**Fixes & Changes:**

1. **Fixed XPadding Placement Dropdown**:
   - Added the missing `cookie` and `query` options to `xPaddingPlacement` (`stream_xhttp.html`).
   - *Why:* Previously, users wanting `cookie` obfuscation were forced to use the `header` placement string. This caused Xray-core to blindly intercept the entire monolithic HTTP Cookie header, failing internal padding-length validations and causing the inbound to silently drop the connection.
2. **Fixed Uplink Data Placement Validation**:
   - Replaced the unsupported `query` option with `cookie` in `uplinkDataPlacement`.
   - *Why:* Xray-core's `transport_internet.go` explicitly forbids `query` as an uplink placement option. Selecting it from the UI previously sent a payload that would cause Xray-core to instantly throw an `unsupported uplink data placement: query` panic. Adding `cookie` perfectly aligns the UI with Xray-core restrictions.
### Related Issues
- Resolves #3992

docker-compose.yml

@@ -12,5 +12,9 @@ services:
       XRAY_VMESS_AEAD_FORCED: "false"
       XUI_ENABLE_FAIL2BAN: "true"
     tty: true
-    network_mode: host
+    # network_mode: host # Отключено, так как на Windows 11/WSL эта опция не пробрасывает порты на localhost
+    ports:
+      - "2053:2053" # Веб-панель
+      - "2054:2054" # Доп. порт панели/API
+      - "2096:2096" # Порт подписки (Subscription port)
     restart: unless-stopped

subproject/Xray-core-main/.github/ISSUE_TEMPLATE/bug_report.yml

@@ -0,0 +1,78 @@
+name: Bug report
+description: "Submit Xray-core bug"
+body:
+  - type: checkboxes
+    attributes:
+      label: Integrity requirements
+      description: |-
+        Please check all of the following options to prove that you have read and understood the requirements, otherwise this issue will be closed.
+      options:
+        - label: I have read all the comments in the issue template and ensured that this issue meet the requirements.
+          required: true
+        - label: I confirm that I have read the documentation, understand the meaning of all the configuration items I wrote, and did not pile up seemingly useful options or default values.
+          required: true
+        - label: I provided the complete config and logs, rather than just providing the truncated parts based on my own judgment.
+          required: true
+        - label: I searched issues and did not find any similar issues.
+          required: true
+        - label: The problem can be successfully reproduced in the latest Release
+          required: true
+  - type: textarea
+    attributes:
+      label: Description
+      description: |-
+        Please provide a detailed description of the error. And the information you think valuable.
+        If the problem occurs after the update, please provide the **specific** version
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: Reproduction Method
+      description: |-
+        Based on the configuration you provided below, provide the method to reproduce the bug.
+    validations:
+      required: true
+  - type: markdown
+    attributes:
+      value: |-
+        ## Configuration and Log Section
+        
+        ### For config
+        Please provide the configuration files that can reproduce the problem, including the server and client.
+        Don't just paste a big exported config file here. Eliminate useless inbound/outbound, rules, options, this can help determine the problem, if you really want to get help.
+        After removing parts that do not affect reproduction, provide the actual running **complete** file.
+        meaning of complete: This config can be directly used to start the core, **not a truncated part of the config**. For fields like keys, use newly generated valid parameters that have not been actually used to fill in.
+
+        ### For logs
+        Please set the log level to debug and dnsLog to true first.
+        Restart Xray-core, then operate according to the reproduction method, try to reduce the irrelevant part in the log.
+        Remember to delete parts with personal information (such as UUID and IP).
+        Provide the log of Xray-core, not the log output by the panel or other things.
+
+        ### Finally
+        The specific content to be filled in each of the following text boxes needs to be placed between ```<details><pre><code>``` and ```</code></pre></details>```, like this
+        ```
+        <details><pre><code>
+        (config)
+        </code></pre></details>
+        ```
+  - type: textarea
+    attributes:
+      label: Client config
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: Server config
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: Client log
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: Server log
+    validations:
+      required: true

subproject/Xray-core-main/.github/ISSUE_TEMPLATE/bug_report_zh.yml

@@ -0,0 +1,78 @@
+name: bug反馈
+description: "提交 Xray-core bug"
+body:
+  - type: checkboxes
+    attributes:
+      label: 完整性要求
+      description: |-
+        请勾选以下所有选项以证明您已经阅读并理解了以下要求，否则该 issue 将被关闭。
+      options:
+        - label: 我读完了 issue 模板中的所有注释，确保填写符合要求。
+          required: true
+        - label: 我保证阅读了文档，了解所有我编写的配置文件项的含义，而不是大量堆砌看似有用的选项或默认值。
+          required: true
+        - label: 我提供了完整的配置文件和日志，而不是出于自己的判断只给出截取的部分。
+          required: true
+        - label: 我搜索了 issues, 没有发现已提出的类似问题。
+          required: true
+        - label: 问题在 Release 最新的版本上可以成功复现
+          required: true
+  - type: textarea
+    attributes:
+      label: 描述
+      description: |-
+        请提供错误的详细描述。以及你认为有价值的信息。
+        如果问题在更新后出现，请提供**具体**出现问题的版本号。
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: 重现方式
+      description: |-
+        基于你下面提供的配置，提供重现BUG方法。
+    validations:
+      required: true
+  - type: markdown
+    attributes:
+      value: |-
+        ## 配置与日志部分
+        
+        ### 对于配置文件
+        请提供可以重现问题的配置文件，包括服务端和客户端。
+        不要直接在这里黏贴一大段导出的 config 文件。去掉无用的出入站、规则、选项，这可以帮助确定问题，如果你真的想得到帮助。
+        在去掉不影响复现的部分后，提供实际运行的**完整**文件。
+        完整的含义：可以直接使用这个配置启动核心，**不是截取的部分配置**。对于密钥等参数使用重新生成未实际使用的有效参数填充。
+        
+        ### 对于日志
+        请先将日志等级设置为 debug, dnsLog 设置为true.
+        重启 Xray-core ，再按复现方式操作，尽量减少日志中的无关部分。
+        记得删除有关个人信息（如UUID与IP）的部分。
+        提供 Xray-core 的日志，而不是面板或者别的东西输出的日志。
+
+        ### 最后
+        把下面的每格具体内容需要放在 ```<details><pre><code>``` 和 ```</code></pre></details>``` 中间，如
+        ```
+        <details><pre><code>
+        (config)
+        </code></pre></details>
+        ```
+  - type: textarea
+    attributes:
+      label: 客户端配置
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: 服务端配置
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: 客户端日志
+    validations:
+      required: true
+  - type: textarea
+    attributes:
+      label: 服务端日志
+    validations:
+      required: true

subproject/Xray-core-main/.github/ISSUE_TEMPLATE/config.yml

@@ -0,0 +1,4 @@
+contact_links:
+  - name: Community Support and Questions
+    url: https://github.com/XTLS/Xray-core/discussions
+    about: Please ask and answer questions there. The issue tracker is for issues with core.

subproject/Xray-core-main/.github/build/friendly-filenames.json

@@ -0,0 +1,33 @@
+{
+  "android-arm64": { "friendlyName": "android-arm64-v8a" },
+  "darwin-amd64": { "friendlyName": "macos-64" },
+  "darwin-arm64": { "friendlyName": "macos-arm64-v8a" },
+  "freebsd-386": { "friendlyName": "freebsd-32" },
+  "freebsd-amd64": { "friendlyName": "freebsd-64" },
+  "freebsd-arm64": { "friendlyName": "freebsd-arm64-v8a" },
+  "freebsd-arm7": { "friendlyName": "freebsd-arm32-v7a" },
+  "linux-386": { "friendlyName": "linux-32" },
+  "linux-amd64": { "friendlyName": "linux-64" },
+  "linux-arm5": { "friendlyName": "linux-arm32-v5" },
+  "linux-arm64": { "friendlyName": "linux-arm64-v8a" },
+  "linux-arm6": { "friendlyName": "linux-arm32-v6" },
+  "linux-arm7": { "friendlyName": "linux-arm32-v7a" },
+  "linux-mips64le": { "friendlyName": "linux-mips64le" },
+  "linux-mips64": { "friendlyName": "linux-mips64" },
+  "linux-mipslesoftfloat": { "friendlyName": "linux-mips32le-softfloat" },
+  "linux-mipsle": { "friendlyName": "linux-mips32le" },
+  "linux-mipssoftfloat": { "friendlyName": "linux-mips32-softfloat" },
+  "linux-mips": { "friendlyName": "linux-mips32" },
+  "linux-ppc64le": { "friendlyName": "linux-ppc64le" },
+  "linux-ppc64": { "friendlyName": "linux-ppc64" },
+  "linux-riscv64": { "friendlyName": "linux-riscv64" },
+  "linux-loong64": { "friendlyName": "linux-loong64" },
+  "linux-s390x": { "friendlyName": "linux-s390x" },
+  "openbsd-386": { "friendlyName": "openbsd-32" },
+  "openbsd-amd64": { "friendlyName": "openbsd-64" },
+  "openbsd-arm64": { "friendlyName": "openbsd-arm64-v8a" },
+  "openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
+  "windows-386": { "friendlyName": "windows-32" },
+  "windows-amd64": { "friendlyName": "windows-64" },
+  "windows-arm64": { "friendlyName": "windows-arm64-v8a" }
+}

subproject/Xray-core-main/.github/dependabot.yml

@@ -0,0 +1,15 @@
+# To get started with Dependabot version updates, you'll need to specify which
+# package ecosystems to update and where the package manifests are located.
+# Please see the documentation for all configuration options:
+# https://help.github.com/github/administering-a-repository/configuration-options-for-dependency-updates
+
+version: 2
+updates:
+  - package-ecosystem: "gomod"
+    directory: "/" # Location of package manifests
+    schedule:
+      interval: "daily"
+  - package-ecosystem: "github-actions"
+    directory: "/"
+    schedule:
+      interval: "daily"

subproject/Xray-core-main/.github/docker/Dockerfile

@@ -0,0 +1,62 @@
+# syntax=docker/dockerfile:latest
+FROM --platform=$BUILDPLATFORM golang:latest AS build
+
+# Build xray-core
+WORKDIR /src
+COPY . .
+ARG TARGETOS
+ARG TARGETARCH
+RUN GOOS=$TARGETOS GOARCH=$TARGETARCH CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags "-s -w -buildid=" ./main
+
+# Download geodat into a staging directory
+ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geoip.dat /tmp/geodat/geoip.dat
+ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geosite.dat /tmp/geodat/geosite.dat
+
+RUN mkdir -p /tmp/empty
+
+# Create config files with empty JSON content
+RUN mkdir -p /tmp/usr/local/etc/xray
+RUN cat <<EOF >/tmp/usr/local/etc/xray/00_log.json
+{
+  "log": {
+    "error": "/var/log/xray/error.log",
+    "loglevel": "warning",
+    "access": "none",
+    "dnsLog": false
+  }
+}
+EOF
+RUN echo '{}' >/tmp/usr/local/etc/xray/01_api.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/02_dns.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/03_routing.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/04_policy.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/05_inbounds.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/06_outbounds.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/07_transport.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/08_stats.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/09_reverse.json
+
+# Create log files
+RUN mkdir -p /tmp/var/log/xray && touch \
+  /tmp/var/log/xray/access.log \
+  /tmp/var/log/xray/error.log
+
+# Build finally image
+FROM gcr.io/distroless/static:nonroot
+
+COPY --from=build --chown=0:0 --chmod=755 /src/xray /usr/local/bin/xray
+COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/share/xray
+COPY --from=build --chown=0:0 --chmod=644 /tmp/geodat/*.dat /usr/local/share/xray/
+COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/etc/xray
+COPY --from=build --chown=0:0 --chmod=644 /tmp/usr/local/etc/xray/*.json /usr/local/etc/xray/
+COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /var/log/xray
+COPY --from=build --chown=65532:65532 --chmod=600 /tmp/var/log/xray/*.log /var/log/xray/
+
+VOLUME /usr/local/etc/xray
+VOLUME /var/log/xray
+
+ARG TZ=Etc/UTC
+ENV TZ=$TZ
+
+ENTRYPOINT [ "/usr/local/bin/xray" ]
+CMD [ "-confdir", "/usr/local/etc/xray/" ]

subproject/Xray-core-main/.github/docker/Dockerfile.usa

@@ -0,0 +1,71 @@
+# syntax=docker/dockerfile:latest
+FROM --platform=$BUILDPLATFORM golang:latest AS build
+
+# Build xray-core
+WORKDIR /src
+COPY . .
+ARG TARGETOS
+ARG TARGETARCH
+RUN GOOS=$TARGETOS GOARCH=$TARGETARCH CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags "-s -w -buildid=" ./main
+
+# Download geodat into a staging directory
+ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geoip.dat /tmp/geodat/geoip.dat
+ADD https://raw.githubusercontent.com/Loyalsoldier/v2ray-rules-dat/release/geosite.dat /tmp/geodat/geosite.dat
+
+RUN mkdir -p /tmp/empty
+
+# Create config files with empty JSON content
+RUN mkdir -p /tmp/usr/local/etc/xray
+RUN cat <<EOF >/tmp/usr/local/etc/xray/00_log.json
+{
+  "log": {
+    "error": "/var/log/xray/error.log",
+    "loglevel": "warning",
+    "access": "none",
+    "dnsLog": false
+  }
+}
+EOF
+RUN echo '{}' >/tmp/usr/local/etc/xray/01_api.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/02_dns.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/03_routing.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/04_policy.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/05_inbounds.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/06_outbounds.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/07_transport.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/08_stats.json
+RUN echo '{}' >/tmp/usr/local/etc/xray/09_reverse.json
+
+# Create log files
+RUN mkdir -p /tmp/var/log/xray && touch \
+  /tmp/var/log/xray/access.log \
+  /tmp/var/log/xray/error.log
+
+# Build finally image
+# Note on Distroless Base Image and Architecture Support:
+# - The official 'gcr.io/distroless/static' image provided by Google only supports a limited set of architectures for Linux:
+#   - linux/amd64
+#   - linux/arm/v7
+#   - linux/arm64/v8
+#   - linux/ppc64le
+#   - linux/s390x
+# - Upon inspection, the blob contents of the Distroless images across these architectures are nearly identical, with only minor differences in metadata (e.g., 'Architecture' field in the manifest).
+# - Due to this similarity in content, it is feasible to forcibly specify a single platform (e.g., '--platform=linux/amd64') for unsupported architectures, as the core image content remains compatible with statically compiled binaries like Go applications.
+FROM --platform=linux/amd64 gcr.io/distroless/static:nonroot
+
+COPY --from=build --chown=0:0 --chmod=755 /src/xray /usr/local/bin/xray
+COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/share/xray
+COPY --from=build --chown=0:0 --chmod=644 /tmp/geodat/*.dat /usr/local/share/xray/
+COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /usr/local/etc/xray
+COPY --from=build --chown=0:0 --chmod=644 /tmp/usr/local/etc/xray/*.json /usr/local/etc/xray/
+COPY --from=build --chown=0:0 --chmod=755 /tmp/empty /var/log/xray
+COPY --from=build --chown=65532:65532 --chmod=600 /tmp/var/log/xray/*.log /var/log/xray/
+
+VOLUME /usr/local/etc/xray
+VOLUME /var/log/xray
+
+ARG TZ=Etc/UTC
+ENV TZ=$TZ
+
+ENTRYPOINT [ "/usr/local/bin/xray" ]
+CMD [ "-confdir", "/usr/local/etc/xray/" ]

subproject/Xray-core-main/.github/workflows/docker.yml

@@ -0,0 +1,133 @@
+name: Build and Push Docker Image
+
+on:
+  release:
+    types:
+      - published
+      - released
+
+  workflow_dispatch:
+    inputs:
+      tag:
+        description: "Docker image tag:"
+        required: true
+      latest:
+        description: "Set to latest"
+        type: boolean
+        default: false
+
+jobs:
+  build-and-push:
+    if: (github.event.action != 'published') || (github.event.action == 'published' && github.event.release.prerelease == true)
+    runs-on: ubuntu-latest
+    permissions:
+      contents: read
+      packages: write
+
+    steps:
+      - name: Set repository and image name to lowercase
+        env:
+          IMAGE_NAME: "${{ github.repository }}"
+        run: |
+          echo "IMAGE_NAME=${IMAGE_NAME,,}" >>${GITHUB_ENV}
+          echo "FULL_IMAGE_NAME=ghcr.io/${IMAGE_NAME,,}" >>${GITHUB_ENV}
+
+      - name: Validate and extract tag
+        run: |
+          SOURCE_TAG="${{ github.event.inputs.tag }}"
+          if [[ -z "$SOURCE_TAG" ]]; then
+            SOURCE_TAG="${{ github.ref_name }}"
+          fi
+          if [[ -z "$SOURCE_TAG" ]]; then
+            SOURCE_TAG="${{ github.event.release.tag_name }}"
+          fi
+
+          if [[ -z "$SOURCE_TAG" ]]; then
+            echo "Error: Could not determine a valid tag source. Input tag and context tag (github.ref_name) are both empty."
+            exit 1
+          fi
+
+          if [[ "$SOURCE_TAG" =~ ^v[0-9]+\.[0-9] ]]; then
+            IMAGE_TAG="${SOURCE_TAG#v}"
+          else
+            IMAGE_TAG="$SOURCE_TAG"
+          fi
+
+          echo "Docker image tag: '$IMAGE_TAG'."
+          echo "IMAGE_TAG=$IMAGE_TAG" >>${GITHUB_ENV}
+
+          LATEST=false
+          if [[ "${{ github.event_name }}" == "release" && "${{ github.event.release.prerelease }}" == "false" ]] || [[ "${{ github.event_name }}" == "workflow_dispatch" && "${{ github.event.inputs.latest }}" == "true" ]]; then
+            LATEST=true
+          fi
+
+          echo "Latest: '$LATEST'."
+          echo "LATEST=$LATEST" >>${GITHUB_ENV}
+
+      - name: Checkout code
+        uses: actions/checkout@v6
+
+      - name: Set up QEMU
+        uses: docker/setup-qemu-action@v4
+
+      - name: Set up Docker Buildx
+        uses: docker/setup-buildx-action@v4
+
+      - name: Login to GitHub Container Registry
+        uses: docker/login-action@v4
+        with:
+          registry: ghcr.io
+          username: ${{ github.repository_owner }}
+          password: ${{ secrets.GITHUB_TOKEN }}
+
+      - name: Build Docker image (main architectures)
+        id: build_main_arches
+        uses: docker/build-push-action@v7
+        with:
+          context: .
+          file: .github/docker/Dockerfile
+          platforms: |
+            linux/amd64
+            linux/arm/v7
+            linux/arm64/v8
+            linux/ppc64le
+            linux/s390x
+          provenance: false
+          outputs: type=image,name=${{ env.FULL_IMAGE_NAME }},push-by-digest=true,name-canonical=true,push=true
+
+      - name: Build Docker image (additional architectures)
+        id: build_additional_arches
+        uses: docker/build-push-action@v7
+        with:
+          context: .
+          file: .github/docker/Dockerfile.usa
+          platforms: |
+            linux/386
+            linux/arm/v6
+            linux/riscv64
+            linux/loong64
+          provenance: false
+          outputs: type=image,name=${{ env.FULL_IMAGE_NAME }},push-by-digest=true,name-canonical=true,push=true
+
+      - name: Create manifest list and push
+        run: |
+          echo "Creating multi-arch manifest with tag: '${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }}'."
+          docker buildx imagetools create \
+            --tag ${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }} \
+            ${{ env.FULL_IMAGE_NAME }}@${{ steps.build_main_arches.outputs.digest }} \
+            ${{ env.FULL_IMAGE_NAME }}@${{ steps.build_additional_arches.outputs.digest }}
+
+          if [[ "${{ env.LATEST }}" == "true" ]]; then
+            echo "Adding 'latest' tag to manifest: '${{ env.FULL_IMAGE_NAME }}:latest'."
+            docker buildx imagetools create \
+            --tag ${{ env.FULL_IMAGE_NAME }}:latest \
+            ${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }}
+          fi
+
+      - name: Inspect image
+        run: |
+          docker buildx imagetools inspect ${{ env.FULL_IMAGE_NAME }}:${{ env.IMAGE_TAG }}
+
+          if [[ "${{ env.LATEST }}" == "true" ]]; then
+            docker buildx imagetools inspect ${{ env.FULL_IMAGE_NAME }}:latest
+          fi

subproject/Xray-core-main/.github/workflows/release-win7.yml

@@ -0,0 +1,180 @@
+name: Build and Release for Windows 7
+
+on:
+  workflow_dispatch:
+  release:
+    types: [published]
+  push:
+  pull_request:
+    types: [opened, synchronize, reopened]
+
+jobs:
+  check-assets:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Restore Geodat Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-geodat-
+
+      - name: Restore Wintun Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-wintun-
+
+      - name: Check Assets Existence
+        id: check-assets
+        run: |
+          [ -d 'resources' ] || mkdir resources
+          LIST=('geoip.dat' 'geosite.dat')
+          for FILE_NAME in "${LIST[@]}"
+          do
+            echo -e "Checking ${FILE_NAME}..."
+            if [ -s "./resources/${FILE_NAME}" ]; then
+              echo -e "${FILE_NAME} exists."
+            else
+              echo -e "${FILE_NAME} does not exist."
+              echo "missing=true" >> $GITHUB_OUTPUT
+              break
+            fi
+          done
+          LIST=('amd64' 'x86')
+          for ARCHITECTURE in "${LIST[@]}"
+          do
+            echo -e "Checking wintun.dll for ${ARCHITECTURE}..."
+            if [ -s "./resources/wintun/bin/${ARCHITECTURE}/wintun.dll" ]; then
+              echo -e "wintun.dll for ${ARCHITECTURE} exists."
+            else
+              echo -e "wintun.dll for ${ARCHITECTURE} is missing."
+              echo "missing=true" >> $GITHUB_OUTPUT
+              break
+            fi
+          done
+
+      - name: Sleep for 90 seconds if Assets Missing
+        if: steps.check-assets.outputs.missing == 'true'
+        run: sleep 90
+
+  build:
+    needs: check-assets
+    permissions:
+      contents: write
+    strategy:
+      matrix:
+        include:
+          # BEGIN Windows 7
+          - goos: windows
+            goarch: amd64
+            assetname: win7-64
+          - goos: windows
+            goarch: 386
+            assetname: win7-32
+          # END Windows 7
+      fail-fast: false
+
+    runs-on: ubuntu-latest
+    env:
+      GOOS: ${{ matrix.goos}}
+      GOARCH: ${{ matrix.goarch }}
+      CGO_ENABLED: 0
+    steps:
+      - name: Checkout codebase
+        uses: actions/checkout@v6
+
+      - name: Show workflow information
+        run: |
+          _NAME=${{ matrix.assetname }}
+          echo "GOOS: ${{ matrix.goos }}, GOARCH: ${{ matrix.goarch }}, RELEASE_NAME: $_NAME"
+          echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
+
+      - name: Set up Go
+        uses: actions/setup-go@v6
+        with:
+          go-version-file: go.mod
+          check-latest: true
+
+      - name: Setup patched builder
+        run: |
+          GOSDK=$(go env GOROOT)
+          rm -r $GOSDK/*
+          cd $GOSDK
+          curl -O -L -H "Authorization: Bearer ${{ secrets.GITHUB_TOKEN }}" https://github.com/XTLS/go-win7/releases/latest/download/go-for-win7-linux-amd64.zip
+          unzip ./go-for-win7-linux-amd64.zip -d $GOSDK
+          rm ./go-for-win7-linux-amd64.zip
+
+      - name: Get project dependencies
+        run: go mod download
+
+      - name: Build Xray
+        run: |
+          mkdir -p build_assets
+          COMMID=$(git describe --always --dirty)
+          echo 'Building Xray for Windows 7...'
+          go build -o build_assets/xray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
+          # The line below is for without running conhost.exe version. Commented for not being used. Provided for reference.
+          # go build -o build_assets/wxray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-H windowsgui -X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
+
+      - name: Restore Geodat Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-geodat-
+
+      - name: Restore Wintun Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-wintun-
+
+      - name: Add additional assets into package
+        run: |
+          mv -f resources/geo* build_assets/
+          if [[ ${GOOS} == 'windows' ]]; then
+            echo 'CreateObject("Wscript.Shell").Run "xray.exe -config config.json",0' > build_assets/xray_no_window.vbs
+            echo 'Start-Process -FilePath ".\xray.exe" -ArgumentList "-config .\config.json" -WindowStyle Hidden' > build_assets/xray_no_window.ps1
+            if [[ ${GOARCH} == 'amd64' ]]; then
+              mv resources/wintun/bin/amd64/wintun.dll build_assets/
+            fi
+            if [[ ${GOARCH} == '386' ]]; then
+              mv resources/wintun/bin/x86/wintun.dll build_assets/
+            fi
+            mv resources/wintun/LICENSE.txt build_assets/LICENSE-wintun.txt
+          fi
+
+      - name: Copy README.md & LICENSE
+        run: |
+          cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
+          cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
+
+      - name: Create ZIP archive
+        if: github.event_name == 'release'
+        shell: bash
+        run: |
+          pushd build_assets || exit 1
+          touch -mt $(date +%Y01010000) *
+          zip -9vr ../Xray-${{ env.ASSET_NAME }}.zip .
+          popd || exit 1
+          FILE=./Xray-${{ env.ASSET_NAME }}.zip
+          DGST=$FILE.dgst
+          for METHOD in {"md5","sha1","sha256","sha512"}
+          do
+            openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
+          done
+
+      - name: Upload binaries to release
+        uses: svenstaro/upload-release-action@v2
+        if: github.event_name == 'release'
+        with:
+          repo_token: ${{ secrets.GITHUB_TOKEN }}
+          file: ./Xray-${{ env.ASSET_NAME }}.zip*
+          tag: ${{ github.ref }}
+          file_glob: true
+
+      - name: Upload files to Artifacts
+        uses: actions/upload-artifact@v7
+        with:
+          name: Xray-${{ env.ASSET_NAME }}
+          path: |
+            ./build_assets/*

subproject/Xray-core-main/.github/workflows/release.yml

@@ -0,0 +1,287 @@
+name: Build and Release
+
+on:
+  workflow_dispatch:
+  release:
+    types: [published]
+  push:
+  pull_request:
+    types: [opened, synchronize, reopened]
+
+jobs:
+  check-assets:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Restore Geodat Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-geodat-
+
+      - name: Restore Wintun Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-wintun-
+
+      - name: Check Assets Existence
+        id: check-assets
+        run: |
+          [ -d 'resources' ] || mkdir resources
+          LIST=('geoip.dat' 'geosite.dat')
+          for FILE_NAME in "${LIST[@]}"
+          do
+            echo -e "Checking ${FILE_NAME}..."
+            if [ -s "./resources/${FILE_NAME}" ]; then
+              echo -e "${FILE_NAME} exists."
+            else
+              echo -e "${FILE_NAME} does not exist."
+              echo "missing=true" >> $GITHUB_OUTPUT
+              break
+            fi
+          done
+          LIST=('amd64' 'x86' 'arm64')
+          for ARCHITECTURE in "${LIST[@]}"
+          do
+            echo -e "Checking wintun.dll for ${ARCHITECTURE}..."
+            if [ -s "./resources/wintun/bin/${ARCHITECTURE}/wintun.dll" ]; then
+              echo -e "wintun.dll for ${ARCHITECTURE} exists."
+            else
+              echo -e "wintun.dll for ${ARCHITECTURE} is missing."
+              echo "missing=true" >> $GITHUB_OUTPUT
+              break
+            fi
+          done
+
+      - name: Trigger Asset Update Workflow if Assets Missing
+        if: steps.check-assets.outputs.missing == 'true'
+        uses: actions/github-script@v8
+        with:
+          github-token: ${{ secrets.GITHUB_TOKEN }}
+          script: |
+            const { owner, repo } = context.repo;
+            await github.rest.actions.createWorkflowDispatch({
+              owner,
+              repo,
+              workflow_id: 'scheduled-assets-update.yml',
+              ref: context.ref
+            });
+            console.log('Triggered scheduled-assets-update.yml due to missing assets on branch:', context.ref);
+
+      - name: Sleep for 90 seconds if Assets Missing
+        if: steps.check-assets.outputs.missing == 'true'
+        run: sleep 90
+
+  build:
+    needs: check-assets
+    permissions:
+      contents: write
+    strategy:
+      matrix:
+        # Include amd64 on all platforms.
+        goos: [windows, freebsd, openbsd, linux, darwin]
+        goarch: [amd64, 386]
+        patch-assetname: [""]
+        exclude:
+          # Exclude i386 on darwin
+          - goarch: 386
+            goos: darwin
+        include:
+          # BEGIN MacOS ARM64
+          - goos: darwin
+            goarch: arm64
+          # END MacOS ARM64
+          # BEGIN Linux ARM 5 6 7
+          - goos: linux
+            goarch: arm
+            goarm: 7
+          - goos: linux
+            goarch: arm
+            goarm: 6
+          - goos: linux
+            goarch: arm
+            goarm: 5
+          # END Linux ARM 5 6 7
+          # BEGIN Android ARM 8
+          - goos: android
+            goarch: arm64
+          # END Android ARM 8
+          # BEGIN Android AMD64
+          - goos: android
+            goarch: amd64
+            patch-assetname: android-amd64
+          # END Android AMD64
+          # Windows ARM
+          - goos: windows
+            goarch: arm64
+          # BEGIN Other architectures
+          # BEGIN riscv64 & ARM64 & LOONG64
+          - goos: linux
+            goarch: arm64
+          - goos: linux
+            goarch: riscv64
+          - goos: linux
+            goarch: loong64
+          # END riscv64 & ARM64 & LOONG64
+          # BEGIN MIPS
+          - goos: linux
+            goarch: mips64
+          - goos: linux
+            goarch: mips64le
+          - goos: linux
+            goarch: mipsle
+          - goos: linux
+            goarch: mips
+          # END MIPS
+          # BEGIN PPC
+          - goos: linux
+            goarch: ppc64
+          - goos: linux
+            goarch: ppc64le
+          # END PPC
+          # BEGIN FreeBSD ARM
+          - goos: freebsd
+            goarch: arm64
+          - goos: freebsd
+            goarch: arm
+            goarm: 7
+          # END FreeBSD ARM
+          # BEGIN S390X
+          - goos: linux
+            goarch: s390x
+          # END S390X
+          # END Other architectures
+          # BEGIN OPENBSD ARM
+          - goos: openbsd
+            goarch: arm64
+          - goos: openbsd
+            goarch: arm
+            goarm: 7
+          # END OPENBSD ARM
+      fail-fast: false
+
+    runs-on: ubuntu-latest
+    env:
+      GOOS: ${{ matrix.goos }}
+      GOARCH: ${{ matrix.goarch }}
+      GOARM: ${{ matrix.goarm }}
+      CGO_ENABLED: 0
+    steps:
+      - name: Checkout codebase
+        uses: actions/checkout@v6
+
+      - name: Set up NDK
+        if: matrix.goos == 'android'
+        run: |
+          wget -qO android-ndk.zip https://dl.google.com/android/repository/android-ndk-r28b-linux.zip
+          unzip android-ndk.zip
+          rm android-ndk.zip
+          declare -A arches=(
+            ["amd64"]="x86_64-linux-android24-clang"
+            ["arm64"]="aarch64-linux-android24-clang"
+          )
+          echo CC="$(realpath android-ndk-*/toolchains/llvm/prebuilt/linux-x86_64/bin)/${arches[${{ matrix.goarch }}]}" >> $GITHUB_ENV
+          echo CGO_ENABLED=1 >> $GITHUB_ENV
+
+      - name: Show workflow information
+        run: |
+          _NAME=${{ matrix.patch-assetname }}
+          [ -n "$_NAME" ] || _NAME=$(jq ".[\"$GOOS-$GOARCH$GOARM$GOMIPS\"].friendlyName" -r < .github/build/friendly-filenames.json)
+          echo "GOOS: $GOOS, GOARCH: $GOARCH, GOARM: $GOARM, GOMIPS: $GOMIPS, RELEASE_NAME: $_NAME"
+          echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
+
+      - name: Set up Go
+        uses: actions/setup-go@v6
+        with:
+          go-version-file: go.mod
+          check-latest: true
+
+      - name: Get project dependencies
+        run: go mod download
+
+      - name: Build Xray
+        run: |
+          mkdir -p build_assets
+          COMMID=$(git describe --always --dirty)
+          if [[ ${GOOS} == 'windows' ]]; then
+            echo 'Building Xray for Windows...'
+            go build -o build_assets/xray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
+            # The line below is for without running conhost.exe version. Commented for not being used. Provided for reference.
+            # go build -o build_assets/wxray.exe -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-H windowsgui -X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
+          else
+            echo 'Building Xray...'
+            if [[ ${GOARCH} == 'mips' || ${GOARCH} == 'mipsle' ]]; then
+              go build -o build_assets/xray -trimpath -buildvcs=false -gcflags="-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
+              echo 'Building soft-float Xray for MIPS/MIPSLE 32-bit...'
+              GOMIPS=softfloat go build -o build_assets/xray_softfloat -trimpath -buildvcs=false -gcflags="-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
+            else
+              go build -o build_assets/xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=${COMMID} -s -w -buildid=" -v ./main
+            fi
+          fi
+
+      - name: Restore Geodat Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-geodat-
+
+      - name: Restore Wintun Cache
+        if: matrix.goos == 'windows'
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-wintun-
+
+      - name: Add additional assets into package
+        run: |
+          mv -f resources/geo* build_assets/
+          if [[ ${GOOS} == 'windows' ]]; then
+            echo 'CreateObject("Wscript.Shell").Run "xray.exe -config config.json",0' > build_assets/xray_no_window.vbs
+            echo 'Start-Process -FilePath ".\xray.exe" -ArgumentList "-config .\config.json" -WindowStyle Hidden' > build_assets/xray_no_window.ps1
+            if [[ ${GOARCH} == 'amd64' ]]; then
+              mv resources/wintun/bin/amd64/wintun.dll build_assets/
+            fi
+            if [[ ${GOARCH} == '386' ]]; then
+              mv resources/wintun/bin/x86/wintun.dll build_assets/
+            fi
+            if [[ ${GOARCH} == 'arm64' ]]; then
+              mv resources/wintun/bin/arm64/wintun.dll build_assets/
+            fi
+            mv resources/wintun/LICENSE.txt build_assets/LICENSE-wintun.txt
+          fi
+
+      - name: Copy README.md & LICENSE
+        run: |
+          cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
+          cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
+
+      - name: Create ZIP archive
+        if: github.event_name == 'release'
+        shell: bash
+        run: |
+          pushd build_assets || exit 1
+          touch -mt $(date +%Y01010000) *
+          zip -9vr ../Xray-${{ env.ASSET_NAME }}.zip .
+          popd || exit 1
+          FILE=./Xray-${{ env.ASSET_NAME }}.zip
+          DGST=$FILE.dgst
+          for METHOD in {"md5","sha1","sha256","sha512"}
+          do
+            openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
+          done
+
+      - name: Upload binaries to release
+        uses: svenstaro/upload-release-action@v2
+        if: github.event_name == 'release'
+        with:
+          repo_token: ${{ secrets.GITHUB_TOKEN }}
+          file: ./Xray-${{ env.ASSET_NAME }}.zip*
+          tag: ${{ github.ref }}
+          file_glob: true
+
+      - name: Upload files to Artifacts
+        uses: actions/upload-artifact@v7
+        with:
+          name: Xray-${{ env.ASSET_NAME }}
+          path: |
+            ./build_assets/*

subproject/Xray-core-main/.github/workflows/scheduled-assets-update.yml

@@ -0,0 +1,129 @@
+name: Scheduled assets update
+
+# NOTE: This Github Actions is required by other actions, for preparing other packaging assets in a
+#       routine manner, for example: GeoIP/GeoSite.
+#       Currently updating:
+#       - Geodat (GeoIP/Geosite)
+#       - Wintun (wintun.dll)
+
+on:
+  workflow_dispatch:
+  schedule:
+    # Update GeoData on every day (22:30 UTC)
+    - cron: "30 22 * * *"
+  push:
+    # Prevent triggering update request storm
+    paths:
+      - ".github/workflows/scheduled-assets-update.yml"
+  pull_request:
+    # Prevent triggering update request storm
+    paths:
+      - ".github/workflows/scheduled-assets-update.yml"
+
+jobs:
+  geodat:
+    if: github.event.schedule == '30 22 * * *' || github.event_name == 'push' || github.event_name == 'pull_request' || github.event_name == 'workflow_dispatch'
+    runs-on: ubuntu-latest
+    steps:
+      - name: Restore Geodat Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-geodat-
+
+      - name: Update Geodat
+        id: update
+        uses: nick-fields/retry@v4
+        with:
+          timeout_minutes: 60
+          retry_wait_seconds: 60
+          max_attempts: 60
+          command: |
+            [ -d 'resources' ] || mkdir resources
+            LIST=('Loyalsoldier v2ray-rules-dat geoip geoip' 'Loyalsoldier v2ray-rules-dat geosite geosite')
+            for i in "${LIST[@]}"
+            do
+              INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3,$4}'))
+              FILE_NAME="${INFO[3]}.dat"
+              echo -e "Verifying HASH key..."
+              HASH="$(curl -sL -H "Authorization: Bearer ${{ secrets.GITHUB_TOKEN }}" "https://raw.githubusercontent.com/${INFO[0]}/${INFO[1]}/release/${INFO[2]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
+              if [ -s "./resources/${FILE_NAME}" ] && [ "$(sha256sum "./resources/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ]; then
+                  continue
+              else
+                  echo -e "Downloading https://raw.githubusercontent.com/${INFO[0]}/${INFO[1]}/release/${INFO[2]}.dat..."
+                  curl -L -H "Authorization: Bearer ${{ secrets.GITHUB_TOKEN }}" "https://raw.githubusercontent.com/${INFO[0]}/${INFO[1]}/release/${INFO[2]}.dat" -o ./resources/${FILE_NAME}
+                  echo -e "Verifying HASH key..."
+                  [ "$(sha256sum "./resources/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
+                  echo "unhit=true" >> $GITHUB_OUTPUT
+              fi
+            done
+
+      - name: Save Geodat Cache
+        uses: actions/cache/save@v5
+        if: ${{ steps.update.outputs.unhit }}
+        with:
+          path: resources
+          key: xray-geodat-${{ github.sha }}-${{ github.run_number }}
+
+  wintun:
+    if: github.event.schedule == '30 22 * * *' || github.event_name == 'push' || github.event_name == 'pull_request' || github.event_name == 'workflow_dispatch'
+    runs-on: ubuntu-latest
+    steps:
+      - name: Restore Wintun Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-wintun-
+
+      - name: Force downloading if run manually or on file update
+        if: github.event_name == 'workflow_dispatch' || github.event_name == 'push'
+        run: |
+          echo "FORCE_UPDATE=true" >> $GITHUB_ENV
+
+      - name: Update Wintun
+        id: update
+        uses: nick-fields/retry@v4
+        with:
+          timeout_minutes: 60
+          retry_wait_seconds: 60
+          max_attempts: 60
+          command: |
+            [ -d 'resources' ] || mkdir resources
+            LIST=('amd64' 'x86' 'arm64')
+            for ARCHITECTURE in "${LIST[@]}"
+            do
+              FILE_PATH="resources/wintun/bin/${ARCHITECTURE}/wintun.dll"
+              echo -e "Checking if wintun.dll for ${ARCHITECTURE} exists..."
+              if [ -s "./resources/wintun/bin/${ARCHITECTURE}/wintun.dll" ]; then
+                  echo -e "wintun.dll for ${ARCHITECTURE} exists"
+                  continue
+              else
+                  echo -e "wintun.dll for ${ARCHITECTURE} is missing"
+                  missing=true
+              fi
+            done
+            if [ -s "./resources/wintun/LICENSE.txt" ]; then
+              echo -e "LICENSE for Wintun exists"
+            else
+              echo -e "LICENSE for Wintun is missing"
+              missing=true
+            fi
+            if [[ -v FORCE_UPDATE ]]; then
+              missing=true
+            fi
+            if [[ "$missing" == true ]]; then
+              FILENAME=wintun.zip
+              DOWNLOAD_FILE=wintun-0.14.1.zip
+              echo -e "Downloading https://www.wintun.net/builds/${DOWNLOAD_FILE}..."
+              curl -L "https://www.wintun.net/builds/${DOWNLOAD_FILE}" -o "${FILENAME}"
+              echo -e "Unpacking wintun..."
+              unzip -u ${FILENAME} -d resources/
+              echo "unhit=true" >> $GITHUB_OUTPUT
+            fi
+
+      - name: Save Wintun Cache
+        uses: actions/cache/save@v5
+        if: ${{ steps.update.outputs.unhit }}
+        with:
+          path: resources
+          key: xray-wintun-${{ github.sha }}-${{ github.run_number }}

subproject/Xray-core-main/.github/workflows/test.yml

@@ -0,0 +1,77 @@
+name: Test
+
+on:
+  push:
+  pull_request:
+    types: [opened, synchronize, reopened]
+
+jobs:
+  check-assets:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Restore Geodat Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-geodat-
+      - name: Check Assets Existence
+        id: check-assets
+        run: |
+          [ -d 'resources' ] || mkdir resources
+          LIST=('geoip.dat' 'geosite.dat')
+          for FILE_NAME in "${LIST[@]}"
+          do
+            echo -e "Checking ${FILE_NAME}..."
+            if [ -s "./resources/${FILE_NAME}" ]; then
+              echo -e "${FILE_NAME} exists."
+            else
+              echo -e "${FILE_NAME} does not exist."
+              echo "missing=true" >> $GITHUB_OUTPUT
+              break
+            fi
+          done
+      - name: Sleep for 90 seconds if Assets Missing
+        if: steps.check-assets.outputs.missing == 'true'
+        run: sleep 90
+
+  check-proto:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout codebase
+        uses: actions/checkout@v6
+      - name: Check Proto Version Header
+        run: |
+          head -n 4 core/config.pb.go > ref.txt
+          find . -name "*.pb.go" ! -name "*_grpc.pb.go" -print0 | while IFS= read -r -d '' file; do
+            if ! cmp -s ref.txt <(head -n 4 "$file"); then
+              echo "Error: Header mismatch in $file"
+              head -n 4 "$file"
+              exit 1
+            fi
+          done
+
+  test:
+    needs: check-assets
+    permissions:
+      contents: read
+    runs-on: ${{ matrix.os }}
+    strategy:
+      fail-fast: false
+      matrix:
+        os: [windows-latest, ubuntu-latest, macos-latest]
+    steps:
+      - name: Checkout codebase
+        uses: actions/checkout@v6
+      - name: Set up Go
+        uses: actions/setup-go@v6
+        with:
+          go-version-file: go.mod
+          check-latest: true
+      - name: Restore Geodat Cache
+        uses: actions/cache/restore@v5
+        with:
+          path: resources
+          key: xray-geodat-
+          enableCrossOsArchive: true
+      - name: Test
+        run: go test -timeout 1h -v ./...

subproject/Xray-core-main/.gitignore

@@ -0,0 +1,68 @@
+# Binaries for programs and plugins
+*.exe
+*.exe~
+*.dll
+*.so
+*.dylib
+
+# Test binary, built with `go test -c`
+*.test
+
+# Output of the go coverage tool, specifically when used with LiteIDE
+*.out
+
+# macOS specific files
+.DS_Store
+
+# IDE/editor specific files
+.idea/
+.vscode/
+*.swp
+*.swo
+
+# Archives and compressed files
+*.zip
+*.tar.gz
+*.tar
+*.gz
+*.bz2
+
+# Go build binaries
+xray
+xray_softfloat
+mockgen
+vprotogen
+!infra/vprotogen/
+errorgen
+!common/errors/errorgen/
+*.dat
+
+# Build assets
+/build_assets/
+
+# Output from dlv test
+**/debug.*
+
+# Certificates and keys
+*.crt
+*.key
+
+# Dependency directories (uncomment if needed)
+# vendor/
+
+# Logs
+*.log
+
+# Coverage reports
+coverage.*
+
+# Node modules (in case of frontend assets)
+node_modules/
+
+# System files
+Thumbs.db
+ehthumbs.db
+
+# Other common ignores
+*.bak
+*.tmp

subproject/Xray-core-main/CODE_OF_CONDUCT.md

@@ -0,0 +1,128 @@
+# Contributor Covenant Code of Conduct
+
+## Our Pledge
+
+We as members, contributors, and leaders pledge to make participation in our
+community a harassment-free experience for everyone, regardless of age, body
+size, visible or invisible disability, ethnicity, sex characteristics, gender
+identity and expression, level of experience, education, socio-economic status,
+nationality, personal appearance, race, religion, or sexual identity
+and orientation.
+
+We pledge to act and interact in ways that contribute to an open, welcoming,
+diverse, inclusive, and healthy community.
+
+## Our Standards
+
+Examples of behavior that contributes to a positive environment for our
+community include:
+
+* Demonstrating empathy and kindness toward other people
+* Being respectful of differing opinions, viewpoints, and experiences
+* Giving and gracefully accepting constructive feedback
+* Accepting responsibility and apologizing to those affected by our mistakes,
+  and learning from the experience
+* Focusing on what is best not just for us as individuals, but for the
+  overall community
+
+Examples of unacceptable behavior include:
+
+* The use of sexualized language or imagery, and sexual attention or
+  advances of any kind
+* Trolling, insulting or derogatory comments, and personal or political attacks
+* Public or private harassment
+* Publishing others' private information, such as a physical or email
+  address, without their explicit permission
+* Other conduct which could reasonably be considered inappropriate in a
+  professional setting
+
+## Enforcement Responsibilities
+
+Community leaders are responsible for clarifying and enforcing our standards of
+acceptable behavior and will take appropriate and fair corrective action in
+response to any behavior that they deem inappropriate, threatening, offensive,
+or harmful.
+
+Community leaders have the right and responsibility to remove, edit, or reject
+comments, commits, code, wiki edits, issues, and other contributions that are
+not aligned to this Code of Conduct, and will communicate reasons for moderation
+decisions when appropriate.
+
+## Scope
+
+This Code of Conduct applies within all community spaces, and also applies when
+an individual is officially representing the community in public spaces.
+Examples of representing our community include using an official e-mail address,
+posting via an official social media account, or acting as an appointed
+representative at an online or offline event.
+
+## Enforcement
+
+Instances of abusive, harassing, or otherwise unacceptable behavior may be
+reported to the community leaders responsible for enforcement at
+https://t.me/projectXtls.
+All complaints will be reviewed and investigated promptly and fairly.
+
+All community leaders are obligated to respect the privacy and security of the
+reporter of any incident.
+
+## Enforcement Guidelines
+
+Community leaders will follow these Community Impact Guidelines in determining
+the consequences for any action they deem in violation of this Code of Conduct:
+
+### 1. Correction
+
+**Community Impact**: Use of inappropriate language or other behavior deemed
+unprofessional or unwelcome in the community.
+
+**Consequence**: A private, written warning from community leaders, providing
+clarity around the nature of the violation and an explanation of why the
+behavior was inappropriate. A public apology may be requested.
+
+### 2. Warning
+
+**Community Impact**: A violation through a single incident or series
+of actions.
+
+**Consequence**: A warning with consequences for continued behavior. No
+interaction with the people involved, including unsolicited interaction with
+those enforcing the Code of Conduct, for a specified period of time. This
+includes avoiding interactions in community spaces as well as external channels
+like social media. Violating these terms may lead to a temporary or
+permanent ban.
+
+### 3. Temporary Ban
+
+**Community Impact**: A serious violation of community standards, including
+sustained inappropriate behavior.
+
+**Consequence**: A temporary ban from any sort of interaction or public
+communication with the community for a specified period of time. No public or
+private interaction with the people involved, including unsolicited interaction
+with those enforcing the Code of Conduct, is allowed during this period.
+Violating these terms may lead to a permanent ban.
+
+### 4. Permanent Ban
+
+**Community Impact**: Demonstrating a pattern of violation of community
+standards, including sustained inappropriate behavior,  harassment of an
+individual, or aggression toward or disparagement of classes of individuals.
+
+**Consequence**: A permanent ban from any sort of public interaction within
+the community.
+
+## Attribution
+
+This Code of Conduct is adapted from the [Contributor Covenant][homepage],
+version 2.0, available at
+https://www.contributor-covenant.org/version/2/0/code_of_conduct.html.
+
+Community Impact Guidelines were inspired by [Mozilla's code of conduct
+enforcement ladder](https://github.com/mozilla/diversity).
+
+[homepage]: https://www.contributor-covenant.org
+
+For answers to common questions about this code of conduct, see the FAQ at
+https://www.contributor-covenant.org/faq. Translations are available at
+https://www.contributor-covenant.org/translations.

subproject/Xray-core-main/LICENSE

@@ -0,0 +1,373 @@
+Mozilla Public License Version 2.0
+==================================
+
+1. Definitions
+--------------
+
+1.1. "Contributor"
+    means each individual or legal entity that creates, contributes to
+    the creation of, or owns Covered Software.
+
+1.2. "Contributor Version"
+    means the combination of the Contributions of others (if any) used
+    by a Contributor and that particular Contributor's Contribution.
+
+1.3. "Contribution"
+    means Covered Software of a particular Contributor.
+
+1.4. "Covered Software"
+    means Source Code Form to which the initial Contributor has attached
+    the notice in Exhibit A, the Executable Form of such Source Code
+    Form, and Modifications of such Source Code Form, in each case
+    including portions thereof.
+
+1.5. "Incompatible With Secondary Licenses"
+    means
+
+    (a) that the initial Contributor has attached the notice described
+        in Exhibit B to the Covered Software; or
+
+    (b) that the Covered Software was made available under the terms of
+        version 1.1 or earlier of the License, but not also under the
+        terms of a Secondary License.
+
+1.6. "Executable Form"
+    means any form of the work other than Source Code Form.
+
+1.7. "Larger Work"
+    means a work that combines Covered Software with other material, in
+    a separate file or files, that is not Covered Software.
+
+1.8. "License"
+    means this document.
+
+1.9. "Licensable"
+    means having the right to grant, to the maximum extent possible,
+    whether at the time of the initial grant or subsequently, any and
+    all of the rights conveyed by this License.
+
+1.10. "Modifications"
+    means any of the following:
+
+    (a) any file in Source Code Form that results from an addition to,
+        deletion from, or modification of the contents of Covered
+        Software; or
+
+    (b) any new file in Source Code Form that contains any Covered
+        Software.
+
+1.11. "Patent Claims" of a Contributor
+    means any patent claim(s), including without limitation, method,
+    process, and apparatus claims, in any patent Licensable by such
+    Contributor that would be infringed, but for the grant of the
+    License, by the making, using, selling, offering for sale, having
+    made, import, or transfer of either its Contributions or its
+    Contributor Version.
+
+1.12. "Secondary License"
+    means either the GNU General Public License, Version 2.0, the GNU
+    Lesser General Public License, Version 2.1, the GNU Affero General
+    Public License, Version 3.0, or any later versions of those
+    licenses.
+
+1.13. "Source Code Form"
+    means the form of the work preferred for making modifications.
+
+1.14. "You" (or "Your")
+    means an individual or a legal entity exercising rights under this
+    License. For legal entities, "You" includes any entity that
+    controls, is controlled by, or is under common control with You. For
+    purposes of this definition, "control" means (a) the power, direct
+    or indirect, to cause the direction or management of such entity,
+    whether by contract or otherwise, or (b) ownership of more than
+    fifty percent (50%) of the outstanding shares or beneficial
+    ownership of such entity.
+
+2. License Grants and Conditions
+--------------------------------
+
+2.1. Grants
+
+Each Contributor hereby grants You a world-wide, royalty-free,
+non-exclusive license:
+
+(a) under intellectual property rights (other than patent or trademark)
+    Licensable by such Contributor to use, reproduce, make available,
+    modify, display, perform, distribute, and otherwise exploit its
+    Contributions, either on an unmodified basis, with Modifications, or
+    as part of a Larger Work; and
+
+(b) under Patent Claims of such Contributor to make, use, sell, offer
+    for sale, have made, import, and otherwise transfer either its
+    Contributions or its Contributor Version.
+
+2.2. Effective Date
+
+The licenses granted in Section 2.1 with respect to any Contribution
+become effective for each Contribution on the date the Contributor first
+distributes such Contribution.
+
+2.3. Limitations on Grant Scope
+
+The licenses granted in this Section 2 are the only rights granted under
+this License. No additional rights or licenses will be implied from the
+distribution or licensing of Covered Software under this License.
+Notwithstanding Section 2.1(b) above, no patent license is granted by a
+Contributor:
+
+(a) for any code that a Contributor has removed from Covered Software;
+    or
+
+(b) for infringements caused by: (i) Your and any other third party's
+    modifications of Covered Software, or (ii) the combination of its
+    Contributions with other software (except as part of its Contributor
+    Version); or
+
+(c) under Patent Claims infringed by Covered Software in the absence of
+    its Contributions.
+
+This License does not grant any rights in the trademarks, service marks,
+or logos of any Contributor (except as may be necessary to comply with
+the notice requirements in Section 3.4).
+
+2.4. Subsequent Licenses
+
+No Contributor makes additional grants as a result of Your choice to
+distribute the Covered Software under a subsequent version of this
+License (see Section 10.2) or under the terms of a Secondary License (if
+permitted under the terms of Section 3.3).
+
+2.5. Representation
+
+Each Contributor represents that the Contributor believes its
+Contributions are its original creation(s) or it has sufficient rights
+to grant the rights to its Contributions conveyed by this License.
+
+2.6. Fair Use
+
+This License is not intended to limit any rights You have under
+applicable copyright doctrines of fair use, fair dealing, or other
+equivalents.
+
+2.7. Conditions
+
+Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted
+in Section 2.1.
+
+3. Responsibilities
+-------------------
+
+3.1. Distribution of Source Form
+
+All distribution of Covered Software in Source Code Form, including any
+Modifications that You create or to which You contribute, must be under
+the terms of this License. You must inform recipients that the Source
+Code Form of the Covered Software is governed by the terms of this
+License, and how they can obtain a copy of this License. You may not
+attempt to alter or restrict the recipients' rights in the Source Code
+Form.
+
+3.2. Distribution of Executable Form
+
+If You distribute Covered Software in Executable Form then:
+
+(a) such Covered Software must also be made available in Source Code
+    Form, as described in Section 3.1, and You must inform recipients of
+    the Executable Form how they can obtain a copy of such Source Code
+    Form by reasonable means in a timely manner, at a charge no more
+    than the cost of distribution to the recipient; and
+
+(b) You may distribute such Executable Form under the terms of this
+    License, or sublicense it under different terms, provided that the
+    license for the Executable Form does not attempt to limit or alter
+    the recipients' rights in the Source Code Form under this License.
+
+3.3. Distribution of a Larger Work
+
+You may create and distribute a Larger Work under terms of Your choice,
+provided that You also comply with the requirements of this License for
+the Covered Software. If the Larger Work is a combination of Covered
+Software with a work governed by one or more Secondary Licenses, and the
+Covered Software is not Incompatible With Secondary Licenses, this
+License permits You to additionally distribute such Covered Software
+under the terms of such Secondary License(s), so that the recipient of
+the Larger Work may, at their option, further distribute the Covered
+Software under the terms of either this License or such Secondary
+License(s).
+
+3.4. Notices
+
+You may not remove or alter the substance of any license notices
+(including copyright notices, patent notices, disclaimers of warranty,
+or limitations of liability) contained within the Source Code Form of
+the Covered Software, except that You may alter any license notices to
+the extent required to remedy known factual inaccuracies.
+
+3.5. Application of Additional Terms
+
+You may choose to offer, and to charge a fee for, warranty, support,
+indemnity or liability obligations to one or more recipients of Covered
+Software. However, You may do so only on Your own behalf, and not on
+behalf of any Contributor. You must make it absolutely clear that any
+such warranty, support, indemnity, or liability obligation is offered by
+You alone, and You hereby agree to indemnify every Contributor for any
+liability incurred by such Contributor as a result of warranty, support,
+indemnity or liability terms You offer. You may include additional
+disclaimers of warranty and limitations of liability specific to any
+jurisdiction.
+
+4. Inability to Comply Due to Statute or Regulation
+---------------------------------------------------
+
+If it is impossible for You to comply with any of the terms of this
+License with respect to some or all of the Covered Software due to
+statute, judicial order, or regulation then You must: (a) comply with
+the terms of this License to the maximum extent possible; and (b)
+describe the limitations and the code they affect. Such description must
+be placed in a text file included with all distributions of the Covered
+Software under this License. Except to the extent prohibited by statute
+or regulation, such description must be sufficiently detailed for a
+recipient of ordinary skill to be able to understand it.
+
+5. Termination
+--------------
+
+5.1. The rights granted under this License will terminate automatically
+if You fail to comply with any of its terms. However, if You become
+compliant, then the rights granted under this License from a particular
+Contributor are reinstated (a) provisionally, unless and until such
+Contributor explicitly and finally terminates Your grants, and (b) on an
+ongoing basis, if such Contributor fails to notify You of the
+non-compliance by some reasonable means prior to 60 days after You have
+come back into compliance. Moreover, Your grants from a particular
+Contributor are reinstated on an ongoing basis if such Contributor
+notifies You of the non-compliance by some reasonable means, this is the
+first time You have received notice of non-compliance with this License
+from such Contributor, and You become compliant prior to 30 days after
+Your receipt of the notice.
+
+5.2. If You initiate litigation against any entity by asserting a patent
+infringement claim (excluding declaratory judgment actions,
+counter-claims, and cross-claims) alleging that a Contributor Version
+directly or indirectly infringes any patent, then the rights granted to
+You by any and all Contributors for the Covered Software under Section
+2.1 of this License shall terminate.
+
+5.3. In the event of termination under Sections 5.1 or 5.2 above, all
+end user license agreements (excluding distributors and resellers) which
+have been validly granted by You or Your distributors under this License
+prior to termination shall survive termination.
+
+************************************************************************
+*                                                                      *
+*  6. Disclaimer of Warranty                                           *
+*  -------------------------                                           *
+*                                                                      *
+*  Covered Software is provided under this License on an "as is"       *
+*  basis, without warranty of any kind, either expressed, implied, or  *
+*  statutory, including, without limitation, warranties that the       *
+*  Covered Software is free of defects, merchantable, fit for a        *
+*  particular purpose or non-infringing. The entire risk as to the     *
+*  quality and performance of the Covered Software is with You.        *
+*  Should any Covered Software prove defective in any respect, You     *
+*  (not any Contributor) assume the cost of any necessary servicing,   *
+*  repair, or correction. This disclaimer of warranty constitutes an   *
+*  essential part of this License. No use of any Covered Software is   *
+*  authorized under this License except under this disclaimer.         *
+*                                                                      *
+************************************************************************
+
+************************************************************************
+*                                                                      *
+*  7. Limitation of Liability                                          *
+*  --------------------------                                          *
+*                                                                      *
+*  Under no circumstances and under no legal theory, whether tort      *
+*  (including negligence), contract, or otherwise, shall any           *
+*  Contributor, or anyone who distributes Covered Software as          *
+*  permitted above, be liable to You for any direct, indirect,         *
+*  special, incidental, or consequential damages of any character      *
+*  including, without limitation, damages for lost profits, loss of    *
+*  goodwill, work stoppage, computer failure or malfunction, or any    *
+*  and all other commercial damages or losses, even if such party      *
+*  shall have been informed of the possibility of such damages. This   *
+*  limitation of liability shall not apply to liability for death or   *
+*  personal injury resulting from such party's negligence to the       *
+*  extent applicable law prohibits such limitation. Some               *
+*  jurisdictions do not allow the exclusion or limitation of           *
+*  incidental or consequential damages, so this exclusion and          *
+*  limitation may not apply to You.                                    *
+*                                                                      *
+************************************************************************
+
+8. Litigation
+-------------
+
+Any litigation relating to this License may be brought only in the
+courts of a jurisdiction where the defendant maintains its principal
+place of business and such litigation shall be governed by laws of that
+jurisdiction, without reference to its conflict-of-law provisions.
+Nothing in this Section shall prevent a party's ability to bring
+cross-claims or counter-claims.
+
+9. Miscellaneous
+----------------
+
+This License represents the complete agreement concerning the subject
+matter hereof. If any provision of this License is held to be
+unenforceable, such provision shall be reformed only to the extent
+necessary to make it enforceable. Any law or regulation which provides
+that the language of a contract shall be construed against the drafter
+shall not be used to construe this License against a Contributor.
+
+10. Versions of the License
+---------------------------
+
+10.1. New Versions
+
+Mozilla Foundation is the license steward. Except as provided in Section
+10.3, no one other than the license steward has the right to modify or
+publish new versions of this License. Each version will be given a
+distinguishing version number.
+
+10.2. Effect of New Versions
+
+You may distribute the Covered Software under the terms of the version
+of the License under which You originally received the Covered Software,
+or under the terms of any subsequent version published by the license
+steward.
+
+10.3. Modified Versions
+
+If you create software not governed by this License, and you want to
+create a new license for such software, you may create and use a
+modified version of this License if you rename the license and remove
+any references to the name of the license steward (except to note that
+such modified license differs from this License).
+
+10.4. Distributing Source Code Form that is Incompatible With Secondary
+Licenses
+
+If You choose to distribute Source Code Form that is Incompatible With
+Secondary Licenses under the terms of this version of the License, the
+notice described in Exhibit B of this License must be attached.
+
+Exhibit A - Source Code Form License Notice
+-------------------------------------------
+
+  This Source Code Form is subject to the terms of the Mozilla Public
+  License, v. 2.0. If a copy of the MPL was not distributed with this
+  file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+If it is not possible or desirable to put the notice in a particular
+file, then You may include the notice in a location (such as a LICENSE
+file in a relevant directory) where a recipient would be likely to look
+for such a notice.
+
+You may add additional accurate notices of copyright ownership.
+
+Exhibit B - "Incompatible With Secondary Licenses" Notice
+---------------------------------------------------------
+
+  This Source Code Form is "Incompatible With Secondary Licenses", as
+  defined by the Mozilla Public License, v. 2.0.

subproject/Xray-core-main/README.md

@@ -0,0 +1,214 @@
+# Project X
+
+[Project X](https://github.com/XTLS) originates from XTLS protocol, providing a set of network tools such as [Xray-core](https://github.com/XTLS/Xray-core) and [REALITY](https://github.com/XTLS/REALITY).
+
+[README](https://github.com/XTLS/Xray-core#readme) is open, so feel free to submit your project [here](https://github.com/XTLS/Xray-core/pulls).
+
+## Sponsors
+
+[![Remnawave](https://github.com/user-attachments/assets/a22d34ae-01ee-441c-843a-85356748ed1e)](https://docs.rw)
+
+[![Happ](https://github.com/user-attachments/assets/14055dab-e8bb-48bd-89e8-962709e4098e)](https://happ.su)
+
+[![BlancVPN](https://github.com/user-attachments/assets/9145ea7d-5da3-446e-8143-710dba4292c3)](https://blanc.link/VMTSDqW)
+
+[**Sponsor Xray-core**](https://github.com/XTLS/Xray-core/issues/3668)
+
+## Donation & NFTs
+
+### [Collect a Project X NFT to support the development of Project X!](https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/1)
+
+[<img alt="Project X NFT" width="150px" src="https://raw2.seadn.io/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/7fa9ce900fb39b44226348db330e32/8b7fa9ce900fb39b44226348db330e32.svg" />](https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/1)
+
+- **TRX(Tron)/USDT/USDC: `TNrDh5VSfwd4RPrwsohr6poyNTfFefNYan`**
+- **TON: `UQApeV-u2gm43aC1uP76xAC1m6vCylstaN1gpfBmre_5IyTH`**
+- **BTC: `1JpqcziZZuqv3QQJhZGNGBVdCBrGgkL6cT`**
+- **XMR: `4ABHQZ3yJZkBnLoqiKvb3f8eqUnX4iMPb6wdant5ZLGQELctcerceSGEfJnoCk6nnyRZm73wrwSgvZ2WmjYLng6R7sR67nq`**
+- **SOL/USDT/USDC: `3x5NuXHzB5APG6vRinPZcsUv5ukWUY1tBGRSJiEJWtZa`**
+- **ETH/USDT/USDC: `0xDc3Fe44F0f25D13CACb1C4896CD0D321df3146Ee`**
+- **Project X NFT: https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/1**
+- **VLESS NFT: https://opensea.io/collection/vless**
+- **REALITY NFT: https://opensea.io/item/ethereum/0x5ee362866001613093361eb8569d59c4141b76d1/2**
+- **Related links: [VLESS Post-Quantum Encryption](https://github.com/XTLS/Xray-core/pull/5067), [XHTTP: Beyond REALITY](https://github.com/XTLS/Xray-core/discussions/4113), [Announcement of NFTs by Project X](https://github.com/XTLS/Xray-core/discussions/3633)**
+
+## License
+
+[Mozilla Public License Version 2.0](https://github.com/XTLS/Xray-core/blob/main/LICENSE)
+
+## Documentation
+
+[Project X Official Website](https://xtls.github.io)
+
+## Telegram
+
+[Project X](https://t.me/projectXray)
+
+[Project X Channel](https://t.me/projectXtls)
+
+[Project VLESS](https://t.me/projectVless) (Русский)
+
+[Project XHTTP](https://t.me/projectXhttp) (Persian)
+
+## Installation
+
+- Linux Script
+  - [XTLS/Xray-install](https://github.com/XTLS/Xray-install) (**Official**)
+  - [tempest](https://github.com/team-cloudchaser/tempest) (supports [`systemd`](https://systemd.io) and [OpenRC](https://github.com/OpenRC/openrc); Linux-only)
+- Docker
+  - [ghcr.io/xtls/xray-core](https://ghcr.io/xtls/xray-core) (**Official**)
+  - [teddysun/xray](https://hub.docker.com/r/teddysun/xray)
+  - [wulabing/xray_docker](https://github.com/wulabing/xray_docker)
+- Web Panel
+  - [Remnawave](https://github.com/remnawave/panel)
+  - [3X-UI](https://github.com/MHSanaei/3x-ui)
+  - [PasarGuard](https://github.com/PasarGuard/panel)
+  - [Xray-UI](https://github.com/qist/xray-ui)
+  - [X-Panel](https://github.com/xeefei/X-Panel)
+  - [Marzban](https://github.com/Gozargah/Marzban)
+  - [Hiddify](https://github.com/hiddify/Hiddify-Manager)
+  - [TX-UI](https://github.com/AghayeCoder/tx-ui)
+  - [CELERITY](https://github.com/ClickDevTech/CELERITY-panel)
+- One Click
+  - [Xray-REALITY](https://github.com/zxcvos/Xray-script), [xray-reality](https://github.com/sajjaddg/xray-reality), [reality-ezpz](https://github.com/aleskxyz/reality-ezpz)
+  - [Xray_bash_onekey](https://github.com/hello-yunshu/Xray_bash_onekey), [XTool](https://github.com/LordPenguin666/XTool), [VPainLess](https://github.com/vpainless/vpainless)
+  - [v2ray-agent](https://github.com/mack-a/v2ray-agent), [Xray_onekey](https://github.com/wulabing/Xray_onekey), [ProxySU](https://github.com/proxysu/ProxySU)
+- Magisk
+  - [NetProxy-Magisk](https://github.com/Fanju6/NetProxy-Magisk)
+  - [Xray4Magisk](https://github.com/Asterisk4Magisk/Xray4Magisk)
+  - [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
+- Homebrew
+  - `brew install xray`
+
+## Usage
+
+- Example
+  - [VLESS-XTLS-uTLS-REALITY](https://github.com/XTLS/REALITY#readme)
+  - [VLESS-TCP-XTLS-Vision](https://github.com/XTLS/Xray-examples/tree/main/VLESS-TCP-XTLS-Vision)
+  - [All-in-One-fallbacks-Nginx](https://github.com/XTLS/Xray-examples/tree/main/All-in-One-fallbacks-Nginx)
+- Xray-examples
+  - [XTLS/Xray-examples](https://github.com/XTLS/Xray-examples)
+  - [chika0801/Xray-examples](https://github.com/chika0801/Xray-examples)
+  - [lxhao61/integrated-examples](https://github.com/lxhao61/integrated-examples)
+- Tutorial
+  - [XTLS Vision](https://github.com/chika0801/Xray-install)
+  - [REALITY (English)](https://cscot.pages.dev/2023/03/02/Xray-REALITY-tutorial/)
+  - [XTLS-Iran-Reality (English)](https://github.com/SasukeFreestyle/XTLS-Iran-Reality)
+  - [Xray REALITY with 'steal oneself' (English)](https://computerscot.github.io/vless-xtls-utls-reality-steal-oneself.html)
+  - [Xray with WireGuard inbound (English)](https://g800.pages.dev/wireguard)
+
+## GUI Clients
+
+- OpenWrt
+  - [PassWall](https://github.com/Openwrt-Passwall/openwrt-passwall), [PassWall 2](https://github.com/Openwrt-Passwall/openwrt-passwall2)
+  - [ShadowSocksR Plus+](https://github.com/fw876/helloworld)
+  - [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
+- Asuswrt-Merlin
+  - [XRAYUI](https://github.com/DanielLavrushin/asuswrt-merlin-xrayui)
+  - [fancyss](https://github.com/hq450/fancyss)
+- Windows
+  - [v2rayN](https://github.com/2dust/v2rayN)
+  - [Furious](https://github.com/LorenEteval/Furious)
+  - [Invisible Man - Xray](https://github.com/InvisibleManVPN/InvisibleMan-XRayClient)
+  - [AnyPortal](https://github.com/AnyPortal/AnyPortal)
+  - [GenyConnect](https://github.com/genyleap/GenyConnect)
+- Android
+  - [v2rayNG](https://github.com/2dust/v2rayNG)
+  - [X-flutter](https://github.com/XTLS/X-flutter)
+  - [SaeedDev94/Xray](https://github.com/SaeedDev94/Xray)
+  - [SimpleXray](https://github.com/lhear/SimpleXray)
+  - [XrayFA](https://github.com/Q7DF1/XrayFA)
+  - [AnyPortal](https://github.com/AnyPortal/AnyPortal)
+  - [NetProxy-Magisk](https://github.com/Fanju6/NetProxy-Magisk)
+- iOS & macOS arm64 & tvOS
+  - [Happ](https://apps.apple.com/app/happ-proxy-utility/id6504287215) | [Happ RU](https://apps.apple.com/ru/app/happ-proxy-utility-plus/id6746188973) | [Happ tvOS](https://apps.apple.com/us/app/happ-proxy-utility-for-tv/id6748297274)
+  - [Streisand](https://apps.apple.com/app/streisand/id6450534064)
+  - [OneXray](https://github.com/OneXray/OneXray)
+  - [INCY](https://apps.apple.com/en/app/incy/id6756943388)
+- macOS arm64 & x64
+  - [Happ](https://apps.apple.com/app/happ-proxy-utility/id6504287215) | [Happ RU](https://apps.apple.com/ru/app/happ-proxy-utility-plus/id6746188973)
+  - [V2rayU](https://github.com/yanue/V2rayU)
+  - [V2RayXS](https://github.com/tzmax/V2RayXS)
+  - [Furious](https://github.com/LorenEteval/Furious)
+  - [OneXray](https://github.com/OneXray/OneXray)
+  - [GoXRay](https://github.com/goxray/desktop)
+  - [AnyPortal](https://github.com/AnyPortal/AnyPortal)
+  - [v2rayN](https://github.com/2dust/v2rayN)
+  - [GenyConnect](https://github.com/genyleap/GenyConnect)
+  - [INCY](https://apps.apple.com/en/app/incy/id6756943388)
+- Linux
+  - [v2rayA](https://github.com/v2rayA/v2rayA)
+  - [Furious](https://github.com/LorenEteval/Furious)
+  - [GorzRay](https://github.com/ketetefid/GorzRay)
+  - [GoXRay](https://github.com/goxray/desktop)
+  - [AnyPortal](https://github.com/AnyPortal/AnyPortal)
+  - [v2rayN](https://github.com/2dust/v2rayN)
+  - [GenyConnect](https://github.com/genyleap/GenyConnect)
+
+## Others that support VLESS, XTLS, REALITY, XUDP, PLUX...
+
+- iOS & macOS arm64 & tvOS
+  - [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
+  - [Loon](https://apps.apple.com/us/app/loon/id1373567447)
+  - [Egern](https://apps.apple.com/us/app/egern/id1616105820)
+  - [Quantumult X](https://apps.apple.com/us/app/quantumult-x/id1443988620)
+- Xray Tools
+  - [xray-knife](https://github.com/lilendian0x00/xray-knife)
+  - [xray-checker](https://github.com/kutovoys/xray-checker)
+- Xray Wrapper
+  - [XTLS/libXray](https://github.com/XTLS/libXray)
+  - [xtls-sdk](https://github.com/remnawave/xtls-sdk)
+  - [xtlsapi](https://github.com/hiddify/xtlsapi)
+  - [AndroidLibXrayLite](https://github.com/2dust/AndroidLibXrayLite)
+  - [Xray-core-python](https://github.com/LorenEteval/Xray-core-python)
+  - [xray-api](https://github.com/XVGuardian/xray-api)
+- [XrayR](https://github.com/XrayR-project/XrayR)
+  - [XrayR-release](https://github.com/XrayR-project/XrayR-release)
+  - [XrayR-V2Board](https://github.com/missuo/XrayR-V2Board)
+- Cores
+  - [Amnezia VPN](https://github.com/amnezia-vpn)
+  - [mihomo](https://github.com/MetaCubeX/mihomo)
+  - [sing-box](https://github.com/SagerNet/sing-box)
+
+## Contributing
+
+[Code of Conduct](https://github.com/XTLS/Xray-core/blob/main/CODE_OF_CONDUCT.md)
+
+[![Ask DeepWiki](https://deepwiki.com/badge.svg)](https://deepwiki.com/XTLS/Xray-core)
+
+## Credits
+
+- [Xray-core v1.0.0](https://github.com/XTLS/Xray-core/releases/tag/v1.0.0) was forked from [v2fly-core 9a03cc5](https://github.com/v2fly/v2ray-core/commit/9a03cc5c98d04cc28320fcee26dbc236b3291256), and we have made & accumulated a huge number of enhancements over time, check [the release notes for each version](https://github.com/XTLS/Xray-core/releases).
+- For third-party projects used in [Xray-core](https://github.com/XTLS/Xray-core), check your local or [the latest go.mod](https://github.com/XTLS/Xray-core/blob/main/go.mod).
+
+## One-line Compilation
+
+### Windows (PowerShell)
+
+```powershell
+$env:CGO_ENABLED=0
+go build -o xray.exe -trimpath -buildvcs=false -ldflags="-s -w -buildid=" -v ./main
+```
+
+### Linux / macOS
+
+```bash
+CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -ldflags="-s -w -buildid=" -v ./main
+```
+
+### Reproducible Releases
+
+Make sure that you are using the same Go version, and remember to set the git commit id (7 bytes):
+
+```bash
+CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="all=-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=REPLACE -s -w -buildid=" -v ./main
+```
+
+If you are compiling a 32-bit MIPS/MIPSLE target, use this command instead:
+
+```bash
+CGO_ENABLED=0 go build -o xray -trimpath -buildvcs=false -gcflags="-l=4" -ldflags="-X github.com/xtls/xray-core/core.build=REPLACE -s -w -buildid=" -v ./main
+```
+
+## Stargazers over time
+
+[![Stargazers over time](https://starchart.cc/XTLS/Xray-core.svg)](https://starchart.cc/XTLS/Xray-core)

subproject/Xray-core-main/SECURITY.md

@@ -0,0 +1,5 @@
+# Security Policy
+
+If you found an issue related to security vulnerability or protocol-identification problem, please report it to us via "[Report a vulnerability](https://github.com/XTLS/Xray-core/security/advisories/new)" privately, instead of publish it publicly before we release the fixed version.
+
+Thanks for your contribution to the FREE Internet!

subproject/Xray-core-main/app/app.go

@@ -0,0 +1,2 @@
+// Package app contains feature implementations of Xray. The features may be enabled during runtime.
+package app

subproject/Xray-core-main/app/commander/commander.go

@@ -0,0 +1,121 @@
+package commander
+
+import (
+	"context"
+	"net"
+	"sync"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/signal/done"
+	core "github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/outbound"
+	"google.golang.org/grpc"
+)
+
+// Commander is a Xray feature that provides gRPC methods to external clients.
+type Commander struct {
+	sync.Mutex
+	server   *grpc.Server
+	services []Service
+	ohm      outbound.Manager
+	tag      string
+	listen   string
+}
+
+// NewCommander creates a new Commander based on the given config.
+func NewCommander(ctx context.Context, config *Config) (*Commander, error) {
+	c := &Commander{
+		tag:    config.Tag,
+		listen: config.Listen,
+	}
+
+	common.Must(core.RequireFeatures(ctx, func(om outbound.Manager) {
+		c.ohm = om
+	}))
+
+	for _, rawConfig := range config.Service {
+		config, err := rawConfig.GetInstance()
+		if err != nil {
+			return nil, err
+		}
+		rawService, err := common.CreateObject(ctx, config)
+		if err != nil {
+			return nil, err
+		}
+		service, ok := rawService.(Service)
+		if !ok {
+			return nil, errors.New("not a Service.")
+		}
+		c.services = append(c.services, service)
+	}
+
+	return c, nil
+}
+
+// Type implements common.HasType.
+func (c *Commander) Type() interface{} {
+	return (*Commander)(nil)
+}
+
+// Start implements common.Runnable.
+func (c *Commander) Start() error {
+	c.Lock()
+	c.server = grpc.NewServer()
+	for _, service := range c.services {
+		service.Register(c.server)
+	}
+	c.Unlock()
+
+	var listen = func(listener net.Listener) {
+		if err := c.server.Serve(listener); err != nil {
+			errors.LogErrorInner(context.Background(), err, "failed to start grpc server")
+		}
+	}
+
+	if len(c.listen) > 0 {
+		if l, err := net.Listen("tcp", c.listen); err != nil {
+			errors.LogErrorInner(context.Background(), err, "API server failed to listen on ", c.listen)
+			return err
+		} else {
+			errors.LogInfo(context.Background(), "API server listening on ", l.Addr())
+			go listen(l)
+		}
+		return nil
+	}
+
+	listener := &OutboundListener{
+		buffer: make(chan net.Conn, 4),
+		done:   done.New(),
+	}
+
+	go listen(listener)
+
+	if err := c.ohm.RemoveHandler(context.Background(), c.tag); err != nil {
+		errors.LogInfoInner(context.Background(), err, "failed to remove existing handler")
+	}
+
+	return c.ohm.AddHandler(context.Background(), &Outbound{
+		tag:      c.tag,
+		listener: listener,
+	})
+}
+
+// Close implements common.Closable.
+func (c *Commander) Close() error {
+	c.Lock()
+	defer c.Unlock()
+
+	if c.server != nil {
+		c.server.Stop()
+		c.server = nil
+	}
+
+	return nil
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
+		return NewCommander(ctx, cfg.(*Config))
+	}))
+}

subproject/Xray-core-main/app/commander/config.pb.go

@@ -0,0 +1,188 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/commander/config.proto
+
+package commander
+
+import (
+	serial "github.com/xtls/xray-core/common/serial"
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+// Config is the settings for Commander.
+type Config struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// Tag of the outbound handler that handles grpc connections.
+	Tag string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
+	// Network address of commander grpc service.
+	Listen string `protobuf:"bytes,3,opt,name=listen,proto3" json:"listen,omitempty"`
+	// Services that supported by this server. All services must implement Service
+	// interface.
+	Service       []*serial.TypedMessage `protobuf:"bytes,2,rep,name=service,proto3" json:"service,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_commander_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_commander_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_commander_config_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *Config) GetTag() string {
+	if x != nil {
+		return x.Tag
+	}
+	return ""
+}
+
+func (x *Config) GetListen() string {
+	if x != nil {
+		return x.Listen
+	}
+	return ""
+}
+
+func (x *Config) GetService() []*serial.TypedMessage {
+	if x != nil {
+		return x.Service
+	}
+	return nil
+}
+
+// ReflectionConfig is the placeholder config for ReflectionService.
+type ReflectionConfig struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *ReflectionConfig) Reset() {
+	*x = ReflectionConfig{}
+	mi := &file_app_commander_config_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *ReflectionConfig) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*ReflectionConfig) ProtoMessage() {}
+
+func (x *ReflectionConfig) ProtoReflect() protoreflect.Message {
+	mi := &file_app_commander_config_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use ReflectionConfig.ProtoReflect.Descriptor instead.
+func (*ReflectionConfig) Descriptor() ([]byte, []int) {
+	return file_app_commander_config_proto_rawDescGZIP(), []int{1}
+}
+
+var File_app_commander_config_proto protoreflect.FileDescriptor
+
+const file_app_commander_config_proto_rawDesc = "" +
+	"\n" +
+	"\x1aapp/commander/config.proto\x12\x12xray.app.commander\x1a!common/serial/typed_message.proto\"n\n" +
+	"\x06Config\x12\x10\n" +
+	"\x03tag\x18\x01 \x01(\tR\x03tag\x12\x16\n" +
+	"\x06listen\x18\x03 \x01(\tR\x06listen\x12:\n" +
+	"\aservice\x18\x02 \x03(\v2 .xray.common.serial.TypedMessageR\aservice\"\x12\n" +
+	"\x10ReflectionConfigBX\n" +
+	"\x16com.xray.app.commanderP\x01Z'github.com/xtls/xray-core/app/commander\xaa\x02\x12Xray.App.Commanderb\x06proto3"
+
+var (
+	file_app_commander_config_proto_rawDescOnce sync.Once
+	file_app_commander_config_proto_rawDescData []byte
+)
+
+func file_app_commander_config_proto_rawDescGZIP() []byte {
+	file_app_commander_config_proto_rawDescOnce.Do(func() {
+		file_app_commander_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_commander_config_proto_rawDesc), len(file_app_commander_config_proto_rawDesc)))
+	})
+	return file_app_commander_config_proto_rawDescData
+}
+
+var file_app_commander_config_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
+var file_app_commander_config_proto_goTypes = []any{
+	(*Config)(nil),              // 0: xray.app.commander.Config
+	(*ReflectionConfig)(nil),    // 1: xray.app.commander.ReflectionConfig
+	(*serial.TypedMessage)(nil), // 2: xray.common.serial.TypedMessage
+}
+var file_app_commander_config_proto_depIdxs = []int32{
+	2, // 0: xray.app.commander.Config.service:type_name -> xray.common.serial.TypedMessage
+	1, // [1:1] is the sub-list for method output_type
+	1, // [1:1] is the sub-list for method input_type
+	1, // [1:1] is the sub-list for extension type_name
+	1, // [1:1] is the sub-list for extension extendee
+	0, // [0:1] is the sub-list for field type_name
+}
+
+func init() { file_app_commander_config_proto_init() }
+func file_app_commander_config_proto_init() {
+	if File_app_commander_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_commander_config_proto_rawDesc), len(file_app_commander_config_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   2,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_commander_config_proto_goTypes,
+		DependencyIndexes: file_app_commander_config_proto_depIdxs,
+		MessageInfos:      file_app_commander_config_proto_msgTypes,
+	}.Build()
+	File_app_commander_config_proto = out.File
+	file_app_commander_config_proto_goTypes = nil
+	file_app_commander_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/commander/config.proto

@@ -0,0 +1,25 @@
+syntax = "proto3";
+
+package xray.app.commander;
+option csharp_namespace = "Xray.App.Commander";
+option go_package = "github.com/xtls/xray-core/app/commander";
+option java_package = "com.xray.app.commander";
+option java_multiple_files = true;
+
+import "common/serial/typed_message.proto";
+
+// Config is the settings for Commander.
+message Config {
+  // Tag of the outbound handler that handles grpc connections.
+  string tag = 1;
+
+  // Network address of commander grpc service.
+  string listen = 3;
+
+  // Services that supported by this server. All services must implement Service
+  // interface.
+  repeated xray.common.serial.TypedMessage service = 2;
+}
+
+// ReflectionConfig is the placeholder config for ReflectionService.
+message ReflectionConfig {}

subproject/Xray-core-main/app/commander/outbound.go

@@ -0,0 +1,121 @@
+package commander
+
+import (
+	"context"
+	"sync"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
+	"github.com/xtls/xray-core/common/serial"
+	"github.com/xtls/xray-core/common/signal/done"
+	"github.com/xtls/xray-core/transport"
+)
+
+// OutboundListener is a net.Listener for listening gRPC connections.
+type OutboundListener struct {
+	buffer chan net.Conn
+	done   *done.Instance
+}
+
+func (l *OutboundListener) add(conn net.Conn) {
+	select {
+	case l.buffer <- conn:
+	case <-l.done.Wait():
+		conn.Close()
+	default:
+		conn.Close()
+	}
+}
+
+// Accept implements net.Listener.
+func (l *OutboundListener) Accept() (net.Conn, error) {
+	select {
+	case <-l.done.Wait():
+		return nil, errors.New("listen closed")
+	case c := <-l.buffer:
+		return c, nil
+	}
+}
+
+// Close implements net.Listener.
+func (l *OutboundListener) Close() error {
+	common.Must(l.done.Close())
+L:
+	for {
+		select {
+		case c := <-l.buffer:
+			c.Close()
+		default:
+			break L
+		}
+	}
+	return nil
+}
+
+// Addr implements net.Listener.
+func (l *OutboundListener) Addr() net.Addr {
+	return &net.TCPAddr{
+		IP:   net.IP{0, 0, 0, 0},
+		Port: 0,
+	}
+}
+
+// Outbound is a outbound.Handler that handles gRPC connections.
+type Outbound struct {
+	tag      string
+	listener *OutboundListener
+	access   sync.RWMutex
+	closed   bool
+}
+
+// Dispatch implements outbound.Handler.
+func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
+	co.access.RLock()
+
+	if co.closed {
+		common.Interrupt(link.Reader)
+		common.Interrupt(link.Writer)
+		co.access.RUnlock()
+		return
+	}
+
+	closeSignal := done.New()
+	c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
+	co.listener.add(c)
+	co.access.RUnlock()
+	<-closeSignal.Wait()
+}
+
+// Tag implements outbound.Handler.
+func (co *Outbound) Tag() string {
+	return co.tag
+}
+
+// Start implements common.Runnable.
+func (co *Outbound) Start() error {
+	co.access.Lock()
+	co.closed = false
+	co.access.Unlock()
+	return nil
+}
+
+// Close implements common.Closable.
+func (co *Outbound) Close() error {
+	co.access.Lock()
+	defer co.access.Unlock()
+
+	co.closed = true
+	return co.listener.Close()
+}
+
+// SenderSettings implements outbound.Handler.
+func (co *Outbound) SenderSettings() *serial.TypedMessage {
+	return nil
+}
+
+// ProxySettings implements outbound.Handler.
+func (co *Outbound) ProxySettings() *serial.TypedMessage {
+	return nil
+}

subproject/Xray-core-main/app/commander/service.go

@@ -0,0 +1,27 @@
+package commander
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/common"
+	"google.golang.org/grpc"
+	"google.golang.org/grpc/reflection"
+)
+
+// Service is a Commander service.
+type Service interface {
+	// Register registers the service itself to a gRPC server.
+	Register(*grpc.Server)
+}
+
+type reflectionService struct{}
+
+func (r reflectionService) Register(s *grpc.Server) {
+	reflection.Register(s)
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*ReflectionConfig)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
+		return reflectionService{}, nil
+	}))
+}

subproject/Xray-core-main/app/dispatcher/config.pb.go

@@ -0,0 +1,162 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/dispatcher/config.proto
+
+package dispatcher
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type SessionConfig struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *SessionConfig) Reset() {
+	*x = SessionConfig{}
+	mi := &file_app_dispatcher_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *SessionConfig) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*SessionConfig) ProtoMessage() {}
+
+func (x *SessionConfig) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dispatcher_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use SessionConfig.ProtoReflect.Descriptor instead.
+func (*SessionConfig) Descriptor() ([]byte, []int) {
+	return file_app_dispatcher_config_proto_rawDescGZIP(), []int{0}
+}
+
+type Config struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Settings      *SessionConfig         `protobuf:"bytes,1,opt,name=settings,proto3" json:"settings,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_dispatcher_config_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dispatcher_config_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_dispatcher_config_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *Config) GetSettings() *SessionConfig {
+	if x != nil {
+		return x.Settings
+	}
+	return nil
+}
+
+var File_app_dispatcher_config_proto protoreflect.FileDescriptor
+
+const file_app_dispatcher_config_proto_rawDesc = "" +
+	"\n" +
+	"\x1bapp/dispatcher/config.proto\x12\x13xray.app.dispatcher\"\x15\n" +
+	"\rSessionConfigJ\x04\b\x01\x10\x02\"H\n" +
+	"\x06Config\x12>\n" +
+	"\bsettings\x18\x01 \x01(\v2\".xray.app.dispatcher.SessionConfigR\bsettingsB[\n" +
+	"\x17com.xray.app.dispatcherP\x01Z(github.com/xtls/xray-core/app/dispatcher\xaa\x02\x13Xray.App.Dispatcherb\x06proto3"
+
+var (
+	file_app_dispatcher_config_proto_rawDescOnce sync.Once
+	file_app_dispatcher_config_proto_rawDescData []byte
+)
+
+func file_app_dispatcher_config_proto_rawDescGZIP() []byte {
+	file_app_dispatcher_config_proto_rawDescOnce.Do(func() {
+		file_app_dispatcher_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_dispatcher_config_proto_rawDesc), len(file_app_dispatcher_config_proto_rawDesc)))
+	})
+	return file_app_dispatcher_config_proto_rawDescData
+}
+
+var file_app_dispatcher_config_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
+var file_app_dispatcher_config_proto_goTypes = []any{
+	(*SessionConfig)(nil), // 0: xray.app.dispatcher.SessionConfig
+	(*Config)(nil),        // 1: xray.app.dispatcher.Config
+}
+var file_app_dispatcher_config_proto_depIdxs = []int32{
+	0, // 0: xray.app.dispatcher.Config.settings:type_name -> xray.app.dispatcher.SessionConfig
+	1, // [1:1] is the sub-list for method output_type
+	1, // [1:1] is the sub-list for method input_type
+	1, // [1:1] is the sub-list for extension type_name
+	1, // [1:1] is the sub-list for extension extendee
+	0, // [0:1] is the sub-list for field type_name
+}
+
+func init() { file_app_dispatcher_config_proto_init() }
+func file_app_dispatcher_config_proto_init() {
+	if File_app_dispatcher_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_dispatcher_config_proto_rawDesc), len(file_app_dispatcher_config_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   2,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_dispatcher_config_proto_goTypes,
+		DependencyIndexes: file_app_dispatcher_config_proto_depIdxs,
+		MessageInfos:      file_app_dispatcher_config_proto_msgTypes,
+	}.Build()
+	File_app_dispatcher_config_proto = out.File
+	file_app_dispatcher_config_proto_goTypes = nil
+	file_app_dispatcher_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/dispatcher/config.proto

@@ -0,0 +1,15 @@
+syntax = "proto3";
+
+package xray.app.dispatcher;
+option csharp_namespace = "Xray.App.Dispatcher";
+option go_package = "github.com/xtls/xray-core/app/dispatcher";
+option java_package = "com.xray.app.dispatcher";
+option java_multiple_files = true;
+
+message SessionConfig {
+  reserved 1;
+}
+
+message Config {
+  SessionConfig settings = 1;
+}

subproject/Xray-core-main/app/dispatcher/default.go

@@ -0,0 +1,519 @@
+package dispatcher
+
+import (
+	"context"
+	"regexp"
+	"strings"
+	"sync"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/protocol"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/outbound"
+	"github.com/xtls/xray-core/features/policy"
+	"github.com/xtls/xray-core/features/routing"
+	routing_session "github.com/xtls/xray-core/features/routing/session"
+	"github.com/xtls/xray-core/features/stats"
+	"github.com/xtls/xray-core/transport"
+	"github.com/xtls/xray-core/transport/pipe"
+)
+
+var errSniffingTimeout = errors.New("timeout on sniffing")
+
+type cachedReader struct {
+	sync.Mutex
+	reader buf.TimeoutReader // *pipe.Reader or *buf.TimeoutWrapperReader
+	cache  buf.MultiBuffer
+}
+
+func (r *cachedReader) Cache(b *buf.Buffer, deadline time.Duration) error {
+	mb, err := r.reader.ReadMultiBufferTimeout(deadline)
+	if err != nil {
+		return err
+	}
+	r.Lock()
+	if !mb.IsEmpty() {
+		r.cache, _ = buf.MergeMulti(r.cache, mb)
+	}
+	b.Clear()
+	rawBytes := b.Extend(min(r.cache.Len(), b.Cap()))
+	n := r.cache.Copy(rawBytes)
+	b.Resize(0, int32(n))
+	r.Unlock()
+	return nil
+}
+
+func (r *cachedReader) readInternal() buf.MultiBuffer {
+	r.Lock()
+	defer r.Unlock()
+
+	if r.cache != nil && !r.cache.IsEmpty() {
+		mb := r.cache
+		r.cache = nil
+		return mb
+	}
+
+	return nil
+}
+
+func (r *cachedReader) ReadMultiBuffer() (buf.MultiBuffer, error) {
+	mb := r.readInternal()
+	if mb != nil {
+		return mb, nil
+	}
+
+	return r.reader.ReadMultiBuffer()
+}
+
+func (r *cachedReader) ReadMultiBufferTimeout(timeout time.Duration) (buf.MultiBuffer, error) {
+	mb := r.readInternal()
+	if mb != nil {
+		return mb, nil
+	}
+
+	return r.reader.ReadMultiBufferTimeout(timeout)
+}
+
+func (r *cachedReader) Interrupt() {
+	r.Lock()
+	if r.cache != nil {
+		r.cache = buf.ReleaseMulti(r.cache)
+	}
+	r.Unlock()
+	if p, ok := r.reader.(*pipe.Reader); ok {
+		p.Interrupt()
+	}
+}
+
+// DefaultDispatcher is a default implementation of Dispatcher.
+type DefaultDispatcher struct {
+	ohm    outbound.Manager
+	router routing.Router
+	policy policy.Manager
+	stats  stats.Manager
+	fdns   dns.FakeDNSEngine
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		d := new(DefaultDispatcher)
+		if err := core.RequireFeatures(ctx, func(om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager, dc dns.Client) error {
+			core.OptionalFeatures(ctx, func(fdns dns.FakeDNSEngine) {
+				d.fdns = fdns
+			})
+			return d.Init(config.(*Config), om, router, pm, sm)
+		}); err != nil {
+			return nil, err
+		}
+		return d, nil
+	}))
+}
+
+// Init initializes DefaultDispatcher.
+func (d *DefaultDispatcher) Init(config *Config, om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager) error {
+	d.ohm = om
+	d.router = router
+	d.policy = pm
+	d.stats = sm
+	return nil
+}
+
+// Type implements common.HasType.
+func (*DefaultDispatcher) Type() interface{} {
+	return routing.DispatcherType()
+}
+
+// Start implements common.Runnable.
+func (*DefaultDispatcher) Start() error {
+	return nil
+}
+
+// Close implements common.Closable.
+func (*DefaultDispatcher) Close() error { return nil }
+
+func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *transport.Link) {
+	opt := pipe.OptionsFromContext(ctx)
+	uplinkReader, uplinkWriter := pipe.New(opt...)
+	downlinkReader, downlinkWriter := pipe.New(opt...)
+
+	inboundLink := &transport.Link{
+		Reader: downlinkReader,
+		Writer: uplinkWriter,
+	}
+
+	outboundLink := &transport.Link{
+		Reader: uplinkReader,
+		Writer: downlinkWriter,
+	}
+
+	sessionInbound := session.InboundFromContext(ctx)
+	var user *protocol.MemoryUser
+	if sessionInbound != nil {
+		user = sessionInbound.User
+	}
+
+	if user != nil && len(user.Email) > 0 {
+		p := d.policy.ForLevel(user.Level)
+		if p.Stats.UserUplink {
+			name := "user>>>" + user.Email + ">>>traffic>>>uplink"
+			if c, _ := stats.GetOrRegisterCounter(d.stats, name); c != nil {
+				inboundLink.Writer = &SizeStatWriter{
+					Counter: c,
+					Writer:  inboundLink.Writer,
+				}
+			}
+		}
+		if p.Stats.UserDownlink {
+			name := "user>>>" + user.Email + ">>>traffic>>>downlink"
+			if c, _ := stats.GetOrRegisterCounter(d.stats, name); c != nil {
+				outboundLink.Writer = &SizeStatWriter{
+					Counter: c,
+					Writer:  outboundLink.Writer,
+				}
+			}
+		}
+
+		if p.Stats.UserOnline {
+			name := "user>>>" + user.Email + ">>>online"
+			if om, _ := stats.GetOrRegisterOnlineMap(d.stats, name); om != nil {
+				userIP := sessionInbound.Source.Address.String()
+				om.AddIP(userIP)
+				context.AfterFunc(ctx, func() { om.RemoveIP(userIP) })
+			}
+		}
+	}
+
+	return inboundLink, outboundLink
+}
+
+func WrapLink(ctx context.Context, policyManager policy.Manager, statsManager stats.Manager, link *transport.Link) *transport.Link {
+	sessionInbound := session.InboundFromContext(ctx)
+	var user *protocol.MemoryUser
+	if sessionInbound != nil {
+		user = sessionInbound.User
+	}
+
+	link.Reader = &buf.TimeoutWrapperReader{Reader: link.Reader}
+
+	if user != nil && len(user.Email) > 0 {
+		p := policyManager.ForLevel(user.Level)
+		if p.Stats.UserUplink {
+			name := "user>>>" + user.Email + ">>>traffic>>>uplink"
+			if c, _ := stats.GetOrRegisterCounter(statsManager, name); c != nil {
+				link.Reader.(*buf.TimeoutWrapperReader).Counter = c
+			}
+		}
+		if p.Stats.UserDownlink {
+			name := "user>>>" + user.Email + ">>>traffic>>>downlink"
+			if c, _ := stats.GetOrRegisterCounter(statsManager, name); c != nil {
+				link.Writer = &SizeStatWriter{
+					Counter: c,
+					Writer:  link.Writer,
+				}
+			}
+		}
+		if p.Stats.UserOnline {
+			name := "user>>>" + user.Email + ">>>online"
+			if om, _ := stats.GetOrRegisterOnlineMap(statsManager, name); om != nil {
+				userIP := sessionInbound.Source.Address.String()
+				om.AddIP(userIP)
+				context.AfterFunc(ctx, func() { om.RemoveIP(userIP) })
+			}
+		}
+	}
+
+	return link
+}
+
+func (d *DefaultDispatcher) shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
+	domain := result.Domain()
+	if domain == "" {
+		return false
+	}
+	for _, d := range request.ExcludeForDomain {
+		if strings.HasPrefix(d, "regexp:") {
+			pattern := d[7:]
+			re, err := regexp.Compile(pattern)
+			if err != nil {
+				errors.LogInfo(ctx, "Unable to compile regex")
+				continue
+			}
+			if re.MatchString(domain) {
+				return false
+			}
+		} else {
+			if strings.ToLower(domain) == d {
+				return false
+			}
+		}
+	}
+	protocolString := result.Protocol()
+	if resComp, ok := result.(SnifferResultComposite); ok {
+		protocolString = resComp.ProtocolForDomainResult()
+	}
+	for _, p := range request.OverrideDestinationForProtocol {
+		if strings.HasPrefix(protocolString, p) || strings.HasPrefix(p, protocolString) {
+			return true
+		}
+		if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && protocolString != "bittorrent" && p == "fakedns" &&
+			fkr0.IsIPInIPPool(destination.Address) {
+			errors.LogInfo(ctx, "Using sniffer ", protocolString, " since the fake DNS missed")
+			return true
+		}
+		if resultSubset, ok := result.(SnifferIsProtoSubsetOf); ok {
+			if resultSubset.IsProtoSubsetOf(p) {
+				return true
+			}
+		}
+	}
+
+	return false
+}
+
+// Dispatch implements routing.Dispatcher.
+func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destination) (*transport.Link, error) {
+	if !destination.IsValid() {
+		panic("Dispatcher: Invalid destination.")
+	}
+	outbounds := session.OutboundsFromContext(ctx)
+	if len(outbounds) == 0 {
+		outbounds = []*session.Outbound{{}}
+		ctx = session.ContextWithOutbounds(ctx, outbounds)
+	}
+	ob := outbounds[len(outbounds)-1]
+	ob.OriginalTarget = destination
+	ob.Target = destination
+	content := session.ContentFromContext(ctx)
+	if content == nil {
+		content = new(session.Content)
+		ctx = session.ContextWithContent(ctx, content)
+	}
+
+	sniffingRequest := content.SniffingRequest
+	inbound, outbound := d.getLink(ctx)
+	if !sniffingRequest.Enabled {
+		go d.routedDispatch(ctx, outbound, destination)
+	} else {
+		go func() {
+			cReader := &cachedReader{
+				reader: outbound.Reader.(*pipe.Reader),
+			}
+			outbound.Reader = cReader
+			result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
+			if err == nil {
+				content.Protocol = result.Protocol()
+			}
+			if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
+				domain := result.Domain()
+				errors.LogInfo(ctx, "sniffed domain: ", domain)
+				destination.Address = net.ParseAddress(domain)
+				protocol := result.Protocol()
+				if resComp, ok := result.(SnifferResultComposite); ok {
+					protocol = resComp.ProtocolForDomainResult()
+				}
+				isFakeIP := false
+				if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && fkr0.IsIPInIPPool(ob.Target.Address) {
+					isFakeIP = true
+				}
+				if sniffingRequest.RouteOnly && protocol != "fakedns" && protocol != "fakedns+others" && !isFakeIP {
+					ob.RouteTarget = destination
+				} else {
+					ob.Target = destination
+				}
+			}
+			d.routedDispatch(ctx, outbound, destination)
+		}()
+	}
+	return inbound, nil
+}
+
+// DispatchLink implements routing.Dispatcher.
+func (d *DefaultDispatcher) DispatchLink(ctx context.Context, destination net.Destination, outbound *transport.Link) error {
+	if !destination.IsValid() {
+		return errors.New("Dispatcher: Invalid destination.")
+	}
+	outbounds := session.OutboundsFromContext(ctx)
+	if len(outbounds) == 0 {
+		outbounds = []*session.Outbound{{}}
+		ctx = session.ContextWithOutbounds(ctx, outbounds)
+	}
+	ob := outbounds[len(outbounds)-1]
+	ob.OriginalTarget = destination
+	ob.Target = destination
+	content := session.ContentFromContext(ctx)
+	if content == nil {
+		content = new(session.Content)
+		ctx = session.ContextWithContent(ctx, content)
+	}
+	outbound = WrapLink(ctx, d.policy, d.stats, outbound)
+	sniffingRequest := content.SniffingRequest
+	if !sniffingRequest.Enabled {
+		d.routedDispatch(ctx, outbound, destination)
+	} else {
+		cReader := &cachedReader{
+			reader: outbound.Reader.(buf.TimeoutReader),
+		}
+		outbound.Reader = cReader
+		result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
+		if err == nil {
+			content.Protocol = result.Protocol()
+		}
+		if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
+			domain := result.Domain()
+			errors.LogInfo(ctx, "sniffed domain: ", domain)
+			destination.Address = net.ParseAddress(domain)
+			protocol := result.Protocol()
+			if resComp, ok := result.(SnifferResultComposite); ok {
+				protocol = resComp.ProtocolForDomainResult()
+			}
+			isFakeIP := false
+			if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && fkr0.IsIPInIPPool(ob.Target.Address) {
+				isFakeIP = true
+			}
+			if sniffingRequest.RouteOnly && protocol != "fakedns" && protocol != "fakedns+others" && !isFakeIP {
+				ob.RouteTarget = destination
+			} else {
+				ob.Target = destination
+			}
+		}
+		d.routedDispatch(ctx, outbound, destination)
+	}
+
+	return nil
+}
+
+func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool, network net.Network) (SniffResult, error) {
+	payload := buf.NewWithSize(32767)
+	defer payload.Release()
+
+	sniffer := NewSniffer(ctx)
+
+	metaresult, metadataErr := sniffer.SniffMetadata(ctx)
+
+	if metadataOnly {
+		return metaresult, metadataErr
+	}
+
+	contentResult, contentErr := func() (SniffResult, error) {
+		cacheDeadline := 200 * time.Millisecond
+		totalAttempt := 0
+		for {
+			select {
+			case <-ctx.Done():
+				return nil, ctx.Err()
+			default:
+				cachingStartingTimeStamp := time.Now()
+				err := cReader.Cache(payload, cacheDeadline)
+				if err != nil {
+					return nil, err
+				}
+				cachingTimeElapsed := time.Since(cachingStartingTimeStamp)
+				cacheDeadline -= cachingTimeElapsed
+
+				if !payload.IsEmpty() {
+					result, err := sniffer.Sniff(ctx, payload.Bytes(), network)
+					switch err {
+					case common.ErrNoClue: // No Clue: protocol not matches, and sniffer cannot determine whether there will be a match or not
+						totalAttempt++
+					case protocol.ErrProtoNeedMoreData: // Protocol Need More Data: protocol matches, but need more data to complete sniffing
+						// in this case, do not add totalAttempt(allow to read until timeout)
+					default:
+						return result, err
+					}
+				} else {
+					totalAttempt++
+				}
+				if totalAttempt >= 2 || cacheDeadline <= 0 {
+					return nil, errSniffingTimeout
+				}
+			}
+		}
+	}()
+	if contentErr != nil && metadataErr == nil {
+		return metaresult, nil
+	}
+	if contentErr == nil && metadataErr == nil {
+		return CompositeResult(metaresult, contentResult), nil
+	}
+	return contentResult, contentErr
+}
+
+func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
+	outbounds := session.OutboundsFromContext(ctx)
+	ob := outbounds[len(outbounds)-1]
+
+	var handler outbound.Handler
+
+	routingLink := routing_session.AsRoutingContext(ctx)
+	inTag := routingLink.GetInboundTag()
+	isPickRoute := 0
+	if forcedOutboundTag := session.GetForcedOutboundTagFromContext(ctx); forcedOutboundTag != "" {
+		ctx = session.SetForcedOutboundTagToContext(ctx, "")
+		if h := d.ohm.GetHandler(forcedOutboundTag); h != nil {
+			isPickRoute = 1
+			errors.LogInfo(ctx, "taking platform initialized detour [", forcedOutboundTag, "] for [", destination, "]")
+			handler = h
+		} else {
+			errors.LogError(ctx, "non existing tag for platform initialized detour: ", forcedOutboundTag)
+			common.Close(link.Writer)
+			common.Interrupt(link.Reader)
+			return
+		}
+	} else if d.router != nil {
+		if route, err := d.router.PickRoute(routingLink); err == nil {
+			outTag := route.GetOutboundTag()
+			if h := d.ohm.GetHandler(outTag); h != nil {
+				isPickRoute = 2
+				if route.GetRuleTag() == "" {
+					errors.LogInfo(ctx, "taking detour [", outTag, "] for [", destination, "]")
+				} else {
+					errors.LogInfo(ctx, "Hit route rule: [", route.GetRuleTag(), "] so taking detour [", outTag, "] for [", destination, "]")
+				}
+				handler = h
+			} else {
+				errors.LogWarning(ctx, "non existing outTag: ", outTag)
+				common.Close(link.Writer)
+				common.Interrupt(link.Reader)
+				return // DO NOT CHANGE: the traffic shouldn't be processed by default outbound if the specified outbound tag doesn't exist (yet), e.g., VLESS Reverse Proxy
+			}
+		} else {
+			errors.LogInfo(ctx, "default route for ", destination)
+		}
+	}
+
+	if handler == nil {
+		handler = d.ohm.GetDefaultHandler()
+	}
+
+	if handler == nil {
+		errors.LogInfo(ctx, "default outbound handler not exist")
+		common.Close(link.Writer)
+		common.Interrupt(link.Reader)
+		return
+	}
+
+	ob.Tag = handler.Tag()
+	if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
+		if tag := handler.Tag(); tag != "" {
+			if inTag == "" {
+				accessMessage.Detour = tag
+			} else if isPickRoute == 1 {
+				accessMessage.Detour = inTag + " ==> " + tag
+			} else if isPickRoute == 2 {
+				accessMessage.Detour = inTag + " -> " + tag
+			} else {
+				accessMessage.Detour = inTag + " >> " + tag
+			}
+		}
+		log.Record(accessMessage)
+	}
+
+	handler.Dispatch(ctx, link)
+}

subproject/Xray-core-main/app/dispatcher/dispatcher.go

@@ -0,0 +1 @@
+package dispatcher

subproject/Xray-core-main/app/dispatcher/fakednssniffer.go

@@ -0,0 +1,121 @@
+package dispatcher
+
+import (
+	"context"
+	"strings"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+// newFakeDNSSniffer Creates a Fake DNS metadata sniffer
+func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
+	var fakeDNSEngine dns.FakeDNSEngine
+	{
+		fakeDNSEngineFeat := core.MustFromContext(ctx).GetFeature((*dns.FakeDNSEngine)(nil))
+		if fakeDNSEngineFeat != nil {
+			fakeDNSEngine = fakeDNSEngineFeat.(dns.FakeDNSEngine)
+		}
+	}
+
+	if fakeDNSEngine == nil {
+		errNotInit := errors.New("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
+		return protocolSnifferWithMetadata{}, errNotInit
+	}
+	return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
+		outbounds := session.OutboundsFromContext(ctx)
+		ob := outbounds[len(outbounds)-1]
+		if ob.Target.Network == net.Network_TCP || ob.Target.Network == net.Network_UDP {
+			domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(ob.Target.Address)
+			if domainFromFakeDNS != "" {
+				errors.LogInfo(ctx, "fake dns got domain: ", domainFromFakeDNS, " for ip: ", ob.Target.Address.String())
+				return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
+			}
+		}
+
+		if ipAddressInRangeValueI := ctx.Value(ipAddressInRange); ipAddressInRangeValueI != nil {
+			ipAddressInRangeValue := ipAddressInRangeValueI.(*ipAddressInRangeOpt)
+			if fkr0, ok := fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
+				inPool := fkr0.IsIPInIPPool(ob.Target.Address)
+				ipAddressInRangeValue.addressInRange = &inPool
+			}
+		}
+
+		return nil, common.ErrNoClue
+	}, metadataSniffer: true}, nil
+}
+
+type fakeDNSSniffResult struct {
+	domainName string
+}
+
+func (fakeDNSSniffResult) Protocol() string {
+	return "fakedns"
+}
+
+func (f fakeDNSSniffResult) Domain() string {
+	return f.domainName
+}
+
+type fakeDNSExtraOpts int
+
+const ipAddressInRange fakeDNSExtraOpts = 1
+
+type ipAddressInRangeOpt struct {
+	addressInRange *bool
+}
+
+type DNSThenOthersSniffResult struct {
+	domainName           string
+	protocolOriginalName string
+}
+
+func (f DNSThenOthersSniffResult) IsProtoSubsetOf(protocolName string) bool {
+	return strings.HasPrefix(protocolName, f.protocolOriginalName)
+}
+
+func (DNSThenOthersSniffResult) Protocol() string {
+	return "fakedns+others"
+}
+
+func (f DNSThenOthersSniffResult) Domain() string {
+	return f.domainName
+}
+
+func newFakeDNSThenOthers(ctx context.Context, fakeDNSSniffer protocolSnifferWithMetadata, others []protocolSnifferWithMetadata) (
+	protocolSnifferWithMetadata, error,
+) { // nolint: unparam
+	// ctx may be used in the future
+	_ = ctx
+	return protocolSnifferWithMetadata{
+		protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
+			ipAddressInRangeValue := &ipAddressInRangeOpt{}
+			ctx = context.WithValue(ctx, ipAddressInRange, ipAddressInRangeValue)
+			result, err := fakeDNSSniffer.protocolSniffer(ctx, bytes)
+			if err == nil {
+				return result, nil
+			}
+			if ipAddressInRangeValue.addressInRange != nil {
+				if *ipAddressInRangeValue.addressInRange {
+					for _, v := range others {
+						if v.metadataSniffer || bytes != nil {
+							if result, err := v.protocolSniffer(ctx, bytes); err == nil {
+								return DNSThenOthersSniffResult{domainName: result.Domain(), protocolOriginalName: result.Protocol()}, nil
+							}
+						}
+					}
+					return nil, common.ErrNoClue
+				}
+				errors.LogDebug(ctx, "ip address not in fake dns range, return as is")
+				return nil, common.ErrNoClue
+			}
+			errors.LogWarning(ctx, "fake dns sniffer did not set address in range option, assume false.")
+			return nil, common.ErrNoClue
+		},
+		metadataSniffer: false,
+	}, nil
+}

subproject/Xray-core-main/app/dispatcher/sniffer.go

@@ -0,0 +1,142 @@
+package dispatcher
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/protocol"
+	"github.com/xtls/xray-core/common/protocol/bittorrent"
+	"github.com/xtls/xray-core/common/protocol/http"
+	"github.com/xtls/xray-core/common/protocol/quic"
+	"github.com/xtls/xray-core/common/protocol/tls"
+)
+
+type SniffResult interface {
+	Protocol() string
+	Domain() string
+}
+
+type protocolSniffer func(context.Context, []byte) (SniffResult, error)
+
+type protocolSnifferWithMetadata struct {
+	protocolSniffer protocolSniffer
+	// A Metadata sniffer will be invoked on connection establishment only, with nil body,
+	// for both TCP and UDP connections
+	// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
+	metadataSniffer bool
+	network         net.Network
+}
+
+type Sniffer struct {
+	sniffer []protocolSnifferWithMetadata
+}
+
+func NewSniffer(ctx context.Context) *Sniffer {
+	ret := &Sniffer{
+		sniffer: []protocolSnifferWithMetadata{
+			{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b, c) }, false, net.Network_TCP},
+			{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false, net.Network_TCP},
+			{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false, net.Network_TCP},
+			{func(c context.Context, b []byte) (SniffResult, error) { return quic.SniffQUIC(b) }, false, net.Network_UDP},
+			{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffUTP(b) }, false, net.Network_UDP},
+		},
+	}
+	if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
+		others := ret.sniffer
+		ret.sniffer = append(ret.sniffer, sniffer)
+		fakeDNSThenOthers, err := newFakeDNSThenOthers(ctx, sniffer, others)
+		if err == nil {
+			ret.sniffer = append([]protocolSnifferWithMetadata{fakeDNSThenOthers}, ret.sniffer...)
+		}
+	}
+	return ret
+}
+
+var errUnknownContent = errors.New("unknown content")
+
+func (s *Sniffer) Sniff(c context.Context, payload []byte, network net.Network) (SniffResult, error) {
+	var pendingSniffer []protocolSnifferWithMetadata
+	for _, si := range s.sniffer {
+		protocolSniffer := si.protocolSniffer
+		if si.metadataSniffer || si.network != network {
+			continue
+		}
+		result, err := protocolSniffer(c, payload)
+		if err == common.ErrNoClue {
+			pendingSniffer = append(pendingSniffer, si)
+			continue
+		} else if err == protocol.ErrProtoNeedMoreData { // Sniffer protocol matched, but need more data to complete sniffing
+			s.sniffer = []protocolSnifferWithMetadata{si}
+			return nil, err
+		}
+
+		if err == nil && result != nil {
+			return result, nil
+		}
+	}
+
+	if len(pendingSniffer) > 0 {
+		s.sniffer = pendingSniffer
+		return nil, common.ErrNoClue
+	}
+
+	return nil, errUnknownContent
+}
+
+func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
+	var pendingSniffer []protocolSnifferWithMetadata
+	for _, si := range s.sniffer {
+		s := si.protocolSniffer
+		if !si.metadataSniffer {
+			pendingSniffer = append(pendingSniffer, si)
+			continue
+		}
+		result, err := s(c, nil)
+		if err == common.ErrNoClue {
+			pendingSniffer = append(pendingSniffer, si)
+			continue
+		}
+
+		if err == nil && result != nil {
+			return result, nil
+		}
+	}
+
+	if len(pendingSniffer) > 0 {
+		s.sniffer = pendingSniffer
+		return nil, common.ErrNoClue
+	}
+
+	return nil, errUnknownContent
+}
+
+func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
+	return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
+}
+
+type compositeResult struct {
+	domainResult   SniffResult
+	protocolResult SniffResult
+}
+
+func (c compositeResult) Protocol() string {
+	return c.protocolResult.Protocol()
+}
+
+func (c compositeResult) Domain() string {
+	return c.domainResult.Domain()
+}
+
+func (c compositeResult) ProtocolForDomainResult() string {
+	return c.domainResult.Protocol()
+}
+
+type SnifferResultComposite interface {
+	ProtocolForDomainResult() string
+}
+
+type SnifferIsProtoSubsetOf interface {
+	IsProtoSubsetOf(protocolName string) bool
+}

subproject/Xray-core-main/app/dispatcher/stats.go

@@ -0,0 +1,25 @@
+package dispatcher
+
+import (
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/features/stats"
+)
+
+type SizeStatWriter struct {
+	Counter stats.Counter
+	Writer  buf.Writer
+}
+
+func (w *SizeStatWriter) WriteMultiBuffer(mb buf.MultiBuffer) error {
+	w.Counter.Add(int64(mb.Len()))
+	return w.Writer.WriteMultiBuffer(mb)
+}
+
+func (w *SizeStatWriter) Close() error {
+	return common.Close(w.Writer)
+}
+
+func (w *SizeStatWriter) Interrupt() {
+	common.Interrupt(w.Writer)
+}

subproject/Xray-core-main/app/dispatcher/stats_test.go

@@ -0,0 +1,44 @@
+package dispatcher_test
+
+import (
+	"testing"
+
+	. "github.com/xtls/xray-core/app/dispatcher"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/buf"
+)
+
+type TestCounter int64
+
+func (c *TestCounter) Value() int64 {
+	return int64(*c)
+}
+
+func (c *TestCounter) Add(v int64) int64 {
+	x := int64(*c) + v
+	*c = TestCounter(x)
+	return x
+}
+
+func (c *TestCounter) Set(v int64) int64 {
+	*c = TestCounter(v)
+	return v
+}
+
+func TestStatsWriter(t *testing.T) {
+	var c TestCounter
+	writer := &SizeStatWriter{
+		Counter: &c,
+		Writer:  buf.Discard,
+	}
+
+	mb := buf.MergeBytes(nil, []byte("abcd"))
+	common.Must(writer.WriteMultiBuffer(mb))
+
+	mb = buf.MergeBytes(nil, []byte("efg"))
+	common.Must(writer.WriteMultiBuffer(mb))
+
+	if c.Value() != 7 {
+		t.Fatal("unexpected counter value. want 7, but got ", c.Value())
+	}
+}

subproject/Xray-core-main/app/dns/cache_controller.go

@@ -0,0 +1,339 @@
+package dns
+
+import (
+	"context"
+	go_errors "errors"
+	"runtime"
+	"sync"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/signal/pubsub"
+	"github.com/xtls/xray-core/common/task"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+
+	"golang.org/x/net/dns/dnsmessage"
+	"golang.org/x/sync/singleflight"
+)
+
+const (
+	minSizeForEmptyRebuild  = 512
+	shrinkAbsoluteThreshold = 10240
+	shrinkRatioThreshold    = 0.65
+	migrationBatchSize      = 4096
+)
+
+type CacheController struct {
+	name            string
+	disableCache    bool
+	serveStale      bool
+	serveExpiredTTL int32
+
+	ips      map[string]*record
+	dirtyips map[string]*record
+
+	sync.RWMutex
+	pub           *pubsub.Service
+	cacheCleanup  *task.Periodic
+	highWatermark int
+	requestGroup  singleflight.Group
+}
+
+func NewCacheController(name string, disableCache bool, serveStale bool, serveExpiredTTL uint32) *CacheController {
+	c := &CacheController{
+		name:            name,
+		disableCache:    disableCache,
+		serveStale:      serveStale,
+		serveExpiredTTL: -int32(serveExpiredTTL),
+		ips:             make(map[string]*record),
+		pub:             pubsub.NewService(),
+	}
+
+	c.cacheCleanup = &task.Periodic{
+		Interval: 300 * time.Second,
+		Execute:  c.CacheCleanup,
+	}
+	return c
+}
+
+// CacheCleanup clears expired items from cache
+func (c *CacheController) CacheCleanup() error {
+	expiredKeys, err := c.collectExpiredKeys()
+	if err != nil {
+		return err
+	}
+	if len(expiredKeys) == 0 {
+		return nil
+	}
+	c.writeAndShrink(expiredKeys)
+	return nil
+}
+
+func (c *CacheController) collectExpiredKeys() ([]string, error) {
+	c.RLock()
+	defer c.RUnlock()
+
+	if len(c.ips) == 0 {
+		return nil, errors.New("nothing to do. stopping...")
+	}
+
+	// skip collection if a migration is in progress
+	if c.dirtyips != nil {
+		return nil, nil
+	}
+
+	now := time.Now()
+	if c.serveStale && c.serveExpiredTTL != 0 {
+		now = now.Add(time.Duration(c.serveExpiredTTL) * time.Second)
+	}
+
+	expiredKeys := make([]string, 0, len(c.ips)/4) // pre-allocate
+
+	for domain, rec := range c.ips {
+		if (rec.A != nil && rec.A.Expire.Before(now)) ||
+			(rec.AAAA != nil && rec.AAAA.Expire.Before(now)) {
+			expiredKeys = append(expiredKeys, domain)
+		}
+	}
+
+	return expiredKeys, nil
+}
+
+func (c *CacheController) writeAndShrink(expiredKeys []string) {
+	c.Lock()
+	defer c.Unlock()
+
+	// double check to prevent upper call multiple cleanup tasks
+	if c.dirtyips != nil {
+		return
+	}
+
+	lenBefore := len(c.ips)
+	if lenBefore > c.highWatermark {
+		c.highWatermark = lenBefore
+	}
+
+	now := time.Now()
+	if c.serveStale && c.serveExpiredTTL != 0 {
+		now = now.Add(time.Duration(c.serveExpiredTTL) * time.Second)
+	}
+
+	for _, domain := range expiredKeys {
+		rec := c.ips[domain]
+		if rec == nil {
+			continue
+		}
+		if rec.A != nil && rec.A.Expire.Before(now) {
+			rec.A = nil
+		}
+		if rec.AAAA != nil && rec.AAAA.Expire.Before(now) {
+			rec.AAAA = nil
+		}
+		if rec.A == nil && rec.AAAA == nil {
+			delete(c.ips, domain)
+		}
+	}
+
+	lenAfter := len(c.ips)
+
+	if lenAfter == 0 {
+		if c.highWatermark >= minSizeForEmptyRebuild {
+			errors.LogDebug(context.Background(), c.name,
+				" rebuilding empty cache map to reclaim memory.",
+				" size_before_cleanup=", lenBefore,
+				" peak_size_before_rebuild=", c.highWatermark,
+			)
+
+			c.ips = make(map[string]*record)
+			c.highWatermark = 0
+		}
+		return
+	}
+
+	if reductionFromPeak := c.highWatermark - lenAfter; reductionFromPeak > shrinkAbsoluteThreshold &&
+		float64(reductionFromPeak) > float64(c.highWatermark)*shrinkRatioThreshold {
+		errors.LogDebug(context.Background(), c.name,
+			" shrinking cache map to reclaim memory.",
+			" new_size=", lenAfter,
+			" peak_size_before_shrink=", c.highWatermark,
+			" reduction_since_peak=", reductionFromPeak,
+		)
+
+		c.dirtyips = c.ips
+		c.ips = make(map[string]*record, int(float64(lenAfter)*1.1))
+		c.highWatermark = lenAfter
+		go c.migrate()
+	}
+
+}
+
+type migrationEntry struct {
+	key   string
+	value *record
+}
+
+func (c *CacheController) migrate() {
+	defer func() {
+		if r := recover(); r != nil {
+			errors.LogError(context.Background(), c.name, " panic during cache migration: ", r)
+			c.Lock()
+			c.dirtyips = nil
+			// c.ips = make(map[string]*record)
+			// c.highWatermark = 0
+			c.Unlock()
+		}
+	}()
+
+	c.RLock()
+	dirtyips := c.dirtyips
+	c.RUnlock()
+
+	// double check to prevent upper call multiple cleanup tasks
+	if dirtyips == nil {
+		return
+	}
+
+	errors.LogDebug(context.Background(), c.name, " starting background cache migration for ", len(dirtyips), " items")
+
+	batch := make([]migrationEntry, 0, migrationBatchSize)
+	for domain, recD := range dirtyips {
+		batch = append(batch, migrationEntry{domain, recD})
+
+		if len(batch) >= migrationBatchSize {
+			c.flush(batch)
+			batch = batch[:0]
+			runtime.Gosched()
+		}
+	}
+	if len(batch) > 0 {
+		c.flush(batch)
+	}
+
+	c.Lock()
+	c.dirtyips = nil
+	c.Unlock()
+
+	errors.LogDebug(context.Background(), c.name, " cache migration completed")
+}
+
+func (c *CacheController) flush(batch []migrationEntry) {
+	c.Lock()
+	defer c.Unlock()
+
+	for _, dirty := range batch {
+		if cur := c.ips[dirty.key]; cur != nil {
+			merge := &record{}
+			if cur.A == nil {
+				merge.A = dirty.value.A
+			} else {
+				merge.A = cur.A
+			}
+			if cur.AAAA == nil {
+				merge.AAAA = dirty.value.AAAA
+			} else {
+				merge.AAAA = cur.AAAA
+			}
+			c.ips[dirty.key] = merge
+		} else {
+			c.ips[dirty.key] = dirty.value
+		}
+	}
+}
+
+func (c *CacheController) updateRecord(req *dnsRequest, rep *IPRecord) {
+	rtt := time.Since(req.start)
+
+	switch req.reqType {
+	case dnsmessage.TypeA:
+		c.pub.Publish(req.domain+"4", rep)
+	case dnsmessage.TypeAAAA:
+		c.pub.Publish(req.domain+"6", rep)
+	}
+
+	if c.disableCache {
+		errors.LogInfo(context.Background(), c.name, " got answer: ", req.domain, " ", req.reqType, " -> ", rep.IP, ", rtt: ", rtt)
+		return
+	}
+
+	c.Lock()
+	lockWait := time.Since(req.start) - rtt
+
+	newRec := &record{}
+	oldRec := c.ips[req.domain]
+	var dirtyRec *record
+	if c.dirtyips != nil {
+		dirtyRec = c.dirtyips[req.domain]
+	}
+
+	var pubRecord *IPRecord
+	var pubSuffix string
+
+	switch req.reqType {
+	case dnsmessage.TypeA:
+		newRec.A = rep
+		if oldRec != nil && oldRec.AAAA != nil {
+			newRec.AAAA = oldRec.AAAA
+			pubRecord = oldRec.AAAA
+		} else if dirtyRec != nil && dirtyRec.AAAA != nil {
+			pubRecord = dirtyRec.AAAA
+		}
+		pubSuffix = "6"
+	case dnsmessage.TypeAAAA:
+		newRec.AAAA = rep
+		if oldRec != nil && oldRec.A != nil {
+			newRec.A = oldRec.A
+			pubRecord = oldRec.A
+		} else if dirtyRec != nil && dirtyRec.A != nil {
+			pubRecord = dirtyRec.A
+		}
+		pubSuffix = "4"
+	}
+
+	c.ips[req.domain] = newRec
+	c.Unlock()
+
+	if pubRecord != nil {
+		_, ttl, err := pubRecord.getIPs()
+		if ttl > 0 && !go_errors.Is(err, errRecordNotFound) {
+			c.pub.Publish(req.domain+pubSuffix, pubRecord)
+		}
+	}
+
+	errors.LogInfo(context.Background(), c.name, " got answer: ", req.domain, " ", req.reqType, " -> ", rep.IP, ", rtt: ", rtt, ", lock: ", lockWait)
+
+	if !c.serveStale || c.serveExpiredTTL != 0 {
+		common.Must(c.cacheCleanup.Start())
+	}
+}
+
+func (c *CacheController) findRecords(domain string) *record {
+	c.RLock()
+	defer c.RUnlock()
+
+	rec := c.ips[domain]
+	if rec == nil && c.dirtyips != nil {
+		rec = c.dirtyips[domain]
+	}
+	return rec
+}
+
+func (c *CacheController) registerSubscribers(domain string, option dns_feature.IPOption) (sub4 *pubsub.Subscriber, sub6 *pubsub.Subscriber) {
+	// ipv4 and ipv6 belong to different subscription groups
+	if option.IPv4Enable {
+		sub4 = c.pub.Subscribe(domain + "4")
+	}
+	if option.IPv6Enable {
+		sub6 = c.pub.Subscribe(domain + "6")
+	}
+	return
+}
+
+func closeSubscribers(sub4 *pubsub.Subscriber, sub6 *pubsub.Subscriber) {
+	if sub4 != nil {
+		sub4.Close()
+	}
+	if sub6 != nil {
+		sub6.Close()
+	}
+}

subproject/Xray-core-main/app/dns/config.go

@@ -0,0 +1,64 @@
+package dns
+
+import (
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/strmatcher"
+	"github.com/xtls/xray-core/common/uuid"
+)
+
+var typeMap = map[DomainMatchingType]strmatcher.Type{
+	DomainMatchingType_Full:      strmatcher.Full,
+	DomainMatchingType_Subdomain: strmatcher.Domain,
+	DomainMatchingType_Keyword:   strmatcher.Substr,
+	DomainMatchingType_Regex:     strmatcher.Regex,
+}
+
+// References:
+// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
+// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
+var localTLDsAndDotlessDomains = []*NameServer_PriorityDomain{
+	{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
+	{Type: DomainMatchingType_Subdomain, Domain: "local"},
+	{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
+	{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
+	{Type: DomainMatchingType_Subdomain, Domain: "lan"},
+	{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
+	{Type: DomainMatchingType_Subdomain, Domain: "example"},
+	{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
+	{Type: DomainMatchingType_Subdomain, Domain: "test"},
+}
+
+var localTLDsAndDotlessDomainsRule = &NameServer_OriginalRule{
+	Rule: "geosite:private",
+	Size: uint32(len(localTLDsAndDotlessDomains)),
+}
+
+func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
+	strMType, f := typeMap[t]
+	if !f {
+		return nil, errors.New("unknown mapping type", t).AtWarning()
+	}
+	matcher, err := strMType.New(domain)
+	if err != nil {
+		return nil, errors.New("failed to create str matcher").Base(err)
+	}
+	return matcher, nil
+}
+
+func toNetIP(addrs []net.Address) ([]net.IP, error) {
+	ips := make([]net.IP, 0, len(addrs))
+	for _, addr := range addrs {
+		if addr.Family().IsIP() {
+			ips = append(ips, addr.IP())
+		} else {
+			return nil, errors.New("Failed to convert address", addr, "to Net IP.").AtWarning()
+		}
+	}
+	return ips, nil
+}
+
+func generateRandomTag() string {
+	id := uuid.New()
+	return "xray.system." + id.String()
+}

subproject/Xray-core-main/app/dns/config.pb.go

@@ -0,0 +1,748 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/dns/config.proto
+
+package dns
+
+import (
+	router "github.com/xtls/xray-core/app/router"
+	net "github.com/xtls/xray-core/common/net"
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type DomainMatchingType int32
+
+const (
+	DomainMatchingType_Full      DomainMatchingType = 0
+	DomainMatchingType_Subdomain DomainMatchingType = 1
+	DomainMatchingType_Keyword   DomainMatchingType = 2
+	DomainMatchingType_Regex     DomainMatchingType = 3
+)
+
+// Enum value maps for DomainMatchingType.
+var (
+	DomainMatchingType_name = map[int32]string{
+		0: "Full",
+		1: "Subdomain",
+		2: "Keyword",
+		3: "Regex",
+	}
+	DomainMatchingType_value = map[string]int32{
+		"Full":      0,
+		"Subdomain": 1,
+		"Keyword":   2,
+		"Regex":     3,
+	}
+)
+
+func (x DomainMatchingType) Enum() *DomainMatchingType {
+	p := new(DomainMatchingType)
+	*p = x
+	return p
+}
+
+func (x DomainMatchingType) String() string {
+	return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
+}
+
+func (DomainMatchingType) Descriptor() protoreflect.EnumDescriptor {
+	return file_app_dns_config_proto_enumTypes[0].Descriptor()
+}
+
+func (DomainMatchingType) Type() protoreflect.EnumType {
+	return &file_app_dns_config_proto_enumTypes[0]
+}
+
+func (x DomainMatchingType) Number() protoreflect.EnumNumber {
+	return protoreflect.EnumNumber(x)
+}
+
+// Deprecated: Use DomainMatchingType.Descriptor instead.
+func (DomainMatchingType) EnumDescriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{0}
+}
+
+type QueryStrategy int32
+
+const (
+	QueryStrategy_USE_IP  QueryStrategy = 0
+	QueryStrategy_USE_IP4 QueryStrategy = 1
+	QueryStrategy_USE_IP6 QueryStrategy = 2
+	QueryStrategy_USE_SYS QueryStrategy = 3
+)
+
+// Enum value maps for QueryStrategy.
+var (
+	QueryStrategy_name = map[int32]string{
+		0: "USE_IP",
+		1: "USE_IP4",
+		2: "USE_IP6",
+		3: "USE_SYS",
+	}
+	QueryStrategy_value = map[string]int32{
+		"USE_IP":  0,
+		"USE_IP4": 1,
+		"USE_IP6": 2,
+		"USE_SYS": 3,
+	}
+)
+
+func (x QueryStrategy) Enum() *QueryStrategy {
+	p := new(QueryStrategy)
+	*p = x
+	return p
+}
+
+func (x QueryStrategy) String() string {
+	return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
+}
+
+func (QueryStrategy) Descriptor() protoreflect.EnumDescriptor {
+	return file_app_dns_config_proto_enumTypes[1].Descriptor()
+}
+
+func (QueryStrategy) Type() protoreflect.EnumType {
+	return &file_app_dns_config_proto_enumTypes[1]
+}
+
+func (x QueryStrategy) Number() protoreflect.EnumNumber {
+	return protoreflect.EnumNumber(x)
+}
+
+// Deprecated: Use QueryStrategy.Descriptor instead.
+func (QueryStrategy) EnumDescriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{1}
+}
+
+type NameServer struct {
+	state             protoimpl.MessageState       `protogen:"open.v1"`
+	Address           *net.Endpoint                `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"`
+	ClientIp          []byte                       `protobuf:"bytes,5,opt,name=client_ip,json=clientIp,proto3" json:"client_ip,omitempty"`
+	SkipFallback      bool                         `protobuf:"varint,6,opt,name=skipFallback,proto3" json:"skipFallback,omitempty"`
+	PrioritizedDomain []*NameServer_PriorityDomain `protobuf:"bytes,2,rep,name=prioritized_domain,json=prioritizedDomain,proto3" json:"prioritized_domain,omitempty"`
+	ExpectedGeoip     []*router.GeoIP              `protobuf:"bytes,3,rep,name=expected_geoip,json=expectedGeoip,proto3" json:"expected_geoip,omitempty"`
+	OriginalRules     []*NameServer_OriginalRule   `protobuf:"bytes,4,rep,name=original_rules,json=originalRules,proto3" json:"original_rules,omitempty"`
+	QueryStrategy     QueryStrategy                `protobuf:"varint,7,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
+	ActPrior          bool                         `protobuf:"varint,8,opt,name=actPrior,proto3" json:"actPrior,omitempty"`
+	Tag               string                       `protobuf:"bytes,9,opt,name=tag,proto3" json:"tag,omitempty"`
+	TimeoutMs         uint64                       `protobuf:"varint,10,opt,name=timeoutMs,proto3" json:"timeoutMs,omitempty"`
+	DisableCache      *bool                        `protobuf:"varint,11,opt,name=disableCache,proto3,oneof" json:"disableCache,omitempty"`
+	ServeStale        *bool                        `protobuf:"varint,15,opt,name=serveStale,proto3,oneof" json:"serveStale,omitempty"`
+	ServeExpiredTTL   *uint32                      `protobuf:"varint,16,opt,name=serveExpiredTTL,proto3,oneof" json:"serveExpiredTTL,omitempty"`
+	FinalQuery        bool                         `protobuf:"varint,12,opt,name=finalQuery,proto3" json:"finalQuery,omitempty"`
+	UnexpectedGeoip   []*router.GeoIP              `protobuf:"bytes,13,rep,name=unexpected_geoip,json=unexpectedGeoip,proto3" json:"unexpected_geoip,omitempty"`
+	ActUnprior        bool                         `protobuf:"varint,14,opt,name=actUnprior,proto3" json:"actUnprior,omitempty"`
+	PolicyID          uint32                       `protobuf:"varint,17,opt,name=policyID,proto3" json:"policyID,omitempty"`
+	unknownFields     protoimpl.UnknownFields
+	sizeCache         protoimpl.SizeCache
+}
+
+func (x *NameServer) Reset() {
+	*x = NameServer{}
+	mi := &file_app_dns_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *NameServer) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*NameServer) ProtoMessage() {}
+
+func (x *NameServer) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use NameServer.ProtoReflect.Descriptor instead.
+func (*NameServer) Descriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *NameServer) GetAddress() *net.Endpoint {
+	if x != nil {
+		return x.Address
+	}
+	return nil
+}
+
+func (x *NameServer) GetClientIp() []byte {
+	if x != nil {
+		return x.ClientIp
+	}
+	return nil
+}
+
+func (x *NameServer) GetSkipFallback() bool {
+	if x != nil {
+		return x.SkipFallback
+	}
+	return false
+}
+
+func (x *NameServer) GetPrioritizedDomain() []*NameServer_PriorityDomain {
+	if x != nil {
+		return x.PrioritizedDomain
+	}
+	return nil
+}
+
+func (x *NameServer) GetExpectedGeoip() []*router.GeoIP {
+	if x != nil {
+		return x.ExpectedGeoip
+	}
+	return nil
+}
+
+func (x *NameServer) GetOriginalRules() []*NameServer_OriginalRule {
+	if x != nil {
+		return x.OriginalRules
+	}
+	return nil
+}
+
+func (x *NameServer) GetQueryStrategy() QueryStrategy {
+	if x != nil {
+		return x.QueryStrategy
+	}
+	return QueryStrategy_USE_IP
+}
+
+func (x *NameServer) GetActPrior() bool {
+	if x != nil {
+		return x.ActPrior
+	}
+	return false
+}
+
+func (x *NameServer) GetTag() string {
+	if x != nil {
+		return x.Tag
+	}
+	return ""
+}
+
+func (x *NameServer) GetTimeoutMs() uint64 {
+	if x != nil {
+		return x.TimeoutMs
+	}
+	return 0
+}
+
+func (x *NameServer) GetDisableCache() bool {
+	if x != nil && x.DisableCache != nil {
+		return *x.DisableCache
+	}
+	return false
+}
+
+func (x *NameServer) GetServeStale() bool {
+	if x != nil && x.ServeStale != nil {
+		return *x.ServeStale
+	}
+	return false
+}
+
+func (x *NameServer) GetServeExpiredTTL() uint32 {
+	if x != nil && x.ServeExpiredTTL != nil {
+		return *x.ServeExpiredTTL
+	}
+	return 0
+}
+
+func (x *NameServer) GetFinalQuery() bool {
+	if x != nil {
+		return x.FinalQuery
+	}
+	return false
+}
+
+func (x *NameServer) GetUnexpectedGeoip() []*router.GeoIP {
+	if x != nil {
+		return x.UnexpectedGeoip
+	}
+	return nil
+}
+
+func (x *NameServer) GetActUnprior() bool {
+	if x != nil {
+		return x.ActUnprior
+	}
+	return false
+}
+
+func (x *NameServer) GetPolicyID() uint32 {
+	if x != nil {
+		return x.PolicyID
+	}
+	return 0
+}
+
+type Config struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// NameServer list used by this DNS client.
+	// A special value 'localhost' as a domain address can be set to use DNS on local system.
+	NameServer []*NameServer `protobuf:"bytes,5,rep,name=name_server,json=nameServer,proto3" json:"name_server,omitempty"`
+	// Client IP for EDNS client subnet. Must be 4 bytes (IPv4) or 16 bytes
+	// (IPv6).
+	ClientIp    []byte                `protobuf:"bytes,3,opt,name=client_ip,json=clientIp,proto3" json:"client_ip,omitempty"`
+	StaticHosts []*Config_HostMapping `protobuf:"bytes,4,rep,name=static_hosts,json=staticHosts,proto3" json:"static_hosts,omitempty"`
+	// Tag is the inbound tag of DNS client.
+	Tag string `protobuf:"bytes,6,opt,name=tag,proto3" json:"tag,omitempty"`
+	// DisableCache disables DNS cache
+	DisableCache           bool          `protobuf:"varint,8,opt,name=disableCache,proto3" json:"disableCache,omitempty"`
+	ServeStale             bool          `protobuf:"varint,12,opt,name=serveStale,proto3" json:"serveStale,omitempty"`
+	ServeExpiredTTL        uint32        `protobuf:"varint,13,opt,name=serveExpiredTTL,proto3" json:"serveExpiredTTL,omitempty"`
+	QueryStrategy          QueryStrategy `protobuf:"varint,9,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
+	DisableFallback        bool          `protobuf:"varint,10,opt,name=disableFallback,proto3" json:"disableFallback,omitempty"`
+	DisableFallbackIfMatch bool          `protobuf:"varint,11,opt,name=disableFallbackIfMatch,proto3" json:"disableFallbackIfMatch,omitempty"`
+	EnableParallelQuery    bool          `protobuf:"varint,14,opt,name=enableParallelQuery,proto3" json:"enableParallelQuery,omitempty"`
+	unknownFields          protoimpl.UnknownFields
+	sizeCache              protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_dns_config_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_config_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *Config) GetNameServer() []*NameServer {
+	if x != nil {
+		return x.NameServer
+	}
+	return nil
+}
+
+func (x *Config) GetClientIp() []byte {
+	if x != nil {
+		return x.ClientIp
+	}
+	return nil
+}
+
+func (x *Config) GetStaticHosts() []*Config_HostMapping {
+	if x != nil {
+		return x.StaticHosts
+	}
+	return nil
+}
+
+func (x *Config) GetTag() string {
+	if x != nil {
+		return x.Tag
+	}
+	return ""
+}
+
+func (x *Config) GetDisableCache() bool {
+	if x != nil {
+		return x.DisableCache
+	}
+	return false
+}
+
+func (x *Config) GetServeStale() bool {
+	if x != nil {
+		return x.ServeStale
+	}
+	return false
+}
+
+func (x *Config) GetServeExpiredTTL() uint32 {
+	if x != nil {
+		return x.ServeExpiredTTL
+	}
+	return 0
+}
+
+func (x *Config) GetQueryStrategy() QueryStrategy {
+	if x != nil {
+		return x.QueryStrategy
+	}
+	return QueryStrategy_USE_IP
+}
+
+func (x *Config) GetDisableFallback() bool {
+	if x != nil {
+		return x.DisableFallback
+	}
+	return false
+}
+
+func (x *Config) GetDisableFallbackIfMatch() bool {
+	if x != nil {
+		return x.DisableFallbackIfMatch
+	}
+	return false
+}
+
+func (x *Config) GetEnableParallelQuery() bool {
+	if x != nil {
+		return x.EnableParallelQuery
+	}
+	return false
+}
+
+type NameServer_PriorityDomain struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Type          DomainMatchingType     `protobuf:"varint,1,opt,name=type,proto3,enum=xray.app.dns.DomainMatchingType" json:"type,omitempty"`
+	Domain        string                 `protobuf:"bytes,2,opt,name=domain,proto3" json:"domain,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *NameServer_PriorityDomain) Reset() {
+	*x = NameServer_PriorityDomain{}
+	mi := &file_app_dns_config_proto_msgTypes[2]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *NameServer_PriorityDomain) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*NameServer_PriorityDomain) ProtoMessage() {}
+
+func (x *NameServer_PriorityDomain) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_config_proto_msgTypes[2]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use NameServer_PriorityDomain.ProtoReflect.Descriptor instead.
+func (*NameServer_PriorityDomain) Descriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{0, 0}
+}
+
+func (x *NameServer_PriorityDomain) GetType() DomainMatchingType {
+	if x != nil {
+		return x.Type
+	}
+	return DomainMatchingType_Full
+}
+
+func (x *NameServer_PriorityDomain) GetDomain() string {
+	if x != nil {
+		return x.Domain
+	}
+	return ""
+}
+
+type NameServer_OriginalRule struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Rule          string                 `protobuf:"bytes,1,opt,name=rule,proto3" json:"rule,omitempty"`
+	Size          uint32                 `protobuf:"varint,2,opt,name=size,proto3" json:"size,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *NameServer_OriginalRule) Reset() {
+	*x = NameServer_OriginalRule{}
+	mi := &file_app_dns_config_proto_msgTypes[3]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *NameServer_OriginalRule) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*NameServer_OriginalRule) ProtoMessage() {}
+
+func (x *NameServer_OriginalRule) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_config_proto_msgTypes[3]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use NameServer_OriginalRule.ProtoReflect.Descriptor instead.
+func (*NameServer_OriginalRule) Descriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{0, 1}
+}
+
+func (x *NameServer_OriginalRule) GetRule() string {
+	if x != nil {
+		return x.Rule
+	}
+	return ""
+}
+
+func (x *NameServer_OriginalRule) GetSize() uint32 {
+	if x != nil {
+		return x.Size
+	}
+	return 0
+}
+
+type Config_HostMapping struct {
+	state  protoimpl.MessageState `protogen:"open.v1"`
+	Type   DomainMatchingType     `protobuf:"varint,1,opt,name=type,proto3,enum=xray.app.dns.DomainMatchingType" json:"type,omitempty"`
+	Domain string                 `protobuf:"bytes,2,opt,name=domain,proto3" json:"domain,omitempty"`
+	Ip     [][]byte               `protobuf:"bytes,3,rep,name=ip,proto3" json:"ip,omitempty"`
+	// ProxiedDomain indicates the mapped domain has the same IP address on this
+	// domain. Xray will use this domain for IP queries.
+	ProxiedDomain string `protobuf:"bytes,4,opt,name=proxied_domain,json=proxiedDomain,proto3" json:"proxied_domain,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config_HostMapping) Reset() {
+	*x = Config_HostMapping{}
+	mi := &file_app_dns_config_proto_msgTypes[4]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config_HostMapping) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config_HostMapping) ProtoMessage() {}
+
+func (x *Config_HostMapping) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_config_proto_msgTypes[4]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config_HostMapping.ProtoReflect.Descriptor instead.
+func (*Config_HostMapping) Descriptor() ([]byte, []int) {
+	return file_app_dns_config_proto_rawDescGZIP(), []int{1, 0}
+}
+
+func (x *Config_HostMapping) GetType() DomainMatchingType {
+	if x != nil {
+		return x.Type
+	}
+	return DomainMatchingType_Full
+}
+
+func (x *Config_HostMapping) GetDomain() string {
+	if x != nil {
+		return x.Domain
+	}
+	return ""
+}
+
+func (x *Config_HostMapping) GetIp() [][]byte {
+	if x != nil {
+		return x.Ip
+	}
+	return nil
+}
+
+func (x *Config_HostMapping) GetProxiedDomain() string {
+	if x != nil {
+		return x.ProxiedDomain
+	}
+	return ""
+}
+
+var File_app_dns_config_proto protoreflect.FileDescriptor
+
+const file_app_dns_config_proto_rawDesc = "" +
+	"\n" +
+	"\x14app/dns/config.proto\x12\fxray.app.dns\x1a\x1ccommon/net/destination.proto\x1a\x17app/router/config.proto\"\xdf\a\n" +
+	"\n" +
+	"NameServer\x123\n" +
+	"\aaddress\x18\x01 \x01(\v2\x19.xray.common.net.EndpointR\aaddress\x12\x1b\n" +
+	"\tclient_ip\x18\x05 \x01(\fR\bclientIp\x12\"\n" +
+	"\fskipFallback\x18\x06 \x01(\bR\fskipFallback\x12V\n" +
+	"\x12prioritized_domain\x18\x02 \x03(\v2'.xray.app.dns.NameServer.PriorityDomainR\x11prioritizedDomain\x12=\n" +
+	"\x0eexpected_geoip\x18\x03 \x03(\v2\x16.xray.app.router.GeoIPR\rexpectedGeoip\x12L\n" +
+	"\x0eoriginal_rules\x18\x04 \x03(\v2%.xray.app.dns.NameServer.OriginalRuleR\roriginalRules\x12B\n" +
+	"\x0equery_strategy\x18\a \x01(\x0e2\x1b.xray.app.dns.QueryStrategyR\rqueryStrategy\x12\x1a\n" +
+	"\bactPrior\x18\b \x01(\bR\bactPrior\x12\x10\n" +
+	"\x03tag\x18\t \x01(\tR\x03tag\x12\x1c\n" +
+	"\ttimeoutMs\x18\n" +
+	" \x01(\x04R\ttimeoutMs\x12'\n" +
+	"\fdisableCache\x18\v \x01(\bH\x00R\fdisableCache\x88\x01\x01\x12#\n" +
+	"\n" +
+	"serveStale\x18\x0f \x01(\bH\x01R\n" +
+	"serveStale\x88\x01\x01\x12-\n" +
+	"\x0fserveExpiredTTL\x18\x10 \x01(\rH\x02R\x0fserveExpiredTTL\x88\x01\x01\x12\x1e\n" +
+	"\n" +
+	"finalQuery\x18\f \x01(\bR\n" +
+	"finalQuery\x12A\n" +
+	"\x10unexpected_geoip\x18\r \x03(\v2\x16.xray.app.router.GeoIPR\x0funexpectedGeoip\x12\x1e\n" +
+	"\n" +
+	"actUnprior\x18\x0e \x01(\bR\n" +
+	"actUnprior\x12\x1a\n" +
+	"\bpolicyID\x18\x11 \x01(\rR\bpolicyID\x1a^\n" +
+	"\x0ePriorityDomain\x124\n" +
+	"\x04type\x18\x01 \x01(\x0e2 .xray.app.dns.DomainMatchingTypeR\x04type\x12\x16\n" +
+	"\x06domain\x18\x02 \x01(\tR\x06domain\x1a6\n" +
+	"\fOriginalRule\x12\x12\n" +
+	"\x04rule\x18\x01 \x01(\tR\x04rule\x12\x12\n" +
+	"\x04size\x18\x02 \x01(\rR\x04sizeB\x0f\n" +
+	"\r_disableCacheB\r\n" +
+	"\v_serveStaleB\x12\n" +
+	"\x10_serveExpiredTTL\"\x98\x05\n" +
+	"\x06Config\x129\n" +
+	"\vname_server\x18\x05 \x03(\v2\x18.xray.app.dns.NameServerR\n" +
+	"nameServer\x12\x1b\n" +
+	"\tclient_ip\x18\x03 \x01(\fR\bclientIp\x12C\n" +
+	"\fstatic_hosts\x18\x04 \x03(\v2 .xray.app.dns.Config.HostMappingR\vstaticHosts\x12\x10\n" +
+	"\x03tag\x18\x06 \x01(\tR\x03tag\x12\"\n" +
+	"\fdisableCache\x18\b \x01(\bR\fdisableCache\x12\x1e\n" +
+	"\n" +
+	"serveStale\x18\f \x01(\bR\n" +
+	"serveStale\x12(\n" +
+	"\x0fserveExpiredTTL\x18\r \x01(\rR\x0fserveExpiredTTL\x12B\n" +
+	"\x0equery_strategy\x18\t \x01(\x0e2\x1b.xray.app.dns.QueryStrategyR\rqueryStrategy\x12(\n" +
+	"\x0fdisableFallback\x18\n" +
+	" \x01(\bR\x0fdisableFallback\x126\n" +
+	"\x16disableFallbackIfMatch\x18\v \x01(\bR\x16disableFallbackIfMatch\x120\n" +
+	"\x13enableParallelQuery\x18\x0e \x01(\bR\x13enableParallelQuery\x1a\x92\x01\n" +
+	"\vHostMapping\x124\n" +
+	"\x04type\x18\x01 \x01(\x0e2 .xray.app.dns.DomainMatchingTypeR\x04type\x12\x16\n" +
+	"\x06domain\x18\x02 \x01(\tR\x06domain\x12\x0e\n" +
+	"\x02ip\x18\x03 \x03(\fR\x02ip\x12%\n" +
+	"\x0eproxied_domain\x18\x04 \x01(\tR\rproxiedDomainJ\x04\b\a\x10\b*E\n" +
+	"\x12DomainMatchingType\x12\b\n" +
+	"\x04Full\x10\x00\x12\r\n" +
+	"\tSubdomain\x10\x01\x12\v\n" +
+	"\aKeyword\x10\x02\x12\t\n" +
+	"\x05Regex\x10\x03*B\n" +
+	"\rQueryStrategy\x12\n" +
+	"\n" +
+	"\x06USE_IP\x10\x00\x12\v\n" +
+	"\aUSE_IP4\x10\x01\x12\v\n" +
+	"\aUSE_IP6\x10\x02\x12\v\n" +
+	"\aUSE_SYS\x10\x03BF\n" +
+	"\x10com.xray.app.dnsP\x01Z!github.com/xtls/xray-core/app/dns\xaa\x02\fXray.App.Dnsb\x06proto3"
+
+var (
+	file_app_dns_config_proto_rawDescOnce sync.Once
+	file_app_dns_config_proto_rawDescData []byte
+)
+
+func file_app_dns_config_proto_rawDescGZIP() []byte {
+	file_app_dns_config_proto_rawDescOnce.Do(func() {
+		file_app_dns_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_dns_config_proto_rawDesc), len(file_app_dns_config_proto_rawDesc)))
+	})
+	return file_app_dns_config_proto_rawDescData
+}
+
+var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 2)
+var file_app_dns_config_proto_msgTypes = make([]protoimpl.MessageInfo, 5)
+var file_app_dns_config_proto_goTypes = []any{
+	(DomainMatchingType)(0),           // 0: xray.app.dns.DomainMatchingType
+	(QueryStrategy)(0),                // 1: xray.app.dns.QueryStrategy
+	(*NameServer)(nil),                // 2: xray.app.dns.NameServer
+	(*Config)(nil),                    // 3: xray.app.dns.Config
+	(*NameServer_PriorityDomain)(nil), // 4: xray.app.dns.NameServer.PriorityDomain
+	(*NameServer_OriginalRule)(nil),   // 5: xray.app.dns.NameServer.OriginalRule
+	(*Config_HostMapping)(nil),        // 6: xray.app.dns.Config.HostMapping
+	(*net.Endpoint)(nil),              // 7: xray.common.net.Endpoint
+	(*router.GeoIP)(nil),              // 8: xray.app.router.GeoIP
+}
+var file_app_dns_config_proto_depIdxs = []int32{
+	7,  // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
+	4,  // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
+	8,  // 2: xray.app.dns.NameServer.expected_geoip:type_name -> xray.app.router.GeoIP
+	5,  // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
+	1,  // 4: xray.app.dns.NameServer.query_strategy:type_name -> xray.app.dns.QueryStrategy
+	8,  // 5: xray.app.dns.NameServer.unexpected_geoip:type_name -> xray.app.router.GeoIP
+	2,  // 6: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
+	6,  // 7: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
+	1,  // 8: xray.app.dns.Config.query_strategy:type_name -> xray.app.dns.QueryStrategy
+	0,  // 9: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
+	0,  // 10: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
+	11, // [11:11] is the sub-list for method output_type
+	11, // [11:11] is the sub-list for method input_type
+	11, // [11:11] is the sub-list for extension type_name
+	11, // [11:11] is the sub-list for extension extendee
+	0,  // [0:11] is the sub-list for field type_name
+}
+
+func init() { file_app_dns_config_proto_init() }
+func file_app_dns_config_proto_init() {
+	if File_app_dns_config_proto != nil {
+		return
+	}
+	file_app_dns_config_proto_msgTypes[0].OneofWrappers = []any{}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_dns_config_proto_rawDesc), len(file_app_dns_config_proto_rawDesc)),
+			NumEnums:      2,
+			NumMessages:   5,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_dns_config_proto_goTypes,
+		DependencyIndexes: file_app_dns_config_proto_depIdxs,
+		EnumInfos:         file_app_dns_config_proto_enumTypes,
+		MessageInfos:      file_app_dns_config_proto_msgTypes,
+	}.Build()
+	File_app_dns_config_proto = out.File
+	file_app_dns_config_proto_goTypes = nil
+	file_app_dns_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/dns/config.proto

@@ -0,0 +1,95 @@
+syntax = "proto3";
+
+package xray.app.dns;
+option csharp_namespace = "Xray.App.Dns";
+option go_package = "github.com/xtls/xray-core/app/dns";
+option java_package = "com.xray.app.dns";
+option java_multiple_files = true;
+
+import "common/net/destination.proto";
+import "app/router/config.proto";
+
+message NameServer {
+  xray.common.net.Endpoint address = 1;
+  bytes client_ip = 5;
+  bool skipFallback = 6;
+
+  message PriorityDomain {
+    DomainMatchingType type = 1;
+    string domain = 2;
+  }
+
+  message OriginalRule {
+    string rule = 1;
+    uint32 size = 2;
+  }
+
+  repeated PriorityDomain prioritized_domain = 2;
+  repeated xray.app.router.GeoIP expected_geoip = 3;
+  repeated OriginalRule original_rules = 4;
+  QueryStrategy query_strategy = 7;
+  bool actPrior = 8;
+  string tag = 9;
+  uint64 timeoutMs = 10;
+  optional bool disableCache = 11;
+  optional bool serveStale = 15;
+  optional uint32 serveExpiredTTL = 16;
+  bool finalQuery = 12;
+  repeated xray.app.router.GeoIP unexpected_geoip = 13;
+  bool actUnprior = 14;
+  uint32 policyID = 17;
+}
+
+enum DomainMatchingType {
+  Full = 0;
+  Subdomain = 1;
+  Keyword = 2;
+  Regex = 3;
+}
+
+enum QueryStrategy {
+  USE_IP = 0;
+  USE_IP4 = 1;
+  USE_IP6 = 2;
+  USE_SYS = 3;
+}
+
+message Config {
+  // NameServer list used by this DNS client.
+  // A special value 'localhost' as a domain address can be set to use DNS on local system.
+  repeated NameServer name_server = 5;
+
+  // Client IP for EDNS client subnet. Must be 4 bytes (IPv4) or 16 bytes
+  // (IPv6).
+  bytes client_ip = 3;
+
+  message HostMapping {
+    DomainMatchingType type = 1;
+    string domain = 2;
+
+    repeated bytes ip = 3;
+
+    // ProxiedDomain indicates the mapped domain has the same IP address on this
+    // domain. Xray will use this domain for IP queries.
+    string proxied_domain = 4;
+  }
+
+  repeated HostMapping static_hosts = 4;
+
+  // Tag is the inbound tag of DNS client.
+  string tag = 6;
+
+  reserved 7;
+
+  // DisableCache disables DNS cache
+  bool disableCache = 8;
+  bool serveStale = 12;
+  uint32 serveExpiredTTL = 13;
+
+  QueryStrategy query_strategy = 9;
+
+  bool disableFallback = 10;
+  bool disableFallbackIfMatch = 11;
+
+  bool enableParallelQuery = 14;
+}

subproject/Xray-core-main/app/dns/dns.go

@@ -0,0 +1,606 @@
+// Package dns is an implementation of core.DNS feature.
+package dns
+
+import (
+	"context"
+	go_errors "errors"
+	"fmt"
+	"os"
+	"runtime"
+	"sort"
+	"strings"
+	"sync"
+	"time"
+
+	"github.com/xtls/xray-core/app/router"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/platform"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/common/strmatcher"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+// DNS is a DNS rely server.
+type DNS struct {
+	sync.Mutex
+	disableFallback        bool
+	disableFallbackIfMatch bool
+	enableParallelQuery    bool
+	ipOption               *dns.IPOption
+	hosts                  *StaticHosts
+	clients                []*Client
+	ctx                    context.Context
+	domainMatcher          strmatcher.IndexMatcher
+	matcherInfos           []*DomainMatcherInfo
+	checkSystem            bool
+}
+
+// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
+type DomainMatcherInfo struct {
+	clientIdx     uint16
+	domainRuleIdx uint16
+}
+
+// New creates a new DNS server with given configuration.
+func New(ctx context.Context, config *Config) (*DNS, error) {
+	var clientIP net.IP
+	switch len(config.ClientIp) {
+	case 0, net.IPv4len, net.IPv6len:
+		clientIP = net.IP(config.ClientIp)
+	default:
+		return nil, errors.New("unexpected client IP length ", len(config.ClientIp))
+	}
+
+	var ipOption dns.IPOption
+	checkSystem := false
+	switch config.QueryStrategy {
+	case QueryStrategy_USE_IP:
+		ipOption = dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}
+	case QueryStrategy_USE_SYS:
+		ipOption = dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}
+		checkSystem = true
+	case QueryStrategy_USE_IP4:
+		ipOption = dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}
+	case QueryStrategy_USE_IP6:
+		ipOption = dns.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}
+	default:
+		return nil, errors.New("unexpected query strategy ", config.QueryStrategy)
+	}
+
+	var hosts *StaticHosts
+	mphLoaded := false
+	domainMatcherPath := platform.NewEnvFlag(platform.MphCachePath).GetValue(func() string { return "" })
+	if domainMatcherPath != "" {
+		if f, err := os.Open(domainMatcherPath); err == nil {
+			defer f.Close()
+			if m, err := router.LoadGeoSiteMatcher(f, "HOSTS"); err == nil {
+				f.Seek(0, 0)
+				if hostIPs, err := router.LoadGeoSiteHosts(f); err == nil {
+					if sh, err := NewStaticHostsFromCache(m, hostIPs); err == nil {
+						hosts = sh
+						mphLoaded = true
+						errors.LogDebug(ctx, "MphDomainMatcher loaded from cache for DNS hosts, size: ", sh.matchers.Size())
+					}
+				}
+			}
+		}
+	}
+
+	if !mphLoaded {
+		sh, err := NewStaticHosts(config.StaticHosts)
+		if err != nil {
+			return nil, errors.New("failed to create hosts").Base(err)
+		}
+		hosts = sh
+	}
+
+	var clients []*Client
+	domainRuleCount := 0
+
+	var defaultTag = config.Tag
+	if len(config.Tag) == 0 {
+		defaultTag = generateRandomTag()
+	}
+
+	for _, ns := range config.NameServer {
+		domainRuleCount += len(ns.PrioritizedDomain)
+	}
+
+	// MatcherInfos is ensured to cover the maximum index domainMatcher could return, where matcher's index starts from 1
+	matcherInfos := make([]*DomainMatcherInfo, domainRuleCount+1)
+	domainMatcher := &strmatcher.MatcherGroup{}
+
+	for _, ns := range config.NameServer {
+		clientIdx := len(clients)
+		updateDomain := func(domainRule strmatcher.Matcher, originalRuleIdx int, matcherInfos []*DomainMatcherInfo) {
+			midx := domainMatcher.Add(domainRule)
+			matcherInfos[midx] = &DomainMatcherInfo{
+				clientIdx:     uint16(clientIdx),
+				domainRuleIdx: uint16(originalRuleIdx),
+			}
+		}
+
+		myClientIP := clientIP
+		switch len(ns.ClientIp) {
+		case net.IPv4len, net.IPv6len:
+			myClientIP = net.IP(ns.ClientIp)
+		}
+
+		disableCache := config.DisableCache
+		if ns.DisableCache != nil {
+			disableCache = *ns.DisableCache
+		}
+
+		serveStale := config.ServeStale
+		if ns.ServeStale != nil {
+			serveStale = *ns.ServeStale
+		}
+
+		serveExpiredTTL := config.ServeExpiredTTL
+		if ns.ServeExpiredTTL != nil {
+			serveExpiredTTL = *ns.ServeExpiredTTL
+		}
+
+		var tag = defaultTag
+		if len(ns.Tag) > 0 {
+			tag = ns.Tag
+		}
+		clientIPOption := ResolveIpOptionOverride(ns.QueryStrategy, ipOption)
+		if !clientIPOption.IPv4Enable && !clientIPOption.IPv6Enable {
+			return nil, errors.New("no QueryStrategy available for ", ns.Address)
+		}
+
+		client, err := NewClient(ctx, ns, myClientIP, disableCache, serveStale, serveExpiredTTL, tag, clientIPOption, &matcherInfos, updateDomain)
+		if err != nil {
+			return nil, errors.New("failed to create client").Base(err)
+		}
+		clients = append(clients, client)
+	}
+
+	// If there is no DNS client in config, add a `localhost` DNS client
+	if len(clients) == 0 {
+		clients = append(clients, NewLocalDNSClient(ipOption))
+	}
+
+	return &DNS{
+		hosts:                  hosts,
+		ipOption:               &ipOption,
+		clients:                clients,
+		ctx:                    ctx,
+		domainMatcher:          domainMatcher,
+		matcherInfos:           matcherInfos,
+		disableFallback:        config.DisableFallback,
+		disableFallbackIfMatch: config.DisableFallbackIfMatch,
+		enableParallelQuery:    config.EnableParallelQuery,
+		checkSystem:            checkSystem,
+	}, nil
+}
+
+// Type implements common.HasType.
+func (*DNS) Type() interface{} {
+	return dns.ClientType()
+}
+
+// Start implements common.Runnable.
+func (s *DNS) Start() error {
+	return nil
+}
+
+// Close implements common.Closable.
+func (s *DNS) Close() error {
+	return nil
+}
+
+// IsOwnLink implements proxy.dns.ownLinkVerifier
+func (s *DNS) IsOwnLink(ctx context.Context) bool {
+	inbound := session.InboundFromContext(ctx)
+	if inbound == nil {
+		return false
+	}
+	for _, client := range s.clients {
+		if client.tag == inbound.Tag {
+			return true
+		}
+	}
+	return false
+}
+
+// LookupIP implements dns.Client.
+func (s *DNS) LookupIP(domain string, option dns.IPOption) ([]net.IP, uint32, error) {
+	// Normalize the FQDN form query
+	domain = strings.TrimSuffix(domain, ".")
+	if domain == "" {
+		return nil, 0, errors.New("empty domain name")
+	}
+
+	if s.checkSystem {
+		supportIPv4, supportIPv6 := checkRoutes()
+		option.IPv4Enable = option.IPv4Enable && supportIPv4
+		option.IPv6Enable = option.IPv6Enable && supportIPv6
+	} else {
+		option.IPv4Enable = option.IPv4Enable && s.ipOption.IPv4Enable
+		option.IPv6Enable = option.IPv6Enable && s.ipOption.IPv6Enable
+	}
+
+	if !option.IPv4Enable && !option.IPv6Enable {
+		return nil, 0, dns.ErrEmptyResponse
+	}
+
+	// Static host lookup
+	switch addrs, err := s.hosts.Lookup(domain, option); {
+	case err != nil:
+		if go_errors.Is(err, dns.ErrEmptyResponse) {
+			return nil, 0, dns.ErrEmptyResponse
+		}
+		return nil, 0, errors.New("returning nil for domain ", domain).Base(err)
+	case addrs == nil: // Domain not recorded in static host
+		break
+	case len(addrs) == 0: // Domain recorded, but no valid IP returned (e.g. IPv4 address with only IPv6 enabled)
+		return nil, 0, dns.ErrEmptyResponse
+	case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Domain replacement
+		errors.LogInfo(s.ctx, "domain replaced: ", domain, " -> ", addrs[0].Domain())
+		domain = addrs[0].Domain()
+	default: // Successfully found ip records in static host
+		errors.LogInfo(s.ctx, "returning ", len(addrs), " IP(s) for domain ", domain, " -> ", addrs)
+		ips, err := toNetIP(addrs)
+		if err != nil {
+			return nil, 0, err
+		}
+		return ips, 10, nil // Hosts ttl is 10
+	}
+
+	// Name servers lookup
+	if s.enableParallelQuery {
+		return s.parallelQuery(domain, option)
+	} else {
+		return s.serialQuery(domain, option)
+	}
+}
+
+func (s *DNS) sortClients(domain string) []*Client {
+	clients := make([]*Client, 0, len(s.clients))
+	clientUsed := make([]bool, len(s.clients))
+	clientNames := make([]string, 0, len(s.clients))
+	domainRules := []string{}
+
+	// Priority domain matching
+	hasMatch := false
+	MatchSlice := s.domainMatcher.Match(domain)
+	sort.Slice(MatchSlice, func(i, j int) bool {
+		return MatchSlice[i] < MatchSlice[j]
+	})
+	for _, match := range MatchSlice {
+		info := s.matcherInfos[match]
+		client := s.clients[info.clientIdx]
+		domainRule := client.domains[info.domainRuleIdx]
+		domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", domainRule, info.clientIdx))
+		if clientUsed[info.clientIdx] {
+			continue
+		}
+		clientUsed[info.clientIdx] = true
+		clients = append(clients, client)
+		clientNames = append(clientNames, client.Name())
+		hasMatch = true
+		if client.finalQuery {
+			return clients
+		}
+	}
+
+	if !(s.disableFallback || s.disableFallbackIfMatch && hasMatch) {
+		// Default round-robin query
+		for idx, client := range s.clients {
+			if clientUsed[idx] || client.skipFallback {
+				continue
+			}
+			clientUsed[idx] = true
+			clients = append(clients, client)
+			clientNames = append(clientNames, client.Name())
+			if client.finalQuery {
+				return clients
+			}
+		}
+	}
+
+	if len(domainRules) > 0 {
+		errors.LogDebug(s.ctx, "domain ", domain, " matches following rules: ", domainRules)
+	}
+	if len(clientNames) > 0 {
+		errors.LogDebug(s.ctx, "domain ", domain, " will use DNS in order: ", clientNames)
+	}
+
+	if len(clients) == 0 {
+		if len(s.clients) > 0 {
+			clients = append(clients, s.clients[0])
+			clientNames = append(clientNames, s.clients[0].Name())
+			errors.LogWarning(s.ctx, "domain ", domain, " will use the first DNS: ", clientNames)
+		} else {
+			errors.LogError(s.ctx, "no DNS clients available for domain ", domain, " and no default clients configured")
+		}
+	}
+
+	return clients
+}
+
+func mergeQueryErrors(domain string, errs []error) error {
+	if len(errs) == 0 {
+		return dns.ErrEmptyResponse
+	}
+
+	var noRNF error
+	for _, err := range errs {
+		if go_errors.Is(err, errRecordNotFound) {
+			continue // server no response, ignore
+		} else if noRNF == nil {
+			noRNF = err
+		} else if !go_errors.Is(err, noRNF) {
+			return errors.New("returning nil for domain ", domain).Base(errors.Combine(errs...))
+		}
+	}
+	if go_errors.Is(noRNF, dns.ErrEmptyResponse) {
+		return dns.ErrEmptyResponse
+	}
+	if noRNF == nil {
+		noRNF = errRecordNotFound
+	}
+	return errors.New("returning nil for domain ", domain).Base(noRNF)
+}
+
+func (s *DNS) serialQuery(domain string, option dns.IPOption) ([]net.IP, uint32, error) {
+	var errs []error
+	for _, client := range s.sortClients(domain) {
+		if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
+			errors.LogDebug(s.ctx, "skip DNS resolution for domain ", domain, " at server ", client.Name())
+			continue
+		}
+
+		ips, ttl, err := client.QueryIP(s.ctx, domain, option)
+
+		if len(ips) > 0 {
+			return ips, ttl, nil
+		}
+
+		errors.LogInfoInner(s.ctx, err, "failed to lookup ip for domain ", domain, " at server ", client.Name(), " in serial query mode")
+		if err == nil {
+			err = dns.ErrEmptyResponse
+		}
+		errs = append(errs, err)
+	}
+	return nil, 0, mergeQueryErrors(domain, errs)
+}
+
+func (s *DNS) parallelQuery(domain string, option dns.IPOption) ([]net.IP, uint32, error) {
+	var errs []error
+	clients := s.sortClients(domain)
+
+	resultsChan := asyncQueryAll(domain, option, clients, s.ctx)
+
+	groups, groupOf := makeGroups( /*s.ctx,*/ clients)
+	results := make([]*queryResult, len(clients))
+	pending := make([]int, len(groups))
+	for gi, g := range groups {
+		pending[gi] = g.end - g.start + 1
+	}
+
+	nextGroup := 0
+	for range clients {
+		result := <-resultsChan
+		results[result.index] = &result
+
+		gi := groupOf[result.index]
+		pending[gi]--
+
+		for nextGroup < len(groups) {
+			g := groups[nextGroup]
+
+			// group race, minimum rtt -> return
+			for j := g.start; j <= g.end; j++ {
+				r := results[j]
+				if r != nil && r.err == nil && len(r.ips) > 0 {
+					return r.ips, r.ttl, nil
+				}
+			}
+
+			// current group is incomplete and no one success -> continue pending
+			if pending[nextGroup] > 0 {
+				break
+			}
+
+			// all failed -> log and continue next group
+			for j := g.start; j <= g.end; j++ {
+				r := results[j]
+				e := r.err
+				if e == nil {
+					e = dns.ErrEmptyResponse
+				}
+				errors.LogInfoInner(s.ctx, e, "failed to lookup ip for domain ", domain, " at server ", clients[j].Name(), " in parallel query mode")
+				errs = append(errs, e)
+			}
+			nextGroup++
+		}
+	}
+
+	return nil, 0, mergeQueryErrors(domain, errs)
+}
+
+type queryResult struct {
+	ips   []net.IP
+	ttl   uint32
+	err   error
+	index int
+}
+
+func asyncQueryAll(domain string, option dns.IPOption, clients []*Client, ctx context.Context) chan queryResult {
+	if len(clients) == 0 {
+		ch := make(chan queryResult)
+		close(ch)
+		return ch
+	}
+
+	ch := make(chan queryResult, len(clients))
+	for i, client := range clients {
+		if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
+			errors.LogDebug(ctx, "skip DNS resolution for domain ", domain, " at server ", client.Name())
+			ch <- queryResult{err: dns.ErrEmptyResponse, index: i}
+			continue
+		}
+
+		go func(i int, c *Client) {
+			qctx := ctx
+			if !c.server.IsDisableCache() {
+				nctx, cancel := context.WithTimeout(context.WithoutCancel(ctx), c.timeoutMs*2)
+				qctx = nctx
+				defer cancel()
+			}
+			ips, ttl, err := c.QueryIP(qctx, domain, option)
+			ch <- queryResult{ips: ips, ttl: ttl, err: err, index: i}
+		}(i, client)
+	}
+	return ch
+}
+
+type group struct{ start, end int }
+
+// merge only adjacent and rule-equivalent Client into a single group
+func makeGroups( /*ctx context.Context,*/ clients []*Client) ([]group, []int) {
+	n := len(clients)
+	if n == 0 {
+		return nil, nil
+	}
+	groups := make([]group, 0, n)
+	groupOf := make([]int, n)
+
+	s, e := 0, 0
+	for i := 1; i < n; i++ {
+		if clients[i-1].policyID == clients[i].policyID {
+			e = i
+		} else {
+			for k := s; k <= e; k++ {
+				groupOf[k] = len(groups)
+			}
+			groups = append(groups, group{start: s, end: e})
+			s, e = i, i
+		}
+	}
+	for k := s; k <= e; k++ {
+		groupOf[k] = len(groups)
+	}
+	groups = append(groups, group{start: s, end: e})
+
+	// var b strings.Builder
+	// b.WriteString("dns grouping: total clients=")
+	// b.WriteString(strconv.Itoa(n))
+	// b.WriteString(", groups=")
+	// b.WriteString(strconv.Itoa(len(groups)))
+
+	// for gi, g := range groups {
+	// 	b.WriteString("\n  [")
+	// 	b.WriteString(strconv.Itoa(g.start))
+	// 	b.WriteString("..")
+	// 	b.WriteString(strconv.Itoa(g.end))
+	// 	b.WriteString("] gid=")
+	// 	b.WriteString(strconv.Itoa(gi))
+	// 	b.WriteString(" pid=")
+	// 	b.WriteString(strconv.FormatUint(uint64(clients[g.start].policyID), 10))
+	// 	b.WriteString(" members: ")
+
+	// 	for i := g.start; i <= g.end; i++ {
+	// 		if i > g.start {
+	// 			b.WriteString(", ")
+	// 		}
+	// 		b.WriteString(strconv.Itoa(i))
+	// 		b.WriteByte(':')
+	// 		b.WriteString(clients[i].Name())
+	// 	}
+	// }
+	// errors.LogDebug(ctx, b.String())
+
+	return groups, groupOf
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		return New(ctx, config.(*Config))
+	}))
+}
+
+func probeRoutes() (ipv4 bool, ipv6 bool) {
+	if conn, err := net.Dial("udp4", "192.33.4.12:53"); err == nil {
+		ipv4 = true
+		conn.Close()
+	}
+	if conn, err := net.Dial("udp6", "[2001:500:2::c]:53"); err == nil {
+		ipv6 = true
+		conn.Close()
+	}
+	return
+}
+
+var routeCache struct {
+	sync.Once
+	sync.RWMutex
+	expire     time.Time
+	ipv4, ipv6 bool
+}
+
+func checkRoutes() (bool, bool) {
+	if !isGUIPlatform {
+		routeCache.Once.Do(func() {
+			routeCache.ipv4, routeCache.ipv6 = probeRoutes()
+		})
+		return routeCache.ipv4, routeCache.ipv6
+	}
+
+	routeCache.RWMutex.RLock()
+	now := time.Now()
+	if routeCache.expire.After(now) {
+		routeCache.RWMutex.RUnlock()
+		return routeCache.ipv4, routeCache.ipv6
+	}
+	routeCache.RWMutex.RUnlock()
+
+	routeCache.RWMutex.Lock()
+	defer routeCache.RWMutex.Unlock()
+
+	now = time.Now()
+	if routeCache.expire.After(now) { // double-check
+		return routeCache.ipv4, routeCache.ipv6
+	}
+	routeCache.ipv4, routeCache.ipv6 = probeRoutes()    // ~2ms
+	routeCache.expire = now.Add(100 * time.Millisecond) // ttl
+	return routeCache.ipv4, routeCache.ipv6
+}
+
+var isGUIPlatform = detectGUIPlatform()
+
+func detectGUIPlatform() bool {
+	switch runtime.GOOS {
+	case "android", "ios", "windows", "darwin":
+		return true
+	case "linux", "freebsd", "openbsd":
+		if t := os.Getenv("XDG_SESSION_TYPE"); t == "wayland" || t == "x11" {
+			return true
+		}
+		if os.Getenv("DISPLAY") != "" || os.Getenv("WAYLAND_DISPLAY") != "" {
+			return true
+		}
+	}
+	return false
+}

subproject/Xray-core-main/app/dns/dnscommon.go

@@ -0,0 +1,263 @@
+package dns
+
+import (
+	"context"
+	"encoding/binary"
+	"math"
+	"strings"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/core"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+
+	"golang.org/x/net/dns/dnsmessage"
+)
+
+// Fqdn normalizes domain make sure it ends with '.'
+// case-sensitive
+func Fqdn(domain string) string {
+	if len(domain) > 0 && strings.HasSuffix(domain, ".") {
+		return domain
+	}
+	return domain + "."
+}
+
+type record struct {
+	A    *IPRecord
+	AAAA *IPRecord
+}
+
+// IPRecord is a cacheable item for a resolved domain
+type IPRecord struct {
+	ReqID     uint16
+	IP        []net.IP
+	Expire    time.Time
+	RCode     dnsmessage.RCode
+	RawHeader *dnsmessage.Header
+}
+
+func (r *IPRecord) getIPs() ([]net.IP, int32, error) {
+	if r == nil {
+		return nil, 0, errRecordNotFound
+	}
+
+	untilExpire := time.Until(r.Expire).Seconds()
+	ttl := int32(math.Ceil(untilExpire))
+
+	if r.RCode != dnsmessage.RCodeSuccess {
+		return nil, ttl, dns_feature.RCodeError(r.RCode)
+	}
+	if len(r.IP) == 0 {
+		return nil, ttl, dns_feature.ErrEmptyResponse
+	}
+
+	return r.IP, ttl, nil
+}
+
+var errRecordNotFound = errors.New("record not found")
+
+type dnsRequest struct {
+	reqType dnsmessage.Type
+	domain  string
+	start   time.Time
+	expire  time.Time
+	msg     *dnsmessage.Message
+}
+
+func genEDNS0Options(clientIP net.IP, padding int) *dnsmessage.Resource {
+	if len(clientIP) == 0 && padding == 0 {
+		return nil
+	}
+
+	const EDNS0SUBNET = 0x8
+	const EDNS0PADDING = 0xc
+
+	opt := new(dnsmessage.Resource)
+	common.Must(opt.Header.SetEDNS0(1350, 0xfe00, true))
+	body := dnsmessage.OPTResource{}
+	opt.Body = &body
+
+	if len(clientIP) != 0 {
+		var netmask int
+		var family uint16
+
+		if len(clientIP) == 4 {
+			family = 1
+			netmask = 24 // 24 for IPV4, 96 for IPv6
+		} else {
+			family = 2
+			netmask = 96
+		}
+
+		b := make([]byte, 4)
+		binary.BigEndian.PutUint16(b[0:], family)
+		b[2] = byte(netmask)
+		b[3] = 0
+		switch family {
+		case 1:
+			ip := clientIP.To4().Mask(net.CIDRMask(netmask, net.IPv4len*8))
+			needLength := (netmask + 8 - 1) / 8 // division rounding up
+			b = append(b, ip[:needLength]...)
+		case 2:
+			ip := clientIP.Mask(net.CIDRMask(netmask, net.IPv6len*8))
+			needLength := (netmask + 8 - 1) / 8 // division rounding up
+			b = append(b, ip[:needLength]...)
+		}
+
+		body.Options = append(body.Options,
+			dnsmessage.Option{
+				Code: EDNS0SUBNET,
+				Data: b,
+			})
+	}
+
+	if padding != 0 {
+		body.Options = append(body.Options,
+			dnsmessage.Option{
+				Code: EDNS0PADDING,
+				Data: make([]byte, padding),
+			})
+	}
+
+	return opt
+}
+
+func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
+	qA := dnsmessage.Question{
+		Name:  dnsmessage.MustNewName(domain),
+		Type:  dnsmessage.TypeA,
+		Class: dnsmessage.ClassINET,
+	}
+
+	qAAAA := dnsmessage.Question{
+		Name:  dnsmessage.MustNewName(domain),
+		Type:  dnsmessage.TypeAAAA,
+		Class: dnsmessage.ClassINET,
+	}
+
+	var reqs []*dnsRequest
+	now := time.Now()
+
+	if option.IPv4Enable {
+		msg := new(dnsmessage.Message)
+		msg.Header.ID = reqIDGen()
+		msg.Header.RecursionDesired = true
+		msg.Questions = []dnsmessage.Question{qA}
+		if reqOpts != nil {
+			msg.Additionals = append(msg.Additionals, *reqOpts)
+		}
+		reqs = append(reqs, &dnsRequest{
+			reqType: dnsmessage.TypeA,
+			domain:  domain,
+			start:   now,
+			msg:     msg,
+		})
+	}
+
+	if option.IPv6Enable {
+		msg := new(dnsmessage.Message)
+		msg.Header.ID = reqIDGen()
+		msg.Header.RecursionDesired = true
+		msg.Questions = []dnsmessage.Question{qAAAA}
+		if reqOpts != nil {
+			msg.Additionals = append(msg.Additionals, *reqOpts)
+		}
+		reqs = append(reqs, &dnsRequest{
+			reqType: dnsmessage.TypeAAAA,
+			domain:  domain,
+			start:   now,
+			msg:     msg,
+		})
+	}
+
+	return reqs
+}
+
+// parseResponse parses DNS answers from the returned payload
+func parseResponse(payload []byte) (*IPRecord, error) {
+	var parser dnsmessage.Parser
+	h, err := parser.Start(payload)
+	if err != nil {
+		return nil, errors.New("failed to parse DNS response").Base(err).AtWarning()
+	}
+	if err := parser.SkipAllQuestions(); err != nil {
+		return nil, errors.New("failed to skip questions in DNS response").Base(err).AtWarning()
+	}
+
+	now := time.Now()
+	ipRecord := &IPRecord{
+		ReqID:     h.ID,
+		RCode:     h.RCode,
+		Expire:    now.Add(time.Second * dns_feature.DefaultTTL),
+		RawHeader: &h,
+	}
+
+L:
+	for {
+		ah, err := parser.AnswerHeader()
+		if err != nil {
+			if err != dnsmessage.ErrSectionDone {
+				errors.LogInfoInner(context.Background(), err, "failed to parse answer section for domain: ", ah.Name.String())
+			}
+			break
+		}
+
+		ttl := ah.TTL
+		if ttl == 0 {
+			ttl = 1
+		}
+		expire := now.Add(time.Duration(ttl) * time.Second)
+		if ipRecord.Expire.After(expire) {
+			ipRecord.Expire = expire
+		}
+
+		switch ah.Type {
+		case dnsmessage.TypeA:
+			ans, err := parser.AResource()
+			if err != nil {
+				errors.LogInfoInner(context.Background(), err, "failed to parse A record for domain: ", ah.Name)
+				break L
+			}
+			ipRecord.IP = append(ipRecord.IP, net.IPAddress(ans.A[:]).IP())
+		case dnsmessage.TypeAAAA:
+			ans, err := parser.AAAAResource()
+			if err != nil {
+				errors.LogInfoInner(context.Background(), err, "failed to parse AAAA record for domain: ", ah.Name)
+				break L
+			}
+			newIP := net.IPAddress(ans.AAAA[:]).IP()
+			if len(newIP) == net.IPv6len {
+				ipRecord.IP = append(ipRecord.IP, newIP)
+			}
+		default:
+			if err := parser.SkipAnswer(); err != nil {
+				errors.LogInfoInner(context.Background(), err, "failed to skip answer")
+				break L
+			}
+			continue
+		}
+	}
+
+	return ipRecord, nil
+}
+
+// toDnsContext create a new background context with parent inbound, session and dns log
+func toDnsContext(ctx context.Context, addr string) context.Context {
+	dnsCtx := core.ToBackgroundDetachedContext(ctx)
+	if inbound := session.InboundFromContext(ctx); inbound != nil {
+		dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
+	}
+	dnsCtx = session.ContextWithContent(dnsCtx, session.ContentFromContext(ctx))
+	dnsCtx = log.ContextWithAccessMessage(dnsCtx, &log.AccessMessage{
+		From:   "DNS",
+		To:     addr,
+		Status: log.AccessAccepted,
+		Reason: "",
+	})
+	return dnsCtx
+}

subproject/Xray-core-main/app/dns/dnscommon_test.go

@@ -0,0 +1,185 @@
+package dns
+
+import (
+	"math/rand"
+	"testing"
+	"time"
+
+	"github.com/google/go-cmp/cmp"
+	"github.com/miekg/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+	"golang.org/x/net/dns/dnsmessage"
+)
+
+func Test_parseResponse(t *testing.T) {
+	var p [][]byte
+
+	ans := new(dns.Msg)
+	ans.Id = 0
+	p = append(p, common.Must2(ans.Pack()))
+
+	p = append(p, []byte{})
+
+	ans = new(dns.Msg)
+	ans.Id = 1
+	ans.Answer = append(ans.Answer,
+		common.Must2(dns.NewRR("google.com. IN CNAME m.test.google.com")),
+		common.Must2(dns.NewRR("google.com. IN CNAME fake.google.com")),
+		common.Must2(dns.NewRR("google.com. IN A 8.8.8.8")),
+		common.Must2(dns.NewRR("google.com. IN A 8.8.4.4")),
+	)
+	p = append(p, common.Must2(ans.Pack()))
+
+	ans = new(dns.Msg)
+	ans.Id = 2
+	ans.Answer = append(ans.Answer,
+		common.Must2(dns.NewRR("google.com. IN CNAME m.test.google.com")),
+		common.Must2(dns.NewRR("google.com. IN CNAME fake.google.com")),
+		common.Must2(dns.NewRR("google.com. IN CNAME m.test.google.com")),
+		common.Must2(dns.NewRR("google.com. IN CNAME test.google.com")),
+		common.Must2(dns.NewRR("google.com. IN AAAA 2001:4860:4860::8888")),
+		common.Must2(dns.NewRR("google.com. IN AAAA 2001:4860:4860::8844")),
+	)
+	p = append(p, common.Must2(ans.Pack()))
+
+	tests := []struct {
+		name    string
+		want    *IPRecord
+		wantErr bool
+	}{
+		{
+			"empty",
+			&IPRecord{0, []net.IP(nil), time.Time{}, dnsmessage.RCodeSuccess, nil},
+			false,
+		},
+		{
+			"error",
+			nil,
+			true,
+		},
+		{
+			"a record",
+			&IPRecord{
+				1,
+				[]net.IP{net.ParseIP("8.8.8.8"), net.ParseIP("8.8.4.4")},
+				time.Time{},
+				dnsmessage.RCodeSuccess,
+				nil,
+			},
+			false,
+		},
+		{
+			"aaaa record",
+			&IPRecord{2, []net.IP{net.ParseIP("2001:4860:4860::8888"), net.ParseIP("2001:4860:4860::8844")}, time.Time{}, dnsmessage.RCodeSuccess, nil},
+			false,
+		},
+	}
+	for i, tt := range tests {
+		t.Run(tt.name, func(t *testing.T) {
+			got, err := parseResponse(p[i])
+			if (err != nil) != tt.wantErr {
+				t.Errorf("handleResponse() error = %v, wantErr %v", err, tt.wantErr)
+				return
+			}
+
+			if got != nil {
+				// reset the time and RawHeader
+				got.Expire = time.Time{}
+				got.RawHeader = nil
+			}
+			if cmp.Diff(got, tt.want) != "" {
+				t.Error(cmp.Diff(got, tt.want))
+				// t.Errorf("handleResponse() = %#v, want %#v", got, tt.want)
+			}
+		})
+	}
+}
+
+func Test_buildReqMsgs(t *testing.T) {
+	stubID := func() uint16 {
+		return uint16(rand.Uint32())
+	}
+	type args struct {
+		domain  string
+		option  dns_feature.IPOption
+		reqOpts *dnsmessage.Resource
+	}
+	tests := []struct {
+		name string
+		args args
+		want int
+	}{
+		{"dual stack", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}, nil}, 2},
+		{"ipv4 only", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}, nil}, 1},
+		{"ipv6 only", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+			FakeEnable: false,
+		}, nil}, 1},
+		{"none/error", args{"test.com", dns_feature.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}, nil}, 0},
+	}
+	for _, tt := range tests {
+		t.Run(tt.name, func(t *testing.T) {
+			if got := buildReqMsgs(tt.args.domain, tt.args.option, stubID, tt.args.reqOpts); !(len(got) == tt.want) {
+				t.Errorf("buildReqMsgs() = %v, want %v", got, tt.want)
+			}
+		})
+	}
+}
+
+func Test_genEDNS0Options(t *testing.T) {
+	type args struct {
+		clientIP net.IP
+	}
+	tests := []struct {
+		name string
+		args args
+		want *dnsmessage.Resource
+	}{
+		// TODO: Add test cases.
+		{"ipv4", args{net.ParseIP("4.3.2.1")}, nil},
+		{"ipv6", args{net.ParseIP("2001::4321")}, nil},
+	}
+	for _, tt := range tests {
+		t.Run(tt.name, func(t *testing.T) {
+			if got := genEDNS0Options(tt.args.clientIP, 0); got == nil {
+				t.Errorf("genEDNS0Options() = %v, want %v", got, tt.want)
+			}
+		})
+	}
+}
+
+func TestFqdn(t *testing.T) {
+	type args struct {
+		domain string
+	}
+	tests := []struct {
+		name string
+		args args
+		want string
+	}{
+		{"with fqdn", args{"www.example.com."}, "www.example.com."},
+		{"without fqdn", args{"www.example.com"}, "www.example.com."},
+	}
+	for _, tt := range tests {
+		t.Run(tt.name, func(t *testing.T) {
+			if got := Fqdn(tt.args.domain); got != tt.want {
+				t.Errorf("Fqdn() = %v, want %v", got, tt.want)
+			}
+		})
+	}
+}

subproject/Xray-core-main/app/dns/fakedns/fake.go

@@ -0,0 +1,250 @@
+package fakedns
+
+import (
+	"context"
+	"math"
+	"math/big"
+	"sync"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/cache"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+type Holder struct {
+	domainToIP cache.Lru
+	ipRange    *net.IPNet
+	mu         *sync.Mutex
+
+	config *FakeDnsPool
+}
+
+func (fkdns *Holder) IsIPInIPPool(ip net.Address) bool {
+	if ip.Family().IsDomain() {
+		return false
+	}
+	return fkdns.ipRange.Contains(ip.IP())
+}
+
+func (fkdns *Holder) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
+	isIPv6 := fkdns.ipRange.IP.To4() == nil
+	if (isIPv6 && ipv6) || (!isIPv6 && ipv4) {
+		return fkdns.GetFakeIPForDomain(domain)
+	}
+	return []net.Address{}
+}
+
+func (*Holder) Type() interface{} {
+	return (*dns.FakeDNSEngine)(nil)
+}
+
+func (fkdns *Holder) Start() error {
+	if fkdns.config != nil && fkdns.config.IpPool != "" && fkdns.config.LruSize != 0 {
+		return fkdns.initializeFromConfig()
+	}
+	return errors.New("invalid fakeDNS setting")
+}
+
+func (fkdns *Holder) Close() error {
+	fkdns.domainToIP = nil
+	fkdns.ipRange = nil
+	fkdns.mu = nil
+	return nil
+}
+
+func NewFakeDNSHolder() (*Holder, error) {
+	var fkdns *Holder
+	var err error
+
+	if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
+		return nil, errors.New("Unable to create Fake Dns Engine").Base(err).AtError()
+	}
+	err = fkdns.initialize(dns.FakeIPv4Pool, 65535)
+	if err != nil {
+		return nil, err
+	}
+	return fkdns, nil
+}
+
+func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
+	return &Holder{nil, nil, nil, conf}, nil
+}
+
+func (fkdns *Holder) initializeFromConfig() error {
+	return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
+}
+
+func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
+	var ipRange *net.IPNet
+	var err error
+
+	if _, ipRange, err = net.ParseCIDR(ipPoolCidr); err != nil {
+		return errors.New("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
+	}
+
+	ones, bits := ipRange.Mask.Size()
+	rooms := bits - ones
+	if math.Log2(float64(lruSize)) >= float64(rooms) {
+		return errors.New("LRU size is bigger than subnet size").AtError()
+	}
+	fkdns.domainToIP = cache.NewLru(lruSize)
+	fkdns.ipRange = ipRange
+	fkdns.mu = new(sync.Mutex)
+	return nil
+}
+
+// GetFakeIPForDomain checks and generates a fake IP for a domain name
+func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
+	fkdns.mu.Lock()
+	defer fkdns.mu.Unlock()
+	if v, ok := fkdns.domainToIP.Get(domain); ok {
+		return []net.Address{v.(net.Address)}
+	}
+	currentTimeMillis := uint64(time.Now().UnixNano() / 1e6)
+	ones, bits := fkdns.ipRange.Mask.Size()
+	rooms := bits - ones
+	if rooms < 64 {
+		currentTimeMillis %= (uint64(1) << rooms)
+	}
+	bigIntIP := big.NewInt(0).SetBytes(fkdns.ipRange.IP)
+	bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
+	var ip net.Address
+	for {
+		ip = net.IPAddress(bigIntIP.Bytes())
+
+		// if we run for a long time, we may go back to beginning and start seeing the IP in use
+		if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
+			break
+		}
+
+		bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
+		if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
+			bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
+		}
+	}
+	fkdns.domainToIP.Put(domain, ip)
+	return []net.Address{ip}
+}
+
+// GetDomainFromFakeDNS checks if an IP is a fake IP and have corresponding domain name
+func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
+	if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
+		return ""
+	}
+	if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
+		return k.(string)
+	}
+	errors.LogInfo(context.Background(), "A fake ip request to ", ip, ", however there is no matching domain name in fake DNS")
+	return ""
+}
+
+type HolderMulti struct {
+	holders []*Holder
+
+	config *FakeDnsPoolMulti
+}
+
+func (h *HolderMulti) IsIPInIPPool(ip net.Address) bool {
+	if ip.Family().IsDomain() {
+		return false
+	}
+	for _, v := range h.holders {
+		if v.IsIPInIPPool(ip) {
+			return true
+		}
+	}
+	return false
+}
+
+func (h *HolderMulti) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
+	var ret []net.Address
+	for _, v := range h.holders {
+		ret = append(ret, v.GetFakeIPForDomain3(domain, ipv4, ipv6)...)
+	}
+	return ret
+}
+
+func (h *HolderMulti) GetFakeIPForDomain(domain string) []net.Address {
+	var ret []net.Address
+	for _, v := range h.holders {
+		ret = append(ret, v.GetFakeIPForDomain(domain)...)
+	}
+	return ret
+}
+
+func (h *HolderMulti) GetDomainFromFakeDNS(ip net.Address) string {
+	for _, v := range h.holders {
+		if domain := v.GetDomainFromFakeDNS(ip); domain != "" {
+			return domain
+		}
+	}
+	return ""
+}
+
+func (h *HolderMulti) Type() interface{} {
+	return (*dns.FakeDNSEngine)(nil)
+}
+
+func (h *HolderMulti) Start() error {
+	for _, v := range h.holders {
+		if v.config != nil && v.config.IpPool != "" && v.config.LruSize != 0 {
+			if err := v.Start(); err != nil {
+				return errors.New("Cannot start all fake dns pools").Base(err)
+			}
+		} else {
+			return errors.New("invalid fakeDNS setting")
+		}
+	}
+	return nil
+}
+
+func (h *HolderMulti) Close() error {
+	for _, v := range h.holders {
+		if err := v.Close(); err != nil {
+			return errors.New("Cannot close all fake dns pools").Base(err)
+		}
+	}
+	return nil
+}
+
+func (h *HolderMulti) createHolderGroups() error {
+	for _, v := range h.config.Pools {
+		holder, err := NewFakeDNSHolderConfigOnly(v)
+		if err != nil {
+			return err
+		}
+		h.holders = append(h.holders, holder)
+	}
+	return nil
+}
+
+func NewFakeDNSHolderMulti(conf *FakeDnsPoolMulti) (*HolderMulti, error) {
+	holderMulti := &HolderMulti{nil, conf}
+	if err := holderMulti.createHolderGroups(); err != nil {
+		return nil, err
+	}
+	return holderMulti, nil
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		var f *Holder
+		var err error
+		if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
+			return nil, err
+		}
+		return f, nil
+	}))
+
+	common.Must(common.RegisterConfig((*FakeDnsPoolMulti)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		var f *HolderMulti
+		var err error
+		if f, err = NewFakeDNSHolderMulti(config.(*FakeDnsPoolMulti)); err != nil {
+			return nil, err
+		}
+		return f, nil
+	}))
+}

subproject/Xray-core-main/app/dns/fakedns/fakedns.go

@@ -0,0 +1 @@
+package fakedns

subproject/Xray-core-main/app/dns/fakedns/fakedns.pb.go

@@ -0,0 +1,180 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/dns/fakedns/fakedns.proto
+
+package fakedns
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type FakeDnsPool struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	IpPool        string                 `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
+	LruSize       int64                  `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"`            //Size of Pool for remembering relationship between domain name and IP address
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *FakeDnsPool) Reset() {
+	*x = FakeDnsPool{}
+	mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *FakeDnsPool) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FakeDnsPool) ProtoMessage() {}
+
+func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
+func (*FakeDnsPool) Descriptor() ([]byte, []int) {
+	return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *FakeDnsPool) GetIpPool() string {
+	if x != nil {
+		return x.IpPool
+	}
+	return ""
+}
+
+func (x *FakeDnsPool) GetLruSize() int64 {
+	if x != nil {
+		return x.LruSize
+	}
+	return 0
+}
+
+type FakeDnsPoolMulti struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Pools         []*FakeDnsPool         `protobuf:"bytes,1,rep,name=pools,proto3" json:"pools,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *FakeDnsPoolMulti) Reset() {
+	*x = FakeDnsPoolMulti{}
+	mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *FakeDnsPoolMulti) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FakeDnsPoolMulti) ProtoMessage() {}
+
+func (x *FakeDnsPoolMulti) ProtoReflect() protoreflect.Message {
+	mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FakeDnsPoolMulti.ProtoReflect.Descriptor instead.
+func (*FakeDnsPoolMulti) Descriptor() ([]byte, []int) {
+	return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *FakeDnsPoolMulti) GetPools() []*FakeDnsPool {
+	if x != nil {
+		return x.Pools
+	}
+	return nil
+}
+
+var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
+
+const file_app_dns_fakedns_fakedns_proto_rawDesc = "" +
+	"\n" +
+	"\x1dapp/dns/fakedns/fakedns.proto\x12\x14xray.app.dns.fakedns\"@\n" +
+	"\vFakeDnsPool\x12\x17\n" +
+	"\aip_pool\x18\x01 \x01(\tR\x06ipPool\x12\x18\n" +
+	"\alruSize\x18\x02 \x01(\x03R\alruSize\"K\n" +
+	"\x10FakeDnsPoolMulti\x127\n" +
+	"\x05pools\x18\x01 \x03(\v2!.xray.app.dns.fakedns.FakeDnsPoolR\x05poolsB^\n" +
+	"\x18com.xray.app.dns.fakednsP\x01Z)github.com/xtls/xray-core/app/dns/fakedns\xaa\x02\x14Xray.App.Dns.Fakednsb\x06proto3"
+
+var (
+	file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
+	file_app_dns_fakedns_fakedns_proto_rawDescData []byte
+)
+
+func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
+	file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
+		file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_dns_fakedns_fakedns_proto_rawDesc), len(file_app_dns_fakedns_fakedns_proto_rawDesc)))
+	})
+	return file_app_dns_fakedns_fakedns_proto_rawDescData
+}
+
+var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
+var file_app_dns_fakedns_fakedns_proto_goTypes = []any{
+	(*FakeDnsPool)(nil),      // 0: xray.app.dns.fakedns.FakeDnsPool
+	(*FakeDnsPoolMulti)(nil), // 1: xray.app.dns.fakedns.FakeDnsPoolMulti
+}
+var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
+	0, // 0: xray.app.dns.fakedns.FakeDnsPoolMulti.pools:type_name -> xray.app.dns.fakedns.FakeDnsPool
+	1, // [1:1] is the sub-list for method output_type
+	1, // [1:1] is the sub-list for method input_type
+	1, // [1:1] is the sub-list for extension type_name
+	1, // [1:1] is the sub-list for extension extendee
+	0, // [0:1] is the sub-list for field type_name
+}
+
+func init() { file_app_dns_fakedns_fakedns_proto_init() }
+func file_app_dns_fakedns_fakedns_proto_init() {
+	if File_app_dns_fakedns_fakedns_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_dns_fakedns_fakedns_proto_rawDesc), len(file_app_dns_fakedns_fakedns_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   2,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_dns_fakedns_fakedns_proto_goTypes,
+		DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
+		MessageInfos:      file_app_dns_fakedns_fakedns_proto_msgTypes,
+	}.Build()
+	File_app_dns_fakedns_fakedns_proto = out.File
+	file_app_dns_fakedns_fakedns_proto_goTypes = nil
+	file_app_dns_fakedns_fakedns_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/dns/fakedns/fakedns.proto

@@ -0,0 +1,16 @@
+syntax = "proto3";
+
+package xray.app.dns.fakedns;
+option csharp_namespace = "Xray.App.Dns.Fakedns";
+option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
+option java_package = "com.xray.app.dns.fakedns";
+option java_multiple_files = true;
+
+message FakeDnsPool{
+  string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
+  int64  lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
+}
+
+message FakeDnsPoolMulti{
+  repeated FakeDnsPool pools = 1;
+}

subproject/Xray-core-main/app/dns/fakedns/fakedns_test.go

@@ -0,0 +1,205 @@
+package fakedns
+
+import (
+	"strconv"
+	"testing"
+
+	"github.com/stretchr/testify/assert"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/uuid"
+	"github.com/xtls/xray-core/features/dns"
+	"golang.org/x/sync/errgroup"
+)
+
+var ipPrefix = "198.1"
+
+func TestNewFakeDnsHolder(_ *testing.T) {
+	_, err := NewFakeDNSHolder()
+	common.Must(err)
+}
+
+func TestFakeDnsHolderCreateMapping(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
+}
+
+func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
+
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+	assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
+	assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
+}
+
+func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+
+	{
+		result := fkdns.GetDomainFromFakeDNS(addr[0])
+		assert.Equal(t, "fakednstest.example.com", result)
+	}
+
+	{
+		result := fkdns.GetDomainFromFakeDNS(addr2[0])
+		assert.Equal(t, "fakednstest2.example.com", result)
+	}
+}
+
+func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
+}
+
+func TestGetFakeIPForDomainConcurrently(t *testing.T) {
+	fkdns, err := NewFakeDNSHolder()
+	common.Must(err)
+
+	total := 200
+	addr := make([][]net.Address, total)
+	var errg errgroup.Group
+	for i := 0; i < total; i++ {
+		errg.Go(testGetFakeIP(i, addr, fkdns))
+	}
+	errg.Wait()
+	for i := 0; i < total; i++ {
+		for j := i + 1; j < total; j++ {
+			assert.NotEqual(t, addr[i][0].IP().String(), addr[j][0].IP().String())
+		}
+	}
+}
+
+func testGetFakeIP(index int, addr [][]net.Address, fkdns *Holder) func() error {
+	return func() error {
+		addr[index] = fkdns.GetFakeIPForDomain("fakednstest" + strconv.Itoa(index) + ".example.com")
+		return nil
+	}
+}
+
+func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
+	fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
+		IpPool:  dns.FakeIPv4Pool,
+		LruSize: 256,
+	})
+	common.Must(err)
+
+	err = fkdns.Start()
+
+	common.Must(err)
+
+	addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
+	addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
+
+	for i := 0; i <= 8192; i++ {
+		{
+			result := fkdns.GetDomainFromFakeDNS(addr[0])
+			assert.Equal(t, "fakednstest.example.com", result)
+		}
+
+		{
+			result := fkdns.GetDomainFromFakeDNS(addr2[0])
+			assert.Equal(t, "fakednstest2.example.com", result)
+		}
+
+		{
+			uuid := uuid.New()
+			domain := uuid.String() + ".fakednstest.example.com"
+			tempAddr := fkdns.GetFakeIPForDomain(domain)
+			rsaddr := tempAddr[0].IP().String()
+
+			result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
+			assert.Equal(t, domain, result)
+		}
+	}
+}
+
+func TestFakeDNSMulti(t *testing.T) {
+	fakeMulti, err := NewFakeDNSHolderMulti(&FakeDnsPoolMulti{
+		Pools: []*FakeDnsPool{{
+			IpPool:  "240.0.0.0/12",
+			LruSize: 256,
+		}, {
+			IpPool:  "fddd:c5b4:ff5f:f4f0::/64",
+			LruSize: 256,
+		}},
+	},
+	)
+	common.Must(err)
+
+	err = fakeMulti.Start()
+
+	common.Must(err)
+
+	assert.Nil(t, err, "Should not throw error")
+	_ = fakeMulti
+
+	t.Run("checkInRange", func(t *testing.T) {
+		t.Run("ipv4", func(t *testing.T) {
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{240, 0, 0, 5}))
+			assert.True(t, inPool)
+		})
+		t.Run("ipv6", func(t *testing.T) {
+			ip, err := net.ResolveIPAddr("ip", "fddd:c5b4:ff5f:f4f0::5")
+			assert.Nil(t, err)
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
+			assert.True(t, inPool)
+		})
+		t.Run("ipv4_inverse", func(t *testing.T) {
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{241, 0, 0, 5}))
+			assert.False(t, inPool)
+		})
+		t.Run("ipv6_inverse", func(t *testing.T) {
+			ip, err := net.ResolveIPAddr("ip", "fcdd:c5b4:ff5f:f4f0::5")
+			assert.Nil(t, err)
+			inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
+			assert.False(t, inPool)
+		})
+	})
+
+	t.Run("allocateTwoAddressForTwoPool", func(t *testing.T) {
+		address := fakeMulti.GetFakeIPForDomain("fakednstest.example.com")
+		assert.Len(t, address, 2, "should be 2 address one for each pool")
+		t.Run("eachOfThemShouldResolve:0", func(t *testing.T) {
+			domain := fakeMulti.GetDomainFromFakeDNS(address[0])
+			assert.Equal(t, "fakednstest.example.com", domain)
+		})
+		t.Run("eachOfThemShouldResolve:1", func(t *testing.T) {
+			domain := fakeMulti.GetDomainFromFakeDNS(address[1])
+			assert.Equal(t, "fakednstest.example.com", domain)
+		})
+	})
+
+	t.Run("understandIPTypeSelector", func(t *testing.T) {
+		t.Run("ipv4", func(t *testing.T) {
+			address := fakeMulti.GetFakeIPForDomain3("fakednstestipv4.example.com", true, false)
+			assert.Len(t, address, 1, "should be 1 address")
+			assert.True(t, address[0].Family().IsIPv4())
+		})
+		t.Run("ipv6", func(t *testing.T) {
+			address := fakeMulti.GetFakeIPForDomain3("fakednstestipv6.example.com", false, true)
+			assert.Len(t, address, 1, "should be 1 address")
+			assert.True(t, address[0].Family().IsIPv6())
+		})
+		t.Run("ipv46", func(t *testing.T) {
+			address := fakeMulti.GetFakeIPForDomain3("fakednstestipv46.example.com", true, true)
+			assert.Len(t, address, 2, "should be 2 address")
+			assert.True(t, address[0].Family().IsIPv4())
+			assert.True(t, address[1].Family().IsIPv6())
+		})
+	})
+}

subproject/Xray-core-main/app/dns/hosts.go

@@ -0,0 +1,173 @@
+package dns
+
+import (
+	"context"
+	"runtime"
+	"strconv"
+
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/strmatcher"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+// StaticHosts represents static domain-ip mapping in DNS server.
+type StaticHosts struct {
+	ips      [][]net.Address
+	matchers strmatcher.IndexMatcher
+}
+
+// NewStaticHosts creates a new StaticHosts instance.
+func NewStaticHosts(hosts []*Config_HostMapping) (*StaticHosts, error) {
+	g := new(strmatcher.MatcherGroup)
+	sh := &StaticHosts{
+		ips:      make([][]net.Address, len(hosts)+16),
+		matchers: g,
+	}
+
+	defer runtime.GC()
+	for i, mapping := range hosts {
+		hosts[i] = nil
+		matcher, err := toStrMatcher(mapping.Type, mapping.Domain)
+		if err != nil {
+			errors.LogErrorInner(context.Background(), err, "failed to create domain matcher, ignore domain rule [type: ", mapping.Type, ", domain: ", mapping.Domain, "]")
+			continue
+		}
+		id := g.Add(matcher)
+		ips := make([]net.Address, 0, len(mapping.Ip)+1)
+		switch {
+		case len(mapping.ProxiedDomain) > 0:
+			if mapping.ProxiedDomain[0] == '#' {
+				rcode, err := strconv.Atoi(mapping.ProxiedDomain[1:])
+				if err != nil {
+					return nil, err
+				}
+				ips = append(ips, dns.RCodeError(rcode))
+			} else {
+				ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
+			}
+		case len(mapping.Ip) > 0:
+			for _, ip := range mapping.Ip {
+				addr := net.IPAddress(ip)
+				if addr == nil {
+					errors.LogError(context.Background(), "invalid IP address in static hosts: ", ip, ", ignore this ip for rule [type: ", mapping.Type, ", domain: ", mapping.Domain, "]")
+					continue
+				}
+				ips = append(ips, addr)
+			}
+			if len(ips) == 0 {
+				continue
+			}
+		}
+
+		sh.ips[id] = ips
+	}
+
+	return sh, nil
+}
+
+func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
+	filtered := make([]net.Address, 0, len(ips))
+	for _, ip := range ips {
+		if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
+			filtered = append(filtered, ip)
+		}
+	}
+	return filtered
+}
+
+func (h *StaticHosts) lookupInternal(domain string) ([]net.Address, error) {
+	ips := make([]net.Address, 0)
+	found := false
+	for _, id := range h.matchers.Match(domain) {
+		for _, v := range h.ips[id] {
+			if err, ok := v.(dns.RCodeError); ok {
+				if uint16(err) == 0 {
+					return nil, dns.ErrEmptyResponse
+				}
+				return nil, err
+			}
+		}
+		ips = append(ips, h.ips[id]...)
+		found = true
+	}
+	if !found {
+		return nil, nil
+	}
+	return ips, nil
+}
+
+func (h *StaticHosts) lookup(domain string, option dns.IPOption, maxDepth int) ([]net.Address, error) {
+	switch addrs, err := h.lookupInternal(domain); {
+	case err != nil:
+		return nil, err
+	case len(addrs) == 0: // Not recorded in static hosts, return nil
+		return addrs, nil
+	case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Try to unwrap domain
+		errors.LogDebug(context.Background(), "found replaced domain: ", domain, " -> ", addrs[0].Domain(), ". Try to unwrap it")
+		if maxDepth > 0 {
+			unwrapped, err := h.lookup(addrs[0].Domain(), option, maxDepth-1)
+			if err != nil {
+				return nil, err
+			}
+			if unwrapped != nil {
+				return unwrapped, nil
+			}
+		}
+		return addrs, nil
+	default: // IP record found, return a non-nil IP array
+		return filterIP(addrs, option), nil
+	}
+}
+
+// Lookup returns IP addresses or proxied domain for the given domain, if exists in this StaticHosts.
+func (h *StaticHosts) Lookup(domain string, option dns.IPOption) ([]net.Address, error) {
+	return h.lookup(domain, option, 5)
+}
+func NewStaticHostsFromCache(matcher strmatcher.IndexMatcher, hostIPs map[string][]string) (*StaticHosts, error) {
+	sh := &StaticHosts{
+		ips:      make([][]net.Address, matcher.Size()+1),
+		matchers: matcher,
+	}
+
+	order := hostIPs["_ORDER"]
+	var offset uint32
+
+	img, ok := matcher.(*strmatcher.IndexMatcherGroup)
+	if !ok {
+		// Single matcher (e.g. only manual or only one geosite)
+		if len(order) > 0 {
+			pattern := order[0]
+			ips := parseIPs(hostIPs[pattern])
+			for i := uint32(1); i <= matcher.Size(); i++ {
+				sh.ips[i] = ips
+			}
+		}
+		return sh, nil
+	}
+
+	for i, m := range img.Matchers {
+		if i < len(order) {
+			pattern := order[i]
+			ips := parseIPs(hostIPs[pattern])
+			for j := uint32(1); j <= m.Size(); j++ {
+				sh.ips[offset+j] = ips
+			}
+			offset += m.Size()
+		}
+	}
+	return sh, nil
+}
+
+func parseIPs(raw []string) []net.Address {
+	addrs := make([]net.Address, 0, len(raw))
+	for _, s := range raw {
+		if len(s) > 1 && s[0] == '#' {
+			rcode, _ := strconv.Atoi(s[1:])
+			addrs = append(addrs, dns.RCodeError(rcode))
+		} else {
+			addrs = append(addrs, net.ParseAddress(s))
+		}
+	}
+	return addrs
+}

subproject/Xray-core-main/app/dns/hosts_test.go

@@ -0,0 +1,188 @@
+package dns_test
+
+import (
+	"bytes"
+	"testing"
+
+	"github.com/google/go-cmp/cmp"
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/app/router"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+func TestStaticHosts(t *testing.T) {
+	pb := []*Config_HostMapping{
+		{
+			Type:          DomainMatchingType_Subdomain,
+			Domain:        "lan",
+			ProxiedDomain: "#3",
+		},
+		{
+			Type:   DomainMatchingType_Full,
+			Domain: "example.com",
+			Ip: [][]byte{
+				{1, 1, 1, 1},
+			},
+		},
+		{
+			Type:   DomainMatchingType_Full,
+			Domain: "proxy.xray.com",
+			Ip: [][]byte{
+				{1, 2, 3, 4},
+				{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
+			},
+			ProxiedDomain: "another-proxy.xray.com",
+		},
+		{
+			Type:          DomainMatchingType_Full,
+			Domain:        "proxy2.xray.com",
+			ProxiedDomain: "proxy.xray.com",
+		},
+		{
+			Type:   DomainMatchingType_Subdomain,
+			Domain: "example.cn",
+			Ip: [][]byte{
+				{2, 2, 2, 2},
+			},
+		},
+		{
+			Type:   DomainMatchingType_Subdomain,
+			Domain: "baidu.com",
+			Ip: [][]byte{
+				{127, 0, 0, 1},
+				{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
+			},
+		},
+	}
+
+	hosts, err := NewStaticHosts(pb)
+	common.Must(err)
+
+	{
+		_, err := hosts.Lookup("example.com.lan", dns.IPOption{})
+		if dns.RCodeFromError(err) != 3 {
+			t.Error(err)
+		}
+	}
+
+	{
+		ips, _ := hosts.Lookup("example.com", dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+		})
+		if len(ips) != 1 {
+			t.Error("expect 1 IP, but got ", len(ips))
+		}
+		if diff := cmp.Diff([]byte(ips[0].IP()), []byte{1, 1, 1, 1}); diff != "" {
+			t.Error(diff)
+		}
+	}
+
+	{
+		domain, _ := hosts.Lookup("proxy.xray.com", dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+		})
+		if len(domain) != 1 {
+			t.Error("expect 1 domain, but got ", len(domain))
+		}
+		if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
+			t.Error(diff)
+		}
+	}
+
+	{
+		domain, _ := hosts.Lookup("proxy2.xray.com", dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: false,
+		})
+		if len(domain) != 1 {
+			t.Error("expect 1 domain, but got ", len(domain))
+		}
+		if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
+			t.Error(diff)
+		}
+	}
+
+	{
+		ips, _ := hosts.Lookup("www.example.cn", dns.IPOption{
+			IPv4Enable: true,
+			IPv6Enable: true,
+		})
+		if len(ips) != 1 {
+			t.Error("expect 1 IP, but got ", len(ips))
+		}
+		if diff := cmp.Diff([]byte(ips[0].IP()), []byte{2, 2, 2, 2}); diff != "" {
+			t.Error(diff)
+		}
+	}
+
+	{
+		ips, _ := hosts.Lookup("baidu.com", dns.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: true,
+		})
+		if len(ips) != 1 {
+			t.Error("expect 1 IP, but got ", len(ips))
+		}
+		if diff := cmp.Diff([]byte(ips[0].IP()), []byte(net.LocalHostIPv6.IP())); diff != "" {
+			t.Error(diff)
+		}
+	}
+}
+func TestStaticHostsFromCache(t *testing.T) {
+	sites := []*router.GeoSite{
+		{
+			CountryCode: "cloudflare-dns.com",
+			Domain: []*router.Domain{
+				{Type: router.Domain_Full, Value: "example.com"},
+			},
+		},
+		{
+			CountryCode: "geosite:cn",
+			Domain: []*router.Domain{
+				{Type: router.Domain_Domain, Value: "baidu.cn"},
+			},
+		},
+	}
+	deps := map[string][]string{
+		"HOSTS": {"cloudflare-dns.com", "geosite:cn"},
+	}
+	hostIPs := map[string][]string{
+		"cloudflare-dns.com": {"1.1.1.1"},
+		"geosite:cn":         {"2.2.2.2"},
+		"_ORDER":             {"cloudflare-dns.com", "geosite:cn"},
+	}
+
+	var buf bytes.Buffer
+	err := router.SerializeGeoSiteList(sites, deps, hostIPs, &buf)
+	common.Must(err)
+
+	// Load matcher
+	m, err := router.LoadGeoSiteMatcher(bytes.NewReader(buf.Bytes()), "HOSTS")
+	common.Must(err)
+
+	// Load hostIPs
+	f := bytes.NewReader(buf.Bytes())
+	hips, err := router.LoadGeoSiteHosts(f)
+	common.Must(err)
+
+	hosts, err := NewStaticHostsFromCache(m, hips)
+	common.Must(err)
+
+	{
+		ips, _ := hosts.Lookup("example.com", dns.IPOption{IPv4Enable: true})
+		if len(ips) != 1 || ips[0].String() != "1.1.1.1" {
+			t.Error("failed to lookup example.com from cache")
+		}
+	}
+
+	{
+		ips, _ := hosts.Lookup("baidu.cn", dns.IPOption{IPv4Enable: true})
+		if len(ips) != 1 || ips[0].String() != "2.2.2.2" {
+			t.Error("failed to lookup baidu.cn from cache deps")
+		}
+	}
+}

subproject/Xray-core-main/app/dns/nameserver.go

@@ -0,0 +1,342 @@
+package dns
+
+import (
+	"context"
+	"net/url"
+	"runtime"
+	"strings"
+	"time"
+
+	"github.com/xtls/xray-core/app/router"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/platform"
+	"github.com/xtls/xray-core/common/platform/filesystem"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/common/strmatcher"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/routing"
+)
+
+type mphMatcherWrapper struct {
+	m strmatcher.IndexMatcher
+}
+
+func (w *mphMatcherWrapper) Match(s string) bool {
+	return w.m.Match(s) != nil
+}
+
+func (w *mphMatcherWrapper) String() string {
+	return "mph-matcher"
+}
+
+// Server is the interface for Name Server.
+type Server interface {
+	// Name of the Client.
+	Name() string
+
+	IsDisableCache() bool
+
+	// QueryIP sends IP queries to its configured server.
+	QueryIP(ctx context.Context, domain string, option dns.IPOption) ([]net.IP, uint32, error)
+}
+
+// Client is the interface for DNS client.
+type Client struct {
+	server        Server
+	skipFallback  bool
+	domains       []string
+	expectedIPs   router.GeoIPMatcher
+	unexpectedIPs router.GeoIPMatcher
+	actPrior      bool
+	actUnprior    bool
+	tag           string
+	timeoutMs     time.Duration
+	finalQuery    bool
+	ipOption      *dns.IPOption
+	checkSystem   bool
+	policyID      uint32
+}
+
+// NewServer creates a name server object according to the network destination url.
+func NewServer(ctx context.Context, dest net.Destination, dispatcher routing.Dispatcher, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (Server, error) {
+	if address := dest.Address; address.Family().IsDomain() {
+		u, err := url.Parse(address.Domain())
+		if err != nil {
+			return nil, err
+		}
+		switch {
+		case strings.EqualFold(u.String(), "localhost"):
+			return NewLocalNameServer(), nil
+		case strings.EqualFold(u.Scheme, "https"): // DNS-over-HTTPS Remote mode
+			return NewDoHNameServer(u, dispatcher, false, disableCache, serveStale, serveExpiredTTL, clientIP), nil
+		case strings.EqualFold(u.Scheme, "h2c"): // DNS-over-HTTPS h2c Remote mode
+			return NewDoHNameServer(u, dispatcher, true, disableCache, serveStale, serveExpiredTTL, clientIP), nil
+		case strings.EqualFold(u.Scheme, "https+local"): // DNS-over-HTTPS Local mode
+			return NewDoHNameServer(u, nil, false, disableCache, serveStale, serveExpiredTTL, clientIP), nil
+		case strings.EqualFold(u.Scheme, "h2c+local"): // DNS-over-HTTPS h2c Local mode
+			return NewDoHNameServer(u, nil, true, disableCache, serveStale, serveExpiredTTL, clientIP), nil
+		case strings.EqualFold(u.Scheme, "quic+local"): // DNS-over-QUIC Local mode
+			return NewQUICNameServer(u, disableCache, serveStale, serveExpiredTTL, clientIP)
+		case strings.EqualFold(u.Scheme, "tcp"): // DNS-over-TCP Remote mode
+			return NewTCPNameServer(u, dispatcher, disableCache, serveStale, serveExpiredTTL, clientIP)
+		case strings.EqualFold(u.Scheme, "tcp+local"): // DNS-over-TCP Local mode
+			return NewTCPLocalNameServer(u, disableCache, serveStale, serveExpiredTTL, clientIP)
+		case strings.EqualFold(u.String(), "fakedns"):
+			var fd dns.FakeDNSEngine
+			err = core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
+				fd = fdns
+			})
+			if err != nil {
+				return nil, err
+			}
+			return NewFakeDNSServer(fd), nil
+		}
+	}
+	if dest.Network == net.Network_Unknown {
+		dest.Network = net.Network_UDP
+	}
+	if dest.Network == net.Network_UDP { // UDP classic DNS mode
+		return NewClassicNameServer(dest, dispatcher, disableCache, serveStale, serveExpiredTTL, clientIP), nil
+	}
+	return nil, errors.New("No available name server could be created from ", dest).AtWarning()
+}
+
+// NewClient creates a DNS client managing a name server with client IP, domain rules and expected IPs.
+func NewClient(
+	ctx context.Context,
+	ns *NameServer,
+	clientIP net.IP,
+	disableCache bool, serveStale bool, serveExpiredTTL uint32,
+	tag string,
+	ipOption dns.IPOption,
+	matcherInfos *[]*DomainMatcherInfo,
+	updateDomainRule func(strmatcher.Matcher, int, []*DomainMatcherInfo),
+) (*Client, error) {
+	client := &Client{}
+
+	err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
+		// Create a new server for each client for now
+		server, err := NewServer(ctx, ns.Address.AsDestination(), dispatcher, disableCache, serveStale, serveExpiredTTL, clientIP)
+		if err != nil {
+			return errors.New("failed to create nameserver").Base(err).AtWarning()
+		}
+
+		// Prioritize local domains with specific TLDs or those without any dot for the local DNS
+		if _, isLocalDNS := server.(*LocalNameServer); isLocalDNS {
+			ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
+			ns.OriginalRules = append(ns.OriginalRules, localTLDsAndDotlessDomainsRule)
+			// The following lines is a solution to avoid core panics（rule index out of range） when setting `localhost` DNS client in config.
+			// Because the `localhost` DNS client will append len(localTLDsAndDotlessDomains) rules into matcherInfos to match `geosite:private` default rule.
+			// But `matcherInfos` has no enough length to add rules, which leads to core panics (rule index out of range).
+			// To avoid this, the length of `matcherInfos` must be equal to the expected, so manually append it with Golang default zero value first for later modification.
+			// Related issues:
+			// https://github.com/v2fly/v2ray-core/issues/529
+			// https://github.com/v2fly/v2ray-core/issues/719
+			for i := 0; i < len(localTLDsAndDotlessDomains); i++ {
+				*matcherInfos = append(*matcherInfos, &DomainMatcherInfo{
+					clientIdx:     uint16(0),
+					domainRuleIdx: uint16(0),
+				})
+			}
+		}
+
+		// Establish domain rules
+		var rules []string
+		ruleCurr := 0
+		ruleIter := 0
+
+		// Check if domain matcher cache is provided via environment
+		domainMatcherPath := platform.NewEnvFlag(platform.MphCachePath).GetValue(func() string { return "" })
+		var mphLoaded bool
+
+		if domainMatcherPath != "" && ns.Tag != "" {
+			f, err := filesystem.NewFileReader(domainMatcherPath)
+			if err == nil {
+				defer f.Close()
+				g, err := router.LoadGeoSiteMatcher(f, ns.Tag)
+				if err == nil {
+					errors.LogDebug(ctx, "MphDomainMatcher loaded from cache for ", ns.Tag, " dns tag)")
+					updateDomainRule(&mphMatcherWrapper{m: g}, 0, *matcherInfos)
+					rules = append(rules, "[MPH Cache]")
+					mphLoaded = true
+				}
+			}
+		}
+
+		if !mphLoaded {
+			for i, domain := range ns.PrioritizedDomain {
+				ns.PrioritizedDomain[i] = nil
+				domainRule, err := toStrMatcher(domain.Type, domain.Domain)
+				if err != nil {
+					errors.LogErrorInner(ctx, err, "failed to create domain matcher, ignore domain rule [type: ", domain.Type, ", domain: ", domain.Domain, "]")
+					domainRule, _ = toStrMatcher(DomainMatchingType_Full, "hack.fix.index.for.illegal.domain.rule")
+				}
+				originalRuleIdx := ruleCurr
+				if ruleCurr < len(ns.OriginalRules) {
+					rule := ns.OriginalRules[ruleCurr]
+					if ruleCurr >= len(rules) {
+						rules = append(rules, rule.Rule)
+					}
+					ruleIter++
+					if ruleIter >= int(rule.Size) {
+						ruleIter = 0
+						ruleCurr++
+					}
+				} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
+					rules = append(rules, domainRule.String())
+					ruleCurr++
+				}
+				updateDomainRule(domainRule, originalRuleIdx, *matcherInfos)
+			}
+		}
+		ns.PrioritizedDomain = nil
+		runtime.GC()
+
+		// Establish expected IPs
+		var expectedMatcher router.GeoIPMatcher
+		if len(ns.ExpectedGeoip) > 0 {
+			expectedMatcher, err = router.BuildOptimizedGeoIPMatcher(ns.ExpectedGeoip...)
+			if err != nil {
+				return errors.New("failed to create expected ip matcher").Base(err).AtWarning()
+			}
+			ns.ExpectedGeoip = nil
+			runtime.GC()
+		}
+
+		// Establish unexpected IPs
+		var unexpectedMatcher router.GeoIPMatcher
+		if len(ns.UnexpectedGeoip) > 0 {
+			unexpectedMatcher, err = router.BuildOptimizedGeoIPMatcher(ns.UnexpectedGeoip...)
+			if err != nil {
+				return errors.New("failed to create unexpected ip matcher").Base(err).AtWarning()
+			}
+			ns.UnexpectedGeoip = nil
+			runtime.GC()
+		}
+
+		if len(clientIP) > 0 {
+			switch ns.Address.Address.GetAddress().(type) {
+			case *net.IPOrDomain_Domain:
+				errors.LogInfo(ctx, "DNS: client ", ns.Address.Address.GetDomain(), " uses clientIP ", clientIP.String())
+			case *net.IPOrDomain_Ip:
+				errors.LogInfo(ctx, "DNS: client ", net.IP(ns.Address.Address.GetIp()), " uses clientIP ", clientIP.String())
+			}
+		}
+
+		var timeoutMs = 4000 * time.Millisecond
+		if ns.TimeoutMs > 0 {
+			timeoutMs = time.Duration(ns.TimeoutMs) * time.Millisecond
+		}
+
+		checkSystem := ns.QueryStrategy == QueryStrategy_USE_SYS
+
+		client.server = server
+		client.skipFallback = ns.SkipFallback
+		client.domains = rules
+		client.expectedIPs = expectedMatcher
+		client.unexpectedIPs = unexpectedMatcher
+		client.actPrior = ns.ActPrior
+		client.actUnprior = ns.ActUnprior
+		client.tag = tag
+		client.timeoutMs = timeoutMs
+		client.finalQuery = ns.FinalQuery
+		client.ipOption = &ipOption
+		client.checkSystem = checkSystem
+		client.policyID = ns.PolicyID
+		return nil
+	})
+	return client, err
+}
+
+// Name returns the server name the client manages.
+func (c *Client) Name() string {
+	return c.server.Name()
+}
+
+// QueryIP sends DNS query to the name server with the client's IP.
+func (c *Client) QueryIP(ctx context.Context, domain string, option dns.IPOption) ([]net.IP, uint32, error) {
+	if c.checkSystem {
+		supportIPv4, supportIPv6 := checkRoutes()
+		option.IPv4Enable = option.IPv4Enable && supportIPv4
+		option.IPv6Enable = option.IPv6Enable && supportIPv6
+	} else {
+		option.IPv4Enable = option.IPv4Enable && c.ipOption.IPv4Enable
+		option.IPv6Enable = option.IPv6Enable && c.ipOption.IPv6Enable
+	}
+
+	if !option.IPv4Enable && !option.IPv6Enable {
+		return nil, 0, dns.ErrEmptyResponse
+	}
+
+	ctx, cancel := context.WithTimeout(ctx, c.timeoutMs)
+	ctx = session.ContextWithInbound(ctx, &session.Inbound{Tag: c.tag})
+	ips, ttl, err := c.server.QueryIP(ctx, domain, option)
+	cancel()
+
+	if err != nil {
+		return nil, 0, err
+	}
+
+	if len(ips) == 0 {
+		return nil, 0, dns.ErrEmptyResponse
+	}
+
+	if c.expectedIPs != nil && !c.actPrior {
+		ips, _ = c.expectedIPs.FilterIPs(ips)
+		errors.LogDebug(context.Background(), "domain ", domain, " expectedIPs ", ips, " matched at server ", c.Name())
+		if len(ips) == 0 {
+			return nil, 0, dns.ErrEmptyResponse
+		}
+	}
+
+	if c.unexpectedIPs != nil && !c.actUnprior {
+		_, ips = c.unexpectedIPs.FilterIPs(ips)
+		errors.LogDebug(context.Background(), "domain ", domain, " unexpectedIPs ", ips, " matched at server ", c.Name())
+		if len(ips) == 0 {
+			return nil, 0, dns.ErrEmptyResponse
+		}
+	}
+
+	if c.expectedIPs != nil && c.actPrior {
+		ipsNew, _ := c.expectedIPs.FilterIPs(ips)
+		if len(ipsNew) > 0 {
+			ips = ipsNew
+			errors.LogDebug(context.Background(), "domain ", domain, " priorIPs ", ips, " matched at server ", c.Name())
+		}
+	}
+
+	if c.unexpectedIPs != nil && c.actUnprior {
+		_, ipsNew := c.unexpectedIPs.FilterIPs(ips)
+		if len(ipsNew) > 0 {
+			ips = ipsNew
+			errors.LogDebug(context.Background(), "domain ", domain, " unpriorIPs ", ips, " matched at server ", c.Name())
+		}
+	}
+
+	return ips, ttl, nil
+}
+
+func ResolveIpOptionOverride(queryStrategy QueryStrategy, ipOption dns.IPOption) dns.IPOption {
+	switch queryStrategy {
+	case QueryStrategy_USE_IP:
+		return ipOption
+	case QueryStrategy_USE_SYS:
+		return ipOption
+	case QueryStrategy_USE_IP4:
+		return dns.IPOption{
+			IPv4Enable: ipOption.IPv4Enable,
+			IPv6Enable: false,
+			FakeEnable: false,
+		}
+	case QueryStrategy_USE_IP6:
+		return dns.IPOption{
+			IPv4Enable: false,
+			IPv6Enable: ipOption.IPv6Enable,
+			FakeEnable: false,
+		}
+	default:
+		return ipOption
+	}
+}

subproject/Xray-core-main/app/dns/nameserver_cached.go

@@ -0,0 +1,173 @@
+package dns
+
+import (
+	"context"
+	go_errors "errors"
+	"time"
+
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/signal/pubsub"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+type CachedNameserver interface {
+	getCacheController() *CacheController
+
+	sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns.IPOption)
+}
+
+// queryIP is called from dns.Server->queryIPTimeout
+func queryIP(ctx context.Context, s CachedNameserver, domain string, option dns.IPOption) ([]net.IP, uint32, error) {
+	fqdn := Fqdn(domain)
+
+	cache := s.getCacheController()
+	if !cache.disableCache {
+		if rec := cache.findRecords(fqdn); rec != nil {
+			ips, ttl, err := merge(option, rec.A, rec.AAAA)
+			if !go_errors.Is(err, errRecordNotFound) {
+				if ttl > 0 {
+					errors.LogDebugInner(ctx, err, cache.name, " cache HIT ", fqdn, " -> ", ips)
+					log.Record(&log.DNSLog{Server: cache.name, Domain: fqdn, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
+					return ips, uint32(ttl), err
+				}
+				if cache.serveStale && (cache.serveExpiredTTL == 0 || cache.serveExpiredTTL < ttl) {
+					errors.LogDebugInner(ctx, err, cache.name, " cache OPTIMISTE ", fqdn, " -> ", ips)
+					log.Record(&log.DNSLog{Server: cache.name, Domain: fqdn, Result: ips, Status: log.DNSCacheOptimiste, Elapsed: 0, Error: err})
+					go pull(ctx, s, fqdn, option)
+					return ips, 1, err
+				}
+			}
+		}
+	} else {
+		errors.LogDebug(ctx, "DNS cache is disabled. Querying IP for ", fqdn, " at ", cache.name)
+	}
+
+	return fetch(ctx, s, fqdn, option)
+}
+
+func pull(ctx context.Context, s CachedNameserver, fqdn string, option dns.IPOption) {
+	nctx, cancel := context.WithTimeout(context.WithoutCancel(ctx), 8*time.Second)
+	defer cancel()
+
+	fetch(nctx, s, fqdn, option)
+}
+
+func fetch(ctx context.Context, s CachedNameserver, fqdn string, option dns.IPOption) ([]net.IP, uint32, error) {
+	key := fqdn
+	switch {
+	case option.IPv4Enable && option.IPv6Enable:
+		key = key + "46"
+	case option.IPv4Enable:
+		key = key + "4"
+	case option.IPv6Enable:
+		key = key + "6"
+	}
+
+	v, _, _ := s.getCacheController().requestGroup.Do(key, func() (any, error) {
+		return doFetch(ctx, s, fqdn, option), nil
+	})
+	ret := v.(result)
+
+	return ret.ips, ret.ttl, ret.error
+}
+
+type result struct {
+	ips []net.IP
+	ttl uint32
+	error
+}
+
+func doFetch(ctx context.Context, s CachedNameserver, fqdn string, option dns.IPOption) result {
+	sub4, sub6 := s.getCacheController().registerSubscribers(fqdn, option)
+	defer closeSubscribers(sub4, sub6)
+
+	noResponseErrCh := make(chan error, 2)
+	onEvent := func(sub *pubsub.Subscriber) (*IPRecord, error) {
+		if sub == nil {
+			return nil, nil
+		}
+		select {
+		case <-ctx.Done():
+			return nil, ctx.Err()
+		case err := <-noResponseErrCh:
+			return nil, err
+		case msg := <-sub.Wait():
+			sub.Close()
+			return msg.(*IPRecord), nil // should panic
+		}
+	}
+
+	start := time.Now()
+	s.sendQuery(ctx, noResponseErrCh, fqdn, option)
+
+	rec4, err4 := onEvent(sub4)
+	rec6, err6 := onEvent(sub6)
+
+	var errs []error
+	if err4 != nil {
+		errs = append(errs, err4)
+	}
+	if err6 != nil {
+		errs = append(errs, err6)
+	}
+
+	ips, ttl, err := merge(option, rec4, rec6, errs...)
+	var rTTL uint32
+	if ttl > 0 {
+		rTTL = uint32(ttl)
+	} else if ttl == 0 && go_errors.Is(err, errRecordNotFound) {
+		rTTL = 0
+	} else { // edge case: where a fast rep's ttl expires during the rtt of a slower, parallel query
+		rTTL = 1
+	}
+
+	log.Record(&log.DNSLog{Server: s.getCacheController().name, Domain: fqdn, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
+	return result{ips, rTTL, err}
+}
+
+func merge(option dns.IPOption, rec4 *IPRecord, rec6 *IPRecord, errs ...error) ([]net.IP, int32, error) {
+	var allIPs []net.IP
+	var rTTL int32 = dns.DefaultTTL
+
+	mergeReq := option.IPv4Enable && option.IPv6Enable
+
+	if option.IPv4Enable {
+		ips, ttl, err := rec4.getIPs() // it's safe
+		if !mergeReq || go_errors.Is(err, errRecordNotFound) {
+			return ips, ttl, err
+		}
+		if ttl < rTTL {
+			rTTL = ttl
+		}
+		if len(ips) > 0 {
+			allIPs = append(allIPs, ips...)
+		} else {
+			errs = append(errs, err)
+		}
+	}
+
+	if option.IPv6Enable {
+		ips, ttl, err := rec6.getIPs() // it's safe
+		if !mergeReq || go_errors.Is(err, errRecordNotFound) {
+			return ips, ttl, err
+		}
+		if ttl < rTTL {
+			rTTL = ttl
+		}
+		if len(ips) > 0 {
+			allIPs = append(allIPs, ips...)
+		} else {
+			errs = append(errs, err)
+		}
+	}
+
+	if len(allIPs) > 0 {
+		return allIPs, rTTL, nil
+	}
+	if len(errs) == 2 && go_errors.Is(errs[0], errs[1]) {
+		return nil, rTTL, errs[0]
+	}
+	return nil, rTTL, errors.Combine(errs...)
+}

subproject/Xray-core-main/app/dns/nameserver_doh.go

@@ -0,0 +1,239 @@
+package dns
+
+import (
+	"bytes"
+	"context"
+	"crypto/tls"
+	"fmt"
+	"io"
+	"net/http"
+	"net/url"
+	"time"
+
+	utls "github.com/refraction-networking/utls"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/crypto"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
+	"github.com/xtls/xray-core/common/protocol/dns"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/common/utils"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/routing"
+	"github.com/xtls/xray-core/transport/internet"
+	"golang.org/x/net/http2"
+)
+
+// DoHNameServer implemented DNS over HTTPS (RFC8484) Wire Format,
+// which is compatible with traditional dns over udp(RFC1035),
+// thus most of the DOH implementation is copied from udpns.go
+type DoHNameServer struct {
+	cacheController *CacheController
+	httpClient      *http.Client
+	dohURL          string
+	clientIP        net.IP
+}
+
+// NewDoHNameServer creates DOH/DOHL client object for remote/local resolving.
+func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, h2c bool, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) *DoHNameServer {
+	url.Scheme = "https"
+	mode := "DOH"
+	if dispatcher == nil {
+		mode = "DOHL"
+	}
+	errors.LogInfo(context.Background(), "DNS: created ", mode, " client for ", url.String(), ", with h2c ", h2c)
+	s := &DoHNameServer{
+		cacheController: NewCacheController(mode+"//"+url.Host, disableCache, serveStale, serveExpiredTTL),
+		dohURL:          url.String(),
+		clientIP:        clientIP,
+	}
+	s.httpClient = &http.Client{
+		Transport: &http2.Transport{
+			IdleConnTimeout: net.ConnIdleTimeout,
+			ReadIdleTimeout: net.ChromeH2KeepAlivePeriod,
+			DialTLSContext: func(ctx context.Context, network, addr string, cfg *tls.Config) (net.Conn, error) {
+				dest, err := net.ParseDestination(network + ":" + addr)
+				if err != nil {
+					return nil, err
+				}
+				var conn net.Conn
+				if dispatcher != nil {
+					dnsCtx := toDnsContext(ctx, s.dohURL)
+					if h2c {
+						dnsCtx = session.ContextWithMitmAlpn11(dnsCtx, false) // for insurance
+						dnsCtx = session.ContextWithMitmServerName(dnsCtx, url.Hostname())
+					}
+					link, err := dispatcher.Dispatch(dnsCtx, dest)
+					select {
+					case <-ctx.Done():
+						return nil, ctx.Err()
+					default:
+					}
+					if err != nil {
+						return nil, err
+					}
+					cc := common.ChainedClosable{}
+					if cw, ok := link.Writer.(common.Closable); ok {
+						cc = append(cc, cw)
+					}
+					if cr, ok := link.Reader.(common.Closable); ok {
+						cc = append(cc, cr)
+					}
+					conn = cnc.NewConnection(
+						cnc.ConnectionInputMulti(link.Writer),
+						cnc.ConnectionOutputMulti(link.Reader),
+						cnc.ConnectionOnClose(cc),
+					)
+				} else {
+					log.Record(&log.AccessMessage{
+						From:   "DNS",
+						To:     s.dohURL,
+						Status: log.AccessAccepted,
+						Detour: "local",
+					})
+					conn, err = internet.DialSystem(ctx, dest, nil)
+					if err != nil {
+						return nil, err
+					}
+				}
+				if !h2c {
+					conn = utls.UClient(conn, &utls.Config{ServerName: url.Hostname()}, utls.HelloChrome_Auto)
+					if err := conn.(*utls.UConn).HandshakeContext(ctx); err != nil {
+						return nil, err
+					}
+				}
+				return conn, nil
+			},
+		},
+	}
+	return s
+}
+
+// Name implements Server.
+func (s *DoHNameServer) Name() string {
+	return s.cacheController.name
+}
+
+// IsDisableCache implements Server.
+func (s *DoHNameServer) IsDisableCache() bool {
+	return s.cacheController.disableCache
+}
+
+func (s *DoHNameServer) newReqID() uint16 {
+	return 0
+}
+
+// getCacheController implements CachedNameserver.
+func (s *DoHNameServer) getCacheController() *CacheController {
+	return s.cacheController
+}
+
+// sendQuery implements CachedNameserver.
+func (s *DoHNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
+	errors.LogInfo(ctx, s.Name(), " querying: ", fqdn)
+
+	if s.Name()+"." == "DOH//"+fqdn {
+		errors.LogError(ctx, s.Name(), " tries to resolve itself! Use IP or set \"hosts\" instead")
+		if noResponseErrCh != nil {
+			noResponseErrCh <- errors.New("tries to resolve itself!", s.Name())
+		}
+		return
+	}
+
+	// As we don't want our traffic pattern looks like DoH, we use Random-Length Padding instead of Block-Length Padding recommended in RFC 8467
+	// Although DoH server like 1.1.1.1 will pad the response to Block-Length 468, at least it is better than no padding for response at all
+	reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, int(crypto.RandBetween(100, 300))))
+
+	var deadline time.Time
+	if d, ok := ctx.Deadline(); ok {
+		deadline = d
+	} else {
+		deadline = time.Now().Add(time.Second * 5)
+	}
+
+	for _, req := range reqs {
+		go func(r *dnsRequest) {
+			// generate new context for each req, using same context
+			// may cause reqs all aborted if any one encounter an error
+			dnsCtx := ctx
+
+			// reserve internal dns server requested Inbound
+			if inbound := session.InboundFromContext(ctx); inbound != nil {
+				dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
+			}
+
+			dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
+				Protocol:       "https",
+				SkipDNSResolve: true,
+			})
+
+			// forced to use mux for DOH
+			// dnsCtx = session.ContextWithMuxPreferred(dnsCtx, true)
+
+			var cancel context.CancelFunc
+			dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
+			defer cancel()
+
+			b, err := dns.PackMessage(r.msg)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to pack dns query for ", fqdn)
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			resp, err := s.dohHTTPSContext(dnsCtx, b.Bytes())
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to retrieve response for ", fqdn)
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			rec, err := parseResponse(resp)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to handle DOH response for ", fqdn)
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			s.cacheController.updateRecord(r, rec)
+		}(req)
+	}
+}
+
+func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte, error) {
+	body := bytes.NewBuffer(b)
+	req, err := http.NewRequest("POST", s.dohURL, body)
+	if err != nil {
+		return nil, err
+	}
+
+	req.Header.Add("Accept", "application/dns-message")
+	req.Header.Add("Content-Type", "application/dns-message")
+	utils.TryDefaultHeadersWith(req.Header, "fetch")
+	req.Header.Set("X-Padding", utils.H2Base62Pad(crypto.RandBetween(100, 1000)))
+
+	hc := s.httpClient
+
+	resp, err := hc.Do(req.WithContext(ctx))
+	if err != nil {
+		return nil, err
+	}
+
+	defer resp.Body.Close()
+	if resp.StatusCode != http.StatusOK {
+		io.Copy(io.Discard, resp.Body) // flush resp.Body so that the conn is reusable
+		return nil, fmt.Errorf("DOH server returned code %d", resp.StatusCode)
+	}
+
+	return io.ReadAll(resp.Body)
+}
+
+// QueryIP implements Server.
+func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
+	return queryIP(ctx, s, domain, option)
+}

subproject/Xray-core-main/app/dns/nameserver_doh_test.go

@@ -0,0 +1,105 @@
+package dns_test
+
+import (
+	"context"
+	"net/url"
+	"testing"
+	"time"
+
+	"github.com/google/go-cmp/cmp"
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+)
+
+func TestDOHNameServer(t *testing.T) {
+	url, err := url.Parse("https+local://1.1.1.1/dns-query")
+	common.Must(err)
+
+	s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+}
+
+func TestDOHNameServerWithCache(t *testing.T) {
+	url, err := url.Parse("https+local://1.1.1.1/dns-query")
+	common.Must(err)
+
+	s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips2, _, err := s.QueryIP(ctx2, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if r := cmp.Diff(ips2, ips); r != "" {
+		t.Fatal(r)
+	}
+}
+
+func TestDOHNameServerWithIPv4Override(t *testing.T) {
+	url, err := url.Parse("https+local://1.1.1.1/dns-query")
+	common.Must(err)
+
+	s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: false,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	for _, ip := range ips {
+		if len(ip) != net.IPv4len {
+			t.Error("expect only IPv4 response from DNS query")
+		}
+	}
+}
+
+func TestDOHNameServerWithIPv6Override(t *testing.T) {
+	url, err := url.Parse("https+local://1.1.1.1/dns-query")
+	common.Must(err)
+
+	s := NewDoHNameServer(url, nil, false, false, false, 0, net.IP(nil))
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: false,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	for _, ip := range ips {
+		if len(ip) != net.IPv6len {
+			t.Error("expect only IPv6 response from DNS query")
+		}
+	}
+}

subproject/Xray-core-main/app/dns/nameserver_fakedns.go

@@ -0,0 +1,51 @@
+package dns
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+type FakeDNSServer struct {
+	fakeDNSEngine dns.FakeDNSEngine
+}
+
+func NewFakeDNSServer(fd dns.FakeDNSEngine) *FakeDNSServer {
+	return &FakeDNSServer{fakeDNSEngine: fd}
+}
+
+func (FakeDNSServer) Name() string {
+	return "FakeDNS"
+}
+
+// IsDisableCache implements Server.
+func (s *FakeDNSServer) IsDisableCache() bool {
+	return true
+}
+
+func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, opt dns.IPOption) ([]net.IP, uint32, error) {
+	if f.fakeDNSEngine == nil {
+		return nil, 0, errors.New("Unable to locate a fake DNS Engine").AtError()
+	}
+
+	var ips []net.Address
+	if fkr0, ok := f.fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
+		ips = fkr0.GetFakeIPForDomain3(domain, opt.IPv4Enable, opt.IPv6Enable)
+	} else {
+		ips = f.fakeDNSEngine.GetFakeIPForDomain(domain)
+	}
+
+	netIP, err := toNetIP(ips)
+	if err != nil {
+		return nil, 0, errors.New("Unable to convert IP to net ip").Base(err).AtError()
+	}
+
+	errors.LogInfo(ctx, f.Name(), " got answer: ", domain, " -> ", ips)
+
+	if len(netIP) > 0 {
+		return netIP, 1, nil // fakeIP ttl is 1
+	}
+	return nil, 0, dns.ErrEmptyResponse
+}

subproject/Xray-core-main/app/dns/nameserver_local.go

@@ -0,0 +1,54 @@
+package dns
+
+import (
+	"context"
+	"time"
+
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/dns/localdns"
+)
+
+// LocalNameServer is an wrapper over local DNS feature.
+type LocalNameServer struct {
+	client *localdns.Client
+}
+
+// QueryIP implements Server.
+func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option dns.IPOption) (ips []net.IP, ttl uint32, err error) {
+
+	start := time.Now()
+	ips, ttl, err = s.client.LookupIP(domain, option)
+
+	if len(ips) > 0 {
+		errors.LogInfo(ctx, "Localhost got answer: ", domain, " -> ", ips)
+		log.Record(&log.DNSLog{Server: s.Name(), Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
+	}
+
+	return
+}
+
+// Name implements Server.
+func (s *LocalNameServer) Name() string {
+	return "localhost"
+}
+
+// IsDisableCache implements Server.
+func (s *LocalNameServer) IsDisableCache() bool {
+	return true
+}
+
+// NewLocalNameServer creates localdns server object for directly lookup in system DNS.
+func NewLocalNameServer() *LocalNameServer {
+	errors.LogInfo(context.Background(), "DNS: created localhost client")
+	return &LocalNameServer{
+		client: localdns.New(),
+	}
+}
+
+// NewLocalDNSClient creates localdns client object for directly lookup in system DNS.
+func NewLocalDNSClient(ipOption dns.IPOption) *Client {
+	return &Client{server: NewLocalNameServer(), ipOption: &ipOption}
+}

subproject/Xray-core-main/app/dns/nameserver_local_test.go

@@ -0,0 +1,26 @@
+package dns_test
+
+import (
+	"context"
+	"testing"
+	"time"
+
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+func TestLocalNameServer(t *testing.T) {
+	s := NewLocalNameServer()
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+		FakeEnable: false,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+}

subproject/Xray-core-main/app/dns/nameserver_quic.go

@@ -0,0 +1,276 @@
+package dns
+
+import (
+	"bytes"
+	"context"
+	"encoding/binary"
+	"net/url"
+	"sync"
+	"time"
+
+	"github.com/apernet/quic-go"
+	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/protocol/dns"
+	"github.com/xtls/xray-core/common/session"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/transport/internet/tls"
+	"golang.org/x/net/http2"
+)
+
+// NextProtoDQ - During connection establishment, DNS/QUIC support is indicated
+// by selecting the ALPN token "dq" in the crypto handshake.
+const NextProtoDQ = "doq"
+
+const handshakeTimeout = time.Second * 8
+
+// QUICNameServer implemented DNS over QUIC
+type QUICNameServer struct {
+	sync.RWMutex
+	cacheController *CacheController
+	destination     *net.Destination
+	connection      *quic.Conn
+	clientIP        net.IP
+}
+
+// NewQUICNameServer creates DNS-over-QUIC client object for local resolving
+func NewQUICNameServer(url *url.URL, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (*QUICNameServer, error) {
+	var err error
+	port := net.Port(853)
+	if url.Port() != "" {
+		port, err = net.PortFromString(url.Port())
+		if err != nil {
+			return nil, err
+		}
+	}
+	dest := net.UDPDestination(net.ParseAddress(url.Hostname()), port)
+
+	s := &QUICNameServer{
+		cacheController: NewCacheController(url.String(), disableCache, serveStale, serveExpiredTTL),
+		destination:     &dest,
+		clientIP:        clientIP,
+	}
+
+	errors.LogInfo(context.Background(), "DNS: created Local DNS-over-QUIC client for ", url.String())
+	return s, nil
+}
+
+// Name implements Server.
+func (s *QUICNameServer) Name() string {
+	return s.cacheController.name
+}
+
+// IsDisableCache implements Server.
+func (s *QUICNameServer) IsDisableCache() bool {
+	return s.cacheController.disableCache
+}
+
+func (s *QUICNameServer) newReqID() uint16 {
+	return 0
+}
+
+// getCacheController implements CachedNameServer.
+func (s *QUICNameServer) getCacheController() *CacheController { return s.cacheController }
+
+// sendQuery implements CachedNameServer.
+func (s *QUICNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
+	errors.LogInfo(ctx, s.Name(), " querying: ", fqdn)
+
+	reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, 0))
+
+	var deadline time.Time
+	if d, ok := ctx.Deadline(); ok {
+		deadline = d
+	} else {
+		deadline = time.Now().Add(time.Second * 5)
+	}
+
+	for _, req := range reqs {
+		go func(r *dnsRequest) {
+			// generate new context for each req, using same context
+			// may cause reqs all aborted if any one encounter an error
+			dnsCtx := ctx
+
+			// reserve internal dns server requested Inbound
+			if inbound := session.InboundFromContext(ctx); inbound != nil {
+				dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
+			}
+
+			dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
+				Protocol:       "quic",
+				SkipDNSResolve: true,
+			})
+
+			var cancel context.CancelFunc
+			dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
+			defer cancel()
+
+			b, err := dns.PackMessage(r.msg)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to pack dns query")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+
+			dnsReqBuf := buf.New()
+			err = binary.Write(dnsReqBuf, binary.BigEndian, uint16(b.Len()))
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "binary write failed")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			_, err = dnsReqBuf.Write(b.Bytes())
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "buffer write failed")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			b.Release()
+
+			conn, err := s.openStream(dnsCtx)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to open quic connection")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+
+			_, err = conn.Write(dnsReqBuf.Bytes())
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to send query")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+
+			_ = conn.Close()
+
+			respBuf := buf.New()
+			defer respBuf.Release()
+			n, err := respBuf.ReadFullFrom(conn, 2)
+			if err != nil && n == 0 {
+				errors.LogErrorInner(ctx, err, "failed to read response length")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			var length uint16
+			err = binary.Read(bytes.NewReader(respBuf.Bytes()), binary.BigEndian, &length)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to parse response length")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			respBuf.Clear()
+			n, err = respBuf.ReadFullFrom(conn, int32(length))
+			if err != nil && n == 0 {
+				errors.LogErrorInner(ctx, err, "failed to read response length")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+
+			rec, err := parseResponse(respBuf.Bytes())
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to handle response")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			s.cacheController.updateRecord(r, rec)
+		}(req)
+	}
+}
+
+// QueryIP implements Server.
+func (s *QUICNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
+	return queryIP(ctx, s, domain, option)
+}
+
+func isActive(s *quic.Conn) bool {
+	select {
+	case <-s.Context().Done():
+		return false
+	default:
+		return true
+	}
+}
+
+func (s *QUICNameServer) getConnection() (*quic.Conn, error) {
+	var conn *quic.Conn
+	s.RLock()
+	conn = s.connection
+	if conn != nil && isActive(conn) {
+		s.RUnlock()
+		return conn, nil
+	}
+	if conn != nil {
+		// we're recreating the connection, let's create a new one
+		_ = conn.CloseWithError(0, "")
+	}
+	s.RUnlock()
+
+	s.Lock()
+	defer s.Unlock()
+
+	var err error
+	conn, err = s.openConnection()
+	if err != nil {
+		// This does not look too nice, but QUIC (or maybe quic-go)
+		// doesn't seem stable enough.
+		// Maybe retransmissions aren't fully implemented in quic-go?
+		// Anyways, the simple solution is to make a second try when
+		// it fails to open the QUIC connection.
+		conn, err = s.openConnection()
+		if err != nil {
+			return nil, err
+		}
+	}
+	s.connection = conn
+	return conn, nil
+}
+
+func (s *QUICNameServer) openConnection() (*quic.Conn, error) {
+	tlsConfig := tls.Config{}
+	quicConfig := &quic.Config{
+		HandshakeIdleTimeout: handshakeTimeout,
+	}
+	tlsConfig.ServerName = s.destination.Address.String()
+	conn, err := quic.DialAddr(context.Background(), s.destination.NetAddr(), tlsConfig.GetTLSConfig(tls.WithNextProto("http/1.1", http2.NextProtoTLS, NextProtoDQ)), quicConfig)
+	log.Record(&log.AccessMessage{
+		From:   "DNS",
+		To:     s.destination,
+		Status: log.AccessAccepted,
+		Detour: "local",
+	})
+	if err != nil {
+		return nil, err
+	}
+
+	return conn, nil
+}
+
+func (s *QUICNameServer) openStream(ctx context.Context) (*quic.Stream, error) {
+	conn, err := s.getConnection()
+	if err != nil {
+		return nil, err
+	}
+
+	// open a new stream
+	return conn.OpenStreamSync(ctx)
+}

subproject/Xray-core-main/app/dns/nameserver_quic_test.go

@@ -0,0 +1,87 @@
+package dns_test
+
+import (
+	"context"
+	"net/url"
+	"testing"
+	"time"
+
+	"github.com/google/go-cmp/cmp"
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/features/dns"
+)
+
+func TestQUICNameServer(t *testing.T) {
+	url, err := url.Parse("quic://dns.adguard-dns.com")
+	common.Must(err)
+	s, err := NewQUICNameServer(url, false, false, 0, net.IP(nil))
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+	ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips2, _, err := s.QueryIP(ctx2, "google.com", dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if r := cmp.Diff(ips2, ips); r != "" {
+		t.Fatal(r)
+	}
+}
+
+func TestQUICNameServerWithIPv4Override(t *testing.T) {
+	url, err := url.Parse("quic://dns.adguard-dns.com")
+	common.Must(err)
+	s, err := NewQUICNameServer(url, false, false, 0, net.IP(nil))
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: false,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	for _, ip := range ips {
+		if len(ip) != net.IPv4len {
+			t.Error("expect only IPv4 response from DNS query")
+		}
+	}
+}
+
+func TestQUICNameServerWithIPv6Override(t *testing.T) {
+	url, err := url.Parse("quic://dns.adguard-dns.com")
+	common.Must(err)
+	s, err := NewQUICNameServer(url, false, false, 0, net.IP(nil))
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns.IPOption{
+		IPv4Enable: false,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	for _, ip := range ips {
+		if len(ip) != net.IPv6len {
+			t.Error("expect only IPv6 response from DNS query")
+		}
+	}
+}

subproject/Xray-core-main/app/dns/nameserver_tcp.go

@@ -0,0 +1,235 @@
+package dns
+
+import (
+	"bytes"
+	"context"
+	"encoding/binary"
+	"net/url"
+	"sync/atomic"
+	"time"
+
+	"github.com/xtls/xray-core/common/buf"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
+	"github.com/xtls/xray-core/common/protocol/dns"
+	"github.com/xtls/xray-core/common/session"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/routing"
+	"github.com/xtls/xray-core/transport/internet"
+)
+
+// TCPNameServer implemented DNS over TCP (RFC7766).
+type TCPNameServer struct {
+	cacheController *CacheController
+	destination     *net.Destination
+	reqID           uint32
+	dial            func(context.Context) (net.Conn, error)
+	clientIP        net.IP
+}
+
+// NewTCPNameServer creates DNS over TCP server object for remote resolving.
+func NewTCPNameServer(
+	url *url.URL,
+	dispatcher routing.Dispatcher,
+	disableCache bool, serveStale bool, serveExpiredTTL uint32,
+	clientIP net.IP,
+) (*TCPNameServer, error) {
+	s, err := baseTCPNameServer(url, "TCP", disableCache, serveStale, serveExpiredTTL, clientIP)
+	if err != nil {
+		return nil, err
+	}
+
+	s.dial = func(ctx context.Context) (net.Conn, error) {
+		link, err := dispatcher.Dispatch(toDnsContext(ctx, s.destination.String()), *s.destination)
+		if err != nil {
+			return nil, err
+		}
+
+		return cnc.NewConnection(
+			cnc.ConnectionInputMulti(link.Writer),
+			cnc.ConnectionOutputMulti(link.Reader),
+		), nil
+	}
+
+	errors.LogInfo(context.Background(), "DNS: created TCP client initialized for ", url.String())
+	return s, nil
+}
+
+// NewTCPLocalNameServer creates DNS over TCP client object for local resolving
+func NewTCPLocalNameServer(url *url.URL, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (*TCPNameServer, error) {
+	s, err := baseTCPNameServer(url, "TCPL", disableCache, serveStale, serveExpiredTTL, clientIP)
+	if err != nil {
+		return nil, err
+	}
+
+	s.dial = func(ctx context.Context) (net.Conn, error) {
+		return internet.DialSystem(ctx, *s.destination, nil)
+	}
+
+	errors.LogInfo(context.Background(), "DNS: created Local TCP client initialized for ", url.String())
+	return s, nil
+}
+
+func baseTCPNameServer(url *url.URL, prefix string, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) (*TCPNameServer, error) {
+	port := net.Port(53)
+	if url.Port() != "" {
+		var err error
+		if port, err = net.PortFromString(url.Port()); err != nil {
+			return nil, err
+		}
+	}
+	dest := net.TCPDestination(net.ParseAddress(url.Hostname()), port)
+
+	s := &TCPNameServer{
+		cacheController: NewCacheController(prefix+"//"+dest.NetAddr(), disableCache, serveStale, serveExpiredTTL),
+		destination:     &dest,
+		clientIP:        clientIP,
+	}
+
+	return s, nil
+}
+
+// Name implements Server.
+func (s *TCPNameServer) Name() string {
+	return s.cacheController.name
+}
+
+// IsDisableCache implements Server.
+func (s *TCPNameServer) IsDisableCache() bool {
+	return s.cacheController.disableCache
+}
+
+func (s *TCPNameServer) newReqID() uint16 {
+	return uint16(atomic.AddUint32(&s.reqID, 1))
+}
+
+// getCacheController implements CachedNameserver.
+func (s *TCPNameServer) getCacheController() *CacheController {
+	return s.cacheController
+}
+
+// sendQuery implements CachedNameserver.
+func (s *TCPNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
+	errors.LogInfo(ctx, s.Name(), " querying DNS for: ", fqdn)
+
+	reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, 0))
+
+	var deadline time.Time
+	if d, ok := ctx.Deadline(); ok {
+		deadline = d
+	} else {
+		deadline = time.Now().Add(time.Second * 5)
+	}
+
+	for _, req := range reqs {
+		go func(r *dnsRequest) {
+			dnsCtx := ctx
+
+			if inbound := session.InboundFromContext(ctx); inbound != nil {
+				dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
+			}
+
+			dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
+				Protocol:       "dns",
+				SkipDNSResolve: true,
+			})
+
+			var cancel context.CancelFunc
+			dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
+			defer cancel()
+
+			b, err := dns.PackMessage(r.msg)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to pack dns query")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+
+			conn, err := s.dial(dnsCtx)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to dial namesever")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			defer conn.Close()
+			dnsReqBuf := buf.New()
+			err = binary.Write(dnsReqBuf, binary.BigEndian, uint16(b.Len()))
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "binary write failed")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			_, err = dnsReqBuf.Write(b.Bytes())
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "buffer write failed")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			b.Release()
+
+			_, err = conn.Write(dnsReqBuf.Bytes())
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to send query")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			dnsReqBuf.Release()
+
+			respBuf := buf.New()
+			defer respBuf.Release()
+			n, err := respBuf.ReadFullFrom(conn, 2)
+			if err != nil && n == 0 {
+				errors.LogErrorInner(ctx, err, "failed to read response length")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			var length uint16
+			err = binary.Read(bytes.NewReader(respBuf.Bytes()), binary.BigEndian, &length)
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to parse response length")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+			respBuf.Clear()
+			n, err = respBuf.ReadFullFrom(conn, int32(length))
+			if err != nil && n == 0 {
+				errors.LogErrorInner(ctx, err, "failed to read response length")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+
+			rec, err := parseResponse(respBuf.Bytes())
+			if err != nil {
+				errors.LogErrorInner(ctx, err, "failed to parse DNS over TCP response")
+				if noResponseErrCh != nil {
+					noResponseErrCh <- err
+				}
+				return
+			}
+
+			s.cacheController.updateRecord(r, rec)
+		}(req)
+	}
+}
+
+// QueryIP implements Server.
+func (s *TCPNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
+	return queryIP(ctx, s, domain, option)
+}

subproject/Xray-core-main/app/dns/nameserver_tcp_test.go

@@ -0,0 +1,107 @@
+package dns_test
+
+import (
+	"context"
+	"net/url"
+	"testing"
+	"time"
+
+	"github.com/google/go-cmp/cmp"
+	. "github.com/xtls/xray-core/app/dns"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/net"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+)
+
+func TestTCPLocalNameServer(t *testing.T) {
+	url, err := url.Parse("tcp+local://8.8.8.8")
+	common.Must(err)
+	s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+}
+
+func TestTCPLocalNameServerWithCache(t *testing.T) {
+	url, err := url.Parse("tcp+local://8.8.8.8")
+	common.Must(err)
+	s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips2, _, err := s.QueryIP(ctx2, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+	if r := cmp.Diff(ips2, ips); r != "" {
+		t.Fatal(r)
+	}
+}
+
+func TestTCPLocalNameServerWithIPv4Override(t *testing.T) {
+	url, err := url.Parse("tcp+local://8.8.8.8")
+	common.Must(err)
+	s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: true,
+		IPv6Enable: false,
+	})
+	cancel()
+	common.Must(err)
+
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	for _, ip := range ips {
+		if len(ip) != net.IPv4len {
+			t.Error("expect only IPv4 response from DNS query")
+		}
+	}
+}
+
+func TestTCPLocalNameServerWithIPv6Override(t *testing.T) {
+	url, err := url.Parse("tcp+local://8.8.8.8")
+	common.Must(err)
+	s, err := NewTCPLocalNameServer(url, false, false, 0, net.IP(nil))
+	common.Must(err)
+	ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
+	ips, _, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
+		IPv4Enable: false,
+		IPv6Enable: true,
+	})
+	cancel()
+	common.Must(err)
+
+	if len(ips) == 0 {
+		t.Error("expect some ips, but got 0")
+	}
+
+	for _, ip := range ips {
+		if len(ip) != net.IPv6len {
+			t.Error("expect only IPv6 response from DNS query")
+		}
+	}
+}

subproject/Xray-core-main/app/dns/nameserver_udp.go

@@ -0,0 +1,191 @@
+package dns
+
+import (
+	"context"
+	"strings"
+	"sync"
+	"sync/atomic"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/protocol/dns"
+	udp_proto "github.com/xtls/xray-core/common/protocol/udp"
+	"github.com/xtls/xray-core/common/task"
+	dns_feature "github.com/xtls/xray-core/features/dns"
+	"github.com/xtls/xray-core/features/routing"
+	"github.com/xtls/xray-core/transport/internet/udp"
+	"golang.org/x/net/dns/dnsmessage"
+)
+
+// ClassicNameServer implemented traditional UDP DNS.
+type ClassicNameServer struct {
+	sync.RWMutex
+	cacheController *CacheController
+	address         *net.Destination
+	requests        map[uint16]*udpDnsRequest
+	udpServer       *udp.Dispatcher
+	requestsCleanup *task.Periodic
+	reqID           uint32
+	clientIP        net.IP
+}
+
+type udpDnsRequest struct {
+	dnsRequest
+	ctx context.Context
+}
+
+// NewClassicNameServer creates udp server object for remote resolving.
+func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher, disableCache bool, serveStale bool, serveExpiredTTL uint32, clientIP net.IP) *ClassicNameServer {
+	// default to 53 if unspecific
+	if address.Port == 0 {
+		address.Port = net.Port(53)
+	}
+
+	s := &ClassicNameServer{
+		cacheController: NewCacheController(strings.ToUpper(address.String()), disableCache, serveStale, serveExpiredTTL),
+		address:         &address,
+		requests:        make(map[uint16]*udpDnsRequest),
+		clientIP:        clientIP,
+	}
+	s.requestsCleanup = &task.Periodic{
+		Interval: time.Minute,
+		Execute:  s.RequestsCleanup,
+	}
+	s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
+
+	errors.LogInfo(context.Background(), "DNS: created UDP client initialized for ", address.NetAddr())
+	return s
+}
+
+// Name implements Server.
+func (s *ClassicNameServer) Name() string {
+	return s.cacheController.name
+}
+
+// IsDisableCache implements Server.
+func (s *ClassicNameServer) IsDisableCache() bool {
+	return s.cacheController.disableCache
+}
+
+// RequestsCleanup clears expired items from cache
+func (s *ClassicNameServer) RequestsCleanup() error {
+	now := time.Now()
+	s.Lock()
+	defer s.Unlock()
+
+	if len(s.requests) == 0 {
+		return errors.New(s.Name(), " nothing to do. stopping...")
+	}
+
+	for id, req := range s.requests {
+		if req.expire.Before(now) {
+			delete(s.requests, id)
+		}
+	}
+
+	if len(s.requests) == 0 {
+		s.requests = make(map[uint16]*udpDnsRequest)
+	}
+
+	return nil
+}
+
+// HandleResponse handles udp response packet from remote DNS server.
+func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_proto.Packet) {
+	payload := packet.Payload
+	ipRec, err := parseResponse(payload.Bytes())
+	payload.Release()
+	if err != nil {
+		errors.LogErrorInner(ctx, err, s.Name(), " fail to parse responded DNS udp")
+		return
+	}
+
+	s.Lock()
+	id := ipRec.ReqID
+	req, ok := s.requests[id]
+	if ok {
+		// remove the pending request
+		delete(s.requests, id)
+	}
+	s.Unlock()
+	if !ok {
+		errors.LogErrorInner(ctx, err, s.Name(), " cannot find the pending request")
+		return
+	}
+
+	// if truncated, retry with EDNS0 option(udp payload size: 1350)
+	if ipRec.RawHeader.Truncated {
+		// if already has EDNS0 option, no need to retry
+		if len(req.msg.Additionals) == 0 {
+			// copy necessary meta data from original request
+			// and add EDNS0 option
+			opt := new(dnsmessage.Resource)
+			common.Must(opt.Header.SetEDNS0(1350, 0xfe00, true))
+			opt.Body = &dnsmessage.OPTResource{}
+			newMsg := *req.msg
+			newReq := *req
+			newMsg.Additionals = append(newMsg.Additionals, *opt)
+			newMsg.ID = s.newReqID()
+			newReq.msg = &newMsg
+			s.addPendingRequest(&newReq)
+			b, _ := dns.PackMessage(newReq.msg)
+			copyDest := net.UDPDestination(s.address.Address, s.address.Port)
+			b.UDP = &copyDest
+			s.udpServer.Dispatch(toDnsContext(newReq.ctx, s.address.String()), *s.address, b)
+			return
+		}
+	}
+
+	s.cacheController.updateRecord(&req.dnsRequest, ipRec)
+}
+
+func (s *ClassicNameServer) newReqID() uint16 {
+	return uint16(atomic.AddUint32(&s.reqID, 1))
+}
+
+func (s *ClassicNameServer) addPendingRequest(req *udpDnsRequest) {
+	s.Lock()
+	id := req.msg.ID
+	req.expire = time.Now().Add(time.Second * 8)
+	s.requests[id] = req
+	s.Unlock()
+	common.Must(s.requestsCleanup.Start())
+}
+
+// getCacheController implements CachedNameserver.
+func (s *ClassicNameServer) getCacheController() *CacheController {
+	return s.cacheController
+}
+
+// sendQuery implements CachedNameserver.
+func (s *ClassicNameServer) sendQuery(ctx context.Context, noResponseErrCh chan<- error, fqdn string, option dns_feature.IPOption) {
+	errors.LogInfo(ctx, s.Name(), " querying DNS for: ", fqdn)
+
+	reqs := buildReqMsgs(fqdn, option, s.newReqID, genEDNS0Options(s.clientIP, 0))
+
+	for _, req := range reqs {
+		udpReq := &udpDnsRequest{
+			dnsRequest: *req,
+			ctx:        ctx,
+		}
+		s.addPendingRequest(udpReq)
+		b, err := dns.PackMessage(req.msg)
+		if err != nil {
+			errors.LogErrorInner(ctx, err, "failed to pack dns query")
+			if noResponseErrCh != nil {
+				noResponseErrCh <- err
+			}
+			return
+		}
+		copyDest := net.UDPDestination(s.address.Address, s.address.Port)
+		b.UDP = &copyDest
+		s.udpServer.Dispatch(toDnsContext(ctx, s.address.String()), *s.address, b)
+	}
+}
+
+// QueryIP implements Server.
+func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, uint32, error) {
+	return queryIP(ctx, s, domain, option)
+}

subproject/Xray-core-main/app/log/command/command.go

@@ -0,0 +1,55 @@
+package command
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/app/log"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/core"
+	grpc "google.golang.org/grpc"
+)
+
+type LoggerServer struct {
+	V *core.Instance
+}
+
+// RestartLogger implements LoggerService.
+func (s *LoggerServer) RestartLogger(ctx context.Context, request *RestartLoggerRequest) (*RestartLoggerResponse, error) {
+	logger := s.V.GetFeature((*log.Instance)(nil))
+	if logger == nil {
+		return nil, errors.New("unable to get logger instance")
+	}
+	if err := logger.Close(); err != nil {
+		return nil, errors.New("failed to close logger").Base(err)
+	}
+	if err := logger.Start(); err != nil {
+		return nil, errors.New("failed to start logger").Base(err)
+	}
+	return &RestartLoggerResponse{}, nil
+}
+
+func (s *LoggerServer) mustEmbedUnimplementedLoggerServiceServer() {}
+
+type service struct {
+	v *core.Instance
+}
+
+func (s *service) Register(server *grpc.Server) {
+	ls := &LoggerServer{
+		V: s.v,
+	}
+	RegisterLoggerServiceServer(server, ls)
+
+	// For compatibility purposes
+	vCoreDesc := LoggerService_ServiceDesc
+	vCoreDesc.ServiceName = "v2ray.core.app.log.command.LoggerService"
+	server.RegisterService(&vCoreDesc, ls)
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
+		s := core.MustFromContext(ctx)
+		return &service{v: s}, nil
+	}))
+}

subproject/Xray-core-main/app/log/command/command_test.go

@@ -0,0 +1,34 @@
+package command_test
+
+import (
+	"context"
+	"testing"
+
+	"github.com/xtls/xray-core/app/dispatcher"
+	"github.com/xtls/xray-core/app/log"
+	. "github.com/xtls/xray-core/app/log/command"
+	"github.com/xtls/xray-core/app/proxyman"
+	_ "github.com/xtls/xray-core/app/proxyman/inbound"
+	_ "github.com/xtls/xray-core/app/proxyman/outbound"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/serial"
+	"github.com/xtls/xray-core/core"
+)
+
+func TestLoggerRestart(t *testing.T) {
+	v, err := core.New(&core.Config{
+		App: []*serial.TypedMessage{
+			serial.ToTypedMessage(&log.Config{}),
+			serial.ToTypedMessage(&dispatcher.Config{}),
+			serial.ToTypedMessage(&proxyman.InboundConfig{}),
+			serial.ToTypedMessage(&proxyman.OutboundConfig{}),
+		},
+	})
+	common.Must(err)
+	common.Must(v.Start())
+
+	server := &LoggerServer{
+		V: v,
+	}
+	common.Must2(server.RestartLogger(context.Background(), &RestartLoggerRequest{}))
+}

subproject/Xray-core-main/app/log/command/config.pb.go

@@ -0,0 +1,194 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/log/command/config.proto
+
+package command
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type Config struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_log_command_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_log_command_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_log_command_config_proto_rawDescGZIP(), []int{0}
+}
+
+type RestartLoggerRequest struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *RestartLoggerRequest) Reset() {
+	*x = RestartLoggerRequest{}
+	mi := &file_app_log_command_config_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *RestartLoggerRequest) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*RestartLoggerRequest) ProtoMessage() {}
+
+func (x *RestartLoggerRequest) ProtoReflect() protoreflect.Message {
+	mi := &file_app_log_command_config_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use RestartLoggerRequest.ProtoReflect.Descriptor instead.
+func (*RestartLoggerRequest) Descriptor() ([]byte, []int) {
+	return file_app_log_command_config_proto_rawDescGZIP(), []int{1}
+}
+
+type RestartLoggerResponse struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *RestartLoggerResponse) Reset() {
+	*x = RestartLoggerResponse{}
+	mi := &file_app_log_command_config_proto_msgTypes[2]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *RestartLoggerResponse) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*RestartLoggerResponse) ProtoMessage() {}
+
+func (x *RestartLoggerResponse) ProtoReflect() protoreflect.Message {
+	mi := &file_app_log_command_config_proto_msgTypes[2]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use RestartLoggerResponse.ProtoReflect.Descriptor instead.
+func (*RestartLoggerResponse) Descriptor() ([]byte, []int) {
+	return file_app_log_command_config_proto_rawDescGZIP(), []int{2}
+}
+
+var File_app_log_command_config_proto protoreflect.FileDescriptor
+
+const file_app_log_command_config_proto_rawDesc = "" +
+	"\n" +
+	"\x1capp/log/command/config.proto\x12\x14xray.app.log.command\"\b\n" +
+	"\x06Config\"\x16\n" +
+	"\x14RestartLoggerRequest\"\x17\n" +
+	"\x15RestartLoggerResponse2{\n" +
+	"\rLoggerService\x12j\n" +
+	"\rRestartLogger\x12*.xray.app.log.command.RestartLoggerRequest\x1a+.xray.app.log.command.RestartLoggerResponse\"\x00B^\n" +
+	"\x18com.xray.app.log.commandP\x01Z)github.com/xtls/xray-core/app/log/command\xaa\x02\x14Xray.App.Log.Commandb\x06proto3"
+
+var (
+	file_app_log_command_config_proto_rawDescOnce sync.Once
+	file_app_log_command_config_proto_rawDescData []byte
+)
+
+func file_app_log_command_config_proto_rawDescGZIP() []byte {
+	file_app_log_command_config_proto_rawDescOnce.Do(func() {
+		file_app_log_command_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_log_command_config_proto_rawDesc), len(file_app_log_command_config_proto_rawDesc)))
+	})
+	return file_app_log_command_config_proto_rawDescData
+}
+
+var file_app_log_command_config_proto_msgTypes = make([]protoimpl.MessageInfo, 3)
+var file_app_log_command_config_proto_goTypes = []any{
+	(*Config)(nil),                // 0: xray.app.log.command.Config
+	(*RestartLoggerRequest)(nil),  // 1: xray.app.log.command.RestartLoggerRequest
+	(*RestartLoggerResponse)(nil), // 2: xray.app.log.command.RestartLoggerResponse
+}
+var file_app_log_command_config_proto_depIdxs = []int32{
+	1, // 0: xray.app.log.command.LoggerService.RestartLogger:input_type -> xray.app.log.command.RestartLoggerRequest
+	2, // 1: xray.app.log.command.LoggerService.RestartLogger:output_type -> xray.app.log.command.RestartLoggerResponse
+	1, // [1:2] is the sub-list for method output_type
+	0, // [0:1] is the sub-list for method input_type
+	0, // [0:0] is the sub-list for extension type_name
+	0, // [0:0] is the sub-list for extension extendee
+	0, // [0:0] is the sub-list for field type_name
+}
+
+func init() { file_app_log_command_config_proto_init() }
+func file_app_log_command_config_proto_init() {
+	if File_app_log_command_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_log_command_config_proto_rawDesc), len(file_app_log_command_config_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   3,
+			NumExtensions: 0,
+			NumServices:   1,
+		},
+		GoTypes:           file_app_log_command_config_proto_goTypes,
+		DependencyIndexes: file_app_log_command_config_proto_depIdxs,
+		MessageInfos:      file_app_log_command_config_proto_msgTypes,
+	}.Build()
+	File_app_log_command_config_proto = out.File
+	file_app_log_command_config_proto_goTypes = nil
+	file_app_log_command_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/log/command/config.proto

@@ -0,0 +1,17 @@
+syntax = "proto3";
+
+package xray.app.log.command;
+option csharp_namespace = "Xray.App.Log.Command";
+option go_package = "github.com/xtls/xray-core/app/log/command";
+option java_package = "com.xray.app.log.command";
+option java_multiple_files = true;
+
+message Config {}
+
+message RestartLoggerRequest {}
+
+message RestartLoggerResponse {}
+
+service LoggerService {
+  rpc RestartLogger(RestartLoggerRequest) returns (RestartLoggerResponse) {}
+}

subproject/Xray-core-main/app/log/command/config_grpc.pb.go

@@ -0,0 +1,121 @@
+// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
+// versions:
+// - protoc-gen-go-grpc v1.6.0
+// - protoc             v6.33.5
+// source: app/log/command/config.proto
+
+package command
+
+import (
+	context "context"
+	grpc "google.golang.org/grpc"
+	codes "google.golang.org/grpc/codes"
+	status "google.golang.org/grpc/status"
+)
+
+// This is a compile-time assertion to ensure that this generated file
+// is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.64.0 or later.
+const _ = grpc.SupportPackageIsVersion9
+
+const (
+	LoggerService_RestartLogger_FullMethodName = "/xray.app.log.command.LoggerService/RestartLogger"
+)
+
+// LoggerServiceClient is the client API for LoggerService service.
+//
+// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
+type LoggerServiceClient interface {
+	RestartLogger(ctx context.Context, in *RestartLoggerRequest, opts ...grpc.CallOption) (*RestartLoggerResponse, error)
+}
+
+type loggerServiceClient struct {
+	cc grpc.ClientConnInterface
+}
+
+func NewLoggerServiceClient(cc grpc.ClientConnInterface) LoggerServiceClient {
+	return &loggerServiceClient{cc}
+}
+
+func (c *loggerServiceClient) RestartLogger(ctx context.Context, in *RestartLoggerRequest, opts ...grpc.CallOption) (*RestartLoggerResponse, error) {
+	cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...)
+	out := new(RestartLoggerResponse)
+	err := c.cc.Invoke(ctx, LoggerService_RestartLogger_FullMethodName, in, out, cOpts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+// LoggerServiceServer is the server API for LoggerService service.
+// All implementations must embed UnimplementedLoggerServiceServer
+// for forward compatibility.
+type LoggerServiceServer interface {
+	RestartLogger(context.Context, *RestartLoggerRequest) (*RestartLoggerResponse, error)
+	mustEmbedUnimplementedLoggerServiceServer()
+}
+
+// UnimplementedLoggerServiceServer must be embedded to have
+// forward compatible implementations.
+//
+// NOTE: this should be embedded by value instead of pointer to avoid a nil
+// pointer dereference when methods are called.
+type UnimplementedLoggerServiceServer struct{}
+
+func (UnimplementedLoggerServiceServer) RestartLogger(context.Context, *RestartLoggerRequest) (*RestartLoggerResponse, error) {
+	return nil, status.Error(codes.Unimplemented, "method RestartLogger not implemented")
+}
+func (UnimplementedLoggerServiceServer) mustEmbedUnimplementedLoggerServiceServer() {}
+func (UnimplementedLoggerServiceServer) testEmbeddedByValue()                       {}
+
+// UnsafeLoggerServiceServer may be embedded to opt out of forward compatibility for this service.
+// Use of this interface is not recommended, as added methods to LoggerServiceServer will
+// result in compilation errors.
+type UnsafeLoggerServiceServer interface {
+	mustEmbedUnimplementedLoggerServiceServer()
+}
+
+func RegisterLoggerServiceServer(s grpc.ServiceRegistrar, srv LoggerServiceServer) {
+	// If the following call panics, it indicates UnimplementedLoggerServiceServer was
+	// embedded by pointer and is nil.  This will cause panics if an
+	// unimplemented method is ever invoked, so we test this at initialization
+	// time to prevent it from happening at runtime later due to I/O.
+	if t, ok := srv.(interface{ testEmbeddedByValue() }); ok {
+		t.testEmbeddedByValue()
+	}
+	s.RegisterService(&LoggerService_ServiceDesc, srv)
+}
+
+func _LoggerService_RestartLogger_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(RestartLoggerRequest)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(LoggerServiceServer).RestartLogger(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: LoggerService_RestartLogger_FullMethodName,
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(LoggerServiceServer).RestartLogger(ctx, req.(*RestartLoggerRequest))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+// LoggerService_ServiceDesc is the grpc.ServiceDesc for LoggerService service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var LoggerService_ServiceDesc = grpc.ServiceDesc{
+	ServiceName: "xray.app.log.command.LoggerService",
+	HandlerType: (*LoggerServiceServer)(nil),
+	Methods: []grpc.MethodDesc{
+		{
+			MethodName: "RestartLogger",
+			Handler:    _LoggerService_RestartLogger_Handler,
+		},
+	},
+	Streams:  []grpc.StreamDesc{},
+	Metadata: "app/log/command/config.proto",
+}

subproject/Xray-core-main/app/log/config.pb.go

@@ -0,0 +1,242 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/log/config.proto
+
+package log
+
+import (
+	log "github.com/xtls/xray-core/common/log"
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type LogType int32
+
+const (
+	LogType_None    LogType = 0
+	LogType_Console LogType = 1
+	LogType_File    LogType = 2
+	LogType_Event   LogType = 3
+)
+
+// Enum value maps for LogType.
+var (
+	LogType_name = map[int32]string{
+		0: "None",
+		1: "Console",
+		2: "File",
+		3: "Event",
+	}
+	LogType_value = map[string]int32{
+		"None":    0,
+		"Console": 1,
+		"File":    2,
+		"Event":   3,
+	}
+)
+
+func (x LogType) Enum() *LogType {
+	p := new(LogType)
+	*p = x
+	return p
+}
+
+func (x LogType) String() string {
+	return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
+}
+
+func (LogType) Descriptor() protoreflect.EnumDescriptor {
+	return file_app_log_config_proto_enumTypes[0].Descriptor()
+}
+
+func (LogType) Type() protoreflect.EnumType {
+	return &file_app_log_config_proto_enumTypes[0]
+}
+
+func (x LogType) Number() protoreflect.EnumNumber {
+	return protoreflect.EnumNumber(x)
+}
+
+// Deprecated: Use LogType.Descriptor instead.
+func (LogType) EnumDescriptor() ([]byte, []int) {
+	return file_app_log_config_proto_rawDescGZIP(), []int{0}
+}
+
+type Config struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	ErrorLogType  LogType                `protobuf:"varint,1,opt,name=error_log_type,json=errorLogType,proto3,enum=xray.app.log.LogType" json:"error_log_type,omitempty"`
+	ErrorLogLevel log.Severity           `protobuf:"varint,2,opt,name=error_log_level,json=errorLogLevel,proto3,enum=xray.common.log.Severity" json:"error_log_level,omitempty"`
+	ErrorLogPath  string                 `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
+	AccessLogType LogType                `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
+	AccessLogPath string                 `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
+	EnableDnsLog  bool                   `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
+	MaskAddress   string                 `protobuf:"bytes,7,opt,name=mask_address,json=maskAddress,proto3" json:"mask_address,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_log_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_log_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_log_config_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *Config) GetErrorLogType() LogType {
+	if x != nil {
+		return x.ErrorLogType
+	}
+	return LogType_None
+}
+
+func (x *Config) GetErrorLogLevel() log.Severity {
+	if x != nil {
+		return x.ErrorLogLevel
+	}
+	return log.Severity(0)
+}
+
+func (x *Config) GetErrorLogPath() string {
+	if x != nil {
+		return x.ErrorLogPath
+	}
+	return ""
+}
+
+func (x *Config) GetAccessLogType() LogType {
+	if x != nil {
+		return x.AccessLogType
+	}
+	return LogType_None
+}
+
+func (x *Config) GetAccessLogPath() string {
+	if x != nil {
+		return x.AccessLogPath
+	}
+	return ""
+}
+
+func (x *Config) GetEnableDnsLog() bool {
+	if x != nil {
+		return x.EnableDnsLog
+	}
+	return false
+}
+
+func (x *Config) GetMaskAddress() string {
+	if x != nil {
+		return x.MaskAddress
+	}
+	return ""
+}
+
+var File_app_log_config_proto protoreflect.FileDescriptor
+
+const file_app_log_config_proto_rawDesc = "" +
+	"\n" +
+	"\x14app/log/config.proto\x12\fxray.app.log\x1a\x14common/log/log.proto\"\xde\x02\n" +
+	"\x06Config\x12;\n" +
+	"\x0eerror_log_type\x18\x01 \x01(\x0e2\x15.xray.app.log.LogTypeR\ferrorLogType\x12A\n" +
+	"\x0ferror_log_level\x18\x02 \x01(\x0e2\x19.xray.common.log.SeverityR\rerrorLogLevel\x12$\n" +
+	"\x0eerror_log_path\x18\x03 \x01(\tR\ferrorLogPath\x12=\n" +
+	"\x0faccess_log_type\x18\x04 \x01(\x0e2\x15.xray.app.log.LogTypeR\raccessLogType\x12&\n" +
+	"\x0faccess_log_path\x18\x05 \x01(\tR\raccessLogPath\x12$\n" +
+	"\x0eenable_dns_log\x18\x06 \x01(\bR\fenableDnsLog\x12!\n" +
+	"\fmask_address\x18\a \x01(\tR\vmaskAddress*5\n" +
+	"\aLogType\x12\b\n" +
+	"\x04None\x10\x00\x12\v\n" +
+	"\aConsole\x10\x01\x12\b\n" +
+	"\x04File\x10\x02\x12\t\n" +
+	"\x05Event\x10\x03BF\n" +
+	"\x10com.xray.app.logP\x01Z!github.com/xtls/xray-core/app/log\xaa\x02\fXray.App.Logb\x06proto3"
+
+var (
+	file_app_log_config_proto_rawDescOnce sync.Once
+	file_app_log_config_proto_rawDescData []byte
+)
+
+func file_app_log_config_proto_rawDescGZIP() []byte {
+	file_app_log_config_proto_rawDescOnce.Do(func() {
+		file_app_log_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_log_config_proto_rawDesc), len(file_app_log_config_proto_rawDesc)))
+	})
+	return file_app_log_config_proto_rawDescData
+}
+
+var file_app_log_config_proto_enumTypes = make([]protoimpl.EnumInfo, 1)
+var file_app_log_config_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
+var file_app_log_config_proto_goTypes = []any{
+	(LogType)(0),      // 0: xray.app.log.LogType
+	(*Config)(nil),    // 1: xray.app.log.Config
+	(log.Severity)(0), // 2: xray.common.log.Severity
+}
+var file_app_log_config_proto_depIdxs = []int32{
+	0, // 0: xray.app.log.Config.error_log_type:type_name -> xray.app.log.LogType
+	2, // 1: xray.app.log.Config.error_log_level:type_name -> xray.common.log.Severity
+	0, // 2: xray.app.log.Config.access_log_type:type_name -> xray.app.log.LogType
+	3, // [3:3] is the sub-list for method output_type
+	3, // [3:3] is the sub-list for method input_type
+	3, // [3:3] is the sub-list for extension type_name
+	3, // [3:3] is the sub-list for extension extendee
+	0, // [0:3] is the sub-list for field type_name
+}
+
+func init() { file_app_log_config_proto_init() }
+func file_app_log_config_proto_init() {
+	if File_app_log_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_log_config_proto_rawDesc), len(file_app_log_config_proto_rawDesc)),
+			NumEnums:      1,
+			NumMessages:   1,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_log_config_proto_goTypes,
+		DependencyIndexes: file_app_log_config_proto_depIdxs,
+		EnumInfos:         file_app_log_config_proto_enumTypes,
+		MessageInfos:      file_app_log_config_proto_msgTypes,
+	}.Build()
+	File_app_log_config_proto = out.File
+	file_app_log_config_proto_goTypes = nil
+	file_app_log_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/log/config.proto

@@ -0,0 +1,27 @@
+syntax = "proto3";
+
+package xray.app.log;
+option csharp_namespace = "Xray.App.Log";
+option go_package = "github.com/xtls/xray-core/app/log";
+option java_package = "com.xray.app.log";
+option java_multiple_files = true;
+
+import "common/log/log.proto";
+
+enum LogType {
+  None = 0;
+  Console = 1;
+  File = 2;
+  Event = 3;
+}
+
+message Config {
+  LogType error_log_type = 1;
+  xray.common.log.Severity error_log_level = 2;
+  string error_log_path = 3;
+
+  LogType access_log_type = 4;
+  string access_log_path = 5;
+  bool enable_dns_log = 6;
+  string mask_address= 7;
+}

subproject/Xray-core-main/app/log/log.go

@@ -0,0 +1,256 @@
+package log
+
+import (
+	"context"
+	"net"
+	"regexp"
+	"strconv"
+	"strings"
+	"sync"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+)
+
+// Instance is a log.Handler that handles logs.
+type Instance struct {
+	sync.RWMutex
+	config       *Config
+	accessLogger log.Handler
+	errorLogger  log.Handler
+	active       bool
+	dns          bool
+	mask4        int
+	mask6        int
+}
+
+// New creates a new log.Instance based on the given config.
+func New(ctx context.Context, config *Config) (*Instance, error) {
+	m4, m6, err := ParseMaskAddress(config.MaskAddress)
+	if err != nil {
+		return nil, err
+	}
+
+	g := &Instance{
+		config: config,
+		active: false,
+		dns:    config.EnableDnsLog,
+		mask4:  m4,
+		mask6:  m6,
+	}
+	log.RegisterHandler(g)
+
+	// start logger now,
+	// then other modules will be able to log during initialization
+	if err := g.startInternal(); err != nil {
+		return nil, err
+	}
+
+	errors.LogDebug(ctx, "Logger started")
+	return g, nil
+}
+
+func (g *Instance) initAccessLogger() error {
+	handler, err := createHandler(g.config.AccessLogType, HandlerCreatorOptions{
+		Path: g.config.AccessLogPath,
+	})
+	if err != nil {
+		return err
+	}
+	g.accessLogger = handler
+	return nil
+}
+
+func (g *Instance) initErrorLogger() error {
+	handler, err := createHandler(g.config.ErrorLogType, HandlerCreatorOptions{
+		Path: g.config.ErrorLogPath,
+	})
+	if err != nil {
+		return err
+	}
+	g.errorLogger = handler
+	return nil
+}
+
+// Type implements common.HasType.
+func (*Instance) Type() interface{} {
+	return (*Instance)(nil)
+}
+
+func (g *Instance) startInternal() error {
+	g.Lock()
+	defer g.Unlock()
+
+	if g.active {
+		return nil
+	}
+
+	g.active = true
+
+	if err := g.initAccessLogger(); err != nil {
+		return errors.New("failed to initialize access logger").Base(err).AtWarning()
+	}
+	if err := g.initErrorLogger(); err != nil {
+		return errors.New("failed to initialize error logger").Base(err).AtWarning()
+	}
+
+	return nil
+}
+
+// Start implements common.Runnable.Start().
+func (g *Instance) Start() error {
+	return g.startInternal()
+}
+
+// Handle implements log.Handler.
+func (g *Instance) Handle(msg log.Message) {
+	g.RLock()
+	defer g.RUnlock()
+
+	if !g.active {
+		return
+	}
+
+	var Msg log.Message
+	if g.config.MaskAddress != "" {
+		Msg = &MaskedMsgWrapper{
+			Message: msg,
+			Mask4:   g.mask4,
+			Mask6:   g.mask6,
+		}
+	} else {
+		Msg = msg
+	}
+
+	switch msg := msg.(type) {
+	case *log.AccessMessage:
+		if g.accessLogger != nil {
+			g.accessLogger.Handle(Msg)
+		}
+	case *log.DNSLog:
+		if g.dns && g.accessLogger != nil {
+			g.accessLogger.Handle(Msg)
+		}
+	case *log.GeneralMessage:
+		if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
+			g.errorLogger.Handle(Msg)
+		}
+	default:
+		// Swallow
+	}
+}
+
+// Close implements common.Closable.Close().
+func (g *Instance) Close() error {
+	errors.LogDebug(context.Background(), "Logger closing")
+
+	g.Lock()
+	defer g.Unlock()
+
+	if !g.active {
+		return nil
+	}
+
+	g.active = false
+
+	common.Close(g.accessLogger)
+	g.accessLogger = nil
+
+	common.Close(g.errorLogger)
+	g.errorLogger = nil
+
+	return nil
+}
+
+func ParseMaskAddress(c string) (int, int, error) {
+	var m4, m6 int
+	switch c {
+	case "half":
+		m4, m6 = 16, 32
+	case "quarter":
+		m4, m6 = 8, 16
+	case "full":
+		m4, m6 = 0, 0
+	case "":
+		// do nothing
+	default:
+		if parts := strings.Split(c, "+"); len(parts) > 0 {
+			if len(parts) >= 1 && parts[0] != "" {
+				i, err := strconv.Atoi(strings.TrimPrefix(parts[0], "/"))
+				if err != nil {
+					return 32, 128, err
+				}
+				m4 = i
+			}
+			if len(parts) >= 2 && parts[1] != "" {
+				i, err := strconv.Atoi(strings.TrimPrefix(parts[1], "/"))
+				if err != nil {
+					return 32, 128, err
+				}
+				m6 = i
+			}
+		}
+	}
+
+	if m4%8 != 0 || m4 > 32 || m4 < 0 {
+		return 32, 128, errors.New("Log Mask: ipv4 mask must be divisible by 8 and between 0-32")
+	}
+
+	return m4, m6, nil
+}
+
+// MaskedMsgWrapper is to wrap the string() method to mask IP addresses in the log.
+type MaskedMsgWrapper struct {
+	log.Message
+	Mask4 int
+	Mask6 int
+}
+
+var (
+	ipv4Regex = regexp.MustCompile(`(\d{1,3}\.){3}\d{1,3}`)
+	ipv6Regex = regexp.MustCompile(`(?:[\da-fA-F]{0,4}:[\da-fA-F]{0,4}){2,7}`)
+)
+
+func (m *MaskedMsgWrapper) String() string {
+	str := m.Message.String()
+
+	// Process ipv4
+	maskedMsg := ipv4Regex.ReplaceAllStringFunc(str, func(s string) string {
+		if m.Mask4 == 32 {
+			return s
+		}
+		if m.Mask4 == 0 {
+			return "[Masked IPv4]"
+		}
+
+		parts := strings.Split(s, ".")
+		for i := m.Mask4 / 8; i < 4; i++ {
+			parts[i] = "*"
+		}
+		return strings.Join(parts, ".")
+	})
+
+	// process ipv6
+	maskedMsg = ipv6Regex.ReplaceAllStringFunc(maskedMsg, func(s string) string {
+		if m.Mask6 == 128 {
+			return s
+		}
+		if m.Mask6 == 0 {
+			return "Masked IPv6"
+		}
+		ip := net.ParseIP(s)
+		if ip == nil {
+			return s
+		}
+		return ip.Mask(net.CIDRMask(m.Mask6, 128)).String() + "/" + strconv.Itoa(m.Mask6)
+	})
+
+	return maskedMsg
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		return New(ctx, config.(*Config))
+	}))
+}

subproject/Xray-core-main/app/log/log_creator.go

@@ -0,0 +1,60 @@
+package log
+
+import (
+	"sync"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/log"
+)
+
+type HandlerCreatorOptions struct {
+	Path string
+}
+
+type HandlerCreator func(LogType, HandlerCreatorOptions) (log.Handler, error)
+
+var handlerCreatorMap = make(map[LogType]HandlerCreator)
+
+var handlerCreatorMapLock = &sync.RWMutex{}
+
+func RegisterHandlerCreator(logType LogType, f HandlerCreator) error {
+	if f == nil {
+		return errors.New("nil HandlerCreator")
+	}
+
+	handlerCreatorMapLock.Lock()
+	defer handlerCreatorMapLock.Unlock()
+
+	handlerCreatorMap[logType] = f
+	return nil
+}
+
+func createHandler(logType LogType, options HandlerCreatorOptions) (log.Handler, error) {
+	handlerCreatorMapLock.RLock()
+	defer handlerCreatorMapLock.RUnlock()
+
+	creator, found := handlerCreatorMap[logType]
+	if !found {
+		return nil, errors.New("unable to create log handler for ", logType)
+	}
+	return creator(logType, options)
+}
+
+func init() {
+	common.Must(RegisterHandlerCreator(LogType_Console, func(lt LogType, options HandlerCreatorOptions) (log.Handler, error) {
+		return log.NewLogger(log.CreateStdoutLogWriter()), nil
+	}))
+
+	common.Must(RegisterHandlerCreator(LogType_File, func(lt LogType, options HandlerCreatorOptions) (log.Handler, error) {
+		creator, err := log.CreateFileLogWriter(options.Path)
+		if err != nil {
+			return nil, err
+		}
+		return log.NewLogger(creator), nil
+	}))
+
+	common.Must(RegisterHandlerCreator(LogType_None, func(lt LogType, options HandlerCreatorOptions) (log.Handler, error) {
+		return nil, nil
+	}))
+}

subproject/Xray-core-main/app/log/log_test.go

@@ -0,0 +1,89 @@
+package log_test
+
+import (
+	"context"
+	"net"
+	"testing"
+
+	"github.com/golang/mock/gomock"
+	"github.com/xtls/xray-core/app/log"
+	"github.com/xtls/xray-core/common"
+	clog "github.com/xtls/xray-core/common/log"
+	"github.com/xtls/xray-core/testing/mocks"
+)
+
+func TestCustomLogHandler(t *testing.T) {
+	mockCtl := gomock.NewController(t)
+	defer mockCtl.Finish()
+
+	var loggedValue []string
+
+	mockHandler := mocks.NewLogHandler(mockCtl)
+	mockHandler.EXPECT().Handle(gomock.Any()).AnyTimes().DoAndReturn(func(msg clog.Message) {
+		loggedValue = append(loggedValue, msg.String())
+	})
+
+	log.RegisterHandlerCreator(log.LogType_Console, func(lt log.LogType, options log.HandlerCreatorOptions) (clog.Handler, error) {
+		return mockHandler, nil
+	})
+
+	logger, err := log.New(context.Background(), &log.Config{
+		ErrorLogLevel: clog.Severity_Debug,
+		ErrorLogType:  log.LogType_Console,
+		AccessLogType: log.LogType_None,
+	})
+	common.Must(err)
+
+	common.Must(logger.Start())
+
+	clog.Record(&clog.GeneralMessage{
+		Severity: clog.Severity_Debug,
+		Content:  "test",
+	})
+
+	if len(loggedValue) < 2 {
+		t.Fatal("expected 2 log messages, but actually ", loggedValue)
+	}
+
+	if loggedValue[1] != "[Debug] test" {
+		t.Fatal("expected '[Debug] test', but actually ", loggedValue[1])
+	}
+
+	common.Must(logger.Close())
+}
+
+func TestMaskAddress(t *testing.T) {
+	m4, m6, err := log.ParseMaskAddress("half")
+	if err != nil {
+		t.Fatal(err)
+	}
+	maskedAddr := log.MaskedMsgWrapper{
+		Mask4: m4,
+		Mask6: m6,
+	}
+	maskedAddr.Message = net.ParseIP("11.45.1.4")
+	if maskedAddr.String() != "11.45.*.*" {
+		t.Fatal("expected '11.45.*.*', but actually ", maskedAddr.String())
+	}
+	maskedAddr.Message = net.ParseIP("11:45:14:19:19:81:0::")
+	if maskedAddr.String() != "11:45::/32" {
+		t.Fatal("expected '11:45::/32', but actually", maskedAddr.String())
+	}
+
+	m4, m6, err = log.ParseMaskAddress("/16+/64")
+	if err != nil {
+		t.Fatal(err)
+	}
+	maskedAddr = log.MaskedMsgWrapper{
+		Mask4: m4,
+		Mask6: m6,
+	}
+	maskedAddr.Message = net.ParseIP("11.45.1.4")
+	if maskedAddr.String() != "11.45.*.*" {
+		t.Fatal("expected '11.45.*.*', but actually ", maskedAddr.String())
+	}
+	maskedAddr.Message = net.ParseIP("11:45:14:19:19:81:0::")
+	if maskedAddr.String() != "11:45:14:19::/64" {
+		t.Fatal("expected '11:45:14:19::/64', but actually", maskedAddr.String())
+	}
+}

subproject/Xray-core-main/app/metrics/config.pb.go

@@ -0,0 +1,134 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/metrics/config.proto
+
+package metrics
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+// Config is the settings for metrics.
+type Config struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// Tag of the outbound handler that handles metrics http connections.
+	Tag           string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
+	Listen        string `protobuf:"bytes,2,opt,name=listen,proto3" json:"listen,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_metrics_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_metrics_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_metrics_config_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *Config) GetTag() string {
+	if x != nil {
+		return x.Tag
+	}
+	return ""
+}
+
+func (x *Config) GetListen() string {
+	if x != nil {
+		return x.Listen
+	}
+	return ""
+}
+
+var File_app_metrics_config_proto protoreflect.FileDescriptor
+
+const file_app_metrics_config_proto_rawDesc = "" +
+	"\n" +
+	"\x18app/metrics/config.proto\x12\x10xray.app.metrics\"2\n" +
+	"\x06Config\x12\x10\n" +
+	"\x03tag\x18\x01 \x01(\tR\x03tag\x12\x16\n" +
+	"\x06listen\x18\x02 \x01(\tR\x06listenBR\n" +
+	"\x14com.xray.app.metricsP\x01Z%github.com/xtls/xray-core/app/metrics\xaa\x02\x10Xray.App.Metricsb\x06proto3"
+
+var (
+	file_app_metrics_config_proto_rawDescOnce sync.Once
+	file_app_metrics_config_proto_rawDescData []byte
+)
+
+func file_app_metrics_config_proto_rawDescGZIP() []byte {
+	file_app_metrics_config_proto_rawDescOnce.Do(func() {
+		file_app_metrics_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_metrics_config_proto_rawDesc), len(file_app_metrics_config_proto_rawDesc)))
+	})
+	return file_app_metrics_config_proto_rawDescData
+}
+
+var file_app_metrics_config_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
+var file_app_metrics_config_proto_goTypes = []any{
+	(*Config)(nil), // 0: xray.app.metrics.Config
+}
+var file_app_metrics_config_proto_depIdxs = []int32{
+	0, // [0:0] is the sub-list for method output_type
+	0, // [0:0] is the sub-list for method input_type
+	0, // [0:0] is the sub-list for extension type_name
+	0, // [0:0] is the sub-list for extension extendee
+	0, // [0:0] is the sub-list for field type_name
+}
+
+func init() { file_app_metrics_config_proto_init() }
+func file_app_metrics_config_proto_init() {
+	if File_app_metrics_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_metrics_config_proto_rawDesc), len(file_app_metrics_config_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   1,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_metrics_config_proto_goTypes,
+		DependencyIndexes: file_app_metrics_config_proto_depIdxs,
+		MessageInfos:      file_app_metrics_config_proto_msgTypes,
+	}.Build()
+	File_app_metrics_config_proto = out.File
+	file_app_metrics_config_proto_goTypes = nil
+	file_app_metrics_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/metrics/config.proto

@@ -0,0 +1,14 @@
+syntax = "proto3";
+
+package xray.app.metrics;
+option csharp_namespace = "Xray.App.Metrics";
+option go_package = "github.com/xtls/xray-core/app/metrics";
+option java_package = "com.xray.app.metrics";
+option java_multiple_files = true;
+
+// Config is the settings for metrics.
+message Config {
+  // Tag of the outbound handler that handles metrics http connections.
+  string tag = 1;
+  string listen = 2;
+}

subproject/Xray-core-main/app/metrics/metrics.go

@@ -0,0 +1,139 @@
+package metrics
+
+import (
+	"context"
+	"expvar"
+	"net/http"
+	_ "net/http/pprof"
+	"strings"
+
+	"github.com/xtls/xray-core/app/observatory"
+	"github.com/xtls/xray-core/app/stats"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/signal/done"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/extension"
+	"github.com/xtls/xray-core/features/outbound"
+	feature_stats "github.com/xtls/xray-core/features/stats"
+)
+
+type MetricsHandler struct {
+	ohm          outbound.Manager
+	statsManager feature_stats.Manager
+	observatory  extension.Observatory
+	tag          string
+	listen       string
+	tcpListener  net.Listener
+}
+
+// NewMetricsHandler creates a new MetricsHandler based on the given config.
+func NewMetricsHandler(ctx context.Context, config *Config) (*MetricsHandler, error) {
+	c := &MetricsHandler{
+		tag:    config.Tag,
+		listen: config.Listen,
+	}
+	common.Must(core.RequireFeatures(ctx, func(om outbound.Manager, sm feature_stats.Manager) {
+		c.statsManager = sm
+		c.ohm = om
+	}))
+	expvar.Publish("stats", expvar.Func(func() interface{} {
+		manager, ok := c.statsManager.(*stats.Manager)
+		if !ok {
+			return nil
+		}
+		resp := map[string]map[string]map[string]int64{
+			"inbound":  {},
+			"outbound": {},
+			"user":     {},
+		}
+		manager.VisitCounters(func(name string, counter feature_stats.Counter) bool {
+			nameSplit := strings.Split(name, ">>>")
+			typeName, tagOrUser, direction := nameSplit[0], nameSplit[1], nameSplit[3]
+			if item, found := resp[typeName][tagOrUser]; found {
+				item[direction] = counter.Value()
+			} else {
+				resp[typeName][tagOrUser] = map[string]int64{
+					direction: counter.Value(),
+				}
+			}
+			return true
+		})
+		return resp
+	}))
+	expvar.Publish("observatory", expvar.Func(func() interface{} {
+		if c.observatory == nil {
+			common.Must(core.RequireFeatures(ctx, func(observatory extension.Observatory) error {
+				c.observatory = observatory
+				return nil
+			}))
+			if c.observatory == nil {
+				return nil
+			}
+		}
+		resp := map[string]*observatory.OutboundStatus{}
+		if o, err := c.observatory.GetObservation(context.Background()); err != nil {
+			return err
+		} else {
+			for _, x := range o.(*observatory.ObservationResult).GetStatus() {
+				resp[x.OutboundTag] = x
+			}
+		}
+		return resp
+	}))
+	return c, nil
+}
+
+func (p *MetricsHandler) Type() interface{} {
+	return (*MetricsHandler)(nil)
+}
+
+func (p *MetricsHandler) Start() error {
+
+	// direct listen a port if listen is set
+	if p.listen != "" {
+		TCPlistener, err := net.Listen("tcp", p.listen)
+		if err != nil {
+			return err
+		}
+		p.tcpListener = TCPlistener
+		errors.LogInfo(context.Background(), "Metrics server listening on ", p.listen)
+
+		go func() {
+			if err := http.Serve(TCPlistener, http.DefaultServeMux); err != nil {
+				errors.LogErrorInner(context.Background(), err, "failed to start metrics server")
+			}
+		}()
+	}
+
+	listener := &OutboundListener{
+		buffer: make(chan net.Conn, 4),
+		done:   done.New(),
+	}
+
+	go func() {
+		if err := http.Serve(listener, http.DefaultServeMux); err != nil {
+			errors.LogErrorInner(context.Background(), err, "failed to start metrics server")
+		}
+	}()
+
+	if err := p.ohm.RemoveHandler(context.Background(), p.tag); err != nil {
+		errors.LogInfo(context.Background(), "failed to remove existing handler")
+	}
+
+	return p.ohm.AddHandler(context.Background(), &Outbound{
+		tag:      p.tag,
+		listener: listener,
+	})
+}
+
+func (p *MetricsHandler) Close() error {
+	return nil
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
+		return NewMetricsHandler(ctx, cfg.(*Config))
+	}))
+}

subproject/Xray-core-main/app/metrics/outbound.go

@@ -0,0 +1,121 @@
+package metrics
+
+import (
+	"context"
+	"sync"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/net/cnc"
+	"github.com/xtls/xray-core/common/serial"
+	"github.com/xtls/xray-core/common/signal/done"
+	"github.com/xtls/xray-core/transport"
+)
+
+// OutboundListener is a net.Listener for listening metrics http connections.
+type OutboundListener struct {
+	buffer chan net.Conn
+	done   *done.Instance
+}
+
+func (l *OutboundListener) add(conn net.Conn) {
+	select {
+	case l.buffer <- conn:
+	case <-l.done.Wait():
+		conn.Close()
+	default:
+		conn.Close()
+	}
+}
+
+// Accept implements net.Listener.
+func (l *OutboundListener) Accept() (net.Conn, error) {
+	select {
+	case <-l.done.Wait():
+		return nil, errors.New("listen closed")
+	case c := <-l.buffer:
+		return c, nil
+	}
+}
+
+// Close implement net.Listener.
+func (l *OutboundListener) Close() error {
+	common.Must(l.done.Close())
+L:
+	for {
+		select {
+		case c := <-l.buffer:
+			c.Close()
+		default:
+			break L
+		}
+	}
+	return nil
+}
+
+// Addr implements net.Listener.
+func (l *OutboundListener) Addr() net.Addr {
+	return &net.TCPAddr{
+		IP:   net.IP{0, 0, 0, 0},
+		Port: 0,
+	}
+}
+
+// Outbound is an outbound.Handler that handles metrics http connections.
+type Outbound struct {
+	tag      string
+	listener *OutboundListener
+	access   sync.RWMutex
+	closed   bool
+}
+
+// Dispatch implements outbound.Handler.
+func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
+	co.access.RLock()
+
+	if co.closed {
+		common.Interrupt(link.Reader)
+		common.Interrupt(link.Writer)
+		co.access.RUnlock()
+		return
+	}
+
+	closeSignal := done.New()
+	c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
+	co.listener.add(c)
+	co.access.RUnlock()
+	<-closeSignal.Wait()
+}
+
+// Tag implements outbound.Handler.
+func (co *Outbound) Tag() string {
+	return co.tag
+}
+
+// Start implements common.Runnable.
+func (co *Outbound) Start() error {
+	co.access.Lock()
+	co.closed = false
+	co.access.Unlock()
+	return nil
+}
+
+// Close implements common.Closable.
+func (co *Outbound) Close() error {
+	co.access.Lock()
+	defer co.access.Unlock()
+
+	co.closed = true
+	return co.listener.Close()
+}
+
+// SenderSettings implements outbound.Handler.
+func (co *Outbound) SenderSettings() *serial.TypedMessage {
+	return nil
+}
+
+// ProxySettings implements outbound.Handler.
+func (co *Outbound) ProxySettings() *serial.TypedMessage {
+	return nil
+}

subproject/Xray-core-main/app/observatory/burst/burst.go

@@ -0,0 +1,12 @@
+package burst
+
+import (
+	"math"
+	"time"
+)
+
+const (
+	rttFailed = time.Duration(math.MaxInt64 - iota)
+	rttUntested
+	rttUnqualified
+)

subproject/Xray-core-main/app/observatory/burst/burstobserver.go

@@ -0,0 +1,117 @@
+package burst
+
+import (
+	"context"
+
+	"sync"
+
+	"github.com/xtls/xray-core/app/observatory"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/signal/done"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/extension"
+	"github.com/xtls/xray-core/features/outbound"
+	"github.com/xtls/xray-core/features/routing"
+	"google.golang.org/protobuf/proto"
+)
+
+type Observer struct {
+	config *Config
+	ctx    context.Context
+
+	statusLock sync.Mutex
+	hp         *HealthPing
+
+	finished *done.Instance
+
+	ohm outbound.Manager
+}
+
+func (o *Observer) GetObservation(ctx context.Context) (proto.Message, error) {
+	return &observatory.ObservationResult{Status: o.createResult()}, nil
+}
+
+func (o *Observer) Check(tag []string) {
+	o.hp.Check(tag)
+}
+
+func (o *Observer) createResult() []*observatory.OutboundStatus {
+	var result []*observatory.OutboundStatus
+	o.hp.access.Lock()
+	defer o.hp.access.Unlock()
+	for name, value := range o.hp.Results {
+		status := observatory.OutboundStatus{
+			Alive:           value.getStatistics().All != value.getStatistics().Fail,
+			Delay:           value.getStatistics().Average.Milliseconds(),
+			LastErrorReason: "",
+			OutboundTag:     name,
+			LastSeenTime:    0,
+			LastTryTime:     0,
+			HealthPing: &observatory.HealthPingMeasurementResult{
+				All:       int64(value.getStatistics().All),
+				Fail:      int64(value.getStatistics().Fail),
+				Deviation: int64(value.getStatistics().Deviation),
+				Average:   int64(value.getStatistics().Average),
+				Max:       int64(value.getStatistics().Max),
+				Min:       int64(value.getStatistics().Min),
+			},
+		}
+		result = append(result, &status)
+	}
+	return result
+}
+
+func (o *Observer) Type() interface{} {
+	return extension.ObservatoryType()
+}
+
+func (o *Observer) Start() error {
+	if o.config != nil && len(o.config.SubjectSelector) != 0 {
+		o.finished = done.New()
+		o.hp.StartScheduler(func() ([]string, error) {
+			hs, ok := o.ohm.(outbound.HandlerSelector)
+			if !ok {
+
+				return nil, errors.New("outbound.Manager is not a HandlerSelector")
+			}
+
+			outbounds := hs.Select(o.config.SubjectSelector)
+			return outbounds, nil
+		})
+	}
+	return nil
+}
+
+func (o *Observer) Close() error {
+	if o.finished != nil {
+		o.hp.StopScheduler()
+		return o.finished.Close()
+	}
+	return nil
+}
+
+func New(ctx context.Context, config *Config) (*Observer, error) {
+	var outboundManager outbound.Manager
+	var dispatcher routing.Dispatcher
+	err := core.RequireFeatures(ctx, func(om outbound.Manager, rd routing.Dispatcher) {
+		outboundManager = om
+		dispatcher = rd
+	})
+	if err != nil {
+		return nil, errors.New("Cannot get depended features").Base(err)
+	}
+	hp := NewHealthPing(ctx, dispatcher, config.PingConfig)
+	return &Observer{
+		config: config,
+		ctx:    ctx,
+		ohm:    outboundManager,
+		hp:     hp,
+	}, nil
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		return New(ctx, config.(*Config))
+	}))
+}

subproject/Xray-core-main/app/observatory/burst/config.pb.go

@@ -0,0 +1,236 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/observatory/burst/config.proto
+
+package burst
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type Config struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// @Document The selectors for outbound under observation
+	SubjectSelector []string          `protobuf:"bytes,2,rep,name=subject_selector,json=subjectSelector,proto3" json:"subject_selector,omitempty"`
+	PingConfig      *HealthPingConfig `protobuf:"bytes,3,opt,name=ping_config,json=pingConfig,proto3" json:"ping_config,omitempty"`
+	unknownFields   protoimpl.UnknownFields
+	sizeCache       protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_observatory_burst_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_burst_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_observatory_burst_config_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *Config) GetSubjectSelector() []string {
+	if x != nil {
+		return x.SubjectSelector
+	}
+	return nil
+}
+
+func (x *Config) GetPingConfig() *HealthPingConfig {
+	if x != nil {
+		return x.PingConfig
+	}
+	return nil
+}
+
+type HealthPingConfig struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// destination url, need 204 for success return
+	// default https://connectivitycheck.gstatic.com/generate_204
+	Destination string `protobuf:"bytes,1,opt,name=destination,proto3" json:"destination,omitempty"`
+	// connectivity check url
+	Connectivity string `protobuf:"bytes,2,opt,name=connectivity,proto3" json:"connectivity,omitempty"`
+	// health check interval, int64 values of time.Duration
+	Interval int64 `protobuf:"varint,3,opt,name=interval,proto3" json:"interval,omitempty"`
+	// sampling count is the amount of recent ping results which are kept for calculation
+	SamplingCount int32 `protobuf:"varint,4,opt,name=samplingCount,proto3" json:"samplingCount,omitempty"`
+	// ping timeout, int64 values of time.Duration
+	Timeout int64 `protobuf:"varint,5,opt,name=timeout,proto3" json:"timeout,omitempty"`
+	// http method to make request
+	HttpMethod    string `protobuf:"bytes,6,opt,name=httpMethod,proto3" json:"httpMethod,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *HealthPingConfig) Reset() {
+	*x = HealthPingConfig{}
+	mi := &file_app_observatory_burst_config_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *HealthPingConfig) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*HealthPingConfig) ProtoMessage() {}
+
+func (x *HealthPingConfig) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_burst_config_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use HealthPingConfig.ProtoReflect.Descriptor instead.
+func (*HealthPingConfig) Descriptor() ([]byte, []int) {
+	return file_app_observatory_burst_config_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *HealthPingConfig) GetDestination() string {
+	if x != nil {
+		return x.Destination
+	}
+	return ""
+}
+
+func (x *HealthPingConfig) GetConnectivity() string {
+	if x != nil {
+		return x.Connectivity
+	}
+	return ""
+}
+
+func (x *HealthPingConfig) GetInterval() int64 {
+	if x != nil {
+		return x.Interval
+	}
+	return 0
+}
+
+func (x *HealthPingConfig) GetSamplingCount() int32 {
+	if x != nil {
+		return x.SamplingCount
+	}
+	return 0
+}
+
+func (x *HealthPingConfig) GetTimeout() int64 {
+	if x != nil {
+		return x.Timeout
+	}
+	return 0
+}
+
+func (x *HealthPingConfig) GetHttpMethod() string {
+	if x != nil {
+		return x.HttpMethod
+	}
+	return ""
+}
+
+var File_app_observatory_burst_config_proto protoreflect.FileDescriptor
+
+const file_app_observatory_burst_config_proto_rawDesc = "" +
+	"\n" +
+	"\"app/observatory/burst/config.proto\x12\x1fxray.core.app.observatory.burst\"\x87\x01\n" +
+	"\x06Config\x12)\n" +
+	"\x10subject_selector\x18\x02 \x03(\tR\x0fsubjectSelector\x12R\n" +
+	"\vping_config\x18\x03 \x01(\v21.xray.core.app.observatory.burst.HealthPingConfigR\n" +
+	"pingConfig\"\xd4\x01\n" +
+	"\x10HealthPingConfig\x12 \n" +
+	"\vdestination\x18\x01 \x01(\tR\vdestination\x12\"\n" +
+	"\fconnectivity\x18\x02 \x01(\tR\fconnectivity\x12\x1a\n" +
+	"\binterval\x18\x03 \x01(\x03R\binterval\x12$\n" +
+	"\rsamplingCount\x18\x04 \x01(\x05R\rsamplingCount\x12\x18\n" +
+	"\atimeout\x18\x05 \x01(\x03R\atimeout\x12\x1e\n" +
+	"\n" +
+	"httpMethod\x18\x06 \x01(\tR\n" +
+	"httpMethodBp\n" +
+	"\x1ecom.xray.app.observatory.burstP\x01Z/github.com/xtls/xray-core/app/observatory/burst\xaa\x02\x1aXray.App.Observatory.Burstb\x06proto3"
+
+var (
+	file_app_observatory_burst_config_proto_rawDescOnce sync.Once
+	file_app_observatory_burst_config_proto_rawDescData []byte
+)
+
+func file_app_observatory_burst_config_proto_rawDescGZIP() []byte {
+	file_app_observatory_burst_config_proto_rawDescOnce.Do(func() {
+		file_app_observatory_burst_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_observatory_burst_config_proto_rawDesc), len(file_app_observatory_burst_config_proto_rawDesc)))
+	})
+	return file_app_observatory_burst_config_proto_rawDescData
+}
+
+var file_app_observatory_burst_config_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
+var file_app_observatory_burst_config_proto_goTypes = []any{
+	(*Config)(nil),           // 0: xray.core.app.observatory.burst.Config
+	(*HealthPingConfig)(nil), // 1: xray.core.app.observatory.burst.HealthPingConfig
+}
+var file_app_observatory_burst_config_proto_depIdxs = []int32{
+	1, // 0: xray.core.app.observatory.burst.Config.ping_config:type_name -> xray.core.app.observatory.burst.HealthPingConfig
+	1, // [1:1] is the sub-list for method output_type
+	1, // [1:1] is the sub-list for method input_type
+	1, // [1:1] is the sub-list for extension type_name
+	1, // [1:1] is the sub-list for extension extendee
+	0, // [0:1] is the sub-list for field type_name
+}
+
+func init() { file_app_observatory_burst_config_proto_init() }
+func file_app_observatory_burst_config_proto_init() {
+	if File_app_observatory_burst_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_observatory_burst_config_proto_rawDesc), len(file_app_observatory_burst_config_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   2,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_observatory_burst_config_proto_goTypes,
+		DependencyIndexes: file_app_observatory_burst_config_proto_depIdxs,
+		MessageInfos:      file_app_observatory_burst_config_proto_msgTypes,
+	}.Build()
+	File_app_observatory_burst_config_proto = out.File
+	file_app_observatory_burst_config_proto_goTypes = nil
+	file_app_observatory_burst_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/observatory/burst/config.proto

@@ -0,0 +1,32 @@
+syntax = "proto3";
+
+package xray.core.app.observatory.burst;
+option csharp_namespace = "Xray.App.Observatory.Burst";
+option go_package = "github.com/xtls/xray-core/app/observatory/burst";
+option java_package = "com.xray.app.observatory.burst";
+option java_multiple_files = true;
+
+message Config {
+  /* @Document The selectors for outbound under observation
+  */
+  repeated string subject_selector = 2;
+
+  HealthPingConfig ping_config = 3;
+}
+
+message HealthPingConfig {
+  // destination url, need 204 for success return
+  // default https://connectivitycheck.gstatic.com/generate_204
+  string destination = 1;
+  // connectivity check url
+  string connectivity = 2;
+  // health check interval, int64 values of time.Duration
+  int64 interval = 3;
+  // sampling count is the amount of recent ping results which are kept for calculation
+  int32 samplingCount = 4;
+  // ping timeout, int64 values of time.Duration
+  int64 timeout = 5;
+  // http method to make request
+  string httpMethod = 6;
+
+}

subproject/Xray-core-main/app/observatory/burst/healthping.go

@@ -0,0 +1,268 @@
+package burst
+
+import (
+	"context"
+	"fmt"
+	"strings"
+	"sync"
+	"time"
+
+	"github.com/xtls/xray-core/common/dice"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/features/routing"
+)
+
+// HealthPingSettings holds settings for health Checker
+type HealthPingSettings struct {
+	Destination   string        `json:"destination"`
+	Connectivity  string        `json:"connectivity"`
+	Interval      time.Duration `json:"interval"`
+	SamplingCount int           `json:"sampling"`
+	Timeout       time.Duration `json:"timeout"`
+	HttpMethod    string        `json:"httpMethod"`
+}
+
+// HealthPing is the health checker for balancers
+type HealthPing struct {
+	ctx         context.Context
+	dispatcher  routing.Dispatcher
+	access      sync.Mutex
+	ticker      *time.Ticker
+	tickerClose chan struct{}
+
+	Settings *HealthPingSettings
+	Results  map[string]*HealthPingRTTS
+}
+
+// NewHealthPing creates a new HealthPing with settings
+func NewHealthPing(ctx context.Context, dispatcher routing.Dispatcher, config *HealthPingConfig) *HealthPing {
+	settings := &HealthPingSettings{}
+	if config != nil {
+
+		var httpMethod string
+		if config.HttpMethod == "" {
+			httpMethod = "HEAD"
+		} else {
+			httpMethod = strings.TrimSpace(config.HttpMethod)
+		}
+
+		settings = &HealthPingSettings{
+			Connectivity:  strings.TrimSpace(config.Connectivity),
+			Destination:   strings.TrimSpace(config.Destination),
+			Interval:      time.Duration(config.Interval),
+			SamplingCount: int(config.SamplingCount),
+			Timeout:       time.Duration(config.Timeout),
+			HttpMethod:    httpMethod,
+		}
+	}
+	if settings.Destination == "" {
+		// Destination URL, need 204 for success return default to chromium
+		// https://github.com/chromium/chromium/blob/main/components/safety_check/url_constants.cc#L10
+		// https://chromium.googlesource.com/chromium/src/+/refs/heads/main/components/safety_check/url_constants.cc#10
+		settings.Destination = "https://connectivitycheck.gstatic.com/generate_204"
+	}
+	if settings.Interval == 0 {
+		settings.Interval = time.Duration(1) * time.Minute
+	} else if settings.Interval < 10 {
+		errors.LogWarning(ctx, "health check interval is too small, 10s is applied")
+		settings.Interval = time.Duration(10) * time.Second
+	}
+	if settings.SamplingCount <= 0 {
+		settings.SamplingCount = 10
+	}
+	if settings.Timeout <= 0 {
+		// results are saved after all health pings finish,
+		// a larger timeout could possibly makes checks run longer
+		settings.Timeout = time.Duration(5) * time.Second
+	}
+	return &HealthPing{
+		ctx:        ctx,
+		dispatcher: dispatcher,
+		Settings:   settings,
+		Results:    nil,
+	}
+}
+
+// StartScheduler implements the HealthChecker
+func (h *HealthPing) StartScheduler(selector func() ([]string, error)) {
+	if h.ticker != nil {
+		return
+	}
+	interval := h.Settings.Interval * time.Duration(h.Settings.SamplingCount)
+	ticker := time.NewTicker(interval)
+	tickerClose := make(chan struct{})
+	h.ticker = ticker
+	h.tickerClose = tickerClose
+	go func() {
+		tags, err := selector()
+		if err != nil {
+			errors.LogWarning(h.ctx, "error select outbounds for initial health check: ", err)
+			return
+		}
+		h.Check(tags)
+	}()
+
+	go func() {
+		for {
+			go func() {
+				tags, err := selector()
+				if err != nil {
+					errors.LogWarning(h.ctx, "error select outbounds for scheduled health check: ", err)
+					return
+				}
+				h.doCheck(tags, interval, h.Settings.SamplingCount)
+				h.Cleanup(tags)
+			}()
+			select {
+			case <-ticker.C:
+				continue
+			case <-tickerClose:
+				return
+			}
+		}
+	}()
+}
+
+// StopScheduler implements the HealthChecker
+func (h *HealthPing) StopScheduler() {
+	if h.ticker == nil {
+		return
+	}
+	h.ticker.Stop()
+	h.ticker = nil
+	close(h.tickerClose)
+	h.tickerClose = nil
+}
+
+// Check implements the HealthChecker
+func (h *HealthPing) Check(tags []string) error {
+	if len(tags) == 0 {
+		return nil
+	}
+	errors.LogInfo(h.ctx, "perform one-time health check for tags ", tags)
+	h.doCheck(tags, 0, 1)
+	return nil
+}
+
+type rtt struct {
+	handler string
+	value   time.Duration
+}
+
+// doCheck performs the 'rounds' amount checks in given 'duration'. You should make
+// sure all tags are valid for current balancer
+func (h *HealthPing) doCheck(tags []string, duration time.Duration, rounds int) {
+	count := len(tags) * rounds
+	if count == 0 {
+		return
+	}
+	ch := make(chan *rtt, count)
+
+	for _, tag := range tags {
+		handler := tag
+		client := newPingClient(
+			h.ctx,
+			h.dispatcher,
+			h.Settings.Destination,
+			h.Settings.Timeout,
+			handler,
+		)
+		for i := 0; i < rounds; i++ {
+			delay := time.Duration(0)
+			if duration > 0 {
+				delay = time.Duration(dice.RollInt63n(int64(duration)))
+			}
+			time.AfterFunc(delay, func() {
+				errors.LogDebug(h.ctx, "checking ", handler)
+				delay, err := client.MeasureDelay(h.Settings.HttpMethod)
+				if err == nil {
+					ch <- &rtt{
+						handler: handler,
+						value:   delay,
+					}
+					return
+				}
+				if !h.checkConnectivity() {
+					errors.LogWarning(h.ctx, "network is down")
+					ch <- &rtt{
+						handler: handler,
+						value:   0,
+					}
+					return
+				}
+				errors.LogWarning(h.ctx, fmt.Sprintf(
+					"error ping %s with %s: %s",
+					h.Settings.Destination,
+					handler,
+					err,
+				))
+				ch <- &rtt{
+					handler: handler,
+					value:   rttFailed,
+				}
+			})
+		}
+	}
+	for i := 0; i < count; i++ {
+		rtt := <-ch
+		if rtt.value > 0 {
+			// should not put results when network is down
+			h.PutResult(rtt.handler, rtt.value)
+		}
+	}
+}
+
+// PutResult put a ping rtt to results
+func (h *HealthPing) PutResult(tag string, rtt time.Duration) {
+	h.access.Lock()
+	defer h.access.Unlock()
+	if h.Results == nil {
+		h.Results = make(map[string]*HealthPingRTTS)
+	}
+	r, ok := h.Results[tag]
+	if !ok {
+		// validity is 2 times to sampling period, since the check are
+		// distributed in the time line randomly, in extreme cases,
+		// Previous checks are distributed on the left, and later ones
+		// on the right
+		validity := h.Settings.Interval * time.Duration(h.Settings.SamplingCount) * 2
+		r = NewHealthPingResult(h.Settings.SamplingCount, validity)
+		h.Results[tag] = r
+	}
+	r.Put(rtt)
+}
+
+// Cleanup removes results of removed handlers,
+// tags should be all valid tags of the Balancer now
+func (h *HealthPing) Cleanup(tags []string) {
+	h.access.Lock()
+	defer h.access.Unlock()
+	for tag := range h.Results {
+		found := false
+		for _, v := range tags {
+			if tag == v {
+				found = true
+				break
+			}
+		}
+		if !found {
+			delete(h.Results, tag)
+		}
+	}
+}
+
+// checkConnectivity checks the network connectivity, it returns
+// true if network is good or "connectivity check url" not set
+func (h *HealthPing) checkConnectivity() bool {
+	if h.Settings.Connectivity == "" {
+		return true
+	}
+	tester := newDirectPingClient(
+		h.Settings.Connectivity,
+		h.Settings.Timeout,
+	)
+	if _, err := tester.MeasureDelay(h.Settings.HttpMethod); err != nil {
+		return false
+	}
+	return true
+}

subproject/Xray-core-main/app/observatory/burst/healthping_result.go

@@ -0,0 +1,143 @@
+package burst
+
+import (
+	"math"
+	"time"
+)
+
+// HealthPingStats is the statistics of HealthPingRTTS
+type HealthPingStats struct {
+	All       int
+	Fail      int
+	Deviation time.Duration
+	Average   time.Duration
+	Max       time.Duration
+	Min       time.Duration
+}
+
+// HealthPingRTTS holds ping rtts for health Checker
+type HealthPingRTTS struct {
+	idx      int
+	cap      int
+	validity time.Duration
+	rtts     []*pingRTT
+
+	lastUpdateAt time.Time
+	stats        *HealthPingStats
+}
+
+type pingRTT struct {
+	time  time.Time
+	value time.Duration
+}
+
+// NewHealthPingResult returns a *HealthPingResult with specified capacity
+func NewHealthPingResult(cap int, validity time.Duration) *HealthPingRTTS {
+	return &HealthPingRTTS{cap: cap, validity: validity}
+}
+
+// Get gets statistics of the HealthPingRTTS
+func (h *HealthPingRTTS) Get() *HealthPingStats {
+	return h.getStatistics()
+}
+
+// GetWithCache get statistics and write cache for next call
+// Make sure use Mutex.Lock() before calling it, RWMutex.RLock()
+// is not an option since it writes cache
+func (h *HealthPingRTTS) GetWithCache() *HealthPingStats {
+	lastPutAt := h.rtts[h.idx].time
+	now := time.Now()
+	if h.stats == nil || h.lastUpdateAt.Before(lastPutAt) || h.findOutdated(now) >= 0 {
+		h.stats = h.getStatistics()
+		h.lastUpdateAt = now
+	}
+	return h.stats
+}
+
+// Put puts a new rtt to the HealthPingResult
+func (h *HealthPingRTTS) Put(d time.Duration) {
+	if h.rtts == nil {
+		h.rtts = make([]*pingRTT, h.cap)
+		for i := 0; i < h.cap; i++ {
+			h.rtts[i] = &pingRTT{}
+		}
+		h.idx = -1
+	}
+	h.idx = h.calcIndex(1)
+	now := time.Now()
+	h.rtts[h.idx].time = now
+	h.rtts[h.idx].value = d
+}
+
+func (h *HealthPingRTTS) calcIndex(step int) int {
+	idx := h.idx
+	idx += step
+	if idx >= h.cap {
+		idx %= h.cap
+	}
+	return idx
+}
+
+func (h *HealthPingRTTS) getStatistics() *HealthPingStats {
+	stats := &HealthPingStats{}
+	stats.Fail = 0
+	stats.Max = 0
+	stats.Min = rttFailed
+	sum := time.Duration(0)
+	cnt := 0
+	validRTTs := make([]time.Duration, 0)
+	for _, rtt := range h.rtts {
+		switch {
+		case rtt.value == 0 || time.Since(rtt.time) > h.validity:
+			continue
+		case rtt.value == rttFailed:
+			stats.Fail++
+			continue
+		}
+		cnt++
+		sum += rtt.value
+		validRTTs = append(validRTTs, rtt.value)
+		if stats.Max < rtt.value {
+			stats.Max = rtt.value
+		}
+		if stats.Min > rtt.value {
+			stats.Min = rtt.value
+		}
+	}
+	stats.All = cnt + stats.Fail
+	if cnt == 0 {
+		stats.Min = 0
+		return stats
+	}
+	stats.Average = time.Duration(int(sum) / cnt)
+	var std float64
+	if cnt < 2 {
+		// no enough data for standard deviation, we assume it's half of the average rtt
+		// if we don't do this, standard deviation of 1 round tested nodes is 0, will always
+		// selected before 2 or more rounds tested nodes
+		std = float64(stats.Average / 2)
+	} else {
+		variance := float64(0)
+		for _, rtt := range validRTTs {
+			variance += math.Pow(float64(rtt-stats.Average), 2)
+		}
+		std = math.Sqrt(variance / float64(cnt))
+	}
+	stats.Deviation = time.Duration(std)
+	return stats
+}
+
+func (h *HealthPingRTTS) findOutdated(now time.Time) int {
+	for i := h.cap - 1; i < 2*h.cap; i++ {
+		// from oldest to latest
+		idx := h.calcIndex(i)
+		validity := h.rtts[idx].time.Add(h.validity)
+		if h.lastUpdateAt.After(validity) {
+			return idx
+		}
+		if validity.Before(now) {
+			return idx
+		}
+	}
+	return -1
+}

subproject/Xray-core-main/app/observatory/burst/healthping_result_test.go

@@ -0,0 +1,106 @@
+package burst_test
+
+import (
+	"math"
+	reflect "reflect"
+	"testing"
+	"time"
+
+	"github.com/xtls/xray-core/app/observatory/burst"
+)
+
+func TestHealthPingResults(t *testing.T) {
+	rtts := []int64{60, 140, 60, 140, 60, 60, 140, 60, 140}
+	hr := burst.NewHealthPingResult(4, time.Hour)
+	for _, rtt := range rtts {
+		hr.Put(time.Duration(rtt))
+	}
+	rttFailed := time.Duration(math.MaxInt64)
+	expected := &burst.HealthPingStats{
+		All:       4,
+		Fail:      0,
+		Deviation: 40,
+		Average:   100,
+		Max:       140,
+		Min:       60,
+	}
+	actual := hr.Get()
+	if !reflect.DeepEqual(expected, actual) {
+		t.Errorf("expected: %v, actual: %v", expected, actual)
+	}
+	hr.Put(rttFailed)
+	hr.Put(rttFailed)
+	expected.Fail = 2
+	actual = hr.Get()
+	if !reflect.DeepEqual(expected, actual) {
+		t.Errorf("failed half-failures test, expected: %v, actual: %v", expected, actual)
+	}
+	hr.Put(rttFailed)
+	hr.Put(rttFailed)
+	expected = &burst.HealthPingStats{
+		All:       4,
+		Fail:      4,
+		Deviation: 0,
+		Average:   0,
+		Max:       0,
+		Min:       0,
+	}
+	actual = hr.Get()
+	if !reflect.DeepEqual(expected, actual) {
+		t.Errorf("failed all-failures test, expected: %v, actual: %v", expected, actual)
+	}
+}
+
+func TestHealthPingResultsIgnoreOutdated(t *testing.T) {
+	rtts := []int64{60, 140, 60, 140}
+	hr := burst.NewHealthPingResult(4, time.Duration(10)*time.Millisecond)
+	for i, rtt := range rtts {
+		if i == 2 {
+			// wait for previous 2 outdated
+			time.Sleep(time.Duration(10) * time.Millisecond)
+		}
+		hr.Put(time.Duration(rtt))
+	}
+	hr.Get()
+	expected := &burst.HealthPingStats{
+		All:       2,
+		Fail:      0,
+		Deviation: 40,
+		Average:   100,
+		Max:       140,
+		Min:       60,
+	}
+	actual := hr.Get()
+	if !reflect.DeepEqual(expected, actual) {
+		t.Errorf("failed 'half-outdated' test, expected: %v, actual: %v", expected, actual)
+	}
+	// wait for all outdated
+	time.Sleep(time.Duration(10) * time.Millisecond)
+	expected = &burst.HealthPingStats{
+		All:       0,
+		Fail:      0,
+		Deviation: 0,
+		Average:   0,
+		Max:       0,
+		Min:       0,
+	}
+	actual = hr.Get()
+	if !reflect.DeepEqual(expected, actual) {
+		t.Errorf("failed 'outdated / not-tested' test, expected: %v, actual: %v", expected, actual)
+	}
+
+	hr.Put(time.Duration(60))
+	expected = &burst.HealthPingStats{
+		All:  1,
+		Fail: 0,
+		// 1 sample, std=0.5rtt
+		Deviation: 30,
+		Average:   60,
+		Max:       60,
+		Min:       60,
+	}
+	actual = hr.Get()
+	if !reflect.DeepEqual(expected, actual) {
+		t.Errorf("expected: %v, actual: %v", expected, actual)
+	}
+}

subproject/Xray-core-main/app/observatory/burst/ping.go

@@ -0,0 +1,81 @@
+package burst
+
+import (
+	"context"
+	"io"
+	"net/http"
+	"time"
+
+	"github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/utils"
+	"github.com/xtls/xray-core/features/routing"
+	"github.com/xtls/xray-core/transport/internet/tagged"
+)
+
+type pingClient struct {
+	destination string
+	httpClient  *http.Client
+}
+
+func newPingClient(ctx context.Context, dispatcher routing.Dispatcher, destination string, timeout time.Duration, handler string) *pingClient {
+	return &pingClient{
+		destination: destination,
+		httpClient:  newHTTPClient(ctx, dispatcher, handler, timeout),
+	}
+}
+
+func newDirectPingClient(destination string, timeout time.Duration) *pingClient {
+	return &pingClient{
+		destination: destination,
+		httpClient:  &http.Client{Timeout: timeout},
+	}
+}
+
+func newHTTPClient(ctxv context.Context, dispatcher routing.Dispatcher, handler string, timeout time.Duration) *http.Client {
+	tr := &http.Transport{
+		DisableKeepAlives: true,
+		DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
+			dest, err := net.ParseDestination(network + ":" + addr)
+			if err != nil {
+				return nil, err
+			}
+			return tagged.Dialer(ctxv, dispatcher, dest, handler)
+		},
+	}
+	return &http.Client{
+		Transport: tr,
+		Timeout:   timeout,
+		// don't follow redirect
+		CheckRedirect: func(req *http.Request, via []*http.Request) error {
+			return http.ErrUseLastResponse
+		},
+	}
+}
+
+// MeasureDelay returns the delay time of the request to dest
+func (s *pingClient) MeasureDelay(httpMethod string) (time.Duration, error) {
+	if s.httpClient == nil {
+		panic("pingClient not initialized")
+	}
+
+	req, err := http.NewRequest(httpMethod, s.destination, nil)
+	if err != nil {
+		return rttFailed, err
+	}
+	utils.TryDefaultHeadersWith(req.Header, "nav")
+
+	start := time.Now()
+	resp, err := s.httpClient.Do(req)
+	if err != nil {
+		return rttFailed, err
+	}
+	if httpMethod == http.MethodGet {
+		_, err = io.Copy(io.Discard, resp.Body)
+		if err != nil {
+			return rttFailed, err
+		}
+	}
+	resp.Body.Close()
+
+	return time.Since(start), nil
+}

subproject/Xray-core-main/app/observatory/command/command.go

@@ -0,0 +1,47 @@
+package command
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/app/observatory"
+	"github.com/xtls/xray-core/common"
+	core "github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/extension"
+	"google.golang.org/grpc"
+)
+
+type service struct {
+	UnimplementedObservatoryServiceServer
+	v *core.Instance
+
+	observatory extension.Observatory
+}
+
+func (s *service) GetOutboundStatus(ctx context.Context, request *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
+	resp, err := s.observatory.GetObservation(ctx)
+	if err != nil {
+		return nil, err
+	}
+	retdata := resp.(*observatory.ObservationResult)
+	return &GetOutboundStatusResponse{
+		Status: retdata,
+	}, nil
+}
+
+func (s *service) Register(server *grpc.Server) {
+	RegisterObservatoryServiceServer(server, s)
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
+		s := core.MustFromContext(ctx)
+		sv := &service{v: s}
+		err := s.RequireFeatures(func(Observatory extension.Observatory) {
+			sv.observatory = Observatory
+		}, false)
+		if err != nil {
+			return nil, err
+		}
+		return sv, nil
+	}))
+}

subproject/Xray-core-main/app/observatory/command/command.pb.go

@@ -0,0 +1,206 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/observatory/command/command.proto
+
+package command
+
+import (
+	observatory "github.com/xtls/xray-core/app/observatory"
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type GetOutboundStatusRequest struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *GetOutboundStatusRequest) Reset() {
+	*x = GetOutboundStatusRequest{}
+	mi := &file_app_observatory_command_command_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *GetOutboundStatusRequest) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*GetOutboundStatusRequest) ProtoMessage() {}
+
+func (x *GetOutboundStatusRequest) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_command_command_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use GetOutboundStatusRequest.ProtoReflect.Descriptor instead.
+func (*GetOutboundStatusRequest) Descriptor() ([]byte, []int) {
+	return file_app_observatory_command_command_proto_rawDescGZIP(), []int{0}
+}
+
+type GetOutboundStatusResponse struct {
+	state         protoimpl.MessageState         `protogen:"open.v1"`
+	Status        *observatory.ObservationResult `protobuf:"bytes,1,opt,name=status,proto3" json:"status,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *GetOutboundStatusResponse) Reset() {
+	*x = GetOutboundStatusResponse{}
+	mi := &file_app_observatory_command_command_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *GetOutboundStatusResponse) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*GetOutboundStatusResponse) ProtoMessage() {}
+
+func (x *GetOutboundStatusResponse) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_command_command_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use GetOutboundStatusResponse.ProtoReflect.Descriptor instead.
+func (*GetOutboundStatusResponse) Descriptor() ([]byte, []int) {
+	return file_app_observatory_command_command_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *GetOutboundStatusResponse) GetStatus() *observatory.ObservationResult {
+	if x != nil {
+		return x.Status
+	}
+	return nil
+}
+
+type Config struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_observatory_command_command_proto_msgTypes[2]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_command_command_proto_msgTypes[2]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_observatory_command_command_proto_rawDescGZIP(), []int{2}
+}
+
+var File_app_observatory_command_command_proto protoreflect.FileDescriptor
+
+const file_app_observatory_command_command_proto_rawDesc = "" +
+	"\n" +
+	"%app/observatory/command/command.proto\x12!xray.core.app.observatory.command\x1a\x1capp/observatory/config.proto\"\x1a\n" +
+	"\x18GetOutboundStatusRequest\"a\n" +
+	"\x19GetOutboundStatusResponse\x12D\n" +
+	"\x06status\x18\x01 \x01(\v2,.xray.core.app.observatory.ObservationResultR\x06status\"\b\n" +
+	"\x06Config2\xa7\x01\n" +
+	"\x12ObservatoryService\x12\x90\x01\n" +
+	"\x11GetOutboundStatus\x12;.xray.core.app.observatory.command.GetOutboundStatusRequest\x1a<.xray.core.app.observatory.command.GetOutboundStatusResponse\"\x00B\x80\x01\n" +
+	"%com.xray.core.app.observatory.commandP\x01Z1github.com/xtls/xray-core/app/observatory/command\xaa\x02!Xray.Core.App.Observatory.Commandb\x06proto3"
+
+var (
+	file_app_observatory_command_command_proto_rawDescOnce sync.Once
+	file_app_observatory_command_command_proto_rawDescData []byte
+)
+
+func file_app_observatory_command_command_proto_rawDescGZIP() []byte {
+	file_app_observatory_command_command_proto_rawDescOnce.Do(func() {
+		file_app_observatory_command_command_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_observatory_command_command_proto_rawDesc), len(file_app_observatory_command_command_proto_rawDesc)))
+	})
+	return file_app_observatory_command_command_proto_rawDescData
+}
+
+var file_app_observatory_command_command_proto_msgTypes = make([]protoimpl.MessageInfo, 3)
+var file_app_observatory_command_command_proto_goTypes = []any{
+	(*GetOutboundStatusRequest)(nil),      // 0: xray.core.app.observatory.command.GetOutboundStatusRequest
+	(*GetOutboundStatusResponse)(nil),     // 1: xray.core.app.observatory.command.GetOutboundStatusResponse
+	(*Config)(nil),                        // 2: xray.core.app.observatory.command.Config
+	(*observatory.ObservationResult)(nil), // 3: xray.core.app.observatory.ObservationResult
+}
+var file_app_observatory_command_command_proto_depIdxs = []int32{
+	3, // 0: xray.core.app.observatory.command.GetOutboundStatusResponse.status:type_name -> xray.core.app.observatory.ObservationResult
+	0, // 1: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:input_type -> xray.core.app.observatory.command.GetOutboundStatusRequest
+	1, // 2: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:output_type -> xray.core.app.observatory.command.GetOutboundStatusResponse
+	2, // [2:3] is the sub-list for method output_type
+	1, // [1:2] is the sub-list for method input_type
+	1, // [1:1] is the sub-list for extension type_name
+	1, // [1:1] is the sub-list for extension extendee
+	0, // [0:1] is the sub-list for field type_name
+}
+
+func init() { file_app_observatory_command_command_proto_init() }
+func file_app_observatory_command_command_proto_init() {
+	if File_app_observatory_command_command_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_observatory_command_command_proto_rawDesc), len(file_app_observatory_command_command_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   3,
+			NumExtensions: 0,
+			NumServices:   1,
+		},
+		GoTypes:           file_app_observatory_command_command_proto_goTypes,
+		DependencyIndexes: file_app_observatory_command_command_proto_depIdxs,
+		MessageInfos:      file_app_observatory_command_command_proto_msgTypes,
+	}.Build()
+	File_app_observatory_command_command_proto = out.File
+	file_app_observatory_command_command_proto_goTypes = nil
+	file_app_observatory_command_command_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/observatory/command/command.proto

@@ -0,0 +1,24 @@
+syntax = "proto3";
+
+package xray.core.app.observatory.command;
+option csharp_namespace = "Xray.Core.App.Observatory.Command";
+option go_package = "github.com/xtls/xray-core/app/observatory/command";
+option java_package = "com.xray.core.app.observatory.command";
+option java_multiple_files = true;
+
+import "app/observatory/config.proto";
+
+message GetOutboundStatusRequest {
+}
+
+message GetOutboundStatusResponse {
+  xray.core.app.observatory.ObservationResult status = 1;
+}
+
+service ObservatoryService {
+  rpc GetOutboundStatus(GetOutboundStatusRequest)
+      returns (GetOutboundStatusResponse) {}
+}
+
+
+message Config {}

subproject/Xray-core-main/app/observatory/command/command_grpc.pb.go

@@ -0,0 +1,121 @@
+// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
+// versions:
+// - protoc-gen-go-grpc v1.6.0
+// - protoc             v6.33.5
+// source: app/observatory/command/command.proto
+
+package command
+
+import (
+	context "context"
+	grpc "google.golang.org/grpc"
+	codes "google.golang.org/grpc/codes"
+	status "google.golang.org/grpc/status"
+)
+
+// This is a compile-time assertion to ensure that this generated file
+// is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.64.0 or later.
+const _ = grpc.SupportPackageIsVersion9
+
+const (
+	ObservatoryService_GetOutboundStatus_FullMethodName = "/xray.core.app.observatory.command.ObservatoryService/GetOutboundStatus"
+)
+
+// ObservatoryServiceClient is the client API for ObservatoryService service.
+//
+// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
+type ObservatoryServiceClient interface {
+	GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error)
+}
+
+type observatoryServiceClient struct {
+	cc grpc.ClientConnInterface
+}
+
+func NewObservatoryServiceClient(cc grpc.ClientConnInterface) ObservatoryServiceClient {
+	return &observatoryServiceClient{cc}
+}
+
+func (c *observatoryServiceClient) GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error) {
+	cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...)
+	out := new(GetOutboundStatusResponse)
+	err := c.cc.Invoke(ctx, ObservatoryService_GetOutboundStatus_FullMethodName, in, out, cOpts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+// ObservatoryServiceServer is the server API for ObservatoryService service.
+// All implementations must embed UnimplementedObservatoryServiceServer
+// for forward compatibility.
+type ObservatoryServiceServer interface {
+	GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error)
+	mustEmbedUnimplementedObservatoryServiceServer()
+}
+
+// UnimplementedObservatoryServiceServer must be embedded to have
+// forward compatible implementations.
+//
+// NOTE: this should be embedded by value instead of pointer to avoid a nil
+// pointer dereference when methods are called.
+type UnimplementedObservatoryServiceServer struct{}
+
+func (UnimplementedObservatoryServiceServer) GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
+	return nil, status.Error(codes.Unimplemented, "method GetOutboundStatus not implemented")
+}
+func (UnimplementedObservatoryServiceServer) mustEmbedUnimplementedObservatoryServiceServer() {}
+func (UnimplementedObservatoryServiceServer) testEmbeddedByValue()                            {}
+
+// UnsafeObservatoryServiceServer may be embedded to opt out of forward compatibility for this service.
+// Use of this interface is not recommended, as added methods to ObservatoryServiceServer will
+// result in compilation errors.
+type UnsafeObservatoryServiceServer interface {
+	mustEmbedUnimplementedObservatoryServiceServer()
+}
+
+func RegisterObservatoryServiceServer(s grpc.ServiceRegistrar, srv ObservatoryServiceServer) {
+	// If the following call panics, it indicates UnimplementedObservatoryServiceServer was
+	// embedded by pointer and is nil.  This will cause panics if an
+	// unimplemented method is ever invoked, so we test this at initialization
+	// time to prevent it from happening at runtime later due to I/O.
+	if t, ok := srv.(interface{ testEmbeddedByValue() }); ok {
+		t.testEmbeddedByValue()
+	}
+	s.RegisterService(&ObservatoryService_ServiceDesc, srv)
+}
+
+func _ObservatoryService_GetOutboundStatus_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(GetOutboundStatusRequest)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: ObservatoryService_GetOutboundStatus_FullMethodName,
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, req.(*GetOutboundStatusRequest))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+// ObservatoryService_ServiceDesc is the grpc.ServiceDesc for ObservatoryService service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var ObservatoryService_ServiceDesc = grpc.ServiceDesc{
+	ServiceName: "xray.core.app.observatory.command.ObservatoryService",
+	HandlerType: (*ObservatoryServiceServer)(nil),
+	Methods: []grpc.MethodDesc{
+		{
+			MethodName: "GetOutboundStatus",
+			Handler:    _ObservatoryService_GetOutboundStatus_Handler,
+		},
+	},
+	Streams:  []grpc.StreamDesc{},
+	Metadata: "app/observatory/command/command.proto",
+}

subproject/Xray-core-main/app/observatory/config.pb.go

@@ -0,0 +1,528 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/observatory/config.proto
+
+package observatory
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type ObservationResult struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Status        []*OutboundStatus      `protobuf:"bytes,1,rep,name=status,proto3" json:"status,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *ObservationResult) Reset() {
+	*x = ObservationResult{}
+	mi := &file_app_observatory_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *ObservationResult) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*ObservationResult) ProtoMessage() {}
+
+func (x *ObservationResult) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use ObservationResult.ProtoReflect.Descriptor instead.
+func (*ObservationResult) Descriptor() ([]byte, []int) {
+	return file_app_observatory_config_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *ObservationResult) GetStatus() []*OutboundStatus {
+	if x != nil {
+		return x.Status
+	}
+	return nil
+}
+
+type HealthPingMeasurementResult struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	All           int64                  `protobuf:"varint,1,opt,name=all,proto3" json:"all,omitempty"`
+	Fail          int64                  `protobuf:"varint,2,opt,name=fail,proto3" json:"fail,omitempty"`
+	Deviation     int64                  `protobuf:"varint,3,opt,name=deviation,proto3" json:"deviation,omitempty"`
+	Average       int64                  `protobuf:"varint,4,opt,name=average,proto3" json:"average,omitempty"`
+	Max           int64                  `protobuf:"varint,5,opt,name=max,proto3" json:"max,omitempty"`
+	Min           int64                  `protobuf:"varint,6,opt,name=min,proto3" json:"min,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *HealthPingMeasurementResult) Reset() {
+	*x = HealthPingMeasurementResult{}
+	mi := &file_app_observatory_config_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *HealthPingMeasurementResult) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*HealthPingMeasurementResult) ProtoMessage() {}
+
+func (x *HealthPingMeasurementResult) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_config_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use HealthPingMeasurementResult.ProtoReflect.Descriptor instead.
+func (*HealthPingMeasurementResult) Descriptor() ([]byte, []int) {
+	return file_app_observatory_config_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *HealthPingMeasurementResult) GetAll() int64 {
+	if x != nil {
+		return x.All
+	}
+	return 0
+}
+
+func (x *HealthPingMeasurementResult) GetFail() int64 {
+	if x != nil {
+		return x.Fail
+	}
+	return 0
+}
+
+func (x *HealthPingMeasurementResult) GetDeviation() int64 {
+	if x != nil {
+		return x.Deviation
+	}
+	return 0
+}
+
+func (x *HealthPingMeasurementResult) GetAverage() int64 {
+	if x != nil {
+		return x.Average
+	}
+	return 0
+}
+
+func (x *HealthPingMeasurementResult) GetMax() int64 {
+	if x != nil {
+		return x.Max
+	}
+	return 0
+}
+
+func (x *HealthPingMeasurementResult) GetMin() int64 {
+	if x != nil {
+		return x.Min
+	}
+	return 0
+}
+
+type OutboundStatus struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// @Document Whether this outbound is usable
+	// @Restriction ReadOnlyForUser
+	Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
+	// @Document The time for probe request to finish.
+	// @Type time.ms
+	// @Restriction ReadOnlyForUser
+	Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
+	// @Document The last error caused this outbound failed to relay probe request
+	// @Restriction NotMachineReadable
+	LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
+	// @Document The outbound tag for this Server
+	// @Type id.outboundTag
+	OutboundTag string `protobuf:"bytes,4,opt,name=outbound_tag,json=outboundTag,proto3" json:"outbound_tag,omitempty"`
+	// @Document The time this outbound is known to be alive
+	// @Type id.outboundTag
+	LastSeenTime int64 `protobuf:"varint,5,opt,name=last_seen_time,json=lastSeenTime,proto3" json:"last_seen_time,omitempty"`
+	// @Document The time this outbound is tried
+	// @Type id.outboundTag
+	LastTryTime   int64                        `protobuf:"varint,6,opt,name=last_try_time,json=lastTryTime,proto3" json:"last_try_time,omitempty"`
+	HealthPing    *HealthPingMeasurementResult `protobuf:"bytes,7,opt,name=health_ping,json=healthPing,proto3" json:"health_ping,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *OutboundStatus) Reset() {
+	*x = OutboundStatus{}
+	mi := &file_app_observatory_config_proto_msgTypes[2]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *OutboundStatus) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*OutboundStatus) ProtoMessage() {}
+
+func (x *OutboundStatus) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_config_proto_msgTypes[2]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use OutboundStatus.ProtoReflect.Descriptor instead.
+func (*OutboundStatus) Descriptor() ([]byte, []int) {
+	return file_app_observatory_config_proto_rawDescGZIP(), []int{2}
+}
+
+func (x *OutboundStatus) GetAlive() bool {
+	if x != nil {
+		return x.Alive
+	}
+	return false
+}
+
+func (x *OutboundStatus) GetDelay() int64 {
+	if x != nil {
+		return x.Delay
+	}
+	return 0
+}
+
+func (x *OutboundStatus) GetLastErrorReason() string {
+	if x != nil {
+		return x.LastErrorReason
+	}
+	return ""
+}
+
+func (x *OutboundStatus) GetOutboundTag() string {
+	if x != nil {
+		return x.OutboundTag
+	}
+	return ""
+}
+
+func (x *OutboundStatus) GetLastSeenTime() int64 {
+	if x != nil {
+		return x.LastSeenTime
+	}
+	return 0
+}
+
+func (x *OutboundStatus) GetLastTryTime() int64 {
+	if x != nil {
+		return x.LastTryTime
+	}
+	return 0
+}
+
+func (x *OutboundStatus) GetHealthPing() *HealthPingMeasurementResult {
+	if x != nil {
+		return x.HealthPing
+	}
+	return nil
+}
+
+type ProbeResult struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// @Document Whether this outbound is usable
+	// @Restriction ReadOnlyForUser
+	Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
+	// @Document The time for probe request to finish.
+	// @Type time.ms
+	// @Restriction ReadOnlyForUser
+	Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
+	// @Document The error caused this outbound failed to relay probe request
+	// @Restriction NotMachineReadable
+	LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
+	unknownFields   protoimpl.UnknownFields
+	sizeCache       protoimpl.SizeCache
+}
+
+func (x *ProbeResult) Reset() {
+	*x = ProbeResult{}
+	mi := &file_app_observatory_config_proto_msgTypes[3]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *ProbeResult) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*ProbeResult) ProtoMessage() {}
+
+func (x *ProbeResult) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_config_proto_msgTypes[3]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use ProbeResult.ProtoReflect.Descriptor instead.
+func (*ProbeResult) Descriptor() ([]byte, []int) {
+	return file_app_observatory_config_proto_rawDescGZIP(), []int{3}
+}
+
+func (x *ProbeResult) GetAlive() bool {
+	if x != nil {
+		return x.Alive
+	}
+	return false
+}
+
+func (x *ProbeResult) GetDelay() int64 {
+	if x != nil {
+		return x.Delay
+	}
+	return 0
+}
+
+func (x *ProbeResult) GetLastErrorReason() string {
+	if x != nil {
+		return x.LastErrorReason
+	}
+	return ""
+}
+
+type Intensity struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// @Document The time interval for a probe request in ms.
+	// @Type time.ms
+	ProbeInterval uint32 `protobuf:"varint,1,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Intensity) Reset() {
+	*x = Intensity{}
+	mi := &file_app_observatory_config_proto_msgTypes[4]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Intensity) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Intensity) ProtoMessage() {}
+
+func (x *Intensity) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_config_proto_msgTypes[4]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Intensity.ProtoReflect.Descriptor instead.
+func (*Intensity) Descriptor() ([]byte, []int) {
+	return file_app_observatory_config_proto_rawDescGZIP(), []int{4}
+}
+
+func (x *Intensity) GetProbeInterval() uint32 {
+	if x != nil {
+		return x.ProbeInterval
+	}
+	return 0
+}
+
+type Config struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// @Document The selectors for outbound under observation
+	SubjectSelector   []string `protobuf:"bytes,2,rep,name=subject_selector,json=subjectSelector,proto3" json:"subject_selector,omitempty"`
+	ProbeUrl          string   `protobuf:"bytes,3,opt,name=probe_url,json=probeUrl,proto3" json:"probe_url,omitempty"`
+	ProbeInterval     int64    `protobuf:"varint,4,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
+	EnableConcurrency bool     `protobuf:"varint,5,opt,name=enable_concurrency,json=enableConcurrency,proto3" json:"enable_concurrency,omitempty"`
+	unknownFields     protoimpl.UnknownFields
+	sizeCache         protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_observatory_config_proto_msgTypes[5]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_observatory_config_proto_msgTypes[5]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_observatory_config_proto_rawDescGZIP(), []int{5}
+}
+
+func (x *Config) GetSubjectSelector() []string {
+	if x != nil {
+		return x.SubjectSelector
+	}
+	return nil
+}
+
+func (x *Config) GetProbeUrl() string {
+	if x != nil {
+		return x.ProbeUrl
+	}
+	return ""
+}
+
+func (x *Config) GetProbeInterval() int64 {
+	if x != nil {
+		return x.ProbeInterval
+	}
+	return 0
+}
+
+func (x *Config) GetEnableConcurrency() bool {
+	if x != nil {
+		return x.EnableConcurrency
+	}
+	return false
+}
+
+var File_app_observatory_config_proto protoreflect.FileDescriptor
+
+const file_app_observatory_config_proto_rawDesc = "" +
+	"\n" +
+	"\x1capp/observatory/config.proto\x12\x19xray.core.app.observatory\"V\n" +
+	"\x11ObservationResult\x12A\n" +
+	"\x06status\x18\x01 \x03(\v2).xray.core.app.observatory.OutboundStatusR\x06status\"\x9f\x01\n" +
+	"\x1bHealthPingMeasurementResult\x12\x10\n" +
+	"\x03all\x18\x01 \x01(\x03R\x03all\x12\x12\n" +
+	"\x04fail\x18\x02 \x01(\x03R\x04fail\x12\x1c\n" +
+	"\tdeviation\x18\x03 \x01(\x03R\tdeviation\x12\x18\n" +
+	"\aaverage\x18\x04 \x01(\x03R\aaverage\x12\x10\n" +
+	"\x03max\x18\x05 \x01(\x03R\x03max\x12\x10\n" +
+	"\x03min\x18\x06 \x01(\x03R\x03min\"\xae\x02\n" +
+	"\x0eOutboundStatus\x12\x14\n" +
+	"\x05alive\x18\x01 \x01(\bR\x05alive\x12\x14\n" +
+	"\x05delay\x18\x02 \x01(\x03R\x05delay\x12*\n" +
+	"\x11last_error_reason\x18\x03 \x01(\tR\x0flastErrorReason\x12!\n" +
+	"\foutbound_tag\x18\x04 \x01(\tR\voutboundTag\x12$\n" +
+	"\x0elast_seen_time\x18\x05 \x01(\x03R\flastSeenTime\x12\"\n" +
+	"\rlast_try_time\x18\x06 \x01(\x03R\vlastTryTime\x12W\n" +
+	"\vhealth_ping\x18\a \x01(\v26.xray.core.app.observatory.HealthPingMeasurementResultR\n" +
+	"healthPing\"e\n" +
+	"\vProbeResult\x12\x14\n" +
+	"\x05alive\x18\x01 \x01(\bR\x05alive\x12\x14\n" +
+	"\x05delay\x18\x02 \x01(\x03R\x05delay\x12*\n" +
+	"\x11last_error_reason\x18\x03 \x01(\tR\x0flastErrorReason\"2\n" +
+	"\tIntensity\x12%\n" +
+	"\x0eprobe_interval\x18\x01 \x01(\rR\rprobeInterval\"\xa6\x01\n" +
+	"\x06Config\x12)\n" +
+	"\x10subject_selector\x18\x02 \x03(\tR\x0fsubjectSelector\x12\x1b\n" +
+	"\tprobe_url\x18\x03 \x01(\tR\bprobeUrl\x12%\n" +
+	"\x0eprobe_interval\x18\x04 \x01(\x03R\rprobeInterval\x12-\n" +
+	"\x12enable_concurrency\x18\x05 \x01(\bR\x11enableConcurrencyB^\n" +
+	"\x18com.xray.app.observatoryP\x01Z)github.com/xtls/xray-core/app/observatory\xaa\x02\x14Xray.App.Observatoryb\x06proto3"
+
+var (
+	file_app_observatory_config_proto_rawDescOnce sync.Once
+	file_app_observatory_config_proto_rawDescData []byte
+)
+
+func file_app_observatory_config_proto_rawDescGZIP() []byte {
+	file_app_observatory_config_proto_rawDescOnce.Do(func() {
+		file_app_observatory_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_observatory_config_proto_rawDesc), len(file_app_observatory_config_proto_rawDesc)))
+	})
+	return file_app_observatory_config_proto_rawDescData
+}
+
+var file_app_observatory_config_proto_msgTypes = make([]protoimpl.MessageInfo, 6)
+var file_app_observatory_config_proto_goTypes = []any{
+	(*ObservationResult)(nil),           // 0: xray.core.app.observatory.ObservationResult
+	(*HealthPingMeasurementResult)(nil), // 1: xray.core.app.observatory.HealthPingMeasurementResult
+	(*OutboundStatus)(nil),              // 2: xray.core.app.observatory.OutboundStatus
+	(*ProbeResult)(nil),                 // 3: xray.core.app.observatory.ProbeResult
+	(*Intensity)(nil),                   // 4: xray.core.app.observatory.Intensity
+	(*Config)(nil),                      // 5: xray.core.app.observatory.Config
+}
+var file_app_observatory_config_proto_depIdxs = []int32{
+	2, // 0: xray.core.app.observatory.ObservationResult.status:type_name -> xray.core.app.observatory.OutboundStatus
+	1, // 1: xray.core.app.observatory.OutboundStatus.health_ping:type_name -> xray.core.app.observatory.HealthPingMeasurementResult
+	2, // [2:2] is the sub-list for method output_type
+	2, // [2:2] is the sub-list for method input_type
+	2, // [2:2] is the sub-list for extension type_name
+	2, // [2:2] is the sub-list for extension extendee
+	0, // [0:2] is the sub-list for field type_name
+}
+
+func init() { file_app_observatory_config_proto_init() }
+func file_app_observatory_config_proto_init() {
+	if File_app_observatory_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_observatory_config_proto_rawDesc), len(file_app_observatory_config_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   6,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_observatory_config_proto_goTypes,
+		DependencyIndexes: file_app_observatory_config_proto_depIdxs,
+		MessageInfos:      file_app_observatory_config_proto_msgTypes,
+	}.Build()
+	File_app_observatory_config_proto = out.File
+	file_app_observatory_config_proto_goTypes = nil
+	file_app_observatory_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/observatory/config.proto

@@ -0,0 +1,84 @@
+syntax = "proto3";
+
+package xray.core.app.observatory;
+option csharp_namespace = "Xray.App.Observatory";
+option go_package = "github.com/xtls/xray-core/app/observatory";
+option java_package = "com.xray.app.observatory";
+option java_multiple_files = true;
+
+message ObservationResult {
+  repeated OutboundStatus status = 1;
+}
+
+message HealthPingMeasurementResult {
+  int64 all = 1;
+  int64 fail = 2;
+  int64 deviation = 3;
+  int64 average = 4;
+  int64 max = 5;
+  int64 min = 6;
+}
+
+message OutboundStatus{
+  /* @Document Whether this outbound is usable
+     @Restriction ReadOnlyForUser
+  */
+  bool alive = 1;
+  /* @Document The time for probe request to finish.
+     @Type time.ms
+     @Restriction ReadOnlyForUser
+  */
+  int64 delay = 2;
+  /* @Document The last error caused this outbound failed to relay probe request
+     @Restriction NotMachineReadable
+  */
+  string last_error_reason = 3;
+  /* @Document The outbound tag for this Server
+     @Type id.outboundTag
+  */
+  string outbound_tag = 4;
+  /* @Document The time this outbound is known to be alive
+   @Type id.outboundTag
+*/
+  int64 last_seen_time = 5;
+  /* @Document The time this outbound is tried
+   @Type id.outboundTag
+*/
+  int64 last_try_time = 6;
+
+  HealthPingMeasurementResult health_ping = 7;
+}
+
+message ProbeResult{
+  /* @Document Whether this outbound is usable
+     @Restriction ReadOnlyForUser
+  */
+  bool alive = 1;
+  /* @Document The time for probe request to finish.
+     @Type time.ms
+     @Restriction ReadOnlyForUser
+  */
+  int64 delay = 2;
+  /* @Document The error caused this outbound failed to relay probe request
+   @Restriction NotMachineReadable
+*/
+  string last_error_reason = 3;
+}
+
+message Intensity{
+  /* @Document The time interval for a probe request in ms.
+     @Type time.ms
+  */
+  uint32 probe_interval = 1;
+}
+message Config {
+  /* @Document The selectors for outbound under observation
+  */
+  repeated string subject_selector = 2;
+
+  string probe_url = 3;
+
+  int64 probe_interval = 4;
+
+  bool enable_concurrency = 5;
+}

subproject/Xray-core-main/app/observatory/explainErrors.go

@@ -0,0 +1,26 @@
+package observatory
+
+import "github.com/xtls/xray-core/common/errors"
+
+type errorCollector struct {
+	errors *errors.Error
+}
+
+func (e *errorCollector) SubmitError(err error) {
+	if e.errors == nil {
+		e.errors = errors.New("underlying connection error").Base(err)
+		return
+	}
+	e.errors = e.errors.Base(errors.New("underlying connection error").Base(err))
+}
+
+func newErrorCollector() *errorCollector {
+	return &errorCollector{}
+}
+
+func (e *errorCollector) UnderlyingError() error {
+	if e.errors == nil {
+		return errors.New("failed to produce report")
+	}
+	return e.errors
+}

subproject/Xray-core-main/app/observatory/observatory.go

@@ -0,0 +1 @@
+package observatory

subproject/Xray-core-main/app/observatory/observer.go

@@ -0,0 +1,252 @@
+package observatory
+
+import (
+	"context"
+	"net"
+	"net/http"
+	"net/url"
+	"slices"
+	"sort"
+	"sync"
+	"time"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	v2net "github.com/xtls/xray-core/common/net"
+	"github.com/xtls/xray-core/common/session"
+	"github.com/xtls/xray-core/common/signal/done"
+	"github.com/xtls/xray-core/common/task"
+	"github.com/xtls/xray-core/common/utils"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/extension"
+	"github.com/xtls/xray-core/features/outbound"
+	"github.com/xtls/xray-core/features/routing"
+	"github.com/xtls/xray-core/transport/internet/tagged"
+	"google.golang.org/protobuf/proto"
+)
+
+type Observer struct {
+	config *Config
+	ctx    context.Context
+
+	statusLock sync.Mutex
+	status     []*OutboundStatus
+
+	finished *done.Instance
+
+	ohm        outbound.Manager
+	dispatcher routing.Dispatcher
+}
+
+func (o *Observer) GetObservation(ctx context.Context) (proto.Message, error) {
+	return &ObservationResult{Status: o.status}, nil
+}
+
+func (o *Observer) Type() interface{} {
+	return extension.ObservatoryType()
+}
+
+func (o *Observer) Start() error {
+	if o.config != nil && len(o.config.SubjectSelector) != 0 {
+		o.finished = done.New()
+		go o.background()
+	}
+	return nil
+}
+
+func (o *Observer) Close() error {
+	if o.finished != nil {
+		return o.finished.Close()
+	}
+	return nil
+}
+
+func (o *Observer) background() {
+	for !o.finished.Done() {
+		hs, ok := o.ohm.(outbound.HandlerSelector)
+		if !ok {
+			errors.LogInfo(o.ctx, "outbound.Manager is not a HandlerSelector")
+			return
+		}
+
+		outbounds := hs.Select(o.config.SubjectSelector)
+
+		o.clearRemovedOutbounds(outbounds)
+
+		sleepTime := time.Second * 10
+		if o.config.ProbeInterval != 0 {
+			sleepTime = time.Duration(o.config.ProbeInterval)
+		}
+
+		if !o.config.EnableConcurrency {
+			sort.Strings(outbounds)
+			for _, v := range outbounds {
+				result := o.probe(v)
+				o.updateStatusForResult(v, &result)
+				if o.finished.Done() {
+					return
+				}
+				time.Sleep(sleepTime)
+			}
+			continue
+		}
+
+		ch := make(chan struct{}, len(outbounds))
+
+		for _, v := range outbounds {
+			go func(v string) {
+				result := o.probe(v)
+				o.updateStatusForResult(v, &result)
+				ch <- struct{}{}
+			}(v)
+		}
+
+		for range outbounds {
+			select {
+			case <-ch:
+			case <-o.finished.Wait():
+				return
+			}
+		}
+		time.Sleep(sleepTime)
+	}
+}
+
+func (o *Observer) clearRemovedOutbounds(outbounds []string) {
+	o.statusLock.Lock()
+	defer o.statusLock.Unlock()
+	if len(o.status) == 0 {
+		return
+	}
+	var pruned []*OutboundStatus
+	for _, status := range o.status {
+		if slices.Contains(outbounds, status.OutboundTag) {
+			pruned = append(pruned, status)
+		}
+	}
+	o.status = pruned
+}
+
+func (o *Observer) probe(outbound string) ProbeResult {
+	errorCollectorForRequest := newErrorCollector()
+
+	httpTransport := http.Transport{
+		Proxy: func(*http.Request) (*url.URL, error) {
+			return nil, nil
+		},
+		DialContext: func(ctx context.Context, network string, addr string) (net.Conn, error) {
+			var connection net.Conn
+			taskErr := task.Run(ctx, func() error {
+				// MUST use Xray's built in context system
+				dest, err := v2net.ParseDestination(network + ":" + addr)
+				if err != nil {
+					return errors.New("cannot understand address").Base(err)
+				}
+				trackedCtx := session.TrackedConnectionError(o.ctx, errorCollectorForRequest)
+				conn, err := tagged.Dialer(trackedCtx, o.dispatcher, dest, outbound)
+				if err != nil {
+					return errors.New("cannot dial remote address ", dest).Base(err)
+				}
+				connection = conn
+				return nil
+			})
+			if taskErr != nil {
+				return nil, errors.New("cannot finish connection").Base(taskErr)
+			}
+			return connection, nil
+		},
+		TLSHandshakeTimeout: time.Second * 5,
+	}
+	httpClient := &http.Client{
+		Transport: &httpTransport,
+		CheckRedirect: func(req *http.Request, via []*http.Request) error {
+			return http.ErrUseLastResponse
+		},
+		Jar:     nil,
+		Timeout: time.Second * 5,
+	}
+	var GETTime time.Duration
+	err := task.Run(o.ctx, func() error {
+		startTime := time.Now()
+		probeURL := "https://www.google.com/generate_204"
+		if o.config.ProbeUrl != "" {
+			probeURL = o.config.ProbeUrl
+		}
+		req, _ := http.NewRequest(http.MethodGet, probeURL, nil)
+		utils.TryDefaultHeadersWith(req.Header, "nav")
+		response, err := httpClient.Do(req)
+		if err != nil {
+			return errors.New("outbound failed to relay connection").Base(err)
+		}
+		if response.Body != nil {
+			response.Body.Close()
+		}
+		endTime := time.Now()
+		GETTime = endTime.Sub(startTime)
+		return nil
+	})
+	if err != nil {
+		var errorMessage = "the outbound " + outbound + " is dead: GET request failed:" + err.Error() + "with outbound handler report underlying connection failed"
+		errors.LogInfoInner(o.ctx, errorCollectorForRequest.UnderlyingError(), errorMessage)
+		return ProbeResult{Alive: false, LastErrorReason: errorMessage}
+	}
+	errors.LogInfo(o.ctx, "the outbound ", outbound, " is alive:", GETTime.Seconds())
+	return ProbeResult{Alive: true, Delay: GETTime.Milliseconds()}
+}
+
+func (o *Observer) updateStatusForResult(outbound string, result *ProbeResult) {
+	o.statusLock.Lock()
+	defer o.statusLock.Unlock()
+	var status *OutboundStatus
+	if location := o.findStatusLocationLockHolderOnly(outbound); location != -1 {
+		status = o.status[location]
+	} else {
+		status = &OutboundStatus{}
+		o.status = append(o.status, status)
+	}
+
+	status.LastTryTime = time.Now().Unix()
+	status.OutboundTag = outbound
+	status.Alive = result.Alive
+	if result.Alive {
+		status.Delay = result.Delay
+		status.LastSeenTime = status.LastTryTime
+		status.LastErrorReason = ""
+	} else {
+		status.LastErrorReason = result.LastErrorReason
+		status.Delay = 99999999
+	}
+}
+
+func (o *Observer) findStatusLocationLockHolderOnly(outbound string) int {
+	for i, v := range o.status {
+		if v.OutboundTag == outbound {
+			return i
+		}
+	}
+	return -1
+}
+
+func New(ctx context.Context, config *Config) (*Observer, error) {
+	var outboundManager outbound.Manager
+	var dispatcher routing.Dispatcher
+	err := core.RequireFeatures(ctx, func(om outbound.Manager, rd routing.Dispatcher) {
+		outboundManager = om
+		dispatcher = rd
+	})
+	if err != nil {
+		return nil, errors.New("Cannot get depended features").Base(err)
+	}
+	return &Observer{
+		config:     config,
+		ctx:        ctx,
+		ohm:        outboundManager,
+		dispatcher: dispatcher,
+	}, nil
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		return New(ctx, config.(*Config))
+	}))
+}

subproject/Xray-core-main/app/observatory/observer_test.go

@@ -0,0 +1,64 @@
+package observatory
+
+import "testing"
+
+func TestObserverUpdateStatusPrunesStaleOutbounds(t *testing.T) {
+	observer := &Observer{
+		status: []*OutboundStatus{
+			{
+				OutboundTag:     "keep",
+				Alive:           true,
+				Delay:           42,
+				LastErrorReason: "",
+				LastSeenTime:    111,
+				LastTryTime:     222,
+			},
+			{
+				OutboundTag:     "drop",
+				Alive:           false,
+				Delay:           99999999,
+				LastErrorReason: "probe failed",
+				LastSeenTime:    333,
+				LastTryTime:     444,
+			},
+		},
+	}
+
+	observer.updateStatus([]string{"keep"})
+
+	if len(observer.status) != 1 {
+		t.Fatalf("expected 1 status after pruning, got %d", len(observer.status))
+	}
+
+	got := observer.status[0]
+	if got.OutboundTag != "keep" {
+		t.Fatalf("expected remaining status for keep, got %q", got.OutboundTag)
+	}
+	if !got.Alive {
+		t.Fatal("expected remaining status to preserve Alive field")
+	}
+	if got.Delay != 42 {
+		t.Fatalf("expected remaining status to preserve Delay, got %d", got.Delay)
+	}
+	if got.LastSeenTime != 111 {
+		t.Fatalf("expected remaining status to preserve LastSeenTime, got %d", got.LastSeenTime)
+	}
+	if got.LastTryTime != 222 {
+		t.Fatalf("expected remaining status to preserve LastTryTime, got %d", got.LastTryTime)
+	}
+}
+
+func TestObserverUpdateStatusClearsWhenNoOutboundsRemain(t *testing.T) {
+	observer := &Observer{
+		status: []*OutboundStatus{
+			{OutboundTag: "drop-1"},
+			{OutboundTag: "drop-2"},
+		},
+	}
+
+	observer.updateStatus(nil)
+
+	if len(observer.status) != 0 {
+		t.Fatalf("expected all statuses to be removed, got %d", len(observer.status))
+	}
+}

subproject/Xray-core-main/app/policy/config.go

@@ -0,0 +1,94 @@
+package policy
+
+import (
+	"time"
+
+	"github.com/xtls/xray-core/features/policy"
+)
+
+// Duration converts Second to time.Duration.
+func (s *Second) Duration() time.Duration {
+	if s == nil {
+		return 0
+	}
+	return time.Second * time.Duration(s.Value)
+}
+
+func defaultPolicy() *Policy {
+	p := policy.SessionDefault()
+
+	return &Policy{
+		Timeout: &Policy_Timeout{
+			Handshake:      &Second{Value: uint32(p.Timeouts.Handshake / time.Second)},
+			ConnectionIdle: &Second{Value: uint32(p.Timeouts.ConnectionIdle / time.Second)},
+			UplinkOnly:     &Second{Value: uint32(p.Timeouts.UplinkOnly / time.Second)},
+			DownlinkOnly:   &Second{Value: uint32(p.Timeouts.DownlinkOnly / time.Second)},
+		},
+		Buffer: &Policy_Buffer{
+			Connection: p.Buffer.PerConnection,
+		},
+	}
+}
+
+func (p *Policy_Timeout) overrideWith(another *Policy_Timeout) {
+	if another.Handshake != nil {
+		p.Handshake = &Second{Value: another.Handshake.Value}
+	}
+	if another.ConnectionIdle != nil {
+		p.ConnectionIdle = &Second{Value: another.ConnectionIdle.Value}
+	}
+	if another.UplinkOnly != nil {
+		p.UplinkOnly = &Second{Value: another.UplinkOnly.Value}
+	}
+	if another.DownlinkOnly != nil {
+		p.DownlinkOnly = &Second{Value: another.DownlinkOnly.Value}
+	}
+}
+
+func (p *Policy) overrideWith(another *Policy) {
+	if another.Timeout != nil {
+		p.Timeout.overrideWith(another.Timeout)
+	}
+	if another.Stats != nil && p.Stats == nil {
+		p.Stats = &Policy_Stats{}
+		p.Stats = another.Stats
+	}
+	if another.Buffer != nil {
+		p.Buffer = &Policy_Buffer{
+			Connection: another.Buffer.Connection,
+		}
+	}
+}
+
+// ToCorePolicy converts this Policy to policy.Session.
+func (p *Policy) ToCorePolicy() policy.Session {
+	cp := policy.SessionDefault()
+
+	if p.Timeout != nil {
+		cp.Timeouts.ConnectionIdle = p.Timeout.ConnectionIdle.Duration()
+		cp.Timeouts.Handshake = p.Timeout.Handshake.Duration()
+		cp.Timeouts.DownlinkOnly = p.Timeout.DownlinkOnly.Duration()
+		cp.Timeouts.UplinkOnly = p.Timeout.UplinkOnly.Duration()
+	}
+	if p.Stats != nil {
+		cp.Stats.UserUplink = p.Stats.UserUplink
+		cp.Stats.UserDownlink = p.Stats.UserDownlink
+		cp.Stats.UserOnline = p.Stats.UserOnline
+	}
+	if p.Buffer != nil {
+		cp.Buffer.PerConnection = p.Buffer.Connection
+	}
+	return cp
+}
+
+// ToCorePolicy converts this SystemPolicy to policy.System.
+func (p *SystemPolicy) ToCorePolicy() policy.System {
+	return policy.System{
+		Stats: policy.SystemStats{
+			InboundUplink:    p.Stats.InboundUplink,
+			InboundDownlink:  p.Stats.InboundDownlink,
+			OutboundUplink:   p.Stats.OutboundUplink,
+			OutboundDownlink: p.Stats.OutboundDownlink,
+		},
+	}
+}

subproject/Xray-core-main/app/policy/config.pb.go

@@ -0,0 +1,574 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.36.11
+// 	protoc        v6.33.5
+// source: app/policy/config.proto
+
+package policy
+
+import (
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+	unsafe "unsafe"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type Second struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Value         uint32                 `protobuf:"varint,1,opt,name=value,proto3" json:"value,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Second) Reset() {
+	*x = Second{}
+	mi := &file_app_policy_config_proto_msgTypes[0]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Second) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Second) ProtoMessage() {}
+
+func (x *Second) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[0]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Second.ProtoReflect.Descriptor instead.
+func (*Second) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *Second) GetValue() uint32 {
+	if x != nil {
+		return x.Value
+	}
+	return 0
+}
+
+type Policy struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Timeout       *Policy_Timeout        `protobuf:"bytes,1,opt,name=timeout,proto3" json:"timeout,omitempty"`
+	Stats         *Policy_Stats          `protobuf:"bytes,2,opt,name=stats,proto3" json:"stats,omitempty"`
+	Buffer        *Policy_Buffer         `protobuf:"bytes,3,opt,name=buffer,proto3" json:"buffer,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Policy) Reset() {
+	*x = Policy{}
+	mi := &file_app_policy_config_proto_msgTypes[1]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Policy) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Policy) ProtoMessage() {}
+
+func (x *Policy) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[1]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Policy.ProtoReflect.Descriptor instead.
+func (*Policy) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *Policy) GetTimeout() *Policy_Timeout {
+	if x != nil {
+		return x.Timeout
+	}
+	return nil
+}
+
+func (x *Policy) GetStats() *Policy_Stats {
+	if x != nil {
+		return x.Stats
+	}
+	return nil
+}
+
+func (x *Policy) GetBuffer() *Policy_Buffer {
+	if x != nil {
+		return x.Buffer
+	}
+	return nil
+}
+
+type SystemPolicy struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Stats         *SystemPolicy_Stats    `protobuf:"bytes,1,opt,name=stats,proto3" json:"stats,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *SystemPolicy) Reset() {
+	*x = SystemPolicy{}
+	mi := &file_app_policy_config_proto_msgTypes[2]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *SystemPolicy) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*SystemPolicy) ProtoMessage() {}
+
+func (x *SystemPolicy) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[2]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use SystemPolicy.ProtoReflect.Descriptor instead.
+func (*SystemPolicy) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{2}
+}
+
+func (x *SystemPolicy) GetStats() *SystemPolicy_Stats {
+	if x != nil {
+		return x.Stats
+	}
+	return nil
+}
+
+type Config struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	Level         map[uint32]*Policy     `protobuf:"bytes,1,rep,name=level,proto3" json:"level,omitempty" protobuf_key:"varint,1,opt,name=key" protobuf_val:"bytes,2,opt,name=value"`
+	System        *SystemPolicy          `protobuf:"bytes,2,opt,name=system,proto3" json:"system,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Config) Reset() {
+	*x = Config{}
+	mi := &file_app_policy_config_proto_msgTypes[3]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Config) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Config) ProtoMessage() {}
+
+func (x *Config) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[3]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Config.ProtoReflect.Descriptor instead.
+func (*Config) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{3}
+}
+
+func (x *Config) GetLevel() map[uint32]*Policy {
+	if x != nil {
+		return x.Level
+	}
+	return nil
+}
+
+func (x *Config) GetSystem() *SystemPolicy {
+	if x != nil {
+		return x.System
+	}
+	return nil
+}
+
+// Timeout is a message for timeout settings in various stages, in seconds.
+type Policy_Timeout struct {
+	state          protoimpl.MessageState `protogen:"open.v1"`
+	Handshake      *Second                `protobuf:"bytes,1,opt,name=handshake,proto3" json:"handshake,omitempty"`
+	ConnectionIdle *Second                `protobuf:"bytes,2,opt,name=connection_idle,json=connectionIdle,proto3" json:"connection_idle,omitempty"`
+	UplinkOnly     *Second                `protobuf:"bytes,3,opt,name=uplink_only,json=uplinkOnly,proto3" json:"uplink_only,omitempty"`
+	DownlinkOnly   *Second                `protobuf:"bytes,4,opt,name=downlink_only,json=downlinkOnly,proto3" json:"downlink_only,omitempty"`
+	unknownFields  protoimpl.UnknownFields
+	sizeCache      protoimpl.SizeCache
+}
+
+func (x *Policy_Timeout) Reset() {
+	*x = Policy_Timeout{}
+	mi := &file_app_policy_config_proto_msgTypes[4]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Policy_Timeout) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Policy_Timeout) ProtoMessage() {}
+
+func (x *Policy_Timeout) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[4]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Policy_Timeout.ProtoReflect.Descriptor instead.
+func (*Policy_Timeout) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{1, 0}
+}
+
+func (x *Policy_Timeout) GetHandshake() *Second {
+	if x != nil {
+		return x.Handshake
+	}
+	return nil
+}
+
+func (x *Policy_Timeout) GetConnectionIdle() *Second {
+	if x != nil {
+		return x.ConnectionIdle
+	}
+	return nil
+}
+
+func (x *Policy_Timeout) GetUplinkOnly() *Second {
+	if x != nil {
+		return x.UplinkOnly
+	}
+	return nil
+}
+
+func (x *Policy_Timeout) GetDownlinkOnly() *Second {
+	if x != nil {
+		return x.DownlinkOnly
+	}
+	return nil
+}
+
+type Policy_Stats struct {
+	state         protoimpl.MessageState `protogen:"open.v1"`
+	UserUplink    bool                   `protobuf:"varint,1,opt,name=user_uplink,json=userUplink,proto3" json:"user_uplink,omitempty"`
+	UserDownlink  bool                   `protobuf:"varint,2,opt,name=user_downlink,json=userDownlink,proto3" json:"user_downlink,omitempty"`
+	UserOnline    bool                   `protobuf:"varint,3,opt,name=user_online,json=userOnline,proto3" json:"user_online,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Policy_Stats) Reset() {
+	*x = Policy_Stats{}
+	mi := &file_app_policy_config_proto_msgTypes[5]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Policy_Stats) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Policy_Stats) ProtoMessage() {}
+
+func (x *Policy_Stats) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[5]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Policy_Stats.ProtoReflect.Descriptor instead.
+func (*Policy_Stats) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{1, 1}
+}
+
+func (x *Policy_Stats) GetUserUplink() bool {
+	if x != nil {
+		return x.UserUplink
+	}
+	return false
+}
+
+func (x *Policy_Stats) GetUserDownlink() bool {
+	if x != nil {
+		return x.UserDownlink
+	}
+	return false
+}
+
+func (x *Policy_Stats) GetUserOnline() bool {
+	if x != nil {
+		return x.UserOnline
+	}
+	return false
+}
+
+type Policy_Buffer struct {
+	state protoimpl.MessageState `protogen:"open.v1"`
+	// Buffer size per connection, in bytes. -1 for unlimited buffer.
+	Connection    int32 `protobuf:"varint,1,opt,name=connection,proto3" json:"connection,omitempty"`
+	unknownFields protoimpl.UnknownFields
+	sizeCache     protoimpl.SizeCache
+}
+
+func (x *Policy_Buffer) Reset() {
+	*x = Policy_Buffer{}
+	mi := &file_app_policy_config_proto_msgTypes[6]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *Policy_Buffer) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Policy_Buffer) ProtoMessage() {}
+
+func (x *Policy_Buffer) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[6]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Policy_Buffer.ProtoReflect.Descriptor instead.
+func (*Policy_Buffer) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{1, 2}
+}
+
+func (x *Policy_Buffer) GetConnection() int32 {
+	if x != nil {
+		return x.Connection
+	}
+	return 0
+}
+
+type SystemPolicy_Stats struct {
+	state            protoimpl.MessageState `protogen:"open.v1"`
+	InboundUplink    bool                   `protobuf:"varint,1,opt,name=inbound_uplink,json=inboundUplink,proto3" json:"inbound_uplink,omitempty"`
+	InboundDownlink  bool                   `protobuf:"varint,2,opt,name=inbound_downlink,json=inboundDownlink,proto3" json:"inbound_downlink,omitempty"`
+	OutboundUplink   bool                   `protobuf:"varint,3,opt,name=outbound_uplink,json=outboundUplink,proto3" json:"outbound_uplink,omitempty"`
+	OutboundDownlink bool                   `protobuf:"varint,4,opt,name=outbound_downlink,json=outboundDownlink,proto3" json:"outbound_downlink,omitempty"`
+	unknownFields    protoimpl.UnknownFields
+	sizeCache        protoimpl.SizeCache
+}
+
+func (x *SystemPolicy_Stats) Reset() {
+	*x = SystemPolicy_Stats{}
+	mi := &file_app_policy_config_proto_msgTypes[7]
+	ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+	ms.StoreMessageInfo(mi)
+}
+
+func (x *SystemPolicy_Stats) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*SystemPolicy_Stats) ProtoMessage() {}
+
+func (x *SystemPolicy_Stats) ProtoReflect() protoreflect.Message {
+	mi := &file_app_policy_config_proto_msgTypes[7]
+	if x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use SystemPolicy_Stats.ProtoReflect.Descriptor instead.
+func (*SystemPolicy_Stats) Descriptor() ([]byte, []int) {
+	return file_app_policy_config_proto_rawDescGZIP(), []int{2, 0}
+}
+
+func (x *SystemPolicy_Stats) GetInboundUplink() bool {
+	if x != nil {
+		return x.InboundUplink
+	}
+	return false
+}
+
+func (x *SystemPolicy_Stats) GetInboundDownlink() bool {
+	if x != nil {
+		return x.InboundDownlink
+	}
+	return false
+}
+
+func (x *SystemPolicy_Stats) GetOutboundUplink() bool {
+	if x != nil {
+		return x.OutboundUplink
+	}
+	return false
+}
+
+func (x *SystemPolicy_Stats) GetOutboundDownlink() bool {
+	if x != nil {
+		return x.OutboundDownlink
+	}
+	return false
+}
+
+var File_app_policy_config_proto protoreflect.FileDescriptor
+
+const file_app_policy_config_proto_rawDesc = "" +
+	"\n" +
+	"\x17app/policy/config.proto\x12\x0fxray.app.policy\"\x1e\n" +
+	"\x06Second\x12\x14\n" +
+	"\x05value\x18\x01 \x01(\rR\x05value\"\xc7\x04\n" +
+	"\x06Policy\x129\n" +
+	"\atimeout\x18\x01 \x01(\v2\x1f.xray.app.policy.Policy.TimeoutR\atimeout\x123\n" +
+	"\x05stats\x18\x02 \x01(\v2\x1d.xray.app.policy.Policy.StatsR\x05stats\x126\n" +
+	"\x06buffer\x18\x03 \x01(\v2\x1e.xray.app.policy.Policy.BufferR\x06buffer\x1a\xfa\x01\n" +
+	"\aTimeout\x125\n" +
+	"\thandshake\x18\x01 \x01(\v2\x17.xray.app.policy.SecondR\thandshake\x12@\n" +
+	"\x0fconnection_idle\x18\x02 \x01(\v2\x17.xray.app.policy.SecondR\x0econnectionIdle\x128\n" +
+	"\vuplink_only\x18\x03 \x01(\v2\x17.xray.app.policy.SecondR\n" +
+	"uplinkOnly\x12<\n" +
+	"\rdownlink_only\x18\x04 \x01(\v2\x17.xray.app.policy.SecondR\fdownlinkOnly\x1an\n" +
+	"\x05Stats\x12\x1f\n" +
+	"\vuser_uplink\x18\x01 \x01(\bR\n" +
+	"userUplink\x12#\n" +
+	"\ruser_downlink\x18\x02 \x01(\bR\fuserDownlink\x12\x1f\n" +
+	"\vuser_online\x18\x03 \x01(\bR\n" +
+	"userOnline\x1a(\n" +
+	"\x06Buffer\x12\x1e\n" +
+	"\n" +
+	"connection\x18\x01 \x01(\x05R\n" +
+	"connection\"\xfb\x01\n" +
+	"\fSystemPolicy\x129\n" +
+	"\x05stats\x18\x01 \x01(\v2#.xray.app.policy.SystemPolicy.StatsR\x05stats\x1a\xaf\x01\n" +
+	"\x05Stats\x12%\n" +
+	"\x0einbound_uplink\x18\x01 \x01(\bR\rinboundUplink\x12)\n" +
+	"\x10inbound_downlink\x18\x02 \x01(\bR\x0finboundDownlink\x12'\n" +
+	"\x0foutbound_uplink\x18\x03 \x01(\bR\x0eoutboundUplink\x12+\n" +
+	"\x11outbound_downlink\x18\x04 \x01(\bR\x10outboundDownlink\"\xcc\x01\n" +
+	"\x06Config\x128\n" +
+	"\x05level\x18\x01 \x03(\v2\".xray.app.policy.Config.LevelEntryR\x05level\x125\n" +
+	"\x06system\x18\x02 \x01(\v2\x1d.xray.app.policy.SystemPolicyR\x06system\x1aQ\n" +
+	"\n" +
+	"LevelEntry\x12\x10\n" +
+	"\x03key\x18\x01 \x01(\rR\x03key\x12-\n" +
+	"\x05value\x18\x02 \x01(\v2\x17.xray.app.policy.PolicyR\x05value:\x028\x01BO\n" +
+	"\x13com.xray.app.policyP\x01Z$github.com/xtls/xray-core/app/policy\xaa\x02\x0fXray.App.Policyb\x06proto3"
+
+var (
+	file_app_policy_config_proto_rawDescOnce sync.Once
+	file_app_policy_config_proto_rawDescData []byte
+)
+
+func file_app_policy_config_proto_rawDescGZIP() []byte {
+	file_app_policy_config_proto_rawDescOnce.Do(func() {
+		file_app_policy_config_proto_rawDescData = protoimpl.X.CompressGZIP(unsafe.Slice(unsafe.StringData(file_app_policy_config_proto_rawDesc), len(file_app_policy_config_proto_rawDesc)))
+	})
+	return file_app_policy_config_proto_rawDescData
+}
+
+var file_app_policy_config_proto_msgTypes = make([]protoimpl.MessageInfo, 9)
+var file_app_policy_config_proto_goTypes = []any{
+	(*Second)(nil),             // 0: xray.app.policy.Second
+	(*Policy)(nil),             // 1: xray.app.policy.Policy
+	(*SystemPolicy)(nil),       // 2: xray.app.policy.SystemPolicy
+	(*Config)(nil),             // 3: xray.app.policy.Config
+	(*Policy_Timeout)(nil),     // 4: xray.app.policy.Policy.Timeout
+	(*Policy_Stats)(nil),       // 5: xray.app.policy.Policy.Stats
+	(*Policy_Buffer)(nil),      // 6: xray.app.policy.Policy.Buffer
+	(*SystemPolicy_Stats)(nil), // 7: xray.app.policy.SystemPolicy.Stats
+	nil,                        // 8: xray.app.policy.Config.LevelEntry
+}
+var file_app_policy_config_proto_depIdxs = []int32{
+	4,  // 0: xray.app.policy.Policy.timeout:type_name -> xray.app.policy.Policy.Timeout
+	5,  // 1: xray.app.policy.Policy.stats:type_name -> xray.app.policy.Policy.Stats
+	6,  // 2: xray.app.policy.Policy.buffer:type_name -> xray.app.policy.Policy.Buffer
+	7,  // 3: xray.app.policy.SystemPolicy.stats:type_name -> xray.app.policy.SystemPolicy.Stats
+	8,  // 4: xray.app.policy.Config.level:type_name -> xray.app.policy.Config.LevelEntry
+	2,  // 5: xray.app.policy.Config.system:type_name -> xray.app.policy.SystemPolicy
+	0,  // 6: xray.app.policy.Policy.Timeout.handshake:type_name -> xray.app.policy.Second
+	0,  // 7: xray.app.policy.Policy.Timeout.connection_idle:type_name -> xray.app.policy.Second
+	0,  // 8: xray.app.policy.Policy.Timeout.uplink_only:type_name -> xray.app.policy.Second
+	0,  // 9: xray.app.policy.Policy.Timeout.downlink_only:type_name -> xray.app.policy.Second
+	1,  // 10: xray.app.policy.Config.LevelEntry.value:type_name -> xray.app.policy.Policy
+	11, // [11:11] is the sub-list for method output_type
+	11, // [11:11] is the sub-list for method input_type
+	11, // [11:11] is the sub-list for extension type_name
+	11, // [11:11] is the sub-list for extension extendee
+	0,  // [0:11] is the sub-list for field type_name
+}
+
+func init() { file_app_policy_config_proto_init() }
+func file_app_policy_config_proto_init() {
+	if File_app_policy_config_proto != nil {
+		return
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: unsafe.Slice(unsafe.StringData(file_app_policy_config_proto_rawDesc), len(file_app_policy_config_proto_rawDesc)),
+			NumEnums:      0,
+			NumMessages:   9,
+			NumExtensions: 0,
+			NumServices:   0,
+		},
+		GoTypes:           file_app_policy_config_proto_goTypes,
+		DependencyIndexes: file_app_policy_config_proto_depIdxs,
+		MessageInfos:      file_app_policy_config_proto_msgTypes,
+	}.Build()
+	File_app_policy_config_proto = out.File
+	file_app_policy_config_proto_goTypes = nil
+	file_app_policy_config_proto_depIdxs = nil
+}

subproject/Xray-core-main/app/policy/config.proto

@@ -0,0 +1,52 @@
+syntax = "proto3";
+
+package xray.app.policy;
+option csharp_namespace = "Xray.App.Policy";
+option go_package = "github.com/xtls/xray-core/app/policy";
+option java_package = "com.xray.app.policy";
+option java_multiple_files = true;
+
+message Second {
+  uint32 value = 1;
+}
+
+message Policy {
+  // Timeout is a message for timeout settings in various stages, in seconds.
+  message Timeout {
+    Second handshake = 1;
+    Second connection_idle = 2;
+    Second uplink_only = 3;
+    Second downlink_only = 4;
+  }
+
+  message Stats {
+    bool user_uplink = 1;
+    bool user_downlink = 2;
+    bool user_online = 3;
+  }
+
+  message Buffer {
+    // Buffer size per connection, in bytes. -1 for unlimited buffer.
+    int32 connection = 1;
+  }
+
+  Timeout timeout = 1;
+  Stats stats = 2;
+  Buffer buffer = 3;
+}
+
+message SystemPolicy {
+  message Stats {
+    bool inbound_uplink = 1;
+    bool inbound_downlink = 2;
+    bool outbound_uplink = 3;
+    bool outbound_downlink = 4;
+  }
+
+  Stats stats = 1;
+}
+
+message Config {
+  map<uint32, Policy> level = 1;
+  SystemPolicy system = 2;
+}

subproject/Xray-core-main/app/policy/manager.go

@@ -0,0 +1,68 @@
+package policy
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/features/policy"
+)
+
+// Instance is an instance of Policy manager.
+type Instance struct {
+	levels map[uint32]*Policy
+	system *SystemPolicy
+}
+
+// New creates new Policy manager instance.
+func New(ctx context.Context, config *Config) (*Instance, error) {
+	m := &Instance{
+		levels: make(map[uint32]*Policy),
+		system: config.System,
+	}
+	if len(config.Level) > 0 {
+		for lv, p := range config.Level {
+			pp := defaultPolicy()
+			pp.overrideWith(p)
+			m.levels[lv] = pp
+		}
+	}
+
+	return m, nil
+}
+
+// Type implements common.HasType.
+func (*Instance) Type() interface{} {
+	return policy.ManagerType()
+}
+
+// ForLevel implements policy.Manager.
+func (m *Instance) ForLevel(level uint32) policy.Session {
+	if p, ok := m.levels[level]; ok {
+		return p.ToCorePolicy()
+	}
+	return policy.SessionDefault()
+}
+
+// ForSystem implements policy.Manager.
+func (m *Instance) ForSystem() policy.System {
+	if m.system == nil {
+		return policy.System{}
+	}
+	return m.system.ToCorePolicy()
+}
+
+// Start implements common.Runnable.Start().
+func (m *Instance) Start() error {
+	return nil
+}
+
+// Close implements common.Closable.Close().
+func (m *Instance) Close() error {
+	return nil
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
+		return New(ctx, config.(*Config))
+	}))
+}

subproject/Xray-core-main/app/policy/manager_test.go

@@ -0,0 +1,45 @@
+package policy_test
+
+import (
+	"context"
+	"testing"
+	"time"
+
+	. "github.com/xtls/xray-core/app/policy"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/features/policy"
+)
+
+func TestPolicy(t *testing.T) {
+	manager, err := New(context.Background(), &Config{
+		Level: map[uint32]*Policy{
+			0: {
+				Timeout: &Policy_Timeout{
+					Handshake: &Second{
+						Value: 2,
+					},
+				},
+			},
+		},
+	})
+	common.Must(err)
+
+	pDefault := policy.SessionDefault()
+
+	{
+		p := manager.ForLevel(0)
+		if p.Timeouts.Handshake != 2*time.Second {
+			t.Error("expect 2 sec timeout, but got ", p.Timeouts.Handshake)
+		}
+		if p.Timeouts.ConnectionIdle != pDefault.Timeouts.ConnectionIdle {
+			t.Error("expect ", pDefault.Timeouts.ConnectionIdle, " sec timeout, but got ", p.Timeouts.ConnectionIdle)
+		}
+	}
+
+	{
+		p := manager.ForLevel(1)
+		if p.Timeouts.Handshake != pDefault.Timeouts.Handshake {
+			t.Error("expect ", pDefault.Timeouts.Handshake, " sec timeout, but got ", p.Timeouts.Handshake)
+		}
+	}
+}

subproject/Xray-core-main/app/policy/policy.go

@@ -0,0 +1,2 @@
+// Package policy is an implementation of policy.Manager feature.
+package policy

subproject/Xray-core-main/app/proxyman/command/command.go

@@ -0,0 +1,234 @@
+package command
+
+import (
+	"context"
+
+	"github.com/xtls/xray-core/app/commander"
+	"github.com/xtls/xray-core/common"
+	"github.com/xtls/xray-core/common/errors"
+	"github.com/xtls/xray-core/common/protocol"
+	"github.com/xtls/xray-core/core"
+	"github.com/xtls/xray-core/features/inbound"
+	"github.com/xtls/xray-core/features/outbound"
+	"github.com/xtls/xray-core/proxy"
+	grpc "google.golang.org/grpc"
+)
+
+// InboundOperation is the interface for operations that applies to inbound handlers.
+type InboundOperation interface {
+	// ApplyInbound applies this operation to the given inbound handler.
+	ApplyInbound(context.Context, inbound.Handler) error
+}
+
+// OutboundOperation is the interface for operations that applies to outbound handlers.
+type OutboundOperation interface {
+	// ApplyOutbound applies this operation to the given outbound handler.
+	ApplyOutbound(context.Context, outbound.Handler) error
+}
+
+func getInbound(handler inbound.Handler) (proxy.Inbound, error) {
+	gi, ok := handler.(proxy.GetInbound)
+	if !ok {
+		return nil, errors.New("can't get inbound proxy from handler.")
+	}
+	return gi.GetInbound(), nil
+}
+
+// ApplyInbound implements InboundOperation.
+func (op *AddUserOperation) ApplyInbound(ctx context.Context, handler inbound.Handler) error {
+	p, err := getInbound(handler)
+	if err != nil {
+		return err
+	}
+	um, ok := p.(proxy.UserManager)
+	if !ok {
+		return errors.New("proxy is not a UserManager")
+	}
+	mUser, err := op.User.ToMemoryUser()
+	if err != nil {
+		return errors.New("failed to parse user").Base(err)
+	}
+	return um.AddUser(ctx, mUser)
+}
+
+// ApplyInbound implements InboundOperation.
+func (op *RemoveUserOperation) ApplyInbound(ctx context.Context, handler inbound.Handler) error {
+	p, err := getInbound(handler)
+	if err != nil {
+		return err
+	}
+	um, ok := p.(proxy.UserManager)
+	if !ok {
+		return errors.New("proxy is not a UserManager")
+	}
+	return um.RemoveUser(ctx, op.Email)
+}
+
+type handlerServer struct {
+	s   *core.Instance
+	ihm inbound.Manager
+	ohm outbound.Manager
+}
+
+func (s *handlerServer) AddInbound(ctx context.Context, request *AddInboundRequest) (*AddInboundResponse, error) {
+	if err := core.AddInboundHandler(s.s, request.Inbound); err != nil {
+		return nil, err
+	}
+
+	return &AddInboundResponse{}, nil
+}
+
+func (s *handlerServer) RemoveInbound(ctx context.Context, request *RemoveInboundRequest) (*RemoveInboundResponse, error) {
+	return &RemoveInboundResponse{}, s.ihm.RemoveHandler(ctx, request.Tag)
+}
+
+func (s *handlerServer) AlterInbound(ctx context.Context, request *AlterInboundRequest) (*AlterInboundResponse, error) {
+	rawOperation, err := request.Operation.GetInstance()
+	if err != nil {
+		return nil, errors.New("unknown operation").Base(err)
+	}
+	operation, ok := rawOperation.(InboundOperation)
+	if !ok {
+		return nil, errors.New("not an inbound operation")
+	}
+
+	handler, err := s.ihm.GetHandler(ctx, request.Tag)
+	if err != nil {
+		return nil, errors.New("failed to get handler: ", request.Tag).Base(err)
+	}
+
+	return &AlterInboundResponse{}, operation.ApplyInbound(ctx, handler)
+}
+
+func (s *handlerServer) ListInbounds(ctx context.Context, request *ListInboundsRequest) (*ListInboundsResponse, error) {
+	handlers := s.ihm.ListHandlers(ctx)
+	response := &ListInboundsResponse{}
+	if request.GetIsOnlyTags() {
+		for _, handler := range handlers {
+			response.Inbounds = append(response.Inbounds, &core.InboundHandlerConfig{
+				Tag: handler.Tag(),
+			})
+		}
+	} else {
+		for _, handler := range handlers {
+			response.Inbounds = append(response.Inbounds, &core.InboundHandlerConfig{
+				Tag:              handler.Tag(),
+				ReceiverSettings: handler.ReceiverSettings(),
+				ProxySettings:    handler.ProxySettings(),
+			})
+		}
+	}
+
+	return response, nil
+}
+
+func (s *handlerServer) GetInboundUsers(ctx context.Context, request *GetInboundUserRequest) (*GetInboundUserResponse, error) {
+	handler, err := s.ihm.GetHandler(ctx, request.Tag)
+	if err != nil {
+		return nil, errors.New("failed to get handler: ", request.Tag).Base(err)
+	}
+	p, err := getInbound(handler)
+	if err != nil {
+		return nil, err
+	}
+	um, ok := p.(proxy.UserManager)
+	if !ok {
+		return nil, errors.New("proxy is not a UserManager")
+	}
+	if len(request.Email) > 0 {
+		return &GetInboundUserResponse{Users: []*protocol.User{protocol.ToProtoUser(um.GetUser(ctx, request.Email))}}, nil
+	}
+	var result = make([]*protocol.User, 0, 100)
+	users := um.GetUsers(ctx)
+	for _, u := range users {
+		result = append(result, protocol.ToProtoUser(u))
+	}
+	return &GetInboundUserResponse{Users: result}, nil
+}
+
+func (s *handlerServer) GetInboundUsersCount(ctx context.Context, request *GetInboundUserRequest) (*GetInboundUsersCountResponse, error) {
+	handler, err := s.ihm.GetHandler(ctx, request.Tag)
+	if err != nil {
+		return nil, errors.New("failed to get handler: ", request.Tag).Base(err)
+	}
+	p, err := getInbound(handler)
+	if err != nil {
+		return nil, err
+	}
+	um, ok := p.(proxy.UserManager)
+	if !ok {
+		return nil, errors.New("proxy is not a UserManager")
+	}
+	return &GetInboundUsersCountResponse{Count: um.GetUsersCount(ctx)}, nil
+}
+
+func (s *handlerServer) AddOutbound(ctx context.Context, request *AddOutboundRequest) (*AddOutboundResponse, error) {
+	if err := core.AddOutboundHandler(s.s, request.Outbound); err != nil {
+		return nil, err
+	}
+	return &AddOutboundResponse{}, nil
+}
+
+func (s *handlerServer) RemoveOutbound(ctx context.Context, request *RemoveOutboundRequest) (*RemoveOutboundResponse, error) {
+	return &RemoveOutboundResponse{}, s.ohm.RemoveHandler(ctx, request.Tag)
+}
+
+func (s *handlerServer) AlterOutbound(ctx context.Context, request *AlterOutboundRequest) (*AlterOutboundResponse, error) {
+	rawOperation, err := request.Operation.GetInstance()
+	if err != nil {
+		return nil, errors.New("unknown operation").Base(err)
+	}
+	operation, ok := rawOperation.(OutboundOperation)
+	if !ok {
+		return nil, errors.New("not an outbound operation")
+	}
+
+	handler := s.ohm.GetHandler(request.Tag)
+	return &AlterOutboundResponse{}, operation.ApplyOutbound(ctx, handler)
+}
+
+func (s *handlerServer) ListOutbounds(ctx context.Context, request *ListOutboundsRequest) (*ListOutboundsResponse, error) {
+	handlers := s.ohm.ListHandlers(ctx)
+	response := &ListOutboundsResponse{}
+	for _, handler := range handlers {
+		// Ignore gRPC outbound
+		if _, ok := handler.(*commander.Outbound); ok {
+			continue
+		}
+		response.Outbounds = append(response.Outbounds, &core.OutboundHandlerConfig{
+			Tag:            handler.Tag(),
+			SenderSettings: handler.SenderSettings(),
+			ProxySettings:  handler.ProxySettings(),
+		})
+	}
+	return response, nil
+}
+
+func (s *handlerServer) mustEmbedUnimplementedHandlerServiceServer() {}
+
+type service struct {
+	v *core.Instance
+}
+
+func (s *service) Register(server *grpc.Server) {
+	hs := &handlerServer{
+		s: s.v,
+	}
+	common.Must(s.v.RequireFeatures(func(im inbound.Manager, om outbound.Manager) {
+		hs.ihm = im
+		hs.ohm = om
+	}, false))
+	RegisterHandlerServiceServer(server, hs)
+
+	// For compatibility purposes
+	vCoreDesc := HandlerService_ServiceDesc
+	vCoreDesc.ServiceName = "v2ray.core.app.proxyman.command.HandlerService"
+	server.RegisterService(&vCoreDesc, hs)
+}
+
+func init() {
+	common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
+		s := core.MustFromContext(ctx)
+		return &service{v: s}, nil
+	}))
+}

subproject/Xray-core-main/app/proxyman/command/command.proto

@@ -0,0 +1,108 @@
+syntax = "proto3";
+
+package xray.app.proxyman.command;
+option csharp_namespace = "Xray.App.Proxyman.Command";
+option go_package = "github.com/xtls/xray-core/app/proxyman/command";
+option java_package = "com.xray.app.proxyman.command";
+option java_multiple_files = true;
+
+import "common/protocol/user.proto";
+import "common/serial/typed_message.proto";
+import "core/config.proto";
+
+message AddUserOperation {
+  xray.common.protocol.User user = 1;
+}
+
+message RemoveUserOperation {
+  string email = 1;
+}
+
+message AddInboundRequest {
+  core.InboundHandlerConfig inbound = 1;
+}
+
+message AddInboundResponse {}
+
+message RemoveInboundRequest {
+  string tag = 1;
+}
+
+message RemoveInboundResponse {}
+
+message AlterInboundRequest {
+  string tag = 1;
+  xray.common.serial.TypedMessage operation = 2;
+}
+
+message AlterInboundResponse {}
+
+message ListInboundsRequest {
+  bool isOnlyTags = 1;
+}
+
+message ListInboundsResponse {
+  repeated core.InboundHandlerConfig inbounds = 1;
+}
+
+message GetInboundUserRequest {
+  string tag = 1;
+  string email = 2;
+}
+
+message GetInboundUserResponse {
+  repeated xray.common.protocol.User users = 1;
+}
+
+message GetInboundUsersCountResponse {
+  int64 count = 1;
+}
+
+message AddOutboundRequest {
+  core.OutboundHandlerConfig outbound = 1;
+}
+
+message AddOutboundResponse {}
+
+message RemoveOutboundRequest {
+  string tag = 1;
+}
+
+message RemoveOutboundResponse {}
+
+message AlterOutboundRequest {
+  string tag = 1;
+  xray.common.serial.TypedMessage operation = 2;
+}
+
+message AlterOutboundResponse {}
+
+message ListOutboundsRequest {}
+
+message ListOutboundsResponse {
+  repeated core.OutboundHandlerConfig outbounds = 1;
+}
+
+service HandlerService {
+  rpc AddInbound(AddInboundRequest) returns (AddInboundResponse) {}
+
+  rpc RemoveInbound(RemoveInboundRequest) returns (RemoveInboundResponse) {}
+
+  rpc AlterInbound(AlterInboundRequest) returns (AlterInboundResponse) {}
+
+  rpc ListInbounds(ListInboundsRequest) returns (ListInboundsResponse) {}
+
+  rpc GetInboundUsers(GetInboundUserRequest) returns (GetInboundUserResponse) {}
+
+  rpc GetInboundUsersCount(GetInboundUserRequest) returns (GetInboundUsersCountResponse) {}
+
+  rpc AddOutbound(AddOutboundRequest) returns (AddOutboundResponse) {}
+
+  rpc RemoveOutbound(RemoveOutboundRequest) returns (RemoveOutboundResponse) {}
+
+  rpc AlterOutbound(AlterOutboundRequest) returns (AlterOutboundResponse) {}
+
+  rpc ListOutbounds(ListOutboundsRequest) returns (ListOutboundsResponse) {}
+}
+
+message Config {}