.Serve(TCPlistener, http.DefaultServeMux); err != nil {
errors.LogErrorInner(context.Background(), err, "failed to start metrics server")
}
}()
}
listener := &OutboundListener{
buffer: make(chan net.Conn, 4),
done: done.New(),
}
go func() {
if err := http.Serve(listener, http.DefaultServeMux); err != nil {
errors.LogErrorInner(context.Background(), err, "failed to start metrics server")
}
}()
if err := p.ohm.RemoveHandler(context.Background(), p.tag); err != nil {
errors.LogInfo(context.Background(), "failed to remove existing handler")
}
return p.ohm.AddHandler(context.Background(), &Outbound{
tag: p.tag,
listener: listener,
})
}
func (p *MetricsHandler) Close() error {
return nil
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
return NewMetricsHandler(ctx, cfg.(*Config))
}))
}

View file

@ -1,121 +0,0 @@
package metrics
import (
"context"
"sync"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/net/cnc"
"github.com/xtls/xray-core/common/serial"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/transport"
)
// OutboundListener is a net.Listener for listening metrics http connections.
type OutboundListener struct {
buffer chan net.Conn
done *done.Instance
}
func (l *OutboundListener) add(conn net.Conn) {
select {
case l.buffer <- conn:
case <-l.done.Wait():
conn.Close()
default:
conn.Close()
}
}
// Accept implements net.Listener.
func (l *OutboundListener) Accept() (net.Conn, error) {
select {
case <-l.done.Wait():
return nil, errors.New("listen closed")
case c := <-l.buffer:
return c, nil
}
}
// Close implement net.Listener.
func (l *OutboundListener) Close() error {
common.Must(l.done.Close())
L:
for {
select {
case c := <-l.buffer:
c.Close()
default:
break L
}
}
return nil
}
// Addr implements net.Listener.
func (l *OutboundListener) Addr() net.Addr {
return &net.TCPAddr{
IP: net.IP{0, 0, 0, 0},
Port: 0,
}
}
// Outbound is an outbound.Handler that handles metrics http connections.
type Outbound struct {
tag string
listener *OutboundListener
access sync.RWMutex
closed bool
}
// Dispatch implements outbound.Handler.
func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
co.access.RLock()
if co.closed {
common.Interrupt(link.Reader)
common.Interrupt(link.Writer)
co.access.RUnlock()
return
}
closeSignal := done.New()
c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
co.listener.add(c)
co.access.RUnlock()
<-closeSignal.Wait()
}
// Tag implements outbound.Handler.
func (co *Outbound) Tag() string {
return co.tag
}
// Start implements common.Runnable.
func (co *Outbound) Start() error {
co.access.Lock()
co.closed = false
co.access.Unlock()
return nil
}
// Close implements common.Closable.
func (co *Outbound) Close() error {
co.access.Lock()
defer co.access.Unlock()
co.closed = true
return co.listener.Close()
}
// SenderSettings implements outbound.Handler.
func (co *Outbound) SenderSettings() *serial.TypedMessage {
return nil
}
// ProxySettings implements outbound.Handler.
func (co *Outbound) ProxySettings() *serial.TypedMessage {
return nil
}

View file

@ -1,12 +0,0 @@
package burst
import (
"math"
"time"
)
const (
rttFailed = time.Duration(math.MaxInt64 - iota)
rttUntested
rttUnqualified
)

View file

@ -1,117 +0,0 @@
package burst
import (
"context"
"sync"
"github.com/xtls/xray-core/app/observatory"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/extension"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/features/routing"
"google.golang.org/protobuf/proto"
)
type Observer struct {
config *Config
ctx context.Context
statusLock sync.Mutex
hp *HealthPing
finished *done.Instance
ohm outbound.Manager
}
func (o *Observer) GetObservation(ctx context.Context) (proto.Message, error) {
return &observatory.ObservationResult{Status: o.createResult()}, nil
}
func (o *Observer) Check(tag []string) {
o.hp.Check(tag)
}
func (o *Observer) createResult() []*observatory.OutboundStatus {
var result []*observatory.OutboundStatus
o.hp.access.Lock()
defer o.hp.access.Unlock()
for name, value := range o.hp.Results {
status := observatory.OutboundStatus{
Alive: value.getStatistics().All != value.getStatistics().Fail,
Delay: value.getStatistics().Average.Milliseconds(),
LastErrorReason: "",
OutboundTag: name,
LastSeenTime: 0,
LastTryTime: 0,
HealthPing: &observatory.HealthPingMeasurementResult{
All: int64(value.getStatistics().All),
Fail: int64(value.getStatistics().Fail),
Deviation: int64(value.getStatistics().Deviation),
Average: int64(value.getStatistics().Average),
Max: int64(value.getStatistics().Max),
Min: int64(value.getStatistics().Min),
},
}
result = append(result, &status)
}
return result
}
func (o *Observer) Type() interface{} {
return extension.ObservatoryType()
}
func (o *Observer) Start() error {
if o.config != nil && len(o.config.SubjectSelector) != 0 {
o.finished = done.New()
o.hp.StartScheduler(func() ([]string, error) {
hs, ok := o.ohm.(outbound.HandlerSelector)
if !ok {
return nil, errors.New("outbound.Manager is not a HandlerSelector")
}
outbounds := hs.Select(o.config.SubjectSelector)
return outbounds, nil
})
}
return nil
}
func (o *Observer) Close() error {
if o.finished != nil {
o.hp.StopScheduler()
return o.finished.Close()
}
return nil
}
func New(ctx context.Context, config *Config) (*Observer, error) {
var outboundManager outbound.Manager
var dispatcher routing.Dispatcher
err := core.RequireFeatures(ctx, func(om outbound.Manager, rd routing.Dispatcher) {
outboundManager = om
dispatcher = rd
})
if err != nil {
return nil, errors.New("Cannot get depended features").Base(err)
}
hp := NewHealthPing(ctx, dispatcher, config.PingConfig)
return &Observer{
config: config,
ctx: ctx,
ohm: outboundManager,
hp: hp,
}, nil
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}

View file

@ -1,236 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/observatory/burst/config.proto
package burst
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
// @Document The selectors for outbound under observation
SubjectSelector []string `protobuf:"bytes,2,rep,name=subject_selector,json=subjectSelector,proto3" json:"subject_selector,omitempty"`
PingConfig *HealthPingConfig `protobuf:"bytes,3,opt,name=ping_config,json=pingConfig,proto3" json:"ping_config,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_observatory_burst_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_burst_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_observatory_burst_config_proto_rawDescGZIP(), []int{0}
}
func (x *Config) GetSubjectSelector() []string {
if x != nil {
return x.SubjectSelector
}
return nil
}
func (x *Config) GetPingConfig() *HealthPingConfig {
if x != nil {
return x.PingConfig
}
return nil
}
type HealthPingConfig struct {
state protoimpl.MessageState `protogen:"open.v1"`
// destination url, need 204 for success return
// default https://connectivitycheck.gstatic.com/generate_204
Destination string `protobuf:"bytes,1,opt,name=destination,proto3" json:"destination,omitempty"`
// connectivity check url
Connectivity string `protobuf:"bytes,2,opt,name=connectivity,proto3" json:"connectivity,omitempty"`
// health check interval, int64 values of time.Duration
Interval int64 `protobuf:"varint,3,opt,name=interval,proto3" json:"interval,omitempty"`
// sampling count is the amount of recent ping results which are kept for calculation
SamplingCount int32 `protobuf:"varint,4,opt,name=samplingCount,proto3" json:"samplingCount,omitempty"`
// ping timeout, int64 values of time.Duration
Timeout int64 `protobuf:"varint,5,opt,name=timeout,proto3" json:"timeout,omitempty"`
// http method to make request
HttpMethod string `protobuf:"bytes,6,opt,name=httpMethod,proto3" json:"httpMethod,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *HealthPingConfig) Reset() {
*x = HealthPingConfig{}
mi := &file_app_observatory_burst_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *HealthPingConfig) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*HealthPingConfig) ProtoMessage() {}
func (x *HealthPingConfig) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_burst_config_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use HealthPingConfig.ProtoReflect.Descriptor instead.
func (*HealthPingConfig) Descriptor() ([]byte, []int) {
return file_app_observatory_burst_config_proto_rawDescGZIP(), []int{1}
}
func (x *HealthPingConfig) GetDestination() string {
if x != nil {
return x.Destination
}
return ""
}
func (x *HealthPingConfig) GetConnectivity() string {
if x != nil {
return x.Connectivity
}
return ""
}
func (x *HealthPingConfig) GetInterval() int64 {
if x != nil {
return x.Interval
}
return 0
}
func (x *HealthPingConfig) GetSamplingCount() int32 {
if x != nil {
return x.SamplingCount
}
return 0
}
func (x *HealthPingConfig) GetTimeout() int64 {
if x != nil {
return x.Timeout
}
return 0
}
func (x *HealthPingConfig) GetHttpMethod() string {
if x != nil {
return x.HttpMethod
}
return ""
}
var File_app_observatory_burst_config_proto protoreflect.FileDescriptor
const file_app_observatory_burst_config_proto_rawDesc = "" +
"\n" +
"\"app/observatory/burst/config.proto\x12\x1fxray.core.app.observatory.burst\"\x87\x01\n" +
"\x06Config\x12)\n" +
"\x10subject_selector\x18\x02 \x03(\tR\x0fsubjectSelector\x12R\n" +
"\vping_config\x18\x03 \x01(\v21.xray.core.app.observatory.burst.HealthPingConfigR\n" +
"pingConfig\"\xd4\x01\n" +
"\x10HealthPingConfig\x12 \n" +
"\vdestination\x18\x01 \x01(\tR\vdestination\x12\"\n" +
"\fconnectivity\x18\x02 \x01(\tR\fconnectivity\x12\x1a\n" +
"\binterval\x18\x03 \x01(\x03R\binterval\x12$\n" +
"\rsamplingCount\x18\x04 \x01(\x05R\rsamplingCount\x12\x18\n" +
"\atimeout\x18\x05 \x01(\x03R\atimeout\x12\x1e\n" +
"\n" +
"httpMethod\x18\x06 \x01(\tR\n" +
"httpMethodBp\n" +
"\x1ecom.xray.app.observatory.burstP\x01Z/github.com/xtls/xray-core/app/observatory/burst\xaa\x02\x1aXray.App.Observatory.Burstb\x06proto3"
var (
file_app_observatory_burst_config_proto_rawDescOnce sync.Once
file_app_observatory_burst_config_proto_rawDescData []byte
)
func file_app_observatory_burst_config_proto_rawDescGZIP() []byte {
file_app_observatory_burst_config_proto_rawDescOnce.Do(func() {
file_app_observatory_burst_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_observatory_burst_config_proto_rawDesc), len(file_app_observatory_burst_config_proto_rawDesc)))
})
return file_app_observatory_burst_config_proto_rawDescData
}
var file_app_observatory_burst_config_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
var file_app_observatory_burst_config_proto_goTypes = []any{
(*Config)(nil), // 0: xray.core.app.observatory.burst.Config
(*HealthPingConfig)(nil), // 1: xray.core.app.observatory.burst.HealthPingConfig
}
var file_app_observatory_burst_config_proto_depIdxs = []int32{
1, // 0: xray.core.app.observatory.burst.Config.ping_config:type_name -> xray.core.app.observatory.burst.HealthPingConfig
1, // [1:1] is the sub-list for method output_type
1, // [1:1] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_observatory_burst_config_proto_init() }
func file_app_observatory_burst_config_proto_init() {
if File_app_observatory_burst_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_observatory_burst_config_proto_rawDesc), len(file_app_observatory_burst_config_proto_rawDesc)),
NumEnums: 0,
NumMessages: 2,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_observatory_burst_config_proto_goTypes,
DependencyIndexes: file_app_observatory_burst_config_proto_depIdxs,
MessageInfos: file_app_observatory_burst_config_proto_msgTypes,
}.Build()
File_app_observatory_burst_config_proto = out.File
file_app_observatory_burst_config_proto_goTypes = nil
file_app_observatory_burst_config_proto_depIdxs = nil
}

View file

@ -1,32 +0,0 @@
syntax = "proto3";
package xray.core.app.observatory.burst;
option csharp_namespace = "Xray.App.Observatory.Burst";
option go_package = "github.com/xtls/xray-core/app/observatory/burst";
option java_package = "com.xray.app.observatory.burst";
option java_multiple_files = true;
message Config {
/* @Document The selectors for outbound under observation
*/
repeated string subject_selector = 2;
HealthPingConfig ping_config = 3;
}
message HealthPingConfig {
// destination url, need 204 for success return
// default https://connectivitycheck.gstatic.com/generate_204
string destination = 1;
// connectivity check url
string connectivity = 2;
// health check interval, int64 values of time.Duration
int64 interval = 3;
// sampling count is the amount of recent ping results which are kept for calculation
int32 samplingCount = 4;
// ping timeout, int64 values of time.Duration
int64 timeout = 5;
// http method to make request
string httpMethod = 6;
}

View file

@ -1,268 +0,0 @@
package burst
import (
"context"
"fmt"
"strings"
"sync"
"time"
"github.com/xtls/xray-core/common/dice"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/features/routing"
)
// HealthPingSettings holds settings for health Checker
type HealthPingSettings struct {
Destination string `json:"destination"`
Connectivity string `json:"connectivity"`
Interval time.Duration `json:"interval"`
SamplingCount int `json:"sampling"`
Timeout time.Duration `json:"timeout"`
HttpMethod string `json:"httpMethod"`
}
// HealthPing is the health checker for balancers
type HealthPing struct {
ctx context.Context
dispatcher routing.Dispatcher
access sync.Mutex
ticker *time.Ticker
tickerClose chan struct{}
Settings *HealthPingSettings
Results map[string]*HealthPingRTTS
}
// NewHealthPing creates a new HealthPing with settings
func NewHealthPing(ctx context.Context, dispatcher routing.Dispatcher, config *HealthPingConfig) *HealthPing {
settings := &HealthPingSettings{}
if config != nil {
var httpMethod string
if config.HttpMethod == "" {
httpMethod = "HEAD"
} else {
httpMethod = strings.TrimSpace(config.HttpMethod)
}
settings = &HealthPingSettings{
Connectivity: strings.TrimSpace(config.Connectivity),
Destination: strings.TrimSpace(config.Destination),
Interval: time.Duration(config.Interval),
SamplingCount: int(config.SamplingCount),
Timeout: time.Duration(config.Timeout),
HttpMethod: httpMethod,
}
}
if settings.Destination == "" {
// Destination URL, need 204 for success return default to chromium
// https://github.com/chromium/chromium/blob/main/components/safety_check/url_constants.cc#L10
// https://chromium.googlesource.com/chromium/src/+/refs/heads/main/components/safety_check/url_constants.cc#10
settings.Destination = "https://connectivitycheck.gstatic.com/generate_204"
}
if settings.Interval == 0 {
settings.Interval = time.Duration(1) * time.Minute
} else if settings.Interval < 10 {
errors.LogWarning(ctx, "health check interval is too small, 10s is applied")
settings.Interval = time.Duration(10) * time.Second
}
if settings.SamplingCount <= 0 {
settings.SamplingCount = 10
}
if settings.Timeout <= 0 {
// results are saved after all health pings finish,
// a larger timeout could possibly makes checks run longer
settings.Timeout = time.Duration(5) * time.Second
}
return &HealthPing{
ctx: ctx,
dispatcher: dispatcher,
Settings: settings,
Results: nil,
}
}
// StartScheduler implements the HealthChecker
func (h *HealthPing) StartScheduler(selector func() ([]string, error)) {
if h.ticker != nil {
return
}
interval := h.Settings.Interval * time.Duration(h.Settings.SamplingCount)
ticker := time.NewTicker(interval)
tickerClose := make(chan struct{})
h.ticker = ticker
h.tickerClose = tickerClose
go func() {
tags, err := selector()
if err != nil {
errors.LogWarning(h.ctx, "error select outbounds for initial health check: ", err)
return
}
h.Check(tags)
}()
go func() {
for {
go func() {
tags, err := selector()
if err != nil {
errors.LogWarning(h.ctx, "error select outbounds for scheduled health check: ", err)
return
}
h.doCheck(tags, interval, h.Settings.SamplingCount)
h.Cleanup(tags)
}()
select {
case <-ticker.C:
continue
case <-tickerClose:
return
}
}
}()
}
// StopScheduler implements the HealthChecker
func (h *HealthPing) StopScheduler() {
if h.ticker == nil {
return
}
h.ticker.Stop()
h.ticker = nil
close(h.tickerClose)
h.tickerClose = nil
}
// Check implements the HealthChecker
func (h *HealthPing) Check(tags []string) error {
if len(tags) == 0 {
return nil
}
errors.LogInfo(h.ctx, "perform one-time health check for tags ", tags)
h.doCheck(tags, 0, 1)
return nil
}
type rtt struct {
handler string
value time.Duration
}
// doCheck performs the 'rounds' amount checks in given 'duration'. You should make
// sure all tags are valid for current balancer
func (h *HealthPing) doCheck(tags []string, duration time.Duration, rounds int) {
count := len(tags) * rounds
if count == 0 {
return
}
ch := make(chan *rtt, count)
for _, tag := range tags {
handler := tag
client := newPingClient(
h.ctx,
h.dispatcher,
h.Settings.Destination,
h.Settings.Timeout,
handler,
)
for i := 0; i < rounds; i++ {
delay := time.Duration(0)
if duration > 0 {
delay = time.Duration(dice.RollInt63n(int64(duration)))
}
time.AfterFunc(delay, func() {
errors.LogDebug(h.ctx, "checking ", handler)
delay, err := client.MeasureDelay(h.Settings.HttpMethod)
if err == nil {
ch <- &rtt{
handler: handler,
value: delay,
}
return
}
if !h.checkConnectivity() {
errors.LogWarning(h.ctx, "network is down")
ch <- &rtt{
handler: handler,
value: 0,
}
return
}
errors.LogWarning(h.ctx, fmt.Sprintf(
"error ping %s with %s: %s",
h.Settings.Destination,
handler,
err,
))
ch <- &rtt{
handler: handler,
value: rttFailed,
}
})
}
}
for i := 0; i < count; i++ {
rtt := <-ch
if rtt.value > 0 {
// should not put results when network is down
h.PutResult(rtt.handler, rtt.value)
}
}
}
// PutResult put a ping rtt to results
func (h *HealthPing) PutResult(tag string, rtt time.Duration) {
h.access.Lock()
defer h.access.Unlock()
if h.Results == nil {
h.Results = make(map[string]*HealthPingRTTS)
}
r, ok := h.Results[tag]
if !ok {
// validity is 2 times to sampling period, since the check are
// distributed in the time line randomly, in extreme cases,
// Previous checks are distributed on the left, and later ones
// on the right
validity := h.Settings.Interval * time.Duration(h.Settings.SamplingCount) * 2
r = NewHealthPingResult(h.Settings.SamplingCount, validity)
h.Results[tag] = r
}
r.Put(rtt)
}
// Cleanup removes results of removed handlers,
// tags should be all valid tags of the Balancer now
func (h *HealthPing) Cleanup(tags []string) {
h.access.Lock()
defer h.access.Unlock()
for tag := range h.Results {
found := false
for _, v := range tags {
if tag == v {
found = true
break
}
}
if !found {
delete(h.Results, tag)
}
}
}
// checkConnectivity checks the network connectivity, it returns
// true if network is good or "connectivity check url" not set
func (h *HealthPing) checkConnectivity() bool {
if h.Settings.Connectivity == "" {
return true
}
tester := newDirectPingClient(
h.Settings.Connectivity,
h.Settings.Timeout,
)
if _, err := tester.MeasureDelay(h.Settings.HttpMethod); err != nil {
return false
}
return true
}

View file

@ -1,143 +0,0 @@
package burst
import (
"math"
"time"
)
// HealthPingStats is the statistics of HealthPingRTTS
type HealthPingStats struct {
All int
Fail int
Deviation time.Duration
Average time.Duration
Max time.Duration
Min time.Duration
}
// HealthPingRTTS holds ping rtts for health Checker
type HealthPingRTTS struct {
idx int
cap int
validity time.Duration
rtts []*pingRTT
lastUpdateAt time.Time
stats *HealthPingStats
}
type pingRTT struct {
time time.Time
value time.Duration
}
// NewHealthPingResult returns a *HealthPingResult with specified capacity
func NewHealthPingResult(cap int, validity time.Duration) *HealthPingRTTS {
return &HealthPingRTTS{cap: cap, validity: validity}
}
// Get gets statistics of the HealthPingRTTS
func (h *HealthPingRTTS) Get() *HealthPingStats {
return h.getStatistics()
}
// GetWithCache get statistics and write cache for next call
// Make sure use Mutex.Lock() before calling it, RWMutex.RLock()
// is not an option since it writes cache
func (h *HealthPingRTTS) GetWithCache() *HealthPingStats {
lastPutAt := h.rtts[h.idx].time
now := time.Now()
if h.stats == nil || h.lastUpdateAt.Before(lastPutAt) || h.findOutdated(now) >= 0 {
h.stats = h.getStatistics()
h.lastUpdateAt = now
}
return h.stats
}
// Put puts a new rtt to the HealthPingResult
func (h *HealthPingRTTS) Put(d time.Duration) {
if h.rtts == nil {
h.rtts = make([]*pingRTT, h.cap)
for i := 0; i < h.cap; i++ {
h.rtts[i] = &pingRTT{}
}
h.idx = -1
}
h.idx = h.calcIndex(1)
now := time.Now()
h.rtts[h.idx].time = now
h.rtts[h.idx].value = d
}
func (h *HealthPingRTTS) calcIndex(step int) int {
idx := h.idx
idx += step
if idx >= h.cap {
idx %= h.cap
}
return idx
}
func (h *HealthPingRTTS) getStatistics() *HealthPingStats {
stats := &HealthPingStats{}
stats.Fail = 0
stats.Max = 0
stats.Min = rttFailed
sum := time.Duration(0)
cnt := 0
validRTTs := make([]time.Duration, 0)
for _, rtt := range h.rtts {
switch {
case rtt.value == 0 || time.Since(rtt.time) > h.validity:
continue
case rtt.value == rttFailed:
stats.Fail++
continue
}
cnt++
sum += rtt.value
validRTTs = append(validRTTs, rtt.value)
if stats.Max < rtt.value {
stats.Max = rtt.value
}
if stats.Min > rtt.value {
stats.Min = rtt.value
}
}
stats.All = cnt + stats.Fail
if cnt == 0 {
stats.Min = 0
return stats
}
stats.Average = time.Duration(int(sum) / cnt)
var std float64
if cnt < 2 {
// no enough data for standard deviation, we assume it's half of the average rtt
// if we don't do this, standard deviation of 1 round tested nodes is 0, will always
// selected before 2 or more rounds tested nodes
std = float64(stats.Average / 2)
} else {
variance := float64(0)
for _, rtt := range validRTTs {
variance += math.Pow(float64(rtt-stats.Average), 2)
}
std = math.Sqrt(variance / float64(cnt))
}
stats.Deviation = time.Duration(std)
return stats
}
func (h *HealthPingRTTS) findOutdated(now time.Time) int {
for i := h.cap - 1; i < 2*h.cap; i++ {
// from oldest to latest
idx := h.calcIndex(i)
validity := h.rtts[idx].time.Add(h.validity)
if h.lastUpdateAt.After(validity) {
return idx
}
if validity.Before(now) {
return idx
}
}
return -1
}

View file

@ -1,106 +0,0 @@
package burst_test
import (
"math"
reflect "reflect"
"testing"
"time"
"github.com/xtls/xray-core/app/observatory/burst"
)
func TestHealthPingResults(t *testing.T) {
rtts := []int64{60, 140, 60, 140, 60, 60, 140, 60, 140}
hr := burst.NewHealthPingResult(4, time.Hour)
for _, rtt := range rtts {
hr.Put(time.Duration(rtt))
}
rttFailed := time.Duration(math.MaxInt64)
expected := &burst.HealthPingStats{
All: 4,
Fail: 0,
Deviation: 40,
Average: 100,
Max: 140,
Min: 60,
}
actual := hr.Get()
if !reflect.DeepEqual(expected, actual) {
t.Errorf("expected: %v, actual: %v", expected, actual)
}
hr.Put(rttFailed)
hr.Put(rttFailed)
expected.Fail = 2
actual = hr.Get()
if !reflect.DeepEqual(expected, actual) {
t.Errorf("failed half-failures test, expected: %v, actual: %v", expected, actual)
}
hr.Put(rttFailed)
hr.Put(rttFailed)
expected = &burst.HealthPingStats{
All: 4,
Fail: 4,
Deviation: 0,
Average: 0,
Max: 0,
Min: 0,
}
actual = hr.Get()
if !reflect.DeepEqual(expected, actual) {
t.Errorf("failed all-failures test, expected: %v, actual: %v", expected, actual)
}
}
func TestHealthPingResultsIgnoreOutdated(t *testing.T) {
rtts := []int64{60, 140, 60, 140}
hr := burst.NewHealthPingResult(4, time.Duration(10)*time.Millisecond)
for i, rtt := range rtts {
if i == 2 {
// wait for previous 2 outdated
time.Sleep(time.Duration(10) * time.Millisecond)
}
hr.Put(time.Duration(rtt))
}
hr.Get()
expected := &burst.HealthPingStats{
All: 2,
Fail: 0,
Deviation: 40,
Average: 100,
Max: 140,
Min: 60,
}
actual := hr.Get()
if !reflect.DeepEqual(expected, actual) {
t.Errorf("failed 'half-outdated' test, expected: %v, actual: %v", expected, actual)
}
// wait for all outdated
time.Sleep(time.Duration(10) * time.Millisecond)
expected = &burst.HealthPingStats{
All: 0,
Fail: 0,
Deviation: 0,
Average: 0,
Max: 0,
Min: 0,
}
actual = hr.Get()
if !reflect.DeepEqual(expected, actual) {
t.Errorf("failed 'outdated / not-tested' test, expected: %v, actual: %v", expected, actual)
}
hr.Put(time.Duration(60))
expected = &burst.HealthPingStats{
All: 1,
Fail: 0,
// 1 sample, std=0.5rtt
Deviation: 30,
Average: 60,
Max: 60,
Min: 60,
}
actual = hr.Get()
if !reflect.DeepEqual(expected, actual) {
t.Errorf("expected: %v, actual: %v", expected, actual)
}
}

View file

@ -1,81 +0,0 @@
package burst
import (
"context"
"io"
"net/http"
"time"
"github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/utils"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/transport/internet/tagged"
)
type pingClient struct {
destination string
httpClient *http.Client
}
func newPingClient(ctx context.Context, dispatcher routing.Dispatcher, destination string, timeout time.Duration, handler string) *pingClient {
return &pingClient{
destination: destination,
httpClient: newHTTPClient(ctx, dispatcher, handler, timeout),
}
}
func newDirectPingClient(destination string, timeout time.Duration) *pingClient {
return &pingClient{
destination: destination,
httpClient: &http.Client{Timeout: timeout},
}
}
func newHTTPClient(ctxv context.Context, dispatcher routing.Dispatcher, handler string, timeout time.Duration) *http.Client {
tr := &http.Transport{
DisableKeepAlives: true,
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
dest, err := net.ParseDestination(network + ":" + addr)
if err != nil {
return nil, err
}
return tagged.Dialer(ctxv, dispatcher, dest, handler)
},
}
return &http.Client{
Transport: tr,
Timeout: timeout,
// don't follow redirect
CheckRedirect: func(req *http.Request, via []*http.Request) error {
return http.ErrUseLastResponse
},
}
}
// MeasureDelay returns the delay time of the request to dest
func (s *pingClient) MeasureDelay(httpMethod string) (time.Duration, error) {
if s.httpClient == nil {
panic("pingClient not initialized")
}
req, err := http.NewRequest(httpMethod, s.destination, nil)
if err != nil {
return rttFailed, err
}
utils.TryDefaultHeadersWith(req.Header, "nav")
start := time.Now()
resp, err := s.httpClient.Do(req)
if err != nil {
return rttFailed, err
}
if httpMethod == http.MethodGet {
_, err = io.Copy(io.Discard, resp.Body)
if err != nil {
return rttFailed, err
}
}
resp.Body.Close()
return time.Since(start), nil
}

View file

@ -1,47 +0,0 @@
package command
import (
"context"
"github.com/xtls/xray-core/app/observatory"
"github.com/xtls/xray-core/common"
core "github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/extension"
"google.golang.org/grpc"
)
type service struct {
UnimplementedObservatoryServiceServer
v *core.Instance
observatory extension.Observatory
}
func (s *service) GetOutboundStatus(ctx context.Context, request *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
resp, err := s.observatory.GetObservation(ctx)
if err != nil {
return nil, err
}
retdata := resp.(*observatory.ObservationResult)
return &GetOutboundStatusResponse{
Status: retdata,
}, nil
}
func (s *service) Register(server *grpc.Server) {
RegisterObservatoryServiceServer(server, s)
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
s := core.MustFromContext(ctx)
sv := &service{v: s}
err := s.RequireFeatures(func(Observatory extension.Observatory) {
sv.observatory = Observatory
}, false)
if err != nil {
return nil, err
}
return sv, nil
}))
}

View file

@ -1,206 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/observatory/command/command.proto
package command
import (
observatory "github.com/xtls/xray-core/app/observatory"
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type GetOutboundStatusRequest struct {
state protoimpl.MessageState `protogen:"open.v1"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *GetOutboundStatusRequest) Reset() {
*x = GetOutboundStatusRequest{}
mi := &file_app_observatory_command_command_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *GetOutboundStatusRequest) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*GetOutboundStatusRequest) ProtoMessage() {}
func (x *GetOutboundStatusRequest) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_command_command_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use GetOutboundStatusRequest.ProtoReflect.Descriptor instead.
func (*GetOutboundStatusRequest) Descriptor() ([]byte, []int) {
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{0}
}
type GetOutboundStatusResponse struct {
state protoimpl.MessageState `protogen:"open.v1"`
Status *observatory.ObservationResult `protobuf:"bytes,1,opt,name=status,proto3" json:"status,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *GetOutboundStatusResponse) Reset() {
*x = GetOutboundStatusResponse{}
mi := &file_app_observatory_command_command_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *GetOutboundStatusResponse) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*GetOutboundStatusResponse) ProtoMessage() {}
func (x *GetOutboundStatusResponse) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_command_command_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use GetOutboundStatusResponse.ProtoReflect.Descriptor instead.
func (*GetOutboundStatusResponse) Descriptor() ([]byte, []int) {
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{1}
}
func (x *GetOutboundStatusResponse) GetStatus() *observatory.ObservationResult {
if x != nil {
return x.Status
}
return nil
}
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_observatory_command_command_proto_msgTypes[2]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_command_command_proto_msgTypes[2]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{2}
}
var File_app_observatory_command_command_proto protoreflect.FileDescriptor
const file_app_observatory_command_command_proto_rawDesc = "" +
"\n" +
"%app/observatory/command/command.proto\x12!xray.core.app.observatory.command\x1a\x1capp/observatory/config.proto\"\x1a\n" +
"\x18GetOutboundStatusRequest\"a\n" +
"\x19GetOutboundStatusResponse\x12D\n" +
"\x06status\x18\x01 \x01(\v2,.xray.core.app.observatory.ObservationResultR\x06status\"\b\n" +
"\x06Config2\xa7\x01\n" +
"\x12ObservatoryService\x12\x90\x01\n" +
"\x11GetOutboundStatus\x12;.xray.core.app.observatory.command.GetOutboundStatusRequest\x1a<.xray.core.app.observatory.command.GetOutboundStatusResponse\"\x00B\x80\x01\n" +
"%com.xray.core.app.observatory.commandP\x01Z1github.com/xtls/xray-core/app/observatory/command\xaa\x02!Xray.Core.App.Observatory.Commandb\x06proto3"
var (
file_app_observatory_command_command_proto_rawDescOnce sync.Once
file_app_observatory_command_command_proto_rawDescData []byte
)
func file_app_observatory_command_command_proto_rawDescGZIP() []byte {
file_app_observatory_command_command_proto_rawDescOnce.Do(func() {
file_app_observatory_command_command_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_observatory_command_command_proto_rawDesc), len(file_app_observatory_command_command_proto_rawDesc)))
})
return file_app_observatory_command_command_proto_rawDescData
}
var file_app_observatory_command_command_proto_msgTypes = make([]protoimpl.MessageInfo, 3)
var file_app_observatory_command_command_proto_goTypes = []any{
(*GetOutboundStatusRequest)(nil), // 0: xray.core.app.observatory.command.GetOutboundStatusRequest
(*GetOutboundStatusResponse)(nil), // 1: xray.core.app.observatory.command.GetOutboundStatusResponse
(*Config)(nil), // 2: xray.core.app.observatory.command.Config
(*observatory.ObservationResult)(nil), // 3: xray.core.app.observatory.ObservationResult
}
var file_app_observatory_command_command_proto_depIdxs = []int32{
3, // 0: xray.core.app.observatory.command.GetOutboundStatusResponse.status:type_name -> xray.core.app.observatory.ObservationResult
0, // 1: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:input_type -> xray.core.app.observatory.command.GetOutboundStatusRequest
1, // 2: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:output_type -> xray.core.app.observatory.command.GetOutboundStatusResponse
2, // [2:3] is the sub-list for method output_type
1, // [1:2] is the sub-list for method input_type
1, // [1:1] is the sub-list for extension type_name
1, // [1:1] is the sub-list for extension extendee
0, // [0:1] is the sub-list for field type_name
}
func init() { file_app_observatory_command_command_proto_init() }
func file_app_observatory_command_command_proto_init() {
if File_app_observatory_command_command_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_observatory_command_command_proto_rawDesc), len(file_app_observatory_command_command_proto_rawDesc)),
NumEnums: 0,
NumMessages: 3,
NumExtensions: 0,
NumServices: 1,
},
GoTypes: file_app_observatory_command_command_proto_goTypes,
DependencyIndexes: file_app_observatory_command_command_proto_depIdxs,
MessageInfos: file_app_observatory_command_command_proto_msgTypes,
}.Build()
File_app_observatory_command_command_proto = out.File
file_app_observatory_command_command_proto_goTypes = nil
file_app_observatory_command_command_proto_depIdxs = nil
}

View file

@ -1,24 +0,0 @@
syntax = "proto3";
package xray.core.app.observatory.command;
option csharp_namespace = "Xray.Core.App.Observatory.Command";
option go_package = "github.com/xtls/xray-core/app/observatory/command";
option java_package = "com.xray.core.app.observatory.command";
option java_multiple_files = true;
import "app/observatory/config.proto";
message GetOutboundStatusRequest {
}
message GetOutboundStatusResponse {
xray.core.app.observatory.ObservationResult status = 1;
}
service ObservatoryService {
rpc GetOutboundStatus(GetOutboundStatusRequest)
returns (GetOutboundStatusResponse) {}
}
message Config {}

View file

@ -1,121 +0,0 @@
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
// versions:
// - protoc-gen-go-grpc v1.6.0
// - protoc v6.33.5
// source: app/observatory/command/command.proto
package command
import (
context "context"
grpc "google.golang.org/grpc"
codes "google.golang.org/grpc/codes"
status "google.golang.org/grpc/status"
)
// This is a compile-time assertion to ensure that this generated file
// is compatible with the grpc package it is being compiled against.
// Requires gRPC-Go v1.64.0 or later.
const _ = grpc.SupportPackageIsVersion9
const (
ObservatoryService_GetOutboundStatus_FullMethodName = "/xray.core.app.observatory.command.ObservatoryService/GetOutboundStatus"
)
// ObservatoryServiceClient is the client API for ObservatoryService service.
//
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
type ObservatoryServiceClient interface {
GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error)
}
type observatoryServiceClient struct {
cc grpc.ClientConnInterface
}
func NewObservatoryServiceClient(cc grpc.ClientConnInterface) ObservatoryServiceClient {
return &observatoryServiceClient{cc}
}
func (c *observatoryServiceClient) GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error) {
cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...)
out := new(GetOutboundStatusResponse)
err := c.cc.Invoke(ctx, ObservatoryService_GetOutboundStatus_FullMethodName, in, out, cOpts...)
if err != nil {
return nil, err
}
return out, nil
}
// ObservatoryServiceServer is the server API for ObservatoryService service.
// All implementations must embed UnimplementedObservatoryServiceServer
// for forward compatibility.
type ObservatoryServiceServer interface {
GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error)
mustEmbedUnimplementedObservatoryServiceServer()
}
// UnimplementedObservatoryServiceServer must be embedded to have
// forward compatible implementations.
//
// NOTE: this should be embedded by value instead of pointer to avoid a nil
// pointer dereference when methods are called.
type UnimplementedObservatoryServiceServer struct{}
func (UnimplementedObservatoryServiceServer) GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
return nil, status.Error(codes.Unimplemented, "method GetOutboundStatus not implemented")
}
func (UnimplementedObservatoryServiceServer) mustEmbedUnimplementedObservatoryServiceServer() {}
func (UnimplementedObservatoryServiceServer) testEmbeddedByValue() {}
// UnsafeObservatoryServiceServer may be embedded to opt out of forward compatibility for this service.
// Use of this interface is not recommended, as added methods to ObservatoryServiceServer will
// result in compilation errors.
type UnsafeObservatoryServiceServer interface {
mustEmbedUnimplementedObservatoryServiceServer()
}
func RegisterObservatoryServiceServer(s grpc.ServiceRegistrar, srv ObservatoryServiceServer) {
// If the following call panics, it indicates UnimplementedObservatoryServiceServer was
// embedded by pointer and is nil. This will cause panics if an
// unimplemented method is ever invoked, so we test this at initialization
// time to prevent it from happening at runtime later due to I/O.
if t, ok := srv.(interface{ testEmbeddedByValue() }); ok {
t.testEmbeddedByValue()
}
s.RegisterService(&ObservatoryService_ServiceDesc, srv)
}
func _ObservatoryService_GetOutboundStatus_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(GetOutboundStatusRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: ObservatoryService_GetOutboundStatus_FullMethodName,
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, req.(*GetOutboundStatusRequest))
}
return interceptor(ctx, in, info, handler)
}
// ObservatoryService_ServiceDesc is the grpc.ServiceDesc for ObservatoryService service.
// It's only intended for direct use with grpc.RegisterService,
// and not to be introspected or modified (even as a copy)
var ObservatoryService_ServiceDesc = grpc.ServiceDesc{
ServiceName: "xray.core.app.observatory.command.ObservatoryService",
HandlerType: (*ObservatoryServiceServer)(nil),
Methods: []grpc.MethodDesc{
{
MethodName: "GetOutboundStatus",
Handler: _ObservatoryService_GetOutboundStatus_Handler,
},
},
Streams: []grpc.StreamDesc{},
Metadata: "app/observatory/command/command.proto",
}

View file

@ -1,528 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/observatory/config.proto
package observatory
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type ObservationResult struct {
state protoimpl.MessageState `protogen:"open.v1"`
Status []*OutboundStatus `protobuf:"bytes,1,rep,name=status,proto3" json:"status,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *ObservationResult) Reset() {
*x = ObservationResult{}
mi := &file_app_observatory_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *ObservationResult) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*ObservationResult) ProtoMessage() {}
func (x *ObservationResult) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use ObservationResult.ProtoReflect.Descriptor instead.
func (*ObservationResult) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{0}
}
func (x *ObservationResult) GetStatus() []*OutboundStatus {
if x != nil {
return x.Status
}
return nil
}
type HealthPingMeasurementResult struct {
state protoimpl.MessageState `protogen:"open.v1"`
All int64 `protobuf:"varint,1,opt,name=all,proto3" json:"all,omitempty"`
Fail int64 `protobuf:"varint,2,opt,name=fail,proto3" json:"fail,omitempty"`
Deviation int64 `protobuf:"varint,3,opt,name=deviation,proto3" json:"deviation,omitempty"`
Average int64 `protobuf:"varint,4,opt,name=average,proto3" json:"average,omitempty"`
Max int64 `protobuf:"varint,5,opt,name=max,proto3" json:"max,omitempty"`
Min int64 `protobuf:"varint,6,opt,name=min,proto3" json:"min,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *HealthPingMeasurementResult) Reset() {
*x = HealthPingMeasurementResult{}
mi := &file_app_observatory_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *HealthPingMeasurementResult) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*HealthPingMeasurementResult) ProtoMessage() {}
func (x *HealthPingMeasurementResult) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use HealthPingMeasurementResult.ProtoReflect.Descriptor instead.
func (*HealthPingMeasurementResult) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{1}
}
func (x *HealthPingMeasurementResult) GetAll() int64 {
if x != nil {
return x.All
}
return 0
}
func (x *HealthPingMeasurementResult) GetFail() int64 {
if x != nil {
return x.Fail
}
return 0
}
func (x *HealthPingMeasurementResult) GetDeviation() int64 {
if x != nil {
return x.Deviation
}
return 0
}
func (x *HealthPingMeasurementResult) GetAverage() int64 {
if x != nil {
return x.Average
}
return 0
}
func (x *HealthPingMeasurementResult) GetMax() int64 {
if x != nil {
return x.Max
}
return 0
}
func (x *HealthPingMeasurementResult) GetMin() int64 {
if x != nil {
return x.Min
}
return 0
}
type OutboundStatus struct {
state protoimpl.MessageState `protogen:"open.v1"`
// @Document Whether this outbound is usable
// @Restriction ReadOnlyForUser
Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
// @Document The time for probe request to finish.
// @Type time.ms
// @Restriction ReadOnlyForUser
Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
// @Document The last error caused this outbound failed to relay probe request
// @Restriction NotMachineReadable
LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
// @Document The outbound tag for this Server
// @Type id.outboundTag
OutboundTag string `protobuf:"bytes,4,opt,name=outbound_tag,json=outboundTag,proto3" json:"outbound_tag,omitempty"`
// @Document The time this outbound is known to be alive
// @Type id.outboundTag
LastSeenTime int64 `protobuf:"varint,5,opt,name=last_seen_time,json=lastSeenTime,proto3" json:"last_seen_time,omitempty"`
// @Document The time this outbound is tried
// @Type id.outboundTag
LastTryTime int64 `protobuf:"varint,6,opt,name=last_try_time,json=lastTryTime,proto3" json:"last_try_time,omitempty"`
HealthPing *HealthPingMeasurementResult `protobuf:"bytes,7,opt,name=health_ping,json=healthPing,proto3" json:"health_ping,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *OutboundStatus) Reset() {
*x = OutboundStatus{}
mi := &file_app_observatory_config_proto_msgTypes[2]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *OutboundStatus) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*OutboundStatus) ProtoMessage() {}
func (x *OutboundStatus) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[2]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use OutboundStatus.ProtoReflect.Descriptor instead.
func (*OutboundStatus) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{2}
}
func (x *OutboundStatus) GetAlive() bool {
if x != nil {
return x.Alive
}
return false
}
func (x *OutboundStatus) GetDelay() int64 {
if x != nil {
return x.Delay
}
return 0
}
func (x *OutboundStatus) GetLastErrorReason() string {
if x != nil {
return x.LastErrorReason
}
return ""
}
func (x *OutboundStatus) GetOutboundTag() string {
if x != nil {
return x.OutboundTag
}
return ""
}
func (x *OutboundStatus) GetLastSeenTime() int64 {
if x != nil {
return x.LastSeenTime
}
return 0
}
func (x *OutboundStatus) GetLastTryTime() int64 {
if x != nil {
return x.LastTryTime
}
return 0
}
func (x *OutboundStatus) GetHealthPing() *HealthPingMeasurementResult {
if x != nil {
return x.HealthPing
}
return nil
}
type ProbeResult struct {
state protoimpl.MessageState `protogen:"open.v1"`
// @Document Whether this outbound is usable
// @Restriction ReadOnlyForUser
Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
// @Document The time for probe request to finish.
// @Type time.ms
// @Restriction ReadOnlyForUser
Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
// @Document The error caused this outbound failed to relay probe request
// @Restriction NotMachineReadable
LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *ProbeResult) Reset() {
*x = ProbeResult{}
mi := &file_app_observatory_config_proto_msgTypes[3]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *ProbeResult) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*ProbeResult) ProtoMessage() {}
func (x *ProbeResult) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[3]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use ProbeResult.ProtoReflect.Descriptor instead.
func (*ProbeResult) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{3}
}
func (x *ProbeResult) GetAlive() bool {
if x != nil {
return x.Alive
}
return false
}
func (x *ProbeResult) GetDelay() int64 {
if x != nil {
return x.Delay
}
return 0
}
func (x *ProbeResult) GetLastErrorReason() string {
if x != nil {
return x.LastErrorReason
}
return ""
}
type Intensity struct {
state protoimpl.MessageState `protogen:"open.v1"`
// @Document The time interval for a probe request in ms.
// @Type time.ms
ProbeInterval uint32 `protobuf:"varint,1,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Intensity) Reset() {
*x = Intensity{}
mi := &file_app_observatory_config_proto_msgTypes[4]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Intensity) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Intensity) ProtoMessage() {}
func (x *Intensity) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[4]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Intensity.ProtoReflect.Descriptor instead.
func (*Intensity) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{4}
}
func (x *Intensity) GetProbeInterval() uint32 {
if x != nil {
return x.ProbeInterval
}
return 0
}
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
// @Document The selectors for outbound under observation
SubjectSelector []string `protobuf:"bytes,2,rep,name=subject_selector,json=subjectSelector,proto3" json:"subject_selector,omitempty"`
ProbeUrl string `protobuf:"bytes,3,opt,name=probe_url,json=probeUrl,proto3" json:"probe_url,omitempty"`
ProbeInterval int64 `protobuf:"varint,4,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
EnableConcurrency bool `protobuf:"varint,5,opt,name=enable_concurrency,json=enableConcurrency,proto3" json:"enable_concurrency,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_observatory_config_proto_msgTypes[5]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_observatory_config_proto_msgTypes[5]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_observatory_config_proto_rawDescGZIP(), []int{5}
}
func (x *Config) GetSubjectSelector() []string {
if x != nil {
return x.SubjectSelector
}
return nil
}
func (x *Config) GetProbeUrl() string {
if x != nil {
return x.ProbeUrl
}
return ""
}
func (x *Config) GetProbeInterval() int64 {
if x != nil {
return x.ProbeInterval
}
return 0
}
func (x *Config) GetEnableConcurrency() bool {
if x != nil {
return x.EnableConcurrency
}
return false
}
var File_app_observatory_config_proto protoreflect.FileDescriptor
const file_app_observatory_config_proto_rawDesc = "" +
"\n" +
"\x1capp/observatory/config.proto\x12\x19xray.core.app.observatory\"V\n" +
"\x11ObservationResult\x12A\n" +
"\x06status\x18\x01 \x03(\v2).xray.core.app.observatory.OutboundStatusR\x06status\"\x9f\x01\n" +
"\x1bHealthPingMeasurementResult\x12\x10\n" +
"\x03all\x18\x01 \x01(\x03R\x03all\x12\x12\n" +
"\x04fail\x18\x02 \x01(\x03R\x04fail\x12\x1c\n" +
"\tdeviation\x18\x03 \x01(\x03R\tdeviation\x12\x18\n" +
"\aaverage\x18\x04 \x01(\x03R\aaverage\x12\x10\n" +
"\x03max\x18\x05 \x01(\x03R\x03max\x12\x10\n" +
"\x03min\x18\x06 \x01(\x03R\x03min\"\xae\x02\n" +
"\x0eOutboundStatus\x12\x14\n" +
"\x05alive\x18\x01 \x01(\bR\x05alive\x12\x14\n" +
"\x05delay\x18\x02 \x01(\x03R\x05delay\x12*\n" +
"\x11last_error_reason\x18\x03 \x01(\tR\x0flastErrorReason\x12!\n" +
"\foutbound_tag\x18\x04 \x01(\tR\voutboundTag\x12$\n" +
"\x0elast_seen_time\x18\x05 \x01(\x03R\flastSeenTime\x12\"\n" +
"\rlast_try_time\x18\x06 \x01(\x03R\vlastTryTime\x12W\n" +
"\vhealth_ping\x18\a \x01(\v26.xray.core.app.observatory.HealthPingMeasurementResultR\n" +
"healthPing\"e\n" +
"\vProbeResult\x12\x14\n" +
"\x05alive\x18\x01 \x01(\bR\x05alive\x12\x14\n" +
"\x05delay\x18\x02 \x01(\x03R\x05delay\x12*\n" +
"\x11last_error_reason\x18\x03 \x01(\tR\x0flastErrorReason\"2\n" +
"\tIntensity\x12%\n" +
"\x0eprobe_interval\x18\x01 \x01(\rR\rprobeInterval\"\xa6\x01\n" +
"\x06Config\x12)\n" +
"\x10subject_selector\x18\x02 \x03(\tR\x0fsubjectSelector\x12\x1b\n" +
"\tprobe_url\x18\x03 \x01(\tR\bprobeUrl\x12%\n" +
"\x0eprobe_interval\x18\x04 \x01(\x03R\rprobeInterval\x12-\n" +
"\x12enable_concurrency\x18\x05 \x01(\bR\x11enableConcurrencyB^\n" +
"\x18com.xray.app.observatoryP\x01Z)github.com/xtls/xray-core/app/observatory\xaa\x02\x14Xray.App.Observatoryb\x06proto3"
var (
file_app_observatory_config_proto_rawDescOnce sync.Once
file_app_observatory_config_proto_rawDescData []byte
)
func file_app_observatory_config_proto_rawDescGZIP() []byte {
file_app_observatory_config_proto_rawDescOnce.Do(func() {
file_app_observatory_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_observatory_config_proto_rawDesc), len(file_app_observatory_config_proto_rawDesc)))
})
return file_app_observatory_config_proto_rawDescData
}
var file_app_observatory_config_proto_msgTypes = make([]protoimpl.MessageInfo, 6)
var file_app_observatory_config_proto_goTypes = []any{
(*ObservationResult)(nil), // 0: xray.core.app.observatory.ObservationResult
(*HealthPingMeasurementResult)(nil), // 1: xray.core.app.observatory.HealthPingMeasurementResult
(*OutboundStatus)(nil), // 2: xray.core.app.observatory.OutboundStatus
(*ProbeResult)(nil), // 3: xray.core.app.observatory.ProbeResult
(*Intensity)(nil), // 4: xray.core.app.observatory.Intensity
(*Config)(nil), // 5: xray.core.app.observatory.Config
}
var file_app_observatory_config_proto_depIdxs = []int32{
2, // 0: xray.core.app.observatory.ObservationResult.status:type_name -> xray.core.app.observatory.OutboundStatus
1, // 1: xray.core.app.observatory.OutboundStatus.health_ping:type_name -> xray.core.app.observatory.HealthPingMeasurementResult
2, // [2:2] is the sub-list for method output_type
2, // [2:2] is the sub-list for method input_type
2, // [2:2] is the sub-list for extension type_name
2, // [2:2] is the sub-list for extension extendee
0, // [0:2] is the sub-list for field type_name
}
func init() { file_app_observatory_config_proto_init() }
func file_app_observatory_config_proto_init() {
if File_app_observatory_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_observatory_config_proto_rawDesc), len(file_app_observatory_config_proto_rawDesc)),
NumEnums: 0,
NumMessages: 6,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_observatory_config_proto_goTypes,
DependencyIndexes: file_app_observatory_config_proto_depIdxs,
MessageInfos: file_app_observatory_config_proto_msgTypes,
}.Build()
File_app_observatory_config_proto = out.File
file_app_observatory_config_proto_goTypes = nil
file_app_observatory_config_proto_depIdxs = nil
}

View file

@ -1,84 +0,0 @@
syntax = "proto3";
package xray.core.app.observatory;
option csharp_namespace = "Xray.App.Observatory";
option go_package = "github.com/xtls/xray-core/app/observatory";
option java_package = "com.xray.app.observatory";
option java_multiple_files = true;
message ObservationResult {
repeated OutboundStatus status = 1;
}
message HealthPingMeasurementResult {
int64 all = 1;
int64 fail = 2;
int64 deviation = 3;
int64 average = 4;
int64 max = 5;
int64 min = 6;
}
message OutboundStatus{
/* @Document Whether this outbound is usable
@Restriction ReadOnlyForUser
*/
bool alive = 1;
/* @Document The time for probe request to finish.
@Type time.ms
@Restriction ReadOnlyForUser
*/
int64 delay = 2;
/* @Document The last error caused this outbound failed to relay probe request
@Restriction NotMachineReadable
*/
string last_error_reason = 3;
/* @Document The outbound tag for this Server
@Type id.outboundTag
*/
string outbound_tag = 4;
/* @Document The time this outbound is known to be alive
@Type id.outboundTag
*/
int64 last_seen_time = 5;
/* @Document The time this outbound is tried
@Type id.outboundTag
*/
int64 last_try_time = 6;
HealthPingMeasurementResult health_ping = 7;
}
message ProbeResult{
/* @Document Whether this outbound is usable
@Restriction ReadOnlyForUser
*/
bool alive = 1;
/* @Document The time for probe request to finish.
@Type time.ms
@Restriction ReadOnlyForUser
*/
int64 delay = 2;
/* @Document The error caused this outbound failed to relay probe request
@Restriction NotMachineReadable
*/
string last_error_reason = 3;
}
message Intensity{
/* @Document The time interval for a probe request in ms.
@Type time.ms
*/
uint32 probe_interval = 1;
}
message Config {
/* @Document The selectors for outbound under observation
*/
repeated string subject_selector = 2;
string probe_url = 3;
int64 probe_interval = 4;
bool enable_concurrency = 5;
}

View file

@ -1,26 +0,0 @@
package observatory
import "github.com/xtls/xray-core/common/errors"
type errorCollector struct {
errors *errors.Error
}
func (e *errorCollector) SubmitError(err error) {
if e.errors == nil {
e.errors = errors.New("underlying connection error").Base(err)
return
}
e.errors = e.errors.Base(errors.New("underlying connection error").Base(err))
}
func newErrorCollector() *errorCollector {
return &errorCollector{}
}
func (e *errorCollector) UnderlyingError() error {
if e.errors == nil {
return errors.New("failed to produce report")
}
return e.errors
}

View file

@ -1 +0,0 @@
package observatory

View file

@ -1,252 +0,0 @@
package observatory
import (
"context"
"net"
"net/http"
"net/url"
"slices"
"sort"
"sync"
"time"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
v2net "github.com/xtls/xray-core/common/net"
"github.com/xtls/xray-core/common/session"
"github.com/xtls/xray-core/common/signal/done"
"github.com/xtls/xray-core/common/task"
"github.com/xtls/xray-core/common/utils"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/extension"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/features/routing"
"github.com/xtls/xray-core/transport/internet/tagged"
"google.golang.org/protobuf/proto"
)
type Observer struct {
config *Config
ctx context.Context
statusLock sync.Mutex
status []*OutboundStatus
finished *done.Instance
ohm outbound.Manager
dispatcher routing.Dispatcher
}
func (o *Observer) GetObservation(ctx context.Context) (proto.Message, error) {
return &ObservationResult{Status: o.status}, nil
}
func (o *Observer) Type() interface{} {
return extension.ObservatoryType()
}
func (o *Observer) Start() error {
if o.config != nil && len(o.config.SubjectSelector) != 0 {
o.finished = done.New()
go o.background()
}
return nil
}
func (o *Observer) Close() error {
if o.finished != nil {
return o.finished.Close()
}
return nil
}
func (o *Observer) background() {
for !o.finished.Done() {
hs, ok := o.ohm.(outbound.HandlerSelector)
if !ok {
errors.LogInfo(o.ctx, "outbound.Manager is not a HandlerSelector")
return
}
outbounds := hs.Select(o.config.SubjectSelector)
o.clearRemovedOutbounds(outbounds)
sleepTime := time.Second * 10
if o.config.ProbeInterval != 0 {
sleepTime = time.Duration(o.config.ProbeInterval)
}
if !o.config.EnableConcurrency {
sort.Strings(outbounds)
for _, v := range outbounds {
result := o.probe(v)
o.updateStatusForResult(v, &result)
if o.finished.Done() {
return
}
time.Sleep(sleepTime)
}
continue
}
ch := make(chan struct{}, len(outbounds))
for _, v := range outbounds {
go func(v string) {
result := o.probe(v)
o.updateStatusForResult(v, &result)
ch <- struct{}{}
}(v)
}
for range outbounds {
select {
case <-ch:
case <-o.finished.Wait():
return
}
}
time.Sleep(sleepTime)
}
}
func (o *Observer) clearRemovedOutbounds(outbounds []string) {
o.statusLock.Lock()
defer o.statusLock.Unlock()
if len(o.status) == 0 {
return
}
var pruned []*OutboundStatus
for _, status := range o.status {
if slices.Contains(outbounds, status.OutboundTag) {
pruned = append(pruned, status)
}
}
o.status = pruned
}
func (o *Observer) probe(outbound string) ProbeResult {
errorCollectorForRequest := newErrorCollector()
httpTransport := http.Transport{
Proxy: func(*http.Request) (*url.URL, error) {
return nil, nil
},
DialContext: func(ctx context.Context, network string, addr string) (net.Conn, error) {
var connection net.Conn
taskErr := task.Run(ctx, func() error {
// MUST use Xray's built in context system
dest, err := v2net.ParseDestination(network + ":" + addr)
if err != nil {
return errors.New("cannot understand address").Base(err)
}
trackedCtx := session.TrackedConnectionError(o.ctx, errorCollectorForRequest)
conn, err := tagged.Dialer(trackedCtx, o.dispatcher, dest, outbound)
if err != nil {
return errors.New("cannot dial remote address ", dest).Base(err)
}
connection = conn
return nil
})
if taskErr != nil {
return nil, errors.New("cannot finish connection").Base(taskErr)
}
return connection, nil
},
TLSHandshakeTimeout: time.Second * 5,
}
httpClient := &http.Client{
Transport: &httpTransport,
CheckRedirect: func(req *http.Request, via []*http.Request) error {
return http.ErrUseLastResponse
},
Jar: nil,
Timeout: time.Second * 5,
}
var GETTime time.Duration
err := task.Run(o.ctx, func() error {
startTime := time.Now()
probeURL := "https://www.google.com/generate_204"
if o.config.ProbeUrl != "" {
probeURL = o.config.ProbeUrl
}
req, _ := http.NewRequest(http.MethodGet, probeURL, nil)
utils.TryDefaultHeadersWith(req.Header, "nav")
response, err := httpClient.Do(req)
if err != nil {
return errors.New("outbound failed to relay connection").Base(err)
}
if response.Body != nil {
response.Body.Close()
}
endTime := time.Now()
GETTime = endTime.Sub(startTime)
return nil
})
if err != nil {
var errorMessage = "the outbound " + outbound + " is dead: GET request failed:" + err.Error() + "with outbound handler report underlying connection failed"
errors.LogInfoInner(o.ctx, errorCollectorForRequest.UnderlyingError(), errorMessage)
return ProbeResult{Alive: false, LastErrorReason: errorMessage}
}
errors.LogInfo(o.ctx, "the outbound ", outbound, " is alive:", GETTime.Seconds())
return ProbeResult{Alive: true, Delay: GETTime.Milliseconds()}
}
func (o *Observer) updateStatusForResult(outbound string, result *ProbeResult) {
o.statusLock.Lock()
defer o.statusLock.Unlock()
var status *OutboundStatus
if location := o.findStatusLocationLockHolderOnly(outbound); location != -1 {
status = o.status[location]
} else {
status = &OutboundStatus{}
o.status = append(o.status, status)
}
status.LastTryTime = time.Now().Unix()
status.OutboundTag = outbound
status.Alive = result.Alive
if result.Alive {
status.Delay = result.Delay
status.LastSeenTime = status.LastTryTime
status.LastErrorReason = ""
} else {
status.LastErrorReason = result.LastErrorReason
status.Delay = 99999999
}
}
func (o *Observer) findStatusLocationLockHolderOnly(outbound string) int {
for i, v := range o.status {
if v.OutboundTag == outbound {
return i
}
}
return -1
}
func New(ctx context.Context, config *Config) (*Observer, error) {
var outboundManager outbound.Manager
var dispatcher routing.Dispatcher
err := core.RequireFeatures(ctx, func(om outbound.Manager, rd routing.Dispatcher) {
outboundManager = om
dispatcher = rd
})
if err != nil {
return nil, errors.New("Cannot get depended features").Base(err)
}
return &Observer{
config: config,
ctx: ctx,
ohm: outboundManager,
dispatcher: dispatcher,
}, nil
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}

View file

@ -1,64 +0,0 @@
package observatory
import "testing"
func TestObserverUpdateStatusPrunesStaleOutbounds(t *testing.T) {
observer := &Observer{
status: []*OutboundStatus{
{
OutboundTag: "keep",
Alive: true,
Delay: 42,
LastErrorReason: "",
LastSeenTime: 111,
LastTryTime: 222,
},
{
OutboundTag: "drop",
Alive: false,
Delay: 99999999,
LastErrorReason: "probe failed",
LastSeenTime: 333,
LastTryTime: 444,
},
},
}
observer.updateStatus([]string{"keep"})
if len(observer.status) != 1 {
t.Fatalf("expected 1 status after pruning, got %d", len(observer.status))
}
got := observer.status[0]
if got.OutboundTag != "keep" {
t.Fatalf("expected remaining status for keep, got %q", got.OutboundTag)
}
if !got.Alive {
t.Fatal("expected remaining status to preserve Alive field")
}
if got.Delay != 42 {
t.Fatalf("expected remaining status to preserve Delay, got %d", got.Delay)
}
if got.LastSeenTime != 111 {
t.Fatalf("expected remaining status to preserve LastSeenTime, got %d", got.LastSeenTime)
}
if got.LastTryTime != 222 {
t.Fatalf("expected remaining status to preserve LastTryTime, got %d", got.LastTryTime)
}
}
func TestObserverUpdateStatusClearsWhenNoOutboundsRemain(t *testing.T) {
observer := &Observer{
status: []*OutboundStatus{
{OutboundTag: "drop-1"},
{OutboundTag: "drop-2"},
},
}
observer.updateStatus(nil)
if len(observer.status) != 0 {
t.Fatalf("expected all statuses to be removed, got %d", len(observer.status))
}
}

View file

@ -1,94 +0,0 @@
package policy
import (
"time"
"github.com/xtls/xray-core/features/policy"
)
// Duration converts Second to time.Duration.
func (s *Second) Duration() time.Duration {
if s == nil {
return 0
}
return time.Second * time.Duration(s.Value)
}
func defaultPolicy() *Policy {
p := policy.SessionDefault()
return &Policy{
Timeout: &Policy_Timeout{
Handshake: &Second{Value: uint32(p.Timeouts.Handshake / time.Second)},
ConnectionIdle: &Second{Value: uint32(p.Timeouts.ConnectionIdle / time.Second)},
UplinkOnly: &Second{Value: uint32(p.Timeouts.UplinkOnly / time.Second)},
DownlinkOnly: &Second{Value: uint32(p.Timeouts.DownlinkOnly / time.Second)},
},
Buffer: &Policy_Buffer{
Connection: p.Buffer.PerConnection,
},
}
}
func (p *Policy_Timeout) overrideWith(another *Policy_Timeout) {
if another.Handshake != nil {
p.Handshake = &Second{Value: another.Handshake.Value}
}
if another.ConnectionIdle != nil {
p.ConnectionIdle = &Second{Value: another.ConnectionIdle.Value}
}
if another.UplinkOnly != nil {
p.UplinkOnly = &Second{Value: another.UplinkOnly.Value}
}
if another.DownlinkOnly != nil {
p.DownlinkOnly = &Second{Value: another.DownlinkOnly.Value}
}
}
func (p *Policy) overrideWith(another *Policy) {
if another.Timeout != nil {
p.Timeout.overrideWith(another.Timeout)
}
if another.Stats != nil && p.Stats == nil {
p.Stats = &Policy_Stats{}
p.Stats = another.Stats
}
if another.Buffer != nil {
p.Buffer = &Policy_Buffer{
Connection: another.Buffer.Connection,
}
}
}
// ToCorePolicy converts this Policy to policy.Session.
func (p *Policy) ToCorePolicy() policy.Session {
cp := policy.SessionDefault()
if p.Timeout != nil {
cp.Timeouts.ConnectionIdle = p.Timeout.ConnectionIdle.Duration()
cp.Timeouts.Handshake = p.Timeout.Handshake.Duration()
cp.Timeouts.DownlinkOnly = p.Timeout.DownlinkOnly.Duration()
cp.Timeouts.UplinkOnly = p.Timeout.UplinkOnly.Duration()
}
if p.Stats != nil {
cp.Stats.UserUplink = p.Stats.UserUplink
cp.Stats.UserDownlink = p.Stats.UserDownlink
cp.Stats.UserOnline = p.Stats.UserOnline
}
if p.Buffer != nil {
cp.Buffer.PerConnection = p.Buffer.Connection
}
return cp
}
// ToCorePolicy converts this SystemPolicy to policy.System.
func (p *SystemPolicy) ToCorePolicy() policy.System {
return policy.System{
Stats: policy.SystemStats{
InboundUplink: p.Stats.InboundUplink,
InboundDownlink: p.Stats.InboundDownlink,
OutboundUplink: p.Stats.OutboundUplink,
OutboundDownlink: p.Stats.OutboundDownlink,
},
}
}

View file

@ -1,574 +0,0 @@
// Code generated by protoc-gen-go. DO NOT EDIT.
// versions:
// protoc-gen-go v1.36.11
// protoc v6.33.5
// source: app/policy/config.proto
package policy
import (
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
reflect "reflect"
sync "sync"
unsafe "unsafe"
)
const (
// Verify that this generated code is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
// Verify that runtime/protoimpl is sufficiently up-to-date.
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
)
type Second struct {
state protoimpl.MessageState `protogen:"open.v1"`
Value uint32 `protobuf:"varint,1,opt,name=value,proto3" json:"value,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Second) Reset() {
*x = Second{}
mi := &file_app_policy_config_proto_msgTypes[0]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Second) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Second) ProtoMessage() {}
func (x *Second) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[0]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Second.ProtoReflect.Descriptor instead.
func (*Second) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{0}
}
func (x *Second) GetValue() uint32 {
if x != nil {
return x.Value
}
return 0
}
type Policy struct {
state protoimpl.MessageState `protogen:"open.v1"`
Timeout *Policy_Timeout `protobuf:"bytes,1,opt,name=timeout,proto3" json:"timeout,omitempty"`
Stats *Policy_Stats `protobuf:"bytes,2,opt,name=stats,proto3" json:"stats,omitempty"`
Buffer *Policy_Buffer `protobuf:"bytes,3,opt,name=buffer,proto3" json:"buffer,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Policy) Reset() {
*x = Policy{}
mi := &file_app_policy_config_proto_msgTypes[1]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Policy) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Policy) ProtoMessage() {}
func (x *Policy) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[1]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Policy.ProtoReflect.Descriptor instead.
func (*Policy) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{1}
}
func (x *Policy) GetTimeout() *Policy_Timeout {
if x != nil {
return x.Timeout
}
return nil
}
func (x *Policy) GetStats() *Policy_Stats {
if x != nil {
return x.Stats
}
return nil
}
func (x *Policy) GetBuffer() *Policy_Buffer {
if x != nil {
return x.Buffer
}
return nil
}
type SystemPolicy struct {
state protoimpl.MessageState `protogen:"open.v1"`
Stats *SystemPolicy_Stats `protobuf:"bytes,1,opt,name=stats,proto3" json:"stats,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *SystemPolicy) Reset() {
*x = SystemPolicy{}
mi := &file_app_policy_config_proto_msgTypes[2]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *SystemPolicy) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*SystemPolicy) ProtoMessage() {}
func (x *SystemPolicy) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[2]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use SystemPolicy.ProtoReflect.Descriptor instead.
func (*SystemPolicy) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{2}
}
func (x *SystemPolicy) GetStats() *SystemPolicy_Stats {
if x != nil {
return x.Stats
}
return nil
}
type Config struct {
state protoimpl.MessageState `protogen:"open.v1"`
Level map[uint32]*Policy `protobuf:"bytes,1,rep,name=level,proto3" json:"level,omitempty" protobuf_key:"varint,1,opt,name=key" protobuf_val:"bytes,2,opt,name=value"`
System *SystemPolicy `protobuf:"bytes,2,opt,name=system,proto3" json:"system,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Config) Reset() {
*x = Config{}
mi := &file_app_policy_config_proto_msgTypes[3]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Config) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Config) ProtoMessage() {}
func (x *Config) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[3]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
func (*Config) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{3}
}
func (x *Config) GetLevel() map[uint32]*Policy {
if x != nil {
return x.Level
}
return nil
}
func (x *Config) GetSystem() *SystemPolicy {
if x != nil {
return x.System
}
return nil
}
// Timeout is a message for timeout settings in various stages, in seconds.
type Policy_Timeout struct {
state protoimpl.MessageState `protogen:"open.v1"`
Handshake *Second `protobuf:"bytes,1,opt,name=handshake,proto3" json:"handshake,omitempty"`
ConnectionIdle *Second `protobuf:"bytes,2,opt,name=connection_idle,json=connectionIdle,proto3" json:"connection_idle,omitempty"`
UplinkOnly *Second `protobuf:"bytes,3,opt,name=uplink_only,json=uplinkOnly,proto3" json:"uplink_only,omitempty"`
DownlinkOnly *Second `protobuf:"bytes,4,opt,name=downlink_only,json=downlinkOnly,proto3" json:"downlink_only,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Policy_Timeout) Reset() {
*x = Policy_Timeout{}
mi := &file_app_policy_config_proto_msgTypes[4]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Policy_Timeout) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Policy_Timeout) ProtoMessage() {}
func (x *Policy_Timeout) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[4]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Policy_Timeout.ProtoReflect.Descriptor instead.
func (*Policy_Timeout) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{1, 0}
}
func (x *Policy_Timeout) GetHandshake() *Second {
if x != nil {
return x.Handshake
}
return nil
}
func (x *Policy_Timeout) GetConnectionIdle() *Second {
if x != nil {
return x.ConnectionIdle
}
return nil
}
func (x *Policy_Timeout) GetUplinkOnly() *Second {
if x != nil {
return x.UplinkOnly
}
return nil
}
func (x *Policy_Timeout) GetDownlinkOnly() *Second {
if x != nil {
return x.DownlinkOnly
}
return nil
}
type Policy_Stats struct {
state protoimpl.MessageState `protogen:"open.v1"`
UserUplink bool `protobuf:"varint,1,opt,name=user_uplink,json=userUplink,proto3" json:"user_uplink,omitempty"`
UserDownlink bool `protobuf:"varint,2,opt,name=user_downlink,json=userDownlink,proto3" json:"user_downlink,omitempty"`
UserOnline bool `protobuf:"varint,3,opt,name=user_online,json=userOnline,proto3" json:"user_online,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Policy_Stats) Reset() {
*x = Policy_Stats{}
mi := &file_app_policy_config_proto_msgTypes[5]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Policy_Stats) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Policy_Stats) ProtoMessage() {}
func (x *Policy_Stats) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[5]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Policy_Stats.ProtoReflect.Descriptor instead.
func (*Policy_Stats) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{1, 1}
}
func (x *Policy_Stats) GetUserUplink() bool {
if x != nil {
return x.UserUplink
}
return false
}
func (x *Policy_Stats) GetUserDownlink() bool {
if x != nil {
return x.UserDownlink
}
return false
}
func (x *Policy_Stats) GetUserOnline() bool {
if x != nil {
return x.UserOnline
}
return false
}
type Policy_Buffer struct {
state protoimpl.MessageState `protogen:"open.v1"`
// Buffer size per connection, in bytes. -1 for unlimited buffer.
Connection int32 `protobuf:"varint,1,opt,name=connection,proto3" json:"connection,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *Policy_Buffer) Reset() {
*x = Policy_Buffer{}
mi := &file_app_policy_config_proto_msgTypes[6]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *Policy_Buffer) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*Policy_Buffer) ProtoMessage() {}
func (x *Policy_Buffer) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[6]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use Policy_Buffer.ProtoReflect.Descriptor instead.
func (*Policy_Buffer) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{1, 2}
}
func (x *Policy_Buffer) GetConnection() int32 {
if x != nil {
return x.Connection
}
return 0
}
type SystemPolicy_Stats struct {
state protoimpl.MessageState `protogen:"open.v1"`
InboundUplink bool `protobuf:"varint,1,opt,name=inbound_uplink,json=inboundUplink,proto3" json:"inbound_uplink,omitempty"`
InboundDownlink bool `protobuf:"varint,2,opt,name=inbound_downlink,json=inboundDownlink,proto3" json:"inbound_downlink,omitempty"`
OutboundUplink bool `protobuf:"varint,3,opt,name=outbound_uplink,json=outboundUplink,proto3" json:"outbound_uplink,omitempty"`
OutboundDownlink bool `protobuf:"varint,4,opt,name=outbound_downlink,json=outboundDownlink,proto3" json:"outbound_downlink,omitempty"`
unknownFields protoimpl.UnknownFields
sizeCache protoimpl.SizeCache
}
func (x *SystemPolicy_Stats) Reset() {
*x = SystemPolicy_Stats{}
mi := &file_app_policy_config_proto_msgTypes[7]
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
ms.StoreMessageInfo(mi)
}
func (x *SystemPolicy_Stats) String() string {
return protoimpl.X.MessageStringOf(x)
}
func (*SystemPolicy_Stats) ProtoMessage() {}
func (x *SystemPolicy_Stats) ProtoReflect() protoreflect.Message {
mi := &file_app_policy_config_proto_msgTypes[7]
if x != nil {
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
if ms.LoadMessageInfo() == nil {
ms.StoreMessageInfo(mi)
}
return ms
}
return mi.MessageOf(x)
}
// Deprecated: Use SystemPolicy_Stats.ProtoReflect.Descriptor instead.
func (*SystemPolicy_Stats) Descriptor() ([]byte, []int) {
return file_app_policy_config_proto_rawDescGZIP(), []int{2, 0}
}
func (x *SystemPolicy_Stats) GetInboundUplink() bool {
if x != nil {
return x.InboundUplink
}
return false
}
func (x *SystemPolicy_Stats) GetInboundDownlink() bool {
if x != nil {
return x.InboundDownlink
}
return false
}
func (x *SystemPolicy_Stats) GetOutboundUplink() bool {
if x != nil {
return x.OutboundUplink
}
return false
}
func (x *SystemPolicy_Stats) GetOutboundDownlink() bool {
if x != nil {
return x.OutboundDownlink
}
return false
}
var File_app_policy_config_proto protoreflect.FileDescriptor
const file_app_policy_config_proto_rawDesc = "" +
"\n" +
"\x17app/policy/config.proto\x12\x0fxray.app.policy\"\x1e\n" +
"\x06Second\x12\x14\n" +
"\x05value\x18\x01 \x01(\rR\x05value\"\xc7\x04\n" +
"\x06Policy\x129\n" +
"\atimeout\x18\x01 \x01(\v2\x1f.xray.app.policy.Policy.TimeoutR\atimeout\x123\n" +
"\x05stats\x18\x02 \x01(\v2\x1d.xray.app.policy.Policy.StatsR\x05stats\x126\n" +
"\x06buffer\x18\x03 \x01(\v2\x1e.xray.app.policy.Policy.BufferR\x06buffer\x1a\xfa\x01\n" +
"\aTimeout\x125\n" +
"\thandshake\x18\x01 \x01(\v2\x17.xray.app.policy.SecondR\thandshake\x12@\n" +
"\x0fconnection_idle\x18\x02 \x01(\v2\x17.xray.app.policy.SecondR\x0econnectionIdle\x128\n" +
"\vuplink_only\x18\x03 \x01(\v2\x17.xray.app.policy.SecondR\n" +
"uplinkOnly\x12<\n" +
"\rdownlink_only\x18\x04 \x01(\v2\x17.xray.app.policy.SecondR\fdownlinkOnly\x1an\n" +
"\x05Stats\x12\x1f\n" +
"\vuser_uplink\x18\x01 \x01(\bR\n" +
"userUplink\x12#\n" +
"\ruser_downlink\x18\x02 \x01(\bR\fuserDownlink\x12\x1f\n" +
"\vuser_online\x18\x03 \x01(\bR\n" +
"userOnline\x1a(\n" +
"\x06Buffer\x12\x1e\n" +
"\n" +
"connection\x18\x01 \x01(\x05R\n" +
"connection\"\xfb\x01\n" +
"\fSystemPolicy\x129\n" +
"\x05stats\x18\x01 \x01(\v2#.xray.app.policy.SystemPolicy.StatsR\x05stats\x1a\xaf\x01\n" +
"\x05Stats\x12%\n" +
"\x0einbound_uplink\x18\x01 \x01(\bR\rinboundUplink\x12)\n" +
"\x10inbound_downlink\x18\x02 \x01(\bR\x0finboundDownlink\x12'\n" +
"\x0foutbound_uplink\x18\x03 \x01(\bR\x0eoutboundUplink\x12+\n" +
"\x11outbound_downlink\x18\x04 \x01(\bR\x10outboundDownlink\"\xcc\x01\n" +
"\x06Config\x128\n" +
"\x05level\x18\x01 \x03(\v2\".xray.app.policy.Config.LevelEntryR\x05level\x125\n" +
"\x06system\x18\x02 \x01(\v2\x1d.xray.app.policy.SystemPolicyR\x06system\x1aQ\n" +
"\n" +
"LevelEntry\x12\x10\n" +
"\x03key\x18\x01 \x01(\rR\x03key\x12-\n" +
"\x05value\x18\x02 \x01(\v2\x17.xray.app.policy.PolicyR\x05value:\x028\x01BO\n" +
"\x13com.xray.app.policyP\x01Z$github.com/xtls/xray-core/app/policy\xaa\x02\x0fXray.App.Policyb\x06proto3"
var (
file_app_policy_config_proto_rawDescOnce sync.Once
file_app_policy_config_proto_rawDescData []byte
)
func file_app_policy_config_proto_rawDescGZIP() []byte {
file_app_policy_config_proto_rawDescOnce.Do(func() {
file_app_policy_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_policy_config_proto_rawDesc), len(file_app_policy_config_proto_rawDesc)))
})
return file_app_policy_config_proto_rawDescData
}
var file_app_policy_config_proto_msgTypes = make([]protoimpl.MessageInfo, 9)
var file_app_policy_config_proto_goTypes = []any{
(*Second)(nil), // 0: xray.app.policy.Second
(*Policy)(nil), // 1: xray.app.policy.Policy
(*SystemPolicy)(nil), // 2: xray.app.policy.SystemPolicy
(*Config)(nil), // 3: xray.app.policy.Config
(*Policy_Timeout)(nil), // 4: xray.app.policy.Policy.Timeout
(*Policy_Stats)(nil), // 5: xray.app.policy.Policy.Stats
(*Policy_Buffer)(nil), // 6: xray.app.policy.Policy.Buffer
(*SystemPolicy_Stats)(nil), // 7: xray.app.policy.SystemPolicy.Stats
nil, // 8: xray.app.policy.Config.LevelEntry
}
var file_app_policy_config_proto_depIdxs = []int32{
4, // 0: xray.app.policy.Policy.timeout:type_name -> xray.app.policy.Policy.Timeout
5, // 1: xray.app.policy.Policy.stats:type_name -> xray.app.policy.Policy.Stats
6, // 2: xray.app.policy.Policy.buffer:type_name -> xray.app.policy.Policy.Buffer
7, // 3: xray.app.policy.SystemPolicy.stats:type_name -> xray.app.policy.SystemPolicy.Stats
8, // 4: xray.app.policy.Config.level:type_name -> xray.app.policy.Config.LevelEntry
2, // 5: xray.app.policy.Config.system:type_name -> xray.app.policy.SystemPolicy
0, // 6: xray.app.policy.Policy.Timeout.handshake:type_name -> xray.app.policy.Second
0, // 7: xray.app.policy.Policy.Timeout.connection_idle:type_name -> xray.app.policy.Second
0, // 8: xray.app.policy.Policy.Timeout.uplink_only:type_name -> xray.app.policy.Second
0, // 9: xray.app.policy.Policy.Timeout.downlink_only:type_name -> xray.app.policy.Second
1, // 10: xray.app.policy.Config.LevelEntry.value:type_name -> xray.app.policy.Policy
11, // [11:11] is the sub-list for method output_type
11, // [11:11] is the sub-list for method input_type
11, // [11:11] is the sub-list for extension type_name
11, // [11:11] is the sub-list for extension extendee
0, // [0:11] is the sub-list for field type_name
}
func init() { file_app_policy_config_proto_init() }
func file_app_policy_config_proto_init() {
if File_app_policy_config_proto != nil {
return
}
type x struct{}
out := protoimpl.TypeBuilder{
File: protoimpl.DescBuilder{
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_policy_config_proto_rawDesc), len(file_app_policy_config_proto_rawDesc)),
NumEnums: 0,
NumMessages: 9,
NumExtensions: 0,
NumServices: 0,
},
GoTypes: file_app_policy_config_proto_goTypes,
DependencyIndexes: file_app_policy_config_proto_depIdxs,
MessageInfos: file_app_policy_config_proto_msgTypes,
}.Build()
File_app_policy_config_proto = out.File
file_app_policy_config_proto_goTypes = nil
file_app_policy_config_proto_depIdxs = nil
}

View file

@ -1,52 +0,0 @@
syntax = "proto3";
package xray.app.policy;
option csharp_namespace = "Xray.App.Policy";
option go_package = "github.com/xtls/xray-core/app/policy";
option java_package = "com.xray.app.policy";
option java_multiple_files = true;
message Second {
uint32 value = 1;
}
message Policy {
// Timeout is a message for timeout settings in various stages, in seconds.
message Timeout {
Second handshake = 1;
Second connection_idle = 2;
Second uplink_only = 3;
Second downlink_only = 4;
}
message Stats {
bool user_uplink = 1;
bool user_downlink = 2;
bool user_online = 3;
}
message Buffer {
// Buffer size per connection, in bytes. -1 for unlimited buffer.
int32 connection = 1;
}
Timeout timeout = 1;
Stats stats = 2;
Buffer buffer = 3;
}
message SystemPolicy {
message Stats {
bool inbound_uplink = 1;
bool inbound_downlink = 2;
bool outbound_uplink = 3;
bool outbound_downlink = 4;
}
Stats stats = 1;
}
message Config {
map<uint32, Policy> level = 1;
SystemPolicy system = 2;
}

View file

@ -1,68 +0,0 @@
package policy
import (
"context"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/features/policy"
)
// Instance is an instance of Policy manager.
type Instance struct {
levels map[uint32]*Policy
system *SystemPolicy
}
// New creates new Policy manager instance.
func New(ctx context.Context, config *Config) (*Instance, error) {
m := &Instance{
levels: make(map[uint32]*Policy),
system: config.System,
}
if len(config.Level) > 0 {
for lv, p := range config.Level {
pp := defaultPolicy()
pp.overrideWith(p)
m.levels[lv] = pp
}
}
return m, nil
}
// Type implements common.HasType.
func (*Instance) Type() interface{} {
return policy.ManagerType()
}
// ForLevel implements policy.Manager.
func (m *Instance) ForLevel(level uint32) policy.Session {
if p, ok := m.levels[level]; ok {
return p.ToCorePolicy()
}
return policy.SessionDefault()
}
// ForSystem implements policy.Manager.
func (m *Instance) ForSystem() policy.System {
if m.system == nil {
return policy.System{}
}
return m.system.ToCorePolicy()
}
// Start implements common.Runnable.Start().
func (m *Instance) Start() error {
return nil
}
// Close implements common.Closable.Close().
func (m *Instance) Close() error {
return nil
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
return New(ctx, config.(*Config))
}))
}

View file

@ -1,45 +0,0 @@
package policy_test
import (
"context"
"testing"
"time"
. "github.com/xtls/xray-core/app/policy"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/features/policy"
)
func TestPolicy(t *testing.T) {
manager, err := New(context.Background(), &Config{
Level: map[uint32]*Policy{
0: {
Timeout: &Policy_Timeout{
Handshake: &Second{
Value: 2,
},
},
},
},
})
common.Must(err)
pDefault := policy.SessionDefault()
{
p := manager.ForLevel(0)
if p.Timeouts.Handshake != 2*time.Second {
t.Error("expect 2 sec timeout, but got ", p.Timeouts.Handshake)
}
if p.Timeouts.ConnectionIdle != pDefault.Timeouts.ConnectionIdle {
t.Error("expect ", pDefault.Timeouts.ConnectionIdle, " sec timeout, but got ", p.Timeouts.ConnectionIdle)
}
}
{
p := manager.ForLevel(1)
if p.Timeouts.Handshake != pDefault.Timeouts.Handshake {
t.Error("expect ", pDefault.Timeouts.Handshake, " sec timeout, but got ", p.Timeouts.Handshake)
}
}
}

View file

@ -1,2 +0,0 @@
// Package policy is an implementation of policy.Manager feature.
package policy

View file

@ -1,234 +0,0 @@
package command
import (
"context"
"github.com/xtls/xray-core/app/commander"
"github.com/xtls/xray-core/common"
"github.com/xtls/xray-core/common/errors"
"github.com/xtls/xray-core/common/protocol"
"github.com/xtls/xray-core/core"
"github.com/xtls/xray-core/features/inbound"
"github.com/xtls/xray-core/features/outbound"
"github.com/xtls/xray-core/proxy"
grpc "google.golang.org/grpc"
)
// InboundOperation is the interface for operations that applies to inbound handlers.
type InboundOperation interface {
// ApplyInbound applies this operation to the given inbound handler.
ApplyInbound(context.Context, inbound.Handler) error
}
// OutboundOperation is the interface for operations that applies to outbound handlers.
type OutboundOperation interface {
// ApplyOutbound applies this operation to the given outbound handler.
ApplyOutbound(context.Context, outbound.Handler) error
}
func getInbound(handler inbound.Handler) (proxy.Inbound, error) {
gi, ok := handler.(proxy.GetInbound)
if !ok {
return nil, errors.New("can't get inbound proxy from handler.")
}
return gi.GetInbound(), nil
}
// ApplyInbound implements InboundOperation.
func (op *AddUserOperation) ApplyInbound(ctx context.Context, handler inbound.Handler) error {
p, err := getInbound(handler)
if err != nil {
return err
}
um, ok := p.(proxy.UserManager)
if !ok {
return errors.New("proxy is not a UserManager")
}
mUser, err := op.User.ToMemoryUser()
if err != nil {
return errors.New("failed to parse user").Base(err)
}
return um.AddUser(ctx, mUser)
}
// ApplyInbound implements InboundOperation.
func (op *RemoveUserOperation) ApplyInbound(ctx context.Context, handler inbound.Handler) error {
p, err := getInbound(handler)
if err != nil {
return err
}
um, ok := p.(proxy.UserManager)
if !ok {
return errors.New("proxy is not a UserManager")
}
return um.RemoveUser(ctx, op.Email)
}
type handlerServer struct {
s *core.Instance
ihm inbound.Manager
ohm outbound.Manager
}
func (s *handlerServer) AddInbound(ctx context.Context, request *AddInboundRequest) (*AddInboundResponse, error) {
if err := core.AddInboundHandler(s.s, request.Inbound); err != nil {
return nil, err
}
return &AddInboundResponse{}, nil
}
func (s *handlerServer) RemoveInbound(ctx context.Context, request *RemoveInboundRequest) (*RemoveInboundResponse, error) {
return &RemoveInboundResponse{}, s.ihm.RemoveHandler(ctx, request.Tag)
}
func (s *handlerServer) AlterInbound(ctx context.Context, request *AlterInboundRequest) (*AlterInboundResponse, error) {
rawOperation, err := request.Operation.GetInstance()
if err != nil {
return nil, errors.New("unknown operation").Base(err)
}
operation, ok := rawOperation.(InboundOperation)
if !ok {
return nil, errors.New("not an inbound operation")
}
handler, err := s.ihm.GetHandler(ctx, request.Tag)
if err != nil {
return nil, errors.New("failed to get handler: ", request.Tag).Base(err)
}
return &AlterInboundResponse{}, operation.ApplyInbound(ctx, handler)
}
func (s *handlerServer) ListInbounds(ctx context.Context, request *ListInboundsRequest) (*ListInboundsResponse, error) {
handlers := s.ihm.ListHandlers(ctx)
response := &ListInboundsResponse{}
if request.GetIsOnlyTags() {
for _, handler := range handlers {
response.Inbounds = append(response.Inbounds, &core.InboundHandlerConfig{
Tag: handler.Tag(),
})
}
} else {
for _, handler := range handlers {
response.Inbounds = append(response.Inbounds, &core.InboundHandlerConfig{
Tag: handler.Tag(),
ReceiverSettings: handler.ReceiverSettings(),
ProxySettings: handler.ProxySettings(),
})
}
}
return response, nil
}
func (s *handlerServer) GetInboundUsers(ctx context.Context, request *GetInboundUserRequest) (*GetInboundUserResponse, error) {
handler, err := s.ihm.GetHandler(ctx, request.Tag)
if err != nil {
return nil, errors.New("failed to get handler: ", request.Tag).Base(err)
}
p, err := getInbound(handler)
if err != nil {
return nil, err
}
um, ok := p.(proxy.UserManager)
if !ok {
return nil, errors.New("proxy is not a UserManager")
}
if len(request.Email) > 0 {
return &GetInboundUserResponse{Users: []*protocol.User{protocol.ToProtoUser(um.GetUser(ctx, request.Email))}}, nil
}
var result = make([]*protocol.User, 0, 100)
users := um.GetUsers(ctx)
for _, u := range users {
result = append(result, protocol.ToProtoUser(u))
}
return &GetInboundUserResponse{Users: result}, nil
}
func (s *handlerServer) GetInboundUsersCount(ctx context.Context, request *GetInboundUserRequest) (*GetInboundUsersCountResponse, error) {
handler, err := s.ihm.GetHandler(ctx, request.Tag)
if err != nil {
return nil, errors.New("failed to get handler: ", request.Tag).Base(err)
}
p, err := getInbound(handler)
if err != nil {
return nil, err
}
um, ok := p.(proxy.UserManager)
if !ok {
return nil, errors.New("proxy is not a UserManager")
}
return &GetInboundUsersCountResponse{Count: um.GetUsersCount(ctx)}, nil
}
func (s *handlerServer) AddOutbound(ctx context.Context, request *AddOutboundRequest) (*AddOutboundResponse, error) {
if err := core.AddOutboundHandler(s.s, request.Outbound); err != nil {
return nil, err
}
return &AddOutboundResponse{}, nil
}
func (s *handlerServer) RemoveOutbound(ctx context.Context, request *RemoveOutboundRequest) (*RemoveOutboundResponse, error) {
return &RemoveOutboundResponse{}, s.ohm.RemoveHandler(ctx, request.Tag)
}
func (s *handlerServer) AlterOutbound(ctx context.Context, request *AlterOutboundRequest) (*AlterOutboundResponse, error) {
rawOperation, err := request.Operation.GetInstance()
if err != nil {
return nil, errors.New("unknown operation").Base(err)
}
operation, ok := rawOperation.(OutboundOperation)
if !ok {
return nil, errors.New("not an outbound operation")
}
handler := s.ohm.GetHandler(request.Tag)
return &AlterOutboundResponse{}, operation.ApplyOutbound(ctx, handler)
}
func (s *handlerServer) ListOutbounds(ctx context.Context, request *ListOutboundsRequest) (*ListOutboundsResponse, error) {
handlers := s.ohm.ListHandlers(ctx)
response := &ListOutboundsResponse{}
for _, handler := range handlers {
// Ignore gRPC outbound
if _, ok := handler.(*commander.Outbound); ok {
continue
}
response.Outbounds = append(response.Outbounds, &core.OutboundHandlerConfig{
Tag: handler.Tag(),
SenderSettings: handler.SenderSettings(),
ProxySettings: handler.ProxySettings(),
})
}
return response, nil
}
func (s *handlerServer) mustEmbedUnimplementedHandlerServiceServer() {}
type service struct {
v *core.Instance
}
func (s *service) Register(server *grpc.Server) {
hs := &handlerServer{
s: s.v,
}
common.Must(s.v.RequireFeatures(func(im inbound.Manager, om outbound.Manager) {
hs.ihm = im
hs.ohm = om
}, false))
RegisterHandlerServiceServer(server, hs)
// For compatibility purposes
vCoreDesc := HandlerService_ServiceDesc
vCoreDesc.ServiceName = "v2ray.core.app.proxyman.command.HandlerService"
server.RegisterService(&vCoreDesc, hs)
}
func init() {
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
s := core.MustFromContext(ctx)
return &service{v: s}, nil
}))
}

File diff suppressed because it is too large Load diff

View file

@ -1,108 +0,0 @@
syntax = "proto3";
package xray.app.proxyman.command;
option csharp_namespace = "Xray.App.Proxyman.Command";
option go_package = "github.com/xtls/xray-core/app/proxyman/command";
option java_package = "com.xray.app.proxyman.command";
option java_multiple_files = true;
import "common/protocol/user.proto";
import "common/serial/typed_message.proto";
import "core/config.proto";
message AddUserOperation {
xray.common.protocol.User user = 1;
}
message RemoveUserOperation {
string email = 1;
}
message AddInboundRequest {
core.InboundHandlerConfig inbound = 1;
}
message AddInboundResponse {}
message RemoveInboundRequest {
string tag = 1;
}
message RemoveInboundResponse {}
message AlterInboundRequest {
string tag = 1;
xray.common.serial.TypedMessage operation = 2;
}
message AlterInboundResponse {}
message ListInboundsRequest {
bool isOnlyTags = 1;
}
message ListInboundsResponse {
repeated core.InboundHandlerConfig inbounds = 1;
}
message GetInboundUserRequest {
string tag = 1;
string email = 2;
}
message GetInboundUserResponse {
repeated xray.common.protocol.User users = 1;
}
message GetInboundUsersCountResponse {
int64 count = 1;
}
message AddOutboundRequest {
core.OutboundHandlerConfig outbound = 1;
}
message AddOutboundResponse {}
message RemoveOutboundRequest {
string tag = 1;
}
message RemoveOutboundResponse {}
message AlterOutboundRequest {
string tag = 1;
xray.common.serial.TypedMessage operation = 2;
}
message AlterOutboundResponse {}
message ListOutboundsRequest {}
message ListOutboundsResponse {
repeated core.OutboundHandlerConfig outbounds = 1;
}
service HandlerService {
rpc AddInbound(AddInboundRequest) returns (AddInboundResponse) {}
rpc RemoveInbound(RemoveInboundRequest) returns (RemoveInboundResponse) {}
rpc AlterInbound(AlterInboundRequest) returns (AlterInboundResponse) {}
rpc ListInbounds(ListInboundsRequest) returns (ListInboundsResponse) {}
rpc GetInboundUsers(GetInboundUserRequest) returns (GetInboundUserResponse) {}
rpc GetInboundUsersCount(GetInboundUserRequest) returns (GetInboundUsersCountResponse) {}
rpc AddOutbound(AddOutboundRequest) returns (AddOutboundResponse) {}
rpc RemoveOutbound(RemoveOutboundRequest) returns (RemoveOutboundResponse) {}
rpc AlterOutbound(AlterOutboundRequest) returns (AlterOutboundResponse) {}
rpc ListOutbounds(ListOutboundsRequest) returns (ListOutboundsResponse) {}
}
message Config {}

Some files were not shown because too many files have changed in this diff Show more